aws-actions/configure-aws-credentials
1
0
Fork 0
mirror of https://github.com/aws-actions/configure-aws-credentials.git synced 2026-03-12 18:07:10 -04:00
Code Issues Packages Projects Releases Wiki Activity
Files
6129f329e60ccdcc69cae650f925172621807647
configure-aws-credentials/dist/index.js
Tim Finnigan 6129f329e6 chore: remove warning (#926) 
Co-authored-by: mergify[bot] <37929162+mergify[bot]@users.noreply.github.com>
2023-12-06 00:23:55 +00:00

23996 lines
854 KiB
JavaScript
Generated
Raw Blame History

/******/ (() => { // webpackBootstrap
/******/ var __webpack_modules__ = ({
/***/ 3301:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.CredentialsClient = void 0;
const core_1 = __nccwpck_require__(42186);
const client_sts_1 = __nccwpck_require__(52209);
const node_http_handler_1 = __nccwpck_require__(20258);
const https_proxy_agent_1 = __nccwpck_require__(77219);
const helpers_1 = __nccwpck_require__(49787);
const USER_AGENT = 'configure-aws-credentials-for-github-actions';
class CredentialsClient {
constructor(props) {
this.region = props.region;
if (props.proxyServer) {
(0, core_1.info)('Configuring proxy handler for STS client');
const handler = new https_proxy_agent_1.HttpsProxyAgent(props.proxyServer);
this.requestHandler = new node_http_handler_1.NodeHttpHandler({
httpAgent: handler,
httpsAgent: handler,
});
}
}
get stsClient() {
if (!this._stsClient) {
this._stsClient = new client_sts_1.STSClient({
region: this.region,
customUserAgent: USER_AGENT,
requestHandler: this.requestHandler ? this.requestHandler : undefined,
});
}
return this._stsClient;
}
async validateCredentials(expectedAccessKeyId, roleChaining) {
let credentials;
try {
credentials = await this.loadCredentials();
if (!credentials.accessKeyId) {
throw new Error('Access key ID empty after loading credentials');
}
}
catch (error) {
throw new Error(`Credentials could not be loaded, please check your action inputs: ${(0, helpers_1.errorMessage)(error)}`);
}
if (!roleChaining) {
const actualAccessKeyId = credentials.accessKeyId;
if (expectedAccessKeyId && expectedAccessKeyId !== actualAccessKeyId) {
throw new Error('Unexpected failure: Credentials loaded by the SDK do not match the access key ID configured by the action');
}
}
}
async loadCredentials() {
const client = new client_sts_1.STSClient({
requestHandler: this.requestHandler ? this.requestHandler : undefined,
});
return client.config.credentials();
}
}
exports.CredentialsClient = CredentialsClient;
//# sourceMappingURL=CredentialsClient.js.map
/***/ }),
/***/ 61209:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
var desc = Object.getOwnPropertyDescriptor(m, k);
if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) {
desc = { enumerable: true, get: function() { return m[k]; } };
}
Object.defineProperty(o, k2, desc);
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.assumeRole = void 0;
const assert_1 = __importDefault(__nccwpck_require__(39491));
const fs_1 = __importDefault(__nccwpck_require__(57147));
const path_1 = __importDefault(__nccwpck_require__(71017));
const core = __importStar(__nccwpck_require__(42186));
const client_sts_1 = __nccwpck_require__(52209);
const helpers_1 = __nccwpck_require__(49787);
async function assumeRoleWithOIDC(params, client, webIdentityToken) {
delete params.Tags;
core.info('Assuming role with OIDC');
try {
const creds = await client.send(new client_sts_1.AssumeRoleWithWebIdentityCommand({
...params,
WebIdentityToken: webIdentityToken,
}));
return creds;
}
catch (error) {
throw new Error(`Could not assume role with OIDC: ${(0, helpers_1.errorMessage)(error)}`);
}
}
async function assumeRoleWithWebIdentityTokenFile(params, client, webIdentityTokenFile, workspace) {
core.debug('webIdentityTokenFile provided. Will call sts:AssumeRoleWithWebIdentity and take session tags from token contents.');
const webIdentityTokenFilePath = path_1.default.isAbsolute(webIdentityTokenFile)
? webIdentityTokenFile
: path_1.default.join(workspace, webIdentityTokenFile);
if (!fs_1.default.existsSync(webIdentityTokenFilePath)) {
throw new Error(`Web identity token file does not exist: ${webIdentityTokenFilePath}`);
}
core.info('Assuming role with web identity token file');
try {
const webIdentityToken = fs_1.default.readFileSync(webIdentityTokenFilePath, 'utf8');
delete params.Tags;
const creds = await client.send(new client_sts_1.AssumeRoleWithWebIdentityCommand({
...params,
WebIdentityToken: webIdentityToken,
}));
return creds;
}
catch (error) {
throw new Error(`Could not assume role with web identity token file: ${(0, helpers_1.errorMessage)(error)}`);
}
}
async function assumeRoleWithCredentials(params, client) {
core.info('Assuming role with user credentials');
try {
const creds = await client.send(new client_sts_1.AssumeRoleCommand({ ...params }));
return creds;
}
catch (error) {
throw new Error(`Could not assume role with user credentials: ${(0, helpers_1.errorMessage)(error)}`);
}
}
async function assumeRole(params) {
const { credentialsClient, sourceAccountId, roleToAssume, roleExternalId, roleDuration, roleSessionName, roleSkipSessionTagging, webIdentityTokenFile, webIdentityToken, inlineSessionPolicy, managedSessionPolicies, } = { ...params };
// Load GitHub environment variables
const { GITHUB_REPOSITORY, GITHUB_WORKFLOW, GITHUB_ACTION, GITHUB_ACTOR, GITHUB_SHA, GITHUB_WORKSPACE } = process.env;
if (!GITHUB_REPOSITORY || !GITHUB_WORKFLOW || !GITHUB_ACTION || !GITHUB_ACTOR || !GITHUB_SHA || !GITHUB_WORKSPACE) {
throw new Error('Missing required environment variables. Are you running in GitHub Actions?');
}
// Load role session tags
const tagArray = [
{ Key: 'GitHub', Value: 'Actions' },
{ Key: 'Repository', Value: GITHUB_REPOSITORY },
{ Key: 'Workflow', Value: (0, helpers_1.sanitizeGitHubVariables)(GITHUB_WORKFLOW) },
{ Key: 'Action', Value: GITHUB_ACTION },
{ Key: 'Actor', Value: (0, helpers_1.sanitizeGitHubVariables)(GITHUB_ACTOR) },
{ Key: 'Commit', Value: GITHUB_SHA },
];
if (process.env['GITHUB_REF']) {
tagArray.push({ Key: 'Branch', Value: (0, helpers_1.sanitizeGitHubVariables)(process.env['GITHUB_REF']) });
}
const tags = roleSkipSessionTagging ? undefined : tagArray;
if (!tags) {
core.debug('Role session tagging has been skipped.');
}
else {
core.debug(`${tags.length} role session tags are being used.`);
}
// Calculate role ARN from name and account ID (currently only supports `aws` partition)
let roleArn = roleToAssume;
if (!roleArn.startsWith('arn:aws')) {
(0, assert_1.default)((0, helpers_1.isDefined)(sourceAccountId), 'Source Account ID is needed if the Role Name is provided and not the Role Arn.');
roleArn = `arn:aws:iam::${sourceAccountId}:role/${roleArn}`;
}
// Ready common parameters to assume role
const commonAssumeRoleParams = {
RoleArn: roleArn,
RoleSessionName: roleSessionName,
DurationSeconds: roleDuration,
Tags: tags ? tags : undefined,
ExternalId: roleExternalId ? roleExternalId : undefined,
Policy: inlineSessionPolicy ? inlineSessionPolicy : undefined,
PolicyArns: managedSessionPolicies?.length ? managedSessionPolicies : undefined,
};
const keys = Object.keys(commonAssumeRoleParams);
keys.forEach((k) => commonAssumeRoleParams[k] === undefined && delete commonAssumeRoleParams[k]);
// Instantiate STS client
const stsClient = credentialsClient.stsClient;
// Assume role using one of three methods
if (!!webIdentityToken) {
return assumeRoleWithOIDC(commonAssumeRoleParams, stsClient, webIdentityToken);
}
else if (!!webIdentityTokenFile) {
return assumeRoleWithWebIdentityTokenFile(commonAssumeRoleParams, stsClient, webIdentityTokenFile, GITHUB_WORKSPACE);
}
else {
return assumeRoleWithCredentials(commonAssumeRoleParams, stsClient);
}
}
exports.assumeRole = assumeRole;
//# sourceMappingURL=assumeRole.js.map
/***/ }),
/***/ 49787:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
var desc = Object.getOwnPropertyDescriptor(m, k);
if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) {
desc = { enumerable: true, get: function() { return m[k]; } };
}
Object.defineProperty(o, k2, desc);
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isDefined = exports.errorMessage = exports.retryAndBackoff = exports.verifyKeys = exports.reset = exports.withsleep = exports.defaultSleep = exports.sanitizeGitHubVariables = exports.exportAccountId = exports.exportRegion = exports.unsetCredentials = exports.exportCredentials = void 0;
const core = __importStar(__nccwpck_require__(42186));
const client_sts_1 = __nccwpck_require__(52209);
const MAX_TAG_VALUE_LENGTH = 256;
const SANITIZATION_CHARACTER = '_';
const SPECIAL_CHARS_REGEX = /[!@#$%^&*()_+\-=[\]{};':"\\|,.<>/?]+/;
// Configure the AWS CLI and AWS SDKs using environment variables and set them as secrets.
// Setting the credentials as secrets masks them in Github Actions logs
function exportCredentials(creds, outputCredentials) {
if (creds?.AccessKeyId) {
core.setSecret(creds.AccessKeyId);
core.exportVariable('AWS_ACCESS_KEY_ID', creds.AccessKeyId);
}
if (creds?.SecretAccessKey) {
core.setSecret(creds.SecretAccessKey);
core.exportVariable('AWS_SECRET_ACCESS_KEY', creds.SecretAccessKey);
}
if (creds?.SessionToken) {
core.setSecret(creds.SessionToken);
core.exportVariable('AWS_SESSION_TOKEN', creds.SessionToken);
}
else if (process.env['AWS_SESSION_TOKEN']) {
// clear session token from previous credentials action
core.exportVariable('AWS_SESSION_TOKEN', '');
}
if (outputCredentials) {
if (creds?.AccessKeyId) {
core.setOutput('aws-access-key-id', creds.AccessKeyId);
}
if (creds?.SecretAccessKey) {
core.setOutput('aws-secret-access-key', creds.SecretAccessKey);
}
if (creds?.SessionToken) {
core.setOutput('aws-session-token', creds.SessionToken);
}
}
}
exports.exportCredentials = exportCredentials;
function unsetCredentials() {
core.exportVariable('AWS_ACCESS_KEY_ID', '');
core.exportVariable('AWS_SECRET_ACCESS_KEY', '');
core.exportVariable('AWS_SESSION_TOKEN', '');
core.exportVariable('AWS_REGION', '');
core.exportVariable('AWS_DEFAULT_REGION', '');
}
exports.unsetCredentials = unsetCredentials;
function exportRegion(region) {
core.exportVariable('AWS_DEFAULT_REGION', region);
core.exportVariable('AWS_REGION', region);
}
exports.exportRegion = exportRegion;
// Obtains account ID from STS Client and sets it as output
async function exportAccountId(credentialsClient, maskAccountId) {
const client = credentialsClient.stsClient;
const identity = await client.send(new client_sts_1.GetCallerIdentityCommand({}));
const accountId = identity.Account;
if (!accountId) {
throw new Error('Could not get Account ID from STS. Did you set credentials?');
}
if (maskAccountId) {
core.setSecret(accountId);
}
core.setOutput('aws-account-id', accountId);
return accountId;
}
exports.exportAccountId = exportAccountId;
// Tags have a more restrictive set of acceptable characters than GitHub environment variables can.
// This replaces anything not conforming to the tag restrictions by inverting the regular expression.
// See the AWS documentation for constraint specifics https://docs.aws.amazon.com/STS/latest/APIReference/API_Tag.html.
function sanitizeGitHubVariables(name) {
const nameWithoutSpecialCharacters = name.replace(/[^\p{L}\p{Z}\p{N}_.:/=+\-@]/gu, SANITIZATION_CHARACTER);
const nameTruncated = nameWithoutSpecialCharacters.slice(0, MAX_TAG_VALUE_LENGTH);
return nameTruncated;
}
exports.sanitizeGitHubVariables = sanitizeGitHubVariables;
async function defaultSleep(ms) {
return new Promise((resolve) => setTimeout(resolve, ms));
}
exports.defaultSleep = defaultSleep;
let sleep = defaultSleep;
function withsleep(s) {
sleep = s;
}
exports.withsleep = withsleep;
function reset() {
sleep = defaultSleep;
}
exports.reset = reset;
function verifyKeys(creds) {
if (!creds) {
return false;
}
if (creds.AccessKeyId) {
if (SPECIAL_CHARS_REGEX.test(creds.AccessKeyId)) {
core.debug('AccessKeyId contains special characters.');
return false;
}
}
if (creds.SecretAccessKey) {
if (SPECIAL_CHARS_REGEX.test(creds.SecretAccessKey)) {
core.debug('SecretAccessKey contains special characters.');
return false;
}
}
return true;
}
exports.verifyKeys = verifyKeys;
// Retries the promise with exponential backoff if the error isRetryable up to maxRetries time.
async function retryAndBackoff(fn, isRetryable, maxRetries = 12, retries = 0, base = 50) {
try {
return await fn();
}
catch (err) {
if (!isRetryable) {
throw err;
}
// It's retryable, so sleep and retry.
await sleep(Math.random() * (Math.pow(2, retries) * base));
retries += 1;
if (retries >= maxRetries) {
throw err;
}
return await retryAndBackoff(fn, isRetryable, maxRetries, retries, base);
}
}
exports.retryAndBackoff = retryAndBackoff;
/* c8 ignore start */
function errorMessage(error) {
return error instanceof Error ? error.message : String(error);
}
exports.errorMessage = errorMessage;
function isDefined(i) {
return i !== undefined && i !== null;
}
exports.isDefined = isDefined;
/* c8 ignore stop */
//# sourceMappingURL=helpers.js.map
/***/ }),
/***/ 71667:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
var desc = Object.getOwnPropertyDescriptor(m, k);
if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) {
desc = { enumerable: true, get: function() { return m[k]; } };
}
Object.defineProperty(o, k2, desc);
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.run = void 0;
const core = __importStar(__nccwpck_require__(42186));
const assumeRole_1 = __nccwpck_require__(61209);
const CredentialsClient_1 = __nccwpck_require__(3301);
const helpers_1 = __nccwpck_require__(49787);
const DEFAULT_ROLE_DURATION = 3600; // One hour (seconds)
const ROLE_SESSION_NAME = 'GitHubActions';
const REGION_REGEX = /^[a-z0-9-]+$/g;
async function run() {
try {
// Get inputs
const AccessKeyId = core.getInput('aws-access-key-id', { required: false });
const SecretAccessKey = core.getInput('aws-secret-access-key', { required: false });
const sessionTokenInput = core.getInput('aws-session-token', { required: false });
const SessionToken = sessionTokenInput === '' ? undefined : sessionTokenInput;
const region = core.getInput('aws-region', { required: true });
const roleToAssume = core.getInput('role-to-assume', { required: false });
const audience = core.getInput('audience', { required: false });
const maskAccountIdInput = core.getInput('mask-aws-account-id', { required: false }) || 'false';
const maskAccountId = maskAccountIdInput.toLowerCase() === 'true';
const roleExternalId = core.getInput('role-external-id', { required: false });
const webIdentityTokenFile = core.getInput('web-identity-token-file', { required: false });
const roleDuration = parseInt(core.getInput('role-duration-seconds', { required: false })) || DEFAULT_ROLE_DURATION;
const roleSessionName = core.getInput('role-session-name', { required: false }) || ROLE_SESSION_NAME;
const roleSkipSessionTaggingInput = core.getInput('role-skip-session-tagging', { required: false }) || 'false';
const roleSkipSessionTagging = roleSkipSessionTaggingInput.toLowerCase() === 'true';
const proxyServer = core.getInput('http-proxy', { required: false });
const inlineSessionPolicy = core.getInput('inline-session-policy', { required: false });
const managedSessionPoliciesInput = core.getMultilineInput('managed-session-policies', { required: false });
const managedSessionPolicies = [];
const roleChainingInput = core.getInput('role-chaining', { required: false }) || 'false';
const roleChaining = roleChainingInput.toLowerCase() === 'true';
const outputCredentialsInput = core.getInput('output-credentials', { required: false }) || 'false';
const outputCredentials = outputCredentialsInput.toLowerCase() === 'true';
const unsetCurrentCredentialsInput = core.getInput('unset-current-credentials', { required: false }) || 'false';
const unsetCurrentCredentials = unsetCurrentCredentialsInput.toLowerCase() === 'true';
const disableRetryInput = core.getInput('disable-retry', { required: false }) || 'false';
let disableRetry = disableRetryInput.toLowerCase() === 'true';
const specialCharacterWorkaroundInput = core.getInput('special-characters-workaround', { required: false }) || 'false';
const specialCharacterWorkaround = specialCharacterWorkaroundInput.toLowerCase() === 'true';
let maxRetries = parseInt(core.getInput('retry-max-attempts', { required: false })) || 12;
switch (true) {
case specialCharacterWorkaround:
// 😳
disableRetry = false;
maxRetries = 12;
break;
case maxRetries < 1:
maxRetries = 1;
break;
}
for (const managedSessionPolicy of managedSessionPoliciesInput) {
managedSessionPolicies.push({ arn: managedSessionPolicy });
}
// Logic to decide whether to attempt to use OIDC or not
const useGitHubOIDCProvider = () => {
// The `ACTIONS_ID_TOKEN_REQUEST_TOKEN` environment variable is set when the `id-token` permission is granted.
// This is necessary to authenticate with OIDC, but not strictly set just for OIDC. If it is not set and all other
// checks pass, it is likely but not guaranteed that the user needs but lacks this permission in their workflow.
// So, we will log a warning when it is the only piece absent
if (!!roleToAssume &&
!webIdentityTokenFile &&
!AccessKeyId &&
!process.env['ACTIONS_ID_TOKEN_REQUEST_TOKEN'] &&
!roleChaining) {
core.info('It looks like you might be trying to authenticate with OIDC. Did you mean to set the `id-token` permission? ' +
'If you are not trying to authenticate with OIDC and the action is working successfully, you can ignore this message.');
}
return (!!roleToAssume &&
!!process.env['ACTIONS_ID_TOKEN_REQUEST_TOKEN'] &&
!AccessKeyId &&
!webIdentityTokenFile &&
!roleChaining);
};
if (unsetCurrentCredentials) {
(0, helpers_1.unsetCredentials)();
}
if (!region.match(REGION_REGEX)) {
throw new Error(`Region is not valid: ${region}`);
}
(0, helpers_1.exportRegion)(region);
// Instantiate credentials client
const credentialsClient = new CredentialsClient_1.CredentialsClient({ region, proxyServer });
let sourceAccountId;
let webIdentityToken;
// If OIDC is being used, generate token
// Else, export credentials provided as input
if (useGitHubOIDCProvider()) {
try {
webIdentityToken = await (0, helpers_1.retryAndBackoff)(async () => {
return core.getIDToken(audience);
}, !disableRetry, maxRetries);
}
catch (error) {
throw new Error(`getIDToken call failed: ${(0, helpers_1.errorMessage)(error)}`);
}
}
else if (AccessKeyId) {
if (!SecretAccessKey) {
throw new Error("'aws-secret-access-key' must be provided if 'aws-access-key-id' is provided");
}
// The STS client for calling AssumeRole pulls creds from the environment.
// Plus, in the assume role case, if the AssumeRole call fails, we want
// the source credentials to already be masked as secrets
// in any error messages.
(0, helpers_1.exportCredentials)({ AccessKeyId, SecretAccessKey, SessionToken });
}
else if (!webIdentityTokenFile && !roleChaining) {
// Proceed only if credentials can be picked up
await credentialsClient.validateCredentials();
sourceAccountId = await (0, helpers_1.exportAccountId)(credentialsClient, maskAccountId);
}
if (AccessKeyId || roleChaining) {
// Validate that the SDK can actually pick up credentials.
// This validates cases where this action is using existing environment credentials,
// and cases where the user intended to provide input credentials but the secrets inputs resolved to empty strings.
await credentialsClient.validateCredentials(AccessKeyId, roleChaining);
sourceAccountId = await (0, helpers_1.exportAccountId)(credentialsClient, maskAccountId);
}
// Get role credentials if configured to do so
if (roleToAssume) {
let roleCredentials;
do {
// eslint-disable-next-line no-await-in-loop
roleCredentials = await (0, helpers_1.retryAndBackoff)(async () => {
return (0, assumeRole_1.assumeRole)({
credentialsClient,
sourceAccountId,
roleToAssume,
roleExternalId,
roleDuration,
roleSessionName,
roleSkipSessionTagging,
webIdentityTokenFile,
webIdentityToken,
inlineSessionPolicy,
managedSessionPolicies,
});
}, !disableRetry, maxRetries);
// eslint-disable-next-line no-unmodified-loop-condition
} while (specialCharacterWorkaround && !(0, helpers_1.verifyKeys)(roleCredentials.Credentials));
core.info(`Authenticated as assumedRoleId ${roleCredentials.AssumedRoleUser.AssumedRoleId}`);
(0, helpers_1.exportCredentials)(roleCredentials.Credentials, outputCredentials);
// We need to validate the credentials in 2 of our use-cases
// First: self-hosted runners. If the GITHUB_ACTIONS environment variable
// is set to `true` then we are NOT in a self-hosted runner.
// Second: Customer provided credentials manually (IAM User keys stored in GH Secrets)
if (!process.env['GITHUB_ACTIONS'] || AccessKeyId) {
await credentialsClient.validateCredentials(roleCredentials.Credentials?.AccessKeyId);
}
await (0, helpers_1.exportAccountId)(credentialsClient, maskAccountId);
}
else {
core.info('Proceeding with IAM user credentials');
}
}
catch (error) {
core.setFailed((0, helpers_1.errorMessage)(error));
const showStackTrace = process.env['SHOW_STACK_TRACE'];
if (showStackTrace === 'true') {
throw error;
}
}
}
exports.run = run;
/* c8 ignore start */
/* istanbul ignore next */
if (require.main === require.cache[eval('__filename')]) {
(async () => {
await run();
})().catch((error) => {
core.setFailed((0, helpers_1.errorMessage)(error));
});
}
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 87351:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.issue = exports.issueCommand = void 0;
const os = __importStar(__nccwpck_require__(22037));
const utils_1 = __nccwpck_require__(5278);
/**
* Commands
*
* Command Format:
* ::name key=value,key=value::message
*
* Examples:
* ::warning::This is the message
* ::set-env name=MY_VAR::some value
*/
function issueCommand(command, properties, message) {
const cmd = new Command(command, properties, message);
process.stdout.write(cmd.toString() + os.EOL);
}
exports.issueCommand = issueCommand;
function issue(name, message = '') {
issueCommand(name, {}, message);
}
exports.issue = issue;
const CMD_STRING = '::';
class Command {
constructor(command, properties, message) {
if (!command) {
command = 'missing.command';
}
this.command = command;
this.properties = properties;
this.message = message;
}
toString() {
let cmdStr = CMD_STRING + this.command;
if (this.properties && Object.keys(this.properties).length > 0) {
cmdStr += ' ';
let first = true;
for (const key in this.properties) {
if (this.properties.hasOwnProperty(key)) {
const val = this.properties[key];
if (val) {
if (first) {
first = false;
}
else {
cmdStr += ',';
}
cmdStr += `${key}=${escapeProperty(val)}`;
}
}
}
}
cmdStr += `${CMD_STRING}${escapeData(this.message)}`;
return cmdStr;
}
}
function escapeData(s) {
return utils_1.toCommandValue(s)
.replace(/%/g, '%25')
.replace(/\r/g, '%0D')
.replace(/\n/g, '%0A');
}
function escapeProperty(s) {
return utils_1.toCommandValue(s)
.replace(/%/g, '%25')
.replace(/\r/g, '%0D')
.replace(/\n/g, '%0A')
.replace(/:/g, '%3A')
.replace(/,/g, '%2C');
}
//# sourceMappingURL=command.js.map
/***/ }),
/***/ 42186:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getIDToken = exports.getState = exports.saveState = exports.group = exports.endGroup = exports.startGroup = exports.info = exports.notice = exports.warning = exports.error = exports.debug = exports.isDebug = exports.setFailed = exports.setCommandEcho = exports.setOutput = exports.getBooleanInput = exports.getMultilineInput = exports.getInput = exports.addPath = exports.setSecret = exports.exportVariable = exports.ExitCode = void 0;
const command_1 = __nccwpck_require__(87351);
const file_command_1 = __nccwpck_require__(717);
const utils_1 = __nccwpck_require__(5278);
const os = __importStar(__nccwpck_require__(22037));
const path = __importStar(__nccwpck_require__(71017));
const oidc_utils_1 = __nccwpck_require__(98041);
/**
* The code to exit an action
*/
var ExitCode;
(function (ExitCode) {
/**
* A code indicating that the action was successful
*/
ExitCode[ExitCode["Success"] = 0] = "Success";
/**
* A code indicating that the action was a failure
*/
ExitCode[ExitCode["Failure"] = 1] = "Failure";
})(ExitCode = exports.ExitCode || (exports.ExitCode = {}));
//-----------------------------------------------------------------------
// Variables
//-----------------------------------------------------------------------
/**
* Sets env variable for this action and future actions in the job
* @param name the name of the variable to set
* @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function exportVariable(name, val) {
const convertedVal = utils_1.toCommandValue(val);
process.env[name] = convertedVal;
const filePath = process.env['GITHUB_ENV'] || '';
if (filePath) {
return file_command_1.issueFileCommand('ENV', file_command_1.prepareKeyValueMessage(name, val));
}
command_1.issueCommand('set-env', { name }, convertedVal);
}
exports.exportVariable = exportVariable;
/**
* Registers a secret which will get masked from logs
* @param secret value of the secret
*/
function setSecret(secret) {
command_1.issueCommand('add-mask', {}, secret);
}
exports.setSecret = setSecret;
/**
* Prepends inputPath to the PATH (for this action and future actions)
* @param inputPath
*/
function addPath(inputPath) {
const filePath = process.env['GITHUB_PATH'] || '';
if (filePath) {
file_command_1.issueFileCommand('PATH', inputPath);
}
else {
command_1.issueCommand('add-path', {}, inputPath);
}
process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`;
}
exports.addPath = addPath;
/**
* Gets the value of an input.
* Unless trimWhitespace is set to false in InputOptions, the value is also trimmed.
* Returns an empty string if the value is not defined.
*
* @param name name of the input to get
* @param options optional. See InputOptions.
* @returns string
*/
function getInput(name, options) {
const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || '';
if (options && options.required && !val) {
throw new Error(`Input required and not supplied: ${name}`);
}
if (options && options.trimWhitespace === false) {
return val;
}
return val.trim();
}
exports.getInput = getInput;
/**
* Gets the values of an multiline input. Each value is also trimmed.
*
* @param name name of the input to get
* @param options optional. See InputOptions.
* @returns string[]
*
*/
function getMultilineInput(name, options) {
const inputs = getInput(name, options)
.split('\n')
.filter(x => x !== '');
if (options && options.trimWhitespace === false) {
return inputs;
}
return inputs.map(input => input.trim());
}
exports.getMultilineInput = getMultilineInput;
/**
* Gets the input value of the boolean type in the YAML 1.2 "core schema" specification.
* Support boolean input list: `true | True | TRUE | false | False | FALSE` .
* The return value is also in boolean type.
* ref: https://yaml.org/spec/1.2/spec.html#id2804923
*
* @param name name of the input to get
* @param options optional. See InputOptions.
* @returns boolean
*/
function getBooleanInput(name, options) {
const trueValue = ['true', 'True', 'TRUE'];
const falseValue = ['false', 'False', 'FALSE'];
const val = getInput(name, options);
if (trueValue.includes(val))
return true;
if (falseValue.includes(val))
return false;
throw new TypeError(`Input does not meet YAML 1.2 "Core Schema" specification: ${name}\n` +
`Support boolean input list: \`true | True | TRUE | false | False | FALSE\``);
}
exports.getBooleanInput = getBooleanInput;
/**
* Sets the value of an output.
*
* @param name name of the output to set
* @param value value to store. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function setOutput(name, value) {
const filePath = process.env['GITHUB_OUTPUT'] || '';
if (filePath) {
return file_command_1.issueFileCommand('OUTPUT', file_command_1.prepareKeyValueMessage(name, value));
}
process.stdout.write(os.EOL);
command_1.issueCommand('set-output', { name }, utils_1.toCommandValue(value));
}
exports.setOutput = setOutput;
/**
* Enables or disables the echoing of commands into stdout for the rest of the step.
* Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set.
*
*/
function setCommandEcho(enabled) {
command_1.issue('echo', enabled ? 'on' : 'off');
}
exports.setCommandEcho = setCommandEcho;
//-----------------------------------------------------------------------
// Results
//-----------------------------------------------------------------------
/**
* Sets the action status to failed.
* When the action exits it will be with an exit code of 1
* @param message add error issue message
*/
function setFailed(message) {
process.exitCode = ExitCode.Failure;
error(message);
}
exports.setFailed = setFailed;
//-----------------------------------------------------------------------
// Logging Commands
//-----------------------------------------------------------------------
/**
* Gets whether Actions Step Debug is on or not
*/
function isDebug() {
return process.env['RUNNER_DEBUG'] === '1';
}
exports.isDebug = isDebug;
/**
* Writes debug message to user log
* @param message debug message
*/
function debug(message) {
command_1.issueCommand('debug', {}, message);
}
exports.debug = debug;
/**
* Adds an error issue
* @param message error issue message. Errors will be converted to string via toString()
* @param properties optional properties to add to the annotation.
*/
function error(message, properties = {}) {
command_1.issueCommand('error', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message);
}
exports.error = error;
/**
* Adds a warning issue
* @param message warning issue message. Errors will be converted to string via toString()
* @param properties optional properties to add to the annotation.
*/
function warning(message, properties = {}) {
command_1.issueCommand('warning', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message);
}
exports.warning = warning;
/**
* Adds a notice issue
* @param message notice issue message. Errors will be converted to string via toString()
* @param properties optional properties to add to the annotation.
*/
function notice(message, properties = {}) {
command_1.issueCommand('notice', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message);
}
exports.notice = notice;
/**
* Writes info to log with console.log.
* @param message info message
*/
function info(message) {
process.stdout.write(message + os.EOL);
}
exports.info = info;
/**
* Begin an output group.
*
* Output until the next `groupEnd` will be foldable in this group
*
* @param name The name of the output group
*/
function startGroup(name) {
command_1.issue('group', name);
}
exports.startGroup = startGroup;
/**
* End an output group.
*/
function endGroup() {
command_1.issue('endgroup');
}
exports.endGroup = endGroup;
/**
* Wrap an asynchronous function call in a group.
*
* Returns the same type as the function itself.
*
* @param name The name of the group
* @param fn The function to wrap in the group
*/
function group(name, fn) {
return __awaiter(this, void 0, void 0, function* () {
startGroup(name);
let result;
try {
result = yield fn();
}
finally {
endGroup();
}
return result;
});
}
exports.group = group;
//-----------------------------------------------------------------------
// Wrapper action state
//-----------------------------------------------------------------------
/**
* Saves state for current action, the state can only be retrieved by this action's post job execution.
*
* @param name name of the state to store
* @param value value to store. Non-string values will be converted to a string via JSON.stringify
*/
// eslint-disable-next-line @typescript-eslint/no-explicit-any
function saveState(name, value) {
const filePath = process.env['GITHUB_STATE'] || '';
if (filePath) {
return file_command_1.issueFileCommand('STATE', file_command_1.prepareKeyValueMessage(name, value));
}
command_1.issueCommand('save-state', { name }, utils_1.toCommandValue(value));
}
exports.saveState = saveState;
/**
* Gets the value of an state set by this action's main execution.
*
* @param name name of the state to get
* @returns string
*/
function getState(name) {
return process.env[`STATE_${name}`] || '';
}
exports.getState = getState;
function getIDToken(aud) {
return __awaiter(this, void 0, void 0, function* () {
return yield oidc_utils_1.OidcClient.getIDToken(aud);
});
}
exports.getIDToken = getIDToken;
/**
* Summary exports
*/
var summary_1 = __nccwpck_require__(81327);
Object.defineProperty(exports, "summary", ({ enumerable: true, get: function () { return summary_1.summary; } }));
/**
* @deprecated use core.summary
*/
var summary_2 = __nccwpck_require__(81327);
Object.defineProperty(exports, "markdownSummary", ({ enumerable: true, get: function () { return summary_2.markdownSummary; } }));
/**
* Path exports
*/
var path_utils_1 = __nccwpck_require__(2981);
Object.defineProperty(exports, "toPosixPath", ({ enumerable: true, get: function () { return path_utils_1.toPosixPath; } }));
Object.defineProperty(exports, "toWin32Path", ({ enumerable: true, get: function () { return path_utils_1.toWin32Path; } }));
Object.defineProperty(exports, "toPlatformPath", ({ enumerable: true, get: function () { return path_utils_1.toPlatformPath; } }));
//# sourceMappingURL=core.js.map
/***/ }),
/***/ 717:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
// For internal use, subject to change.
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.prepareKeyValueMessage = exports.issueFileCommand = void 0;
// We use any as a valid input type
/* eslint-disable @typescript-eslint/no-explicit-any */
const fs = __importStar(__nccwpck_require__(57147));
const os = __importStar(__nccwpck_require__(22037));
const uuid_1 = __nccwpck_require__(75840);
const utils_1 = __nccwpck_require__(5278);
function issueFileCommand(command, message) {
const filePath = process.env[`GITHUB_${command}`];
if (!filePath) {
throw new Error(`Unable to find environment variable for file command ${command}`);
}
if (!fs.existsSync(filePath)) {
throw new Error(`Missing file at path: ${filePath}`);
}
fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, {
encoding: 'utf8'
});
}
exports.issueFileCommand = issueFileCommand;
function prepareKeyValueMessage(key, value) {
const delimiter = `ghadelimiter_${uuid_1.v4()}`;
const convertedValue = utils_1.toCommandValue(value);
// These should realistically never happen, but just in case someone finds a
// way to exploit uuid generation let's not allow keys or values that contain
// the delimiter.
if (key.includes(delimiter)) {
throw new Error(`Unexpected input: name should not contain the delimiter "${delimiter}"`);
}
if (convertedValue.includes(delimiter)) {
throw new Error(`Unexpected input: value should not contain the delimiter "${delimiter}"`);
}
return `${key}<<${delimiter}${os.EOL}${convertedValue}${os.EOL}${delimiter}`;
}
exports.prepareKeyValueMessage = prepareKeyValueMessage;
//# sourceMappingURL=file-command.js.map
/***/ }),
/***/ 98041:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.OidcClient = void 0;
const http_client_1 = __nccwpck_require__(96255);
const auth_1 = __nccwpck_require__(35526);
const core_1 = __nccwpck_require__(42186);
class OidcClient {
static createHttpClient(allowRetry = true, maxRetry = 10) {
const requestOptions = {
allowRetries: allowRetry,
maxRetries: maxRetry
};
return new http_client_1.HttpClient('actions/oidc-client', [new auth_1.BearerCredentialHandler(OidcClient.getRequestToken())], requestOptions);
}
static getRequestToken() {
const token = process.env['ACTIONS_ID_TOKEN_REQUEST_TOKEN'];
if (!token) {
throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_TOKEN env variable');
}
return token;
}
static getIDTokenUrl() {
const runtimeUrl = process.env['ACTIONS_ID_TOKEN_REQUEST_URL'];
if (!runtimeUrl) {
throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_URL env variable');
}
return runtimeUrl;
}
static getCall(id_token_url) {
var _a;
return __awaiter(this, void 0, void 0, function* () {
const httpclient = OidcClient.createHttpClient();
const res = yield httpclient
.getJson(id_token_url)
.catch(error => {
throw new Error(`Failed to get ID Token. \n
Error Code : ${error.statusCode}\n
Error Message: ${error.message}`);
});
const id_token = (_a = res.result) === null || _a === void 0 ? void 0 : _a.value;
if (!id_token) {
throw new Error('Response json body do not have ID Token field');
}
return id_token;
});
}
static getIDToken(audience) {
return __awaiter(this, void 0, void 0, function* () {
try {
// New ID Token is requested from action service
let id_token_url = OidcClient.getIDTokenUrl();
if (audience) {
const encodedAudience = encodeURIComponent(audience);
id_token_url = `${id_token_url}&audience=${encodedAudience}`;
}
core_1.debug(`ID token url is ${id_token_url}`);
const id_token = yield OidcClient.getCall(id_token_url);
core_1.setSecret(id_token);
return id_token;
}
catch (error) {
throw new Error(`Error message: ${error.message}`);
}
});
}
}
exports.OidcClient = OidcClient;
//# sourceMappingURL=oidc-utils.js.map
/***/ }),
/***/ 2981:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toPlatformPath = exports.toWin32Path = exports.toPosixPath = void 0;
const path = __importStar(__nccwpck_require__(71017));
/**
* toPosixPath converts the given path to the posix form. On Windows, \\ will be
* replaced with /.
*
* @param pth. Path to transform.
* @return string Posix path.
*/
function toPosixPath(pth) {
return pth.replace(/[\\]/g, '/');
}
exports.toPosixPath = toPosixPath;
/**
* toWin32Path converts the given path to the win32 form. On Linux, / will be
* replaced with \\.
*
* @param pth. Path to transform.
* @return string Win32 path.
*/
function toWin32Path(pth) {
return pth.replace(/[/]/g, '\\');
}
exports.toWin32Path = toWin32Path;
/**
* toPlatformPath converts the given path to a platform-specific path. It does
* this by replacing instances of / and \ with the platform-specific path
* separator.
*
* @param pth The path to platformize.
* @return string The platform-specific path.
*/
function toPlatformPath(pth) {
return pth.replace(/[/\\]/g, path.sep);
}
exports.toPlatformPath = toPlatformPath;
//# sourceMappingURL=path-utils.js.map
/***/ }),
/***/ 81327:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.summary = exports.markdownSummary = exports.SUMMARY_DOCS_URL = exports.SUMMARY_ENV_VAR = void 0;
const os_1 = __nccwpck_require__(22037);
const fs_1 = __nccwpck_require__(57147);
const { access, appendFile, writeFile } = fs_1.promises;
exports.SUMMARY_ENV_VAR = 'GITHUB_STEP_SUMMARY';
exports.SUMMARY_DOCS_URL = 'https://docs.github.com/actions/using-workflows/workflow-commands-for-github-actions#adding-a-job-summary';
class Summary {
constructor() {
this._buffer = '';
}
/**
* Finds the summary file path from the environment, rejects if env var is not found or file does not exist
* Also checks r/w permissions.
*
* @returns step summary file path
*/
filePath() {
return __awaiter(this, void 0, void 0, function* () {
if (this._filePath) {
return this._filePath;
}
const pathFromEnv = process.env[exports.SUMMARY_ENV_VAR];
if (!pathFromEnv) {
throw new Error(`Unable to find environment variable for $${exports.SUMMARY_ENV_VAR}. Check if your runtime environment supports job summaries.`);
}
try {
yield access(pathFromEnv, fs_1.constants.R_OK | fs_1.constants.W_OK);
}
catch (_a) {
throw new Error(`Unable to access summary file: '${pathFromEnv}'. Check if the file has correct read/write permissions.`);
}
this._filePath = pathFromEnv;
return this._filePath;
});
}
/**
* Wraps content in an HTML tag, adding any HTML attributes
*
* @param {string} tag HTML tag to wrap
* @param {string | null} content content within the tag
* @param {[attribute: string]: string} attrs key-value list of HTML attributes to add
*
* @returns {string} content wrapped in HTML element
*/
wrap(tag, content, attrs = {}) {
const htmlAttrs = Object.entries(attrs)
.map(([key, value]) => ` ${key}="${value}"`)
.join('');
if (!content) {
return `<${tag}${htmlAttrs}>`;
}
return `<${tag}${htmlAttrs}>${content}</${tag}>`;
}
/**
* Writes text in the buffer to the summary buffer file and empties buffer. Will append by default.
*
* @param {SummaryWriteOptions} [options] (optional) options for write operation
*
* @returns {Promise<Summary>} summary instance
*/
write(options) {
return __awaiter(this, void 0, void 0, function* () {
const overwrite = !!(options === null || options === void 0 ? void 0 : options.overwrite);
const filePath = yield this.filePath();
const writeFunc = overwrite ? writeFile : appendFile;
yield writeFunc(filePath, this._buffer, { encoding: 'utf8' });
return this.emptyBuffer();
});
}
/**
* Clears the summary buffer and wipes the summary file
*
* @returns {Summary} summary instance
*/
clear() {
return __awaiter(this, void 0, void 0, function* () {
return this.emptyBuffer().write({ overwrite: true });
});
}
/**
* Returns the current summary buffer as a string
*
* @returns {string} string of summary buffer
*/
stringify() {
return this._buffer;
}
/**
* If the summary buffer is empty
*
* @returns {boolen} true if the buffer is empty
*/
isEmptyBuffer() {
return this._buffer.length === 0;
}
/**
* Resets the summary buffer without writing to summary file
*
* @returns {Summary} summary instance
*/
emptyBuffer() {
this._buffer = '';
return this;
}
/**
* Adds raw text to the summary buffer
*
* @param {string} text content to add
* @param {boolean} [addEOL=false] (optional) append an EOL to the raw text (default: false)
*
* @returns {Summary} summary instance
*/
addRaw(text, addEOL = false) {
this._buffer += text;
return addEOL ? this.addEOL() : this;
}
/**
* Adds the operating system-specific end-of-line marker to the buffer
*
* @returns {Summary} summary instance
*/
addEOL() {
return this.addRaw(os_1.EOL);
}
/**
* Adds an HTML codeblock to the summary buffer
*
* @param {string} code content to render within fenced code block
* @param {string} lang (optional) language to syntax highlight code
*
* @returns {Summary} summary instance
*/
addCodeBlock(code, lang) {
const attrs = Object.assign({}, (lang && { lang }));
const element = this.wrap('pre', this.wrap('code', code), attrs);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML list to the summary buffer
*
* @param {string[]} items list of items to render
* @param {boolean} [ordered=false] (optional) if the rendered list should be ordered or not (default: false)
*
* @returns {Summary} summary instance
*/
addList(items, ordered = false) {
const tag = ordered ? 'ol' : 'ul';
const listItems = items.map(item => this.wrap('li', item)).join('');
const element = this.wrap(tag, listItems);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML table to the summary buffer
*
* @param {SummaryTableCell[]} rows table rows
*
* @returns {Summary} summary instance
*/
addTable(rows) {
const tableBody = rows
.map(row => {
const cells = row
.map(cell => {
if (typeof cell === 'string') {
return this.wrap('td', cell);
}
const { header, data, colspan, rowspan } = cell;
const tag = header ? 'th' : 'td';
const attrs = Object.assign(Object.assign({}, (colspan && { colspan })), (rowspan && { rowspan }));
return this.wrap(tag, data, attrs);
})
.join('');
return this.wrap('tr', cells);
})
.join('');
const element = this.wrap('table', tableBody);
return this.addRaw(element).addEOL();
}
/**
* Adds a collapsable HTML details element to the summary buffer
*
* @param {string} label text for the closed state
* @param {string} content collapsable content
*
* @returns {Summary} summary instance
*/
addDetails(label, content) {
const element = this.wrap('details', this.wrap('summary', label) + content);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML image tag to the summary buffer
*
* @param {string} src path to the image you to embed
* @param {string} alt text description of the image
* @param {SummaryImageOptions} options (optional) addition image attributes
*
* @returns {Summary} summary instance
*/
addImage(src, alt, options) {
const { width, height } = options || {};
const attrs = Object.assign(Object.assign({}, (width && { width })), (height && { height }));
const element = this.wrap('img', null, Object.assign({ src, alt }, attrs));
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML section heading element
*
* @param {string} text heading text
* @param {number | string} [level=1] (optional) the heading level, default: 1
*
* @returns {Summary} summary instance
*/
addHeading(text, level) {
const tag = `h${level}`;
const allowedTag = ['h1', 'h2', 'h3', 'h4', 'h5', 'h6'].includes(tag)
? tag
: 'h1';
const element = this.wrap(allowedTag, text);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML thematic break (<hr>) to the summary buffer
*
* @returns {Summary} summary instance
*/
addSeparator() {
const element = this.wrap('hr', null);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML line break (<br>) to the summary buffer
*
* @returns {Summary} summary instance
*/
addBreak() {
const element = this.wrap('br', null);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML blockquote to the summary buffer
*
* @param {string} text quote text
* @param {string} cite (optional) citation url
*
* @returns {Summary} summary instance
*/
addQuote(text, cite) {
const attrs = Object.assign({}, (cite && { cite }));
const element = this.wrap('blockquote', text, attrs);
return this.addRaw(element).addEOL();
}
/**
* Adds an HTML anchor tag to the summary buffer
*
* @param {string} text link text/content
* @param {string} href hyperlink
*
* @returns {Summary} summary instance
*/
addLink(text, href) {
const element = this.wrap('a', text, { href });
return this.addRaw(element).addEOL();
}
}
const _summary = new Summary();
/**
* @deprecated use `core.summary`
*/
exports.markdownSummary = _summary;
exports.summary = _summary;
//# sourceMappingURL=summary.js.map
/***/ }),
/***/ 5278:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
// We use any as a valid input type
/* eslint-disable @typescript-eslint/no-explicit-any */
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toCommandProperties = exports.toCommandValue = void 0;
/**
* Sanitizes an input into a string so it can be passed into issueCommand safely
* @param input input to sanitize into a string
*/
function toCommandValue(input) {
if (input === null || input === undefined) {
return '';
}
else if (typeof input === 'string' || input instanceof String) {
return input;
}
return JSON.stringify(input);
}
exports.toCommandValue = toCommandValue;
/**
*
* @param annotationProperties
* @returns The command properties to send with the actual annotation command
* See IssueCommandProperties: https://github.com/actions/runner/blob/main/src/Runner.Worker/ActionCommandManager.cs#L646
*/
function toCommandProperties(annotationProperties) {
if (!Object.keys(annotationProperties).length) {
return {};
}
return {
title: annotationProperties.title,
file: annotationProperties.file,
line: annotationProperties.startLine,
endLine: annotationProperties.endLine,
col: annotationProperties.startColumn,
endColumn: annotationProperties.endColumn
};
}
exports.toCommandProperties = toCommandProperties;
//# sourceMappingURL=utils.js.map
/***/ }),
/***/ 35526:
/***/ (function(__unused_webpack_module, exports) {
"use strict";
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.PersonalAccessTokenCredentialHandler = exports.BearerCredentialHandler = exports.BasicCredentialHandler = void 0;
class BasicCredentialHandler {
constructor(username, password) {
this.username = username;
this.password = password;
}
prepareRequest(options) {
if (!options.headers) {
throw Error('The request has no headers');
}
options.headers['Authorization'] = `Basic ${Buffer.from(`${this.username}:${this.password}`).toString('base64')}`;
}
// This handler cannot handle 401
canHandleAuthentication() {
return false;
}
handleAuthentication() {
return __awaiter(this, void 0, void 0, function* () {
throw new Error('not implemented');
});
}
}
exports.BasicCredentialHandler = BasicCredentialHandler;
class BearerCredentialHandler {
constructor(token) {
this.token = token;
}
// currently implements pre-authorization
// TODO: support preAuth = false where it hooks on 401
prepareRequest(options) {
if (!options.headers) {
throw Error('The request has no headers');
}
options.headers['Authorization'] = `Bearer ${this.token}`;
}
// This handler cannot handle 401
canHandleAuthentication() {
return false;
}
handleAuthentication() {
return __awaiter(this, void 0, void 0, function* () {
throw new Error('not implemented');
});
}
}
exports.BearerCredentialHandler = BearerCredentialHandler;
class PersonalAccessTokenCredentialHandler {
constructor(token) {
this.token = token;
}
// currently implements pre-authorization
// TODO: support preAuth = false where it hooks on 401
prepareRequest(options) {
if (!options.headers) {
throw Error('The request has no headers');
}
options.headers['Authorization'] = `Basic ${Buffer.from(`PAT:${this.token}`).toString('base64')}`;
}
// This handler cannot handle 401
canHandleAuthentication() {
return false;
}
handleAuthentication() {
return __awaiter(this, void 0, void 0, function* () {
throw new Error('not implemented');
});
}
}
exports.PersonalAccessTokenCredentialHandler = PersonalAccessTokenCredentialHandler;
//# sourceMappingURL=auth.js.map
/***/ }),
/***/ 96255:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
/* eslint-disable @typescript-eslint/no-explicit-any */
var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
}));
var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
});
var __importStar = (this && this.__importStar) || function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HttpClient = exports.isHttps = exports.HttpClientResponse = exports.HttpClientError = exports.getProxyUrl = exports.MediaTypes = exports.Headers = exports.HttpCodes = void 0;
const http = __importStar(__nccwpck_require__(13685));
const https = __importStar(__nccwpck_require__(95687));
const pm = __importStar(__nccwpck_require__(19835));
const tunnel = __importStar(__nccwpck_require__(74294));
var HttpCodes;
(function (HttpCodes) {
HttpCodes[HttpCodes["OK"] = 200] = "OK";
HttpCodes[HttpCodes["MultipleChoices"] = 300] = "MultipleChoices";
HttpCodes[HttpCodes["MovedPermanently"] = 301] = "MovedPermanently";
HttpCodes[HttpCodes["ResourceMoved"] = 302] = "ResourceMoved";
HttpCodes[HttpCodes["SeeOther"] = 303] = "SeeOther";
HttpCodes[HttpCodes["NotModified"] = 304] = "NotModified";
HttpCodes[HttpCodes["UseProxy"] = 305] = "UseProxy";
HttpCodes[HttpCodes["SwitchProxy"] = 306] = "SwitchProxy";
HttpCodes[HttpCodes["TemporaryRedirect"] = 307] = "TemporaryRedirect";
HttpCodes[HttpCodes["PermanentRedirect"] = 308] = "PermanentRedirect";
HttpCodes[HttpCodes["BadRequest"] = 400] = "BadRequest";
HttpCodes[HttpCodes["Unauthorized"] = 401] = "Unauthorized";
HttpCodes[HttpCodes["PaymentRequired"] = 402] = "PaymentRequired";
HttpCodes[HttpCodes["Forbidden"] = 403] = "Forbidden";
HttpCodes[HttpCodes["NotFound"] = 404] = "NotFound";
HttpCodes[HttpCodes["MethodNotAllowed"] = 405] = "MethodNotAllowed";
HttpCodes[HttpCodes["NotAcceptable"] = 406] = "NotAcceptable";
HttpCodes[HttpCodes["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired";
HttpCodes[HttpCodes["RequestTimeout"] = 408] = "RequestTimeout";
HttpCodes[HttpCodes["Conflict"] = 409] = "Conflict";
HttpCodes[HttpCodes["Gone"] = 410] = "Gone";
HttpCodes[HttpCodes["TooManyRequests"] = 429] = "TooManyRequests";
HttpCodes[HttpCodes["InternalServerError"] = 500] = "InternalServerError";
HttpCodes[HttpCodes["NotImplemented"] = 501] = "NotImplemented";
HttpCodes[HttpCodes["BadGateway"] = 502] = "BadGateway";
HttpCodes[HttpCodes["ServiceUnavailable"] = 503] = "ServiceUnavailable";
HttpCodes[HttpCodes["GatewayTimeout"] = 504] = "GatewayTimeout";
})(HttpCodes = exports.HttpCodes || (exports.HttpCodes = {}));
var Headers;
(function (Headers) {
Headers["Accept"] = "accept";
Headers["ContentType"] = "content-type";
})(Headers = exports.Headers || (exports.Headers = {}));
var MediaTypes;
(function (MediaTypes) {
MediaTypes["ApplicationJson"] = "application/json";
})(MediaTypes = exports.MediaTypes || (exports.MediaTypes = {}));
/**
* Returns the proxy URL, depending upon the supplied url and proxy environment variables.
* @param serverUrl The server URL where the request will be sent. For example, https://api.github.com
*/
function getProxyUrl(serverUrl) {
const proxyUrl = pm.getProxyUrl(new URL(serverUrl));
return proxyUrl ? proxyUrl.href : '';
}
exports.getProxyUrl = getProxyUrl;
const HttpRedirectCodes = [
HttpCodes.MovedPermanently,
HttpCodes.ResourceMoved,
HttpCodes.SeeOther,
HttpCodes.TemporaryRedirect,
HttpCodes.PermanentRedirect
];
const HttpResponseRetryCodes = [
HttpCodes.BadGateway,
HttpCodes.ServiceUnavailable,
HttpCodes.GatewayTimeout
];
const RetryableHttpVerbs = ['OPTIONS', 'GET', 'DELETE', 'HEAD'];
const ExponentialBackoffCeiling = 10;
const ExponentialBackoffTimeSlice = 5;
class HttpClientError extends Error {
constructor(message, statusCode) {
super(message);
this.name = 'HttpClientError';
this.statusCode = statusCode;
Object.setPrototypeOf(this, HttpClientError.prototype);
}
}
exports.HttpClientError = HttpClientError;
class HttpClientResponse {
constructor(message) {
this.message = message;
}
readBody() {
return __awaiter(this, void 0, void 0, function* () {
return new Promise((resolve) => __awaiter(this, void 0, void 0, function* () {
let output = Buffer.alloc(0);
this.message.on('data', (chunk) => {
output = Buffer.concat([output, chunk]);
});
this.message.on('end', () => {
resolve(output.toString());
});
}));
});
}
readBodyBuffer() {
return __awaiter(this, void 0, void 0, function* () {
return new Promise((resolve) => __awaiter(this, void 0, void 0, function* () {
const chunks = [];
this.message.on('data', (chunk) => {
chunks.push(chunk);
});
this.message.on('end', () => {
resolve(Buffer.concat(chunks));
});
}));
});
}
}
exports.HttpClientResponse = HttpClientResponse;
function isHttps(requestUrl) {
const parsedUrl = new URL(requestUrl);
return parsedUrl.protocol === 'https:';
}
exports.isHttps = isHttps;
class HttpClient {
constructor(userAgent, handlers, requestOptions) {
this._ignoreSslError = false;
this._allowRedirects = true;
this._allowRedirectDowngrade = false;
this._maxRedirects = 50;
this._allowRetries = false;
this._maxRetries = 1;
this._keepAlive = false;
this._disposed = false;
this.userAgent = userAgent;
this.handlers = handlers || [];
this.requestOptions = requestOptions;
if (requestOptions) {
if (requestOptions.ignoreSslError != null) {
this._ignoreSslError = requestOptions.ignoreSslError;
}
this._socketTimeout = requestOptions.socketTimeout;
if (requestOptions.allowRedirects != null) {
this._allowRedirects = requestOptions.allowRedirects;
}
if (requestOptions.allowRedirectDowngrade != null) {
this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade;
}
if (requestOptions.maxRedirects != null) {
this._maxRedirects = Math.max(requestOptions.maxRedirects, 0);
}
if (requestOptions.keepAlive != null) {
this._keepAlive = requestOptions.keepAlive;
}
if (requestOptions.allowRetries != null) {
this._allowRetries = requestOptions.allowRetries;
}
if (requestOptions.maxRetries != null) {
this._maxRetries = requestOptions.maxRetries;
}
}
}
options(requestUrl, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('OPTIONS', requestUrl, null, additionalHeaders || {});
});
}
get(requestUrl, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('GET', requestUrl, null, additionalHeaders || {});
});
}
del(requestUrl, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('DELETE', requestUrl, null, additionalHeaders || {});
});
}
post(requestUrl, data, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('POST', requestUrl, data, additionalHeaders || {});
});
}
patch(requestUrl, data, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('PATCH', requestUrl, data, additionalHeaders || {});
});
}
put(requestUrl, data, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('PUT', requestUrl, data, additionalHeaders || {});
});
}
head(requestUrl, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request('HEAD', requestUrl, null, additionalHeaders || {});
});
}
sendStream(verb, requestUrl, stream, additionalHeaders) {
return __awaiter(this, void 0, void 0, function* () {
return this.request(verb, requestUrl, stream, additionalHeaders);
});
}
/**
* Gets a typed object from an endpoint
* Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise
*/
getJson(requestUrl, additionalHeaders = {}) {
return __awaiter(this, void 0, void 0, function* () {
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
const res = yield this.get(requestUrl, additionalHeaders);
return this._processResponse(res, this.requestOptions);
});
}
postJson(requestUrl, obj, additionalHeaders = {}) {
return __awaiter(this, void 0, void 0, function* () {
const data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
const res = yield this.post(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
});
}
putJson(requestUrl, obj, additionalHeaders = {}) {
return __awaiter(this, void 0, void 0, function* () {
const data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
const res = yield this.put(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
});
}
patchJson(requestUrl, obj, additionalHeaders = {}) {
return __awaiter(this, void 0, void 0, function* () {
const data = JSON.stringify(obj, null, 2);
additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson);
additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson);
const res = yield this.patch(requestUrl, data, additionalHeaders);
return this._processResponse(res, this.requestOptions);
});
}
/**
* Makes a raw http request.
* All other methods such as get, post, patch, and request ultimately call this.
* Prefer get, del, post and patch
*/
request(verb, requestUrl, data, headers) {
return __awaiter(this, void 0, void 0, function* () {
if (this._disposed) {
throw new Error('Client has already been disposed.');
}
const parsedUrl = new URL(requestUrl);
let info = this._prepareRequest(verb, parsedUrl, headers);
// Only perform retries on reads since writes may not be idempotent.
const maxTries = this._allowRetries && RetryableHttpVerbs.includes(verb)
? this._maxRetries + 1
: 1;
let numTries = 0;
let response;
do {
response = yield this.requestRaw(info, data);
// Check if it's an authentication challenge
if (response &&
response.message &&
response.message.statusCode === HttpCodes.Unauthorized) {
let authenticationHandler;
for (const handler of this.handlers) {
if (handler.canHandleAuthentication(response)) {
authenticationHandler = handler;
break;
}
}
if (authenticationHandler) {
return authenticationHandler.handleAuthentication(this, info, data);
}
else {
// We have received an unauthorized response but have no handlers to handle it.
// Let the response return to the caller.
return response;
}
}
let redirectsRemaining = this._maxRedirects;
while (response.message.statusCode &&
HttpRedirectCodes.includes(response.message.statusCode) &&
this._allowRedirects &&
redirectsRemaining > 0) {
const redirectUrl = response.message.headers['location'];
if (!redirectUrl) {
// if there's no location to redirect to, we won't
break;
}
const parsedRedirectUrl = new URL(redirectUrl);
if (parsedUrl.protocol === 'https:' &&
parsedUrl.protocol !== parsedRedirectUrl.protocol &&
!this._allowRedirectDowngrade) {
throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.');
}
// we need to finish reading the response before reassigning response
// which will leak the open socket.
yield response.readBody();
// strip authorization header if redirected to a different hostname
if (parsedRedirectUrl.hostname !== parsedUrl.hostname) {
for (const header in headers) {
// header names are case insensitive
if (header.toLowerCase() === 'authorization') {
delete headers[header];
}
}
}
// let's make the request with the new redirectUrl
info = this._prepareRequest(verb, parsedRedirectUrl, headers);
response = yield this.requestRaw(info, data);
redirectsRemaining--;
}
if (!response.message.statusCode ||
!HttpResponseRetryCodes.includes(response.message.statusCode)) {
// If not a retry code, return immediately instead of retrying
return response;
}
numTries += 1;
if (numTries < maxTries) {
yield response.readBody();
yield this._performExponentialBackoff(numTries);
}
} while (numTries < maxTries);
return response;
});
}
/**
* Needs to be called if keepAlive is set to true in request options.
*/
dispose() {
if (this._agent) {
this._agent.destroy();
}
this._disposed = true;
}
/**
* Raw request.
* @param info
* @param data
*/
requestRaw(info, data) {
return __awaiter(this, void 0, void 0, function* () {
return new Promise((resolve, reject) => {
function callbackForResult(err, res) {
if (err) {
reject(err);
}
else if (!res) {
// If `err` is not passed, then `res` must be passed.
reject(new Error('Unknown error'));
}
else {
resolve(res);
}
}
this.requestRawWithCallback(info, data, callbackForResult);
});
});
}
/**
* Raw request with callback.
* @param info
* @param data
* @param onResult
*/
requestRawWithCallback(info, data, onResult) {
if (typeof data === 'string') {
if (!info.options.headers) {
info.options.headers = {};
}
info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8');
}
let callbackCalled = false;
function handleResult(err, res) {
if (!callbackCalled) {
callbackCalled = true;
onResult(err, res);
}
}
const req = info.httpModule.request(info.options, (msg) => {
const res = new HttpClientResponse(msg);
handleResult(undefined, res);
});
let socket;
req.on('socket', sock => {
socket = sock;
});
// If we ever get disconnected, we want the socket to timeout eventually
req.setTimeout(this._socketTimeout || 3 * 60000, () => {
if (socket) {
socket.end();
}
handleResult(new Error(`Request timeout: ${info.options.path}`));
});
req.on('error', function (err) {
// err has statusCode property
// res should have headers
handleResult(err);
});
if (data && typeof data === 'string') {
req.write(data, 'utf8');
}
if (data && typeof data !== 'string') {
data.on('close', function () {
req.end();
});
data.pipe(req);
}
else {
req.end();
}
}
/**
* Gets an http agent. This function is useful when you need an http agent that handles
* routing through a proxy server - depending upon the url and proxy environment variables.
* @param serverUrl The server URL where the request will be sent. For example, https://api.github.com
*/
getAgent(serverUrl) {
const parsedUrl = new URL(serverUrl);
return this._getAgent(parsedUrl);
}
_prepareRequest(method, requestUrl, headers) {
const info = {};
info.parsedUrl = requestUrl;
const usingSsl = info.parsedUrl.protocol === 'https:';
info.httpModule = usingSsl ? https : http;
const defaultPort = usingSsl ? 443 : 80;
info.options = {};
info.options.host = info.parsedUrl.hostname;
info.options.port = info.parsedUrl.port
? parseInt(info.parsedUrl.port)
: defaultPort;
info.options.path =
(info.parsedUrl.pathname || '') + (info.parsedUrl.search || '');
info.options.method = method;
info.options.headers = this._mergeHeaders(headers);
if (this.userAgent != null) {
info.options.headers['user-agent'] = this.userAgent;
}
info.options.agent = this._getAgent(info.parsedUrl);
// gives handlers an opportunity to participate
if (this.handlers) {
for (const handler of this.handlers) {
handler.prepareRequest(info.options);
}
}
return info;
}
_mergeHeaders(headers) {
if (this.requestOptions && this.requestOptions.headers) {
return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers || {}));
}
return lowercaseKeys(headers || {});
}
_getExistingOrDefaultHeader(additionalHeaders, header, _default) {
let clientHeader;
if (this.requestOptions && this.requestOptions.headers) {
clientHeader = lowercaseKeys(this.requestOptions.headers)[header];
}
return additionalHeaders[header] || clientHeader || _default;
}
_getAgent(parsedUrl) {
let agent;
const proxyUrl = pm.getProxyUrl(parsedUrl);
const useProxy = proxyUrl && proxyUrl.hostname;
if (this._keepAlive && useProxy) {
agent = this._proxyAgent;
}
if (this._keepAlive && !useProxy) {
agent = this._agent;
}
// if agent is already assigned use that agent.
if (agent) {
return agent;
}
const usingSsl = parsedUrl.protocol === 'https:';
let maxSockets = 100;
if (this.requestOptions) {
maxSockets = this.requestOptions.maxSockets || http.globalAgent.maxSockets;
}
// This is `useProxy` again, but we need to check `proxyURl` directly for TypeScripts's flow analysis.
if (proxyUrl && proxyUrl.hostname) {
const agentOptions = {
maxSockets,
keepAlive: this._keepAlive,
proxy: Object.assign(Object.assign({}, ((proxyUrl.username || proxyUrl.password) && {
proxyAuth: `${proxyUrl.username}:${proxyUrl.password}`
})), { host: proxyUrl.hostname, port: proxyUrl.port })
};
let tunnelAgent;
const overHttps = proxyUrl.protocol === 'https:';
if (usingSsl) {
tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp;
}
else {
tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp;
}
agent = tunnelAgent(agentOptions);
this._proxyAgent = agent;
}
// if reusing agent across request and tunneling agent isn't assigned create a new agent
if (this._keepAlive && !agent) {
const options = { keepAlive: this._keepAlive, maxSockets };
agent = usingSsl ? new https.Agent(options) : new http.Agent(options);
this._agent = agent;
}
// if not using private agent and tunnel agent isn't setup then use global agent
if (!agent) {
agent = usingSsl ? https.globalAgent : http.globalAgent;
}
if (usingSsl && this._ignoreSslError) {
// we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process
// http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options
// we have to cast it to any and change it directly
agent.options = Object.assign(agent.options || {}, {
rejectUnauthorized: false
});
}
return agent;
}
_performExponentialBackoff(retryNumber) {
return __awaiter(this, void 0, void 0, function* () {
retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber);
const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber);
return new Promise(resolve => setTimeout(() => resolve(), ms));
});
}
_processResponse(res, options) {
return __awaiter(this, void 0, void 0, function* () {
return new Promise((resolve, reject) => __awaiter(this, void 0, void 0, function* () {
const statusCode = res.message.statusCode || 0;
const response = {
statusCode,
result: null,
headers: {}
};
// not found leads to null obj returned
if (statusCode === HttpCodes.NotFound) {
resolve(response);
}
// get the result from the body
function dateTimeDeserializer(key, value) {
if (typeof value === 'string') {
const a = new Date(value);
if (!isNaN(a.valueOf())) {
return a;
}
}
return value;
}
let obj;
let contents;
try {
contents = yield res.readBody();
if (contents && contents.length > 0) {
if (options && options.deserializeDates) {
obj = JSON.parse(contents, dateTimeDeserializer);
}
else {
obj = JSON.parse(contents);
}
response.result = obj;
}
response.headers = res.message.headers;
}
catch (err) {
// Invalid resource (contents not json); leaving result obj null
}
// note that 3xx redirects are handled by the http layer.
if (statusCode > 299) {
let msg;
// if exception/error in body, attempt to get better error
if (obj && obj.message) {
msg = obj.message;
}
else if (contents && contents.length > 0) {
// it may be the case that the exception is in the body message as string
msg = contents;
}
else {
msg = `Failed request: (${statusCode})`;
}
const err = new HttpClientError(msg, statusCode);
err.result = response.result;
reject(err);
}
else {
resolve(response);
}
}));
});
}
}
exports.HttpClient = HttpClient;
const lowercaseKeys = (obj) => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {});
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 19835:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.checkBypass = exports.getProxyUrl = void 0;
function getProxyUrl(reqUrl) {
const usingSsl = reqUrl.protocol === 'https:';
if (checkBypass(reqUrl)) {
return undefined;
}
const proxyVar = (() => {
if (usingSsl) {
return process.env['https_proxy'] || process.env['HTTPS_PROXY'];
}
else {
return process.env['http_proxy'] || process.env['HTTP_PROXY'];
}
})();
if (proxyVar) {
try {
return new URL(proxyVar);
}
catch (_a) {
if (!proxyVar.startsWith('http://') && !proxyVar.startsWith('https://'))
return new URL(`http://${proxyVar}`);
}
}
else {
return undefined;
}
}
exports.getProxyUrl = getProxyUrl;
function checkBypass(reqUrl) {
if (!reqUrl.hostname) {
return false;
}
const reqHost = reqUrl.hostname;
if (isLoopbackAddress(reqHost)) {
return true;
}
const noProxy = process.env['no_proxy'] || process.env['NO_PROXY'] || '';
if (!noProxy) {
return false;
}
// Determine the request port
let reqPort;
if (reqUrl.port) {
reqPort = Number(reqUrl.port);
}
else if (reqUrl.protocol === 'http:') {
reqPort = 80;
}
else if (reqUrl.protocol === 'https:') {
reqPort = 443;
}
// Format the request hostname and hostname with port
const upperReqHosts = [reqUrl.hostname.toUpperCase()];
if (typeof reqPort === 'number') {
upperReqHosts.push(`${upperReqHosts[0]}:${reqPort}`);
}
// Compare request host against noproxy
for (const upperNoProxyItem of noProxy
.split(',')
.map(x => x.trim().toUpperCase())
.filter(x => x)) {
if (upperNoProxyItem === '*' ||
upperReqHosts.some(x => x === upperNoProxyItem ||
x.endsWith(`.${upperNoProxyItem}`) ||
(upperNoProxyItem.startsWith('.') &&
x.endsWith(`${upperNoProxyItem}`)))) {
return true;
}
}
return false;
}
exports.checkBypass = checkBypass;
function isLoopbackAddress(host) {
const hostLower = host.toLowerCase();
return (hostLower === 'localhost' ||
hostLower.startsWith('127.') ||
hostLower.startsWith('[::1]') ||
hostLower.startsWith('[0:0:0:0:0:0:0:1]'));
}
//# sourceMappingURL=proxy.js.map
/***/ }),
/***/ 32374:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AwsCrc32 = void 0;
var tslib_1 = __nccwpck_require__(5066);
var util_1 = __nccwpck_require__(41236);
var index_1 = __nccwpck_require__(47327);
var AwsCrc32 = /** @class */ (function () {
function AwsCrc32() {
this.crc32 = new index_1.Crc32();
}
AwsCrc32.prototype.update = function (toHash) {
if ((0, util_1.isEmptyData)(toHash))
return;
this.crc32.update((0, util_1.convertToBuffer)(toHash));
};
AwsCrc32.prototype.digest = function () {
return tslib_1.__awaiter(this, void 0, void 0, function () {
return tslib_1.__generator(this, function (_a) {
return [2 /*return*/, (0, util_1.numToUint8)(this.crc32.digest())];
});
});
};
AwsCrc32.prototype.reset = function () {
this.crc32 = new index_1.Crc32();
};
return AwsCrc32;
}());
exports.AwsCrc32 = AwsCrc32;
//# sourceMappingURL=aws_crc32.js.map
/***/ }),
/***/ 47327:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AwsCrc32 = exports.Crc32 = exports.crc32 = void 0;
var tslib_1 = __nccwpck_require__(5066);
var util_1 = __nccwpck_require__(41236);
function crc32(data) {
return new Crc32().update(data).digest();
}
exports.crc32 = crc32;
var Crc32 = /** @class */ (function () {
function Crc32() {
this.checksum = 0xffffffff;
}
Crc32.prototype.update = function (data) {
var e_1, _a;
try {
for (var data_1 = tslib_1.__values(data), data_1_1 = data_1.next(); !data_1_1.done; data_1_1 = data_1.next()) {
var byte = data_1_1.value;
this.checksum =
(this.checksum >>> 8) ^ lookupTable[(this.checksum ^ byte) & 0xff];
}
}
catch (e_1_1) { e_1 = { error: e_1_1 }; }
finally {
try {
if (data_1_1 && !data_1_1.done && (_a = data_1.return)) _a.call(data_1);
}
finally { if (e_1) throw e_1.error; }
}
return this;
};
Crc32.prototype.digest = function () {
return (this.checksum ^ 0xffffffff) >>> 0;
};
return Crc32;
}());
exports.Crc32 = Crc32;
// prettier-ignore
var a_lookUpTable = [
0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA,
0x076DC419, 0x706AF48F, 0xE963A535, 0x9E6495A3,
0x0EDB8832, 0x79DCB8A4, 0xE0D5E91E, 0x97D2D988,
0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, 0x90BF1D91,
0x1DB71064, 0x6AB020F2, 0xF3B97148, 0x84BE41DE,
0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7,
0x136C9856, 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC,
0x14015C4F, 0x63066CD9, 0xFA0F3D63, 0x8D080DF5,
0x3B6E20C8, 0x4C69105E, 0xD56041E4, 0xA2677172,
0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B,
0x35B5A8FA, 0x42B2986C, 0xDBBBC9D6, 0xACBCF940,
0x32D86CE3, 0x45DF5C75, 0xDCD60DCF, 0xABD13D59,
0x26D930AC, 0x51DE003A, 0xC8D75180, 0xBFD06116,
0x21B4F4B5, 0x56B3C423, 0xCFBA9599, 0xB8BDA50F,
0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924,
0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D,
0x76DC4190, 0x01DB7106, 0x98D220BC, 0xEFD5102A,
0x71B18589, 0x06B6B51F, 0x9FBFE4A5, 0xE8B8D433,
0x7807C9A2, 0x0F00F934, 0x9609A88E, 0xE10E9818,
0x7F6A0DBB, 0x086D3D2D, 0x91646C97, 0xE6635C01,
0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E,
0x6C0695ED, 0x1B01A57B, 0x8208F4C1, 0xF50FC457,
0x65B0D9C6, 0x12B7E950, 0x8BBEB8EA, 0xFCB9887C,
0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, 0xFBD44C65,
0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2,
0x4ADFA541, 0x3DD895D7, 0xA4D1C46D, 0xD3D6F4FB,
0x4369E96A, 0x346ED9FC, 0xAD678846, 0xDA60B8D0,
0x44042D73, 0x33031DE5, 0xAA0A4C5F, 0xDD0D7CC9,
0x5005713C, 0x270241AA, 0xBE0B1010, 0xC90C2086,
0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F,
0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4,
0x59B33D17, 0x2EB40D81, 0xB7BD5C3B, 0xC0BA6CAD,
0xEDB88320, 0x9ABFB3B6, 0x03B6E20C, 0x74B1D29A,
0xEAD54739, 0x9DD277AF, 0x04DB2615, 0x73DC1683,
0xE3630B12, 0x94643B84, 0x0D6D6A3E, 0x7A6A5AA8,
0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1,
0xF00F9344, 0x8708A3D2, 0x1E01F268, 0x6906C2FE,
0xF762575D, 0x806567CB, 0x196C3671, 0x6E6B06E7,
0xFED41B76, 0x89D32BE0, 0x10DA7A5A, 0x67DD4ACC,
0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5,
0xD6D6A3E8, 0xA1D1937E, 0x38D8C2C4, 0x4FDFF252,
0xD1BB67F1, 0xA6BC5767, 0x3FB506DD, 0x48B2364B,
0xD80D2BDA, 0xAF0A1B4C, 0x36034AF6, 0x41047A60,
0xDF60EFC3, 0xA867DF55, 0x316E8EEF, 0x4669BE79,
0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236,
0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F,
0xC5BA3BBE, 0xB2BD0B28, 0x2BB45A92, 0x5CB36A04,
0xC2D7FFA7, 0xB5D0CF31, 0x2CD99E8B, 0x5BDEAE1D,
0x9B64C2B0, 0xEC63F226, 0x756AA39C, 0x026D930A,
0x9C0906A9, 0xEB0E363F, 0x72076785, 0x05005713,
0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38,
0x92D28E9B, 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21,
0x86D3D2D4, 0xF1D4E242, 0x68DDB3F8, 0x1FDA836E,
0x81BE16CD, 0xF6B9265B, 0x6FB077E1, 0x18B74777,
0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C,
0x8F659EFF, 0xF862AE69, 0x616BFFD3, 0x166CCF45,
0xA00AE278, 0xD70DD2EE, 0x4E048354, 0x3903B3C2,
0xA7672661, 0xD06016F7, 0x4969474D, 0x3E6E77DB,
0xAED16A4A, 0xD9D65ADC, 0x40DF0B66, 0x37D83BF0,
0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9,
0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6,
0xBAD03605, 0xCDD70693, 0x54DE5729, 0x23D967BF,
0xB3667A2E, 0xC4614AB8, 0x5D681B02, 0x2A6F2B94,
0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, 0x2D02EF8D,
];
var lookupTable = (0, util_1.uint32ArrayFrom)(a_lookUpTable);
var aws_crc32_1 = __nccwpck_require__(32374);
Object.defineProperty(exports, "AwsCrc32", ({ enumerable: true, get: function () { return aws_crc32_1.AwsCrc32; } }));
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 5066:
/***/ ((module) => {
/*! *****************************************************************************
Copyright (c) Microsoft Corporation.
Permission to use, copy, modify, and/or distribute this software for any
purpose with or without fee is hereby granted.
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
PERFORMANCE OF THIS SOFTWARE.
***************************************************************************** */
/* global global, define, System, Reflect, Promise */
var __extends;
var __assign;
var __rest;
var __decorate;
var __param;
var __metadata;
var __awaiter;
var __generator;
var __exportStar;
var __values;
var __read;
var __spread;
var __spreadArrays;
var __await;
var __asyncGenerator;
var __asyncDelegator;
var __asyncValues;
var __makeTemplateObject;
var __importStar;
var __importDefault;
var __classPrivateFieldGet;
var __classPrivateFieldSet;
var __createBinding;
(function (factory) {
var root = typeof global === "object" ? global : typeof self === "object" ? self : typeof this === "object" ? this : {};
if (typeof define === "function" && define.amd) {
define("tslib", ["exports"], function (exports) { factory(createExporter(root, createExporter(exports))); });
}
else if ( true && typeof module.exports === "object") {
factory(createExporter(root, createExporter(module.exports)));
}
else {
factory(createExporter(root));
}
function createExporter(exports, previous) {
if (exports !== root) {
if (typeof Object.create === "function") {
Object.defineProperty(exports, "__esModule", { value: true });
}
else {
exports.__esModule = true;
}
}
return function (id, v) { return exports[id] = previous ? previous(id, v) : v; };
}
})
(function (exporter) {
var extendStatics = Object.setPrototypeOf ||
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
__extends = function (d, b) {
extendStatics(d, b);
function __() { this.constructor = d; }
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
};
__assign = Object.assign || function (t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
}
return t;
};
__rest = function (s, e) {
var t = {};
for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
t[p[i]] = s[p[i]];
}
return t;
};
__decorate = function (decorators, target, key, desc) {
var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
return c > 3 && r && Object.defineProperty(target, key, r), r;
};
__param = function (paramIndex, decorator) {
return function (target, key) { decorator(target, key, paramIndex); }
};
__metadata = function (metadataKey, metadataValue) {
if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
};
__awaiter = function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
__generator = function (thisArg, body) {
var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
function verb(n) { return function (v) { return step([n, v]); }; }
function step(op) {
if (f) throw new TypeError("Generator is already executing.");
while (_) try {
if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
if (y = 0, t) op = [op[0] & 2, t.value];
switch (op[0]) {
case 0: case 1: t = op; break;
case 4: _.label++; return { value: op[1], done: false };
case 5: _.label++; y = op[1]; op = [0]; continue;
case 7: op = _.ops.pop(); _.trys.pop(); continue;
default:
if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
if (t[2]) _.ops.pop();
_.trys.pop(); continue;
}
op = body.call(thisArg, _);
} catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
}
};
__createBinding = function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
};
__exportStar = function (m, exports) {
for (var p in m) if (p !== "default" && !exports.hasOwnProperty(p)) exports[p] = m[p];
};
__values = function (o) {
var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0;
if (m) return m.call(o);
if (o && typeof o.length === "number") return {
next: function () {
if (o && i >= o.length) o = void 0;
return { value: o && o[i++], done: !o };
}
};
throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined.");
};
__read = function (o, n) {
var m = typeof Symbol === "function" && o[Symbol.iterator];
if (!m) return o;
var i = m.call(o), r, ar = [], e;
try {
while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
}
catch (error) { e = { error: error }; }
finally {
try {
if (r && !r.done && (m = i["return"])) m.call(i);
}
finally { if (e) throw e.error; }
}
return ar;
};
__spread = function () {
for (var ar = [], i = 0; i < arguments.length; i++)
ar = ar.concat(__read(arguments[i]));
return ar;
};
__spreadArrays = function () {
for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;
for (var r = Array(s), k = 0, i = 0; i < il; i++)
for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
r[k] = a[j];
return r;
};
__await = function (v) {
return this instanceof __await ? (this.v = v, this) : new __await(v);
};
__asyncGenerator = function (thisArg, _arguments, generator) {
if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
var g = generator.apply(thisArg, _arguments || []), i, q = [];
return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
function fulfill(value) { resume("next", value); }
function reject(value) { resume("throw", value); }
function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
};
__asyncDelegator = function (o) {
var i, p;
return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
};
__asyncValues = function (o) {
if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
var m = o[Symbol.asyncIterator], i;
return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
};
__makeTemplateObject = function (cooked, raw) {
if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
return cooked;
};
__importStar = function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k];
result["default"] = mod;
return result;
};
__importDefault = function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
__classPrivateFieldGet = function (receiver, privateMap) {
if (!privateMap.has(receiver)) {
throw new TypeError("attempted to get private field on non-instance");
}
return privateMap.get(receiver);
};
__classPrivateFieldSet = function (receiver, privateMap, value) {
if (!privateMap.has(receiver)) {
throw new TypeError("attempted to set private field on non-instance");
}
privateMap.set(receiver, value);
return value;
};
exporter("__extends", __extends);
exporter("__assign", __assign);
exporter("__rest", __rest);
exporter("__decorate", __decorate);
exporter("__param", __param);
exporter("__metadata", __metadata);
exporter("__awaiter", __awaiter);
exporter("__generator", __generator);
exporter("__exportStar", __exportStar);
exporter("__createBinding", __createBinding);
exporter("__values", __values);
exporter("__read", __read);
exporter("__spread", __spread);
exporter("__spreadArrays", __spreadArrays);
exporter("__await", __await);
exporter("__asyncGenerator", __asyncGenerator);
exporter("__asyncDelegator", __asyncDelegator);
exporter("__asyncValues", __asyncValues);
exporter("__makeTemplateObject", __makeTemplateObject);
exporter("__importStar", __importStar);
exporter("__importDefault", __importDefault);
exporter("__classPrivateFieldGet", __classPrivateFieldGet);
exporter("__classPrivateFieldSet", __classPrivateFieldSet);
});
/***/ }),
/***/ 43228:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.convertToBuffer = void 0;
var util_utf8_browser_1 = __nccwpck_require__(28172);
// Quick polyfill
var fromUtf8 = typeof Buffer !== "undefined" && Buffer.from
? function (input) { return Buffer.from(input, "utf8"); }
: util_utf8_browser_1.fromUtf8;
function convertToBuffer(data) {
// Already a Uint8, do nothing
if (data instanceof Uint8Array)
return data;
if (typeof data === "string") {
return fromUtf8(data);
}
if (ArrayBuffer.isView(data)) {
return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);
}
return new Uint8Array(data);
}
exports.convertToBuffer = convertToBuffer;
//# sourceMappingURL=convertToBuffer.js.map
/***/ }),
/***/ 41236:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.uint32ArrayFrom = exports.numToUint8 = exports.isEmptyData = exports.convertToBuffer = void 0;
var convertToBuffer_1 = __nccwpck_require__(43228);
Object.defineProperty(exports, "convertToBuffer", ({ enumerable: true, get: function () { return convertToBuffer_1.convertToBuffer; } }));
var isEmptyData_1 = __nccwpck_require__(18275);
Object.defineProperty(exports, "isEmptyData", ({ enumerable: true, get: function () { return isEmptyData_1.isEmptyData; } }));
var numToUint8_1 = __nccwpck_require__(93775);
Object.defineProperty(exports, "numToUint8", ({ enumerable: true, get: function () { return numToUint8_1.numToUint8; } }));
var uint32ArrayFrom_1 = __nccwpck_require__(39404);
Object.defineProperty(exports, "uint32ArrayFrom", ({ enumerable: true, get: function () { return uint32ArrayFrom_1.uint32ArrayFrom; } }));
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 18275:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isEmptyData = void 0;
function isEmptyData(data) {
if (typeof data === "string") {
return data.length === 0;
}
return data.byteLength === 0;
}
exports.isEmptyData = isEmptyData;
//# sourceMappingURL=isEmptyData.js.map
/***/ }),
/***/ 93775:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.numToUint8 = void 0;
function numToUint8(num) {
return new Uint8Array([
(num & 0xff000000) >> 24,
(num & 0x00ff0000) >> 16,
(num & 0x0000ff00) >> 8,
num & 0x000000ff,
]);
}
exports.numToUint8 = numToUint8;
//# sourceMappingURL=numToUint8.js.map
/***/ }),
/***/ 39404:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
// Copyright Amazon.com Inc. or its affiliates. All Rights Reserved.
// SPDX-License-Identifier: Apache-2.0
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.uint32ArrayFrom = void 0;
// IE 11 does not support Array.from, so we do it manually
function uint32ArrayFrom(a_lookUpTable) {
if (!Uint32Array.from) {
var return_array = new Uint32Array(a_lookUpTable.length);
var a_index = 0;
while (a_index < a_lookUpTable.length) {
return_array[a_index] = a_lookUpTable[a_index];
a_index += 1;
}
return return_array;
}
return Uint32Array.from(a_lookUpTable);
}
exports.uint32ArrayFrom = uint32ArrayFrom;
//# sourceMappingURL=uint32ArrayFrom.js.map
/***/ }),
/***/ 69838:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SSO = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const GetRoleCredentialsCommand_1 = __nccwpck_require__(18972);
const ListAccountRolesCommand_1 = __nccwpck_require__(1513);
const ListAccountsCommand_1 = __nccwpck_require__(64296);
const LogoutCommand_1 = __nccwpck_require__(12586);
const SSOClient_1 = __nccwpck_require__(71057);
const commands = {
GetRoleCredentialsCommand: GetRoleCredentialsCommand_1.GetRoleCredentialsCommand,
ListAccountRolesCommand: ListAccountRolesCommand_1.ListAccountRolesCommand,
ListAccountsCommand: ListAccountsCommand_1.ListAccountsCommand,
LogoutCommand: LogoutCommand_1.LogoutCommand,
};
class SSO extends SSOClient_1.SSOClient {
}
exports.SSO = SSO;
(0, smithy_client_1.createAggregatedClient)(commands, SSO);
/***/ }),
/***/ 71057:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SSOClient = exports.__Client = void 0;
const middleware_host_header_1 = __nccwpck_require__(22545);
const middleware_logger_1 = __nccwpck_require__(20014);
const middleware_recursion_detection_1 = __nccwpck_require__(85525);
const middleware_user_agent_1 = __nccwpck_require__(64688);
const config_resolver_1 = __nccwpck_require__(53098);
const middleware_content_length_1 = __nccwpck_require__(82800);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_retry_1 = __nccwpck_require__(96039);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } }));
const EndpointParameters_1 = __nccwpck_require__(34214);
const runtimeConfig_1 = __nccwpck_require__(19756);
const runtimeExtensions_1 = __nccwpck_require__(63398);
class SSOClient extends smithy_client_1.Client {
constructor(...[configuration]) {
const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {});
const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0);
const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1);
const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2);
const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3);
const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4);
const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5);
const _config_7 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_6, configuration?.extensions || []);
super(_config_7);
this.config = _config_7;
this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config));
this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config));
this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config));
this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config));
this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config));
this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config));
}
destroy() {
super.destroy();
}
}
exports.SSOClient = SSOClient;
/***/ }),
/***/ 18972:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetRoleCredentialsCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(66390);
const Aws_restJson1_1 = __nccwpck_require__(98507);
class GetRoleCredentialsCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRoleCredentialsCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOClient";
const commandName = "GetRoleCredentialsCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.GetRoleCredentialsRequestFilterSensitiveLog,
outputFilterSensitiveLog: models_0_1.GetRoleCredentialsResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "SWBPortalService",
operation: "GetRoleCredentials",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_restJson1_1.se_GetRoleCredentialsCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_restJson1_1.de_GetRoleCredentialsCommand)(output, context);
}
}
exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand;
/***/ }),
/***/ 1513:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ListAccountRolesCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(66390);
const Aws_restJson1_1 = __nccwpck_require__(98507);
class ListAccountRolesCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountRolesCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOClient";
const commandName = "ListAccountRolesCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.ListAccountRolesRequestFilterSensitiveLog,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "SWBPortalService",
operation: "ListAccountRoles",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_restJson1_1.se_ListAccountRolesCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_restJson1_1.de_ListAccountRolesCommand)(output, context);
}
}
exports.ListAccountRolesCommand = ListAccountRolesCommand;
/***/ }),
/***/ 64296:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ListAccountsCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(66390);
const Aws_restJson1_1 = __nccwpck_require__(98507);
class ListAccountsCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountsCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOClient";
const commandName = "ListAccountsCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.ListAccountsRequestFilterSensitiveLog,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "SWBPortalService",
operation: "ListAccounts",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_restJson1_1.se_ListAccountsCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_restJson1_1.de_ListAccountsCommand)(output, context);
}
}
exports.ListAccountsCommand = ListAccountsCommand;
/***/ }),
/***/ 12586:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.LogoutCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(66390);
const Aws_restJson1_1 = __nccwpck_require__(98507);
class LogoutCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, LogoutCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOClient";
const commandName = "LogoutCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.LogoutRequestFilterSensitiveLog,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "SWBPortalService",
operation: "Logout",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_restJson1_1.se_LogoutCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_restJson1_1.de_LogoutCommand)(output, context);
}
}
exports.LogoutCommand = LogoutCommand;
/***/ }),
/***/ 65706:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(18972), exports);
tslib_1.__exportStar(__nccwpck_require__(1513), exports);
tslib_1.__exportStar(__nccwpck_require__(64296), exports);
tslib_1.__exportStar(__nccwpck_require__(12586), exports);
/***/ }),
/***/ 34214:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveClientEndpointParameters = void 0;
const resolveClientEndpointParameters = (options) => {
return {
...options,
useDualstackEndpoint: options.useDualstackEndpoint ?? false,
useFipsEndpoint: options.useFipsEndpoint ?? false,
defaultSigningName: "awsssoportal",
};
};
exports.resolveClientEndpointParameters = resolveClientEndpointParameters;
/***/ }),
/***/ 30898:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultEndpointResolver = void 0;
const util_endpoints_1 = __nccwpck_require__(45473);
const ruleset_1 = __nccwpck_require__(13341);
const defaultEndpointResolver = (endpointParams, context = {}) => {
return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, {
endpointParams: endpointParams,
logger: context.logger,
});
};
exports.defaultEndpointResolver = defaultEndpointResolver;
/***/ }),
/***/ 13341:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ruleSet = void 0;
const u = "required", v = "fn", w = "argv", x = "ref";
const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }];
const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] };
exports.ruleSet = _data;
/***/ }),
/***/ 82666:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SSOServiceException = void 0;
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(71057), exports);
tslib_1.__exportStar(__nccwpck_require__(69838), exports);
tslib_1.__exportStar(__nccwpck_require__(65706), exports);
tslib_1.__exportStar(__nccwpck_require__(36773), exports);
tslib_1.__exportStar(__nccwpck_require__(14952), exports);
__nccwpck_require__(13350);
var SSOServiceException_1 = __nccwpck_require__(81517);
Object.defineProperty(exports, "SSOServiceException", ({ enumerable: true, get: function () { return SSOServiceException_1.SSOServiceException; } }));
/***/ }),
/***/ 81517:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SSOServiceException = exports.__ServiceException = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } }));
class SSOServiceException extends smithy_client_1.ServiceException {
constructor(options) {
super(options);
Object.setPrototypeOf(this, SSOServiceException.prototype);
}
}
exports.SSOServiceException = SSOServiceException;
/***/ }),
/***/ 14952:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(66390), exports);
/***/ }),
/***/ 66390:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.LogoutRequestFilterSensitiveLog = exports.ListAccountsRequestFilterSensitiveLog = exports.ListAccountRolesRequestFilterSensitiveLog = exports.GetRoleCredentialsResponseFilterSensitiveLog = exports.RoleCredentialsFilterSensitiveLog = exports.GetRoleCredentialsRequestFilterSensitiveLog = exports.UnauthorizedException = exports.TooManyRequestsException = exports.ResourceNotFoundException = exports.InvalidRequestException = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const SSOServiceException_1 = __nccwpck_require__(81517);
class InvalidRequestException extends SSOServiceException_1.SSOServiceException {
constructor(opts) {
super({
name: "InvalidRequestException",
$fault: "client",
...opts,
});
this.name = "InvalidRequestException";
this.$fault = "client";
Object.setPrototypeOf(this, InvalidRequestException.prototype);
}
}
exports.InvalidRequestException = InvalidRequestException;
class ResourceNotFoundException extends SSOServiceException_1.SSOServiceException {
constructor(opts) {
super({
name: "ResourceNotFoundException",
$fault: "client",
...opts,
});
this.name = "ResourceNotFoundException";
this.$fault = "client";
Object.setPrototypeOf(this, ResourceNotFoundException.prototype);
}
}
exports.ResourceNotFoundException = ResourceNotFoundException;
class TooManyRequestsException extends SSOServiceException_1.SSOServiceException {
constructor(opts) {
super({
name: "TooManyRequestsException",
$fault: "client",
...opts,
});
this.name = "TooManyRequestsException";
this.$fault = "client";
Object.setPrototypeOf(this, TooManyRequestsException.prototype);
}
}
exports.TooManyRequestsException = TooManyRequestsException;
class UnauthorizedException extends SSOServiceException_1.SSOServiceException {
constructor(opts) {
super({
name: "UnauthorizedException",
$fault: "client",
...opts,
});
this.name = "UnauthorizedException";
this.$fault = "client";
Object.setPrototypeOf(this, UnauthorizedException.prototype);
}
}
exports.UnauthorizedException = UnauthorizedException;
const GetRoleCredentialsRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.GetRoleCredentialsRequestFilterSensitiveLog = GetRoleCredentialsRequestFilterSensitiveLog;
const RoleCredentialsFilterSensitiveLog = (obj) => ({
...obj,
...(obj.secretAccessKey && { secretAccessKey: smithy_client_1.SENSITIVE_STRING }),
...(obj.sessionToken && { sessionToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.RoleCredentialsFilterSensitiveLog = RoleCredentialsFilterSensitiveLog;
const GetRoleCredentialsResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.roleCredentials && { roleCredentials: (0, exports.RoleCredentialsFilterSensitiveLog)(obj.roleCredentials) }),
});
exports.GetRoleCredentialsResponseFilterSensitiveLog = GetRoleCredentialsResponseFilterSensitiveLog;
const ListAccountRolesRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.ListAccountRolesRequestFilterSensitiveLog = ListAccountRolesRequestFilterSensitiveLog;
const ListAccountsRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.ListAccountsRequestFilterSensitiveLog = ListAccountsRequestFilterSensitiveLog;
const LogoutRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.LogoutRequestFilterSensitiveLog = LogoutRequestFilterSensitiveLog;
/***/ }),
/***/ 80849:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 88460:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.paginateListAccountRoles = void 0;
const ListAccountRolesCommand_1 = __nccwpck_require__(1513);
const SSOClient_1 = __nccwpck_require__(71057);
const makePagedClientRequest = async (client, input, ...args) => {
return await client.send(new ListAccountRolesCommand_1.ListAccountRolesCommand(input), ...args);
};
async function* paginateListAccountRoles(config, input, ...additionalArguments) {
let token = config.startingToken || undefined;
let hasNext = true;
let page;
while (hasNext) {
input.nextToken = token;
input["maxResults"] = config.pageSize;
if (config.client instanceof SSOClient_1.SSOClient) {
page = await makePagedClientRequest(config.client, input, ...additionalArguments);
}
else {
throw new Error("Invalid client, expected SSO | SSOClient");
}
yield page;
const prevToken = token;
token = page.nextToken;
hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken));
}
return undefined;
}
exports.paginateListAccountRoles = paginateListAccountRoles;
/***/ }),
/***/ 50938:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.paginateListAccounts = void 0;
const ListAccountsCommand_1 = __nccwpck_require__(64296);
const SSOClient_1 = __nccwpck_require__(71057);
const makePagedClientRequest = async (client, input, ...args) => {
return await client.send(new ListAccountsCommand_1.ListAccountsCommand(input), ...args);
};
async function* paginateListAccounts(config, input, ...additionalArguments) {
let token = config.startingToken || undefined;
let hasNext = true;
let page;
while (hasNext) {
input.nextToken = token;
input["maxResults"] = config.pageSize;
if (config.client instanceof SSOClient_1.SSOClient) {
page = await makePagedClientRequest(config.client, input, ...additionalArguments);
}
else {
throw new Error("Invalid client, expected SSO | SSOClient");
}
yield page;
const prevToken = token;
token = page.nextToken;
hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken));
}
return undefined;
}
exports.paginateListAccounts = paginateListAccounts;
/***/ }),
/***/ 36773:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(80849), exports);
tslib_1.__exportStar(__nccwpck_require__(88460), exports);
tslib_1.__exportStar(__nccwpck_require__(50938), exports);
/***/ }),
/***/ 98507:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.de_LogoutCommand = exports.de_ListAccountsCommand = exports.de_ListAccountRolesCommand = exports.de_GetRoleCredentialsCommand = exports.se_LogoutCommand = exports.se_ListAccountsCommand = exports.se_ListAccountRolesCommand = exports.se_GetRoleCredentialsCommand = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const smithy_client_1 = __nccwpck_require__(63570);
const models_0_1 = __nccwpck_require__(66390);
const SSOServiceException_1 = __nccwpck_require__(81517);
const se_GetRoleCredentialsCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, {
"x-amz-sso_bearer_token": input.accessToken,
});
const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/federation/credentials";
const query = (0, smithy_client_1.map)({
role_name: [, (0, smithy_client_1.expectNonNull)(input.roleName, `roleName`)],
account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)],
});
let body;
return new protocol_http_1.HttpRequest({
protocol,
hostname,
port,
method: "GET",
headers,
path: resolvedPath,
query,
body,
});
};
exports.se_GetRoleCredentialsCommand = se_GetRoleCredentialsCommand;
const se_ListAccountRolesCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, {
"x-amz-sso_bearer_token": input.accessToken,
});
const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/roles";
const query = (0, smithy_client_1.map)({
next_token: [, input.nextToken],
max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()],
account_id: [, (0, smithy_client_1.expectNonNull)(input.accountId, `accountId`)],
});
let body;
return new protocol_http_1.HttpRequest({
protocol,
hostname,
port,
method: "GET",
headers,
path: resolvedPath,
query,
body,
});
};
exports.se_ListAccountRolesCommand = se_ListAccountRolesCommand;
const se_ListAccountsCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, {
"x-amz-sso_bearer_token": input.accessToken,
});
const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/accounts";
const query = (0, smithy_client_1.map)({
next_token: [, input.nextToken],
max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()],
});
let body;
return new protocol_http_1.HttpRequest({
protocol,
hostname,
port,
method: "GET",
headers,
path: resolvedPath,
query,
body,
});
};
exports.se_ListAccountsCommand = se_ListAccountsCommand;
const se_LogoutCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = (0, smithy_client_1.map)({}, isSerializableHeaderValue, {
"x-amz-sso_bearer_token": input.accessToken,
});
const resolvedPath = `${basePath?.endsWith("/") ? basePath.slice(0, -1) : basePath || ""}` + "/logout";
let body;
return new protocol_http_1.HttpRequest({
protocol,
hostname,
port,
method: "POST",
headers,
path: resolvedPath,
body,
});
};
exports.se_LogoutCommand = se_LogoutCommand;
const de_GetRoleCredentialsCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_GetRoleCredentialsCommandError(output, context);
}
const contents = (0, smithy_client_1.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_1.take)(data, {
roleCredentials: smithy_client_1._json,
});
Object.assign(contents, doc);
return contents;
};
exports.de_GetRoleCredentialsCommand = de_GetRoleCredentialsCommand;
const de_GetRoleCredentialsCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InvalidRequestException":
case "com.amazonaws.sso#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "ResourceNotFoundException":
case "com.amazonaws.sso#ResourceNotFoundException":
throw await de_ResourceNotFoundExceptionRes(parsedOutput, context);
case "TooManyRequestsException":
case "com.amazonaws.sso#TooManyRequestsException":
throw await de_TooManyRequestsExceptionRes(parsedOutput, context);
case "UnauthorizedException":
case "com.amazonaws.sso#UnauthorizedException":
throw await de_UnauthorizedExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
const de_ListAccountRolesCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_ListAccountRolesCommandError(output, context);
}
const contents = (0, smithy_client_1.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_1.take)(data, {
nextToken: smithy_client_1.expectString,
roleList: smithy_client_1._json,
});
Object.assign(contents, doc);
return contents;
};
exports.de_ListAccountRolesCommand = de_ListAccountRolesCommand;
const de_ListAccountRolesCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InvalidRequestException":
case "com.amazonaws.sso#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "ResourceNotFoundException":
case "com.amazonaws.sso#ResourceNotFoundException":
throw await de_ResourceNotFoundExceptionRes(parsedOutput, context);
case "TooManyRequestsException":
case "com.amazonaws.sso#TooManyRequestsException":
throw await de_TooManyRequestsExceptionRes(parsedOutput, context);
case "UnauthorizedException":
case "com.amazonaws.sso#UnauthorizedException":
throw await de_UnauthorizedExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
const de_ListAccountsCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_ListAccountsCommandError(output, context);
}
const contents = (0, smithy_client_1.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_1.take)(data, {
accountList: smithy_client_1._json,
nextToken: smithy_client_1.expectString,
});
Object.assign(contents, doc);
return contents;
};
exports.de_ListAccountsCommand = de_ListAccountsCommand;
const de_ListAccountsCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InvalidRequestException":
case "com.amazonaws.sso#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "ResourceNotFoundException":
case "com.amazonaws.sso#ResourceNotFoundException":
throw await de_ResourceNotFoundExceptionRes(parsedOutput, context);
case "TooManyRequestsException":
case "com.amazonaws.sso#TooManyRequestsException":
throw await de_TooManyRequestsExceptionRes(parsedOutput, context);
case "UnauthorizedException":
case "com.amazonaws.sso#UnauthorizedException":
throw await de_UnauthorizedExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
const de_LogoutCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_LogoutCommandError(output, context);
}
const contents = (0, smithy_client_1.map)({
$metadata: deserializeMetadata(output),
});
await (0, smithy_client_1.collectBody)(output.body, context);
return contents;
};
exports.de_LogoutCommand = de_LogoutCommand;
const de_LogoutCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InvalidRequestException":
case "com.amazonaws.sso#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "TooManyRequestsException":
case "com.amazonaws.sso#TooManyRequestsException":
throw await de_TooManyRequestsExceptionRes(parsedOutput, context);
case "UnauthorizedException":
case "com.amazonaws.sso#UnauthorizedException":
throw await de_UnauthorizedExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
const throwDefaultError = (0, smithy_client_1.withBaseException)(SSOServiceException_1.SSOServiceException);
const de_InvalidRequestExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_1.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_1.take)(data, {
message: smithy_client_1.expectString,
});
Object.assign(contents, doc);
const exception = new models_0_1.InvalidRequestException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body);
};
const de_ResourceNotFoundExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_1.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_1.take)(data, {
message: smithy_client_1.expectString,
});
Object.assign(contents, doc);
const exception = new models_0_1.ResourceNotFoundException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body);
};
const de_TooManyRequestsExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_1.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_1.take)(data, {
message: smithy_client_1.expectString,
});
Object.assign(contents, doc);
const exception = new models_0_1.TooManyRequestsException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body);
};
const de_UnauthorizedExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_1.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_1.take)(data, {
message: smithy_client_1.expectString,
});
Object.assign(contents, doc);
const exception = new models_0_1.UnauthorizedException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body);
};
const deserializeMetadata = (output) => ({
httpStatusCode: output.statusCode,
requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
extendedRequestId: output.headers["x-amz-id-2"],
cfId: output.headers["x-amz-cf-id"],
});
const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body));
const isSerializableHeaderValue = (value) => value !== undefined &&
value !== null &&
value !== "" &&
(!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) &&
(!Object.getOwnPropertyNames(value).includes("size") || value.size != 0);
const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {
if (encoded.length) {
return JSON.parse(encoded);
}
return {};
});
const parseErrorBody = async (errorBody, context) => {
const value = await parseBody(errorBody, context);
value.message = value.message ?? value.Message;
return value;
};
const loadRestJsonErrorCode = (output, data) => {
const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase());
const sanitizeErrorCode = (rawValue) => {
let cleanValue = rawValue;
if (typeof cleanValue === "number") {
cleanValue = cleanValue.toString();
}
if (cleanValue.indexOf(",") >= 0) {
cleanValue = cleanValue.split(",")[0];
}
if (cleanValue.indexOf(":") >= 0) {
cleanValue = cleanValue.split(":")[0];
}
if (cleanValue.indexOf("#") >= 0) {
cleanValue = cleanValue.split("#")[1];
}
return cleanValue;
};
const headerKey = findKey(output.headers, "x-amzn-errortype");
if (headerKey !== undefined) {
return sanitizeErrorCode(output.headers[headerKey]);
}
if (data.code !== undefined) {
return sanitizeErrorCode(data.code);
}
if (data["__type"] !== undefined) {
return sanitizeErrorCode(data["__type"]);
}
};
/***/ }),
/***/ 19756:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRuntimeConfig = void 0;
const tslib_1 = __nccwpck_require__(4351);
const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(91092));
const core_1 = __nccwpck_require__(59963);
const util_user_agent_node_1 = __nccwpck_require__(98095);
const config_resolver_1 = __nccwpck_require__(53098);
const hash_node_1 = __nccwpck_require__(3081);
const middleware_retry_1 = __nccwpck_require__(96039);
const node_config_provider_1 = __nccwpck_require__(33461);
const node_http_handler_1 = __nccwpck_require__(20258);
const util_body_length_node_1 = __nccwpck_require__(68075);
const util_retry_1 = __nccwpck_require__(84902);
const runtimeConfig_shared_1 = __nccwpck_require__(44809);
const smithy_client_1 = __nccwpck_require__(63570);
const util_defaults_mode_node_1 = __nccwpck_require__(72429);
const smithy_client_2 = __nccwpck_require__(63570);
const getRuntimeConfig = (config) => {
(0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version);
const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode);
const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config);
(0, core_1.emitWarningIfUnsupportedVersion)(process.version);
return {
...clientSharedValues,
...config,
runtime: "node",
defaultsMode,
bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength,
defaultUserAgentProvider: config?.defaultUserAgentProvider ??
(0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }),
maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS),
region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS),
requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider),
retryMode: config?.retryMode ??
(0, node_config_provider_1.loadConfig)({
...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS,
default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
}),
sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"),
streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector,
useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS),
useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS),
};
};
exports.getRuntimeConfig = getRuntimeConfig;
/***/ }),
/***/ 44809:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRuntimeConfig = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const url_parser_1 = __nccwpck_require__(14681);
const util_base64_1 = __nccwpck_require__(75600);
const util_utf8_1 = __nccwpck_require__(41895);
const endpointResolver_1 = __nccwpck_require__(30898);
const getRuntimeConfig = (config) => {
return {
apiVersion: "2019-06-10",
base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64,
base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64,
disableHostPrefix: config?.disableHostPrefix ?? false,
endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver,
extensions: config?.extensions ?? [],
logger: config?.logger ?? new smithy_client_1.NoOpLogger(),
serviceId: config?.serviceId ?? "SSO",
urlParser: config?.urlParser ?? url_parser_1.parseUrl,
utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8,
utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8,
};
};
exports.getRuntimeConfig = getRuntimeConfig;
/***/ }),
/***/ 63398:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveRuntimeExtensions = void 0;
const region_config_resolver_1 = __nccwpck_require__(18156);
const protocol_http_1 = __nccwpck_require__(64418);
const smithy_client_1 = __nccwpck_require__(63570);
const asPartial = (t) => t;
const resolveRuntimeExtensions = (runtimeConfig, extensions) => {
const extensionConfiguration = {
...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)),
...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)),
...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)),
};
extensions.forEach((extension) => extension.configure(extensionConfiguration));
return {
...runtimeConfig,
...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration),
...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration),
...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration),
};
};
exports.resolveRuntimeExtensions = resolveRuntimeExtensions;
/***/ }),
/***/ 32605:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.STS = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const AssumeRoleCommand_1 = __nccwpck_require__(59802);
const AssumeRoleWithSAMLCommand_1 = __nccwpck_require__(72865);
const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451);
const DecodeAuthorizationMessageCommand_1 = __nccwpck_require__(74150);
const GetAccessKeyInfoCommand_1 = __nccwpck_require__(49804);
const GetCallerIdentityCommand_1 = __nccwpck_require__(24278);
const GetFederationTokenCommand_1 = __nccwpck_require__(57552);
const GetSessionTokenCommand_1 = __nccwpck_require__(43285);
const STSClient_1 = __nccwpck_require__(64195);
const commands = {
AssumeRoleCommand: AssumeRoleCommand_1.AssumeRoleCommand,
AssumeRoleWithSAMLCommand: AssumeRoleWithSAMLCommand_1.AssumeRoleWithSAMLCommand,
AssumeRoleWithWebIdentityCommand: AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand,
DecodeAuthorizationMessageCommand: DecodeAuthorizationMessageCommand_1.DecodeAuthorizationMessageCommand,
GetAccessKeyInfoCommand: GetAccessKeyInfoCommand_1.GetAccessKeyInfoCommand,
GetCallerIdentityCommand: GetCallerIdentityCommand_1.GetCallerIdentityCommand,
GetFederationTokenCommand: GetFederationTokenCommand_1.GetFederationTokenCommand,
GetSessionTokenCommand: GetSessionTokenCommand_1.GetSessionTokenCommand,
};
class STS extends STSClient_1.STSClient {
}
exports.STS = STS;
(0, smithy_client_1.createAggregatedClient)(commands, STS);
/***/ }),
/***/ 64195:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.STSClient = exports.__Client = void 0;
const middleware_host_header_1 = __nccwpck_require__(22545);
const middleware_logger_1 = __nccwpck_require__(20014);
const middleware_recursion_detection_1 = __nccwpck_require__(85525);
const middleware_sdk_sts_1 = __nccwpck_require__(55959);
const middleware_user_agent_1 = __nccwpck_require__(64688);
const config_resolver_1 = __nccwpck_require__(53098);
const middleware_content_length_1 = __nccwpck_require__(82800);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_retry_1 = __nccwpck_require__(96039);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } }));
const EndpointParameters_1 = __nccwpck_require__(20510);
const runtimeConfig_1 = __nccwpck_require__(83405);
const runtimeExtensions_1 = __nccwpck_require__(32053);
class STSClient extends smithy_client_1.Client {
constructor(...[configuration]) {
const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {});
const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0);
const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1);
const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2);
const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3);
const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4);
const _config_6 = (0, middleware_sdk_sts_1.resolveStsAuthConfig)(_config_5, { stsClientCtor: STSClient });
const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6);
const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []);
super(_config_8);
this.config = _config_8;
this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config));
this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config));
this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config));
this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config));
this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config));
this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config));
}
destroy() {
super.destroy();
}
}
exports.STSClient = STSClient;
/***/ }),
/***/ 59802:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AssumeRoleCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(21780);
const Aws_query_1 = __nccwpck_require__(10740);
class AssumeRoleCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "AssumeRoleCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: models_0_1.AssumeRoleResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "AssumeRole",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_AssumeRoleCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_AssumeRoleCommand)(output, context);
}
}
exports.AssumeRoleCommand = AssumeRoleCommand;
/***/ }),
/***/ 72865:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AssumeRoleWithSAMLCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(21780);
const Aws_query_1 = __nccwpck_require__(10740);
class AssumeRoleWithSAMLCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithSAMLCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "AssumeRoleWithSAMLCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLRequestFilterSensitiveLog,
outputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "AssumeRoleWithSAML",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_AssumeRoleWithSAMLCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_AssumeRoleWithSAMLCommand)(output, context);
}
}
exports.AssumeRoleWithSAMLCommand = AssumeRoleWithSAMLCommand;
/***/ }),
/***/ 37451:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AssumeRoleWithWebIdentityCommand = exports.$Command = void 0;
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(21780);
const Aws_query_1 = __nccwpck_require__(10740);
class AssumeRoleWithWebIdentityCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithWebIdentityCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "AssumeRoleWithWebIdentityCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityRequestFilterSensitiveLog,
outputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "AssumeRoleWithWebIdentity",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_AssumeRoleWithWebIdentityCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_AssumeRoleWithWebIdentityCommand)(output, context);
}
}
exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand;
/***/ }),
/***/ 74150:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.DecodeAuthorizationMessageCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const Aws_query_1 = __nccwpck_require__(10740);
class DecodeAuthorizationMessageCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DecodeAuthorizationMessageCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "DecodeAuthorizationMessageCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "DecodeAuthorizationMessage",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_DecodeAuthorizationMessageCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_DecodeAuthorizationMessageCommand)(output, context);
}
}
exports.DecodeAuthorizationMessageCommand = DecodeAuthorizationMessageCommand;
/***/ }),
/***/ 49804:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetAccessKeyInfoCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const Aws_query_1 = __nccwpck_require__(10740);
class GetAccessKeyInfoCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAccessKeyInfoCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "GetAccessKeyInfoCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "GetAccessKeyInfo",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_GetAccessKeyInfoCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_GetAccessKeyInfoCommand)(output, context);
}
}
exports.GetAccessKeyInfoCommand = GetAccessKeyInfoCommand;
/***/ }),
/***/ 24278:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetCallerIdentityCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const Aws_query_1 = __nccwpck_require__(10740);
class GetCallerIdentityCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetCallerIdentityCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "GetCallerIdentityCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "GetCallerIdentity",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_GetCallerIdentityCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_GetCallerIdentityCommand)(output, context);
}
}
exports.GetCallerIdentityCommand = GetCallerIdentityCommand;
/***/ }),
/***/ 57552:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetFederationTokenCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(21780);
const Aws_query_1 = __nccwpck_require__(10740);
class GetFederationTokenCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetFederationTokenCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "GetFederationTokenCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: models_0_1.GetFederationTokenResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "GetFederationToken",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_GetFederationTokenCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_GetFederationTokenCommand)(output, context);
}
}
exports.GetFederationTokenCommand = GetFederationTokenCommand;
/***/ }),
/***/ 43285:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetSessionTokenCommand = exports.$Command = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "$Command", ({ enumerable: true, get: function () { return smithy_client_1.Command; } }));
const types_1 = __nccwpck_require__(55756);
const models_0_1 = __nccwpck_require__(21780);
const Aws_query_1 = __nccwpck_require__(10740);
class GetSessionTokenCommand extends smithy_client_1.Command {
static getEndpointParameterInstructions() {
return {
UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" },
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
constructor(input) {
super();
this.input = input;
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetSessionTokenCommand.getEndpointParameterInstructions()));
this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "STSClient";
const commandName = "GetSessionTokenCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: models_0_1.GetSessionTokenResponseFilterSensitiveLog,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSecurityTokenServiceV20110615",
operation: "GetSessionToken",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return (0, Aws_query_1.se_GetSessionTokenCommand)(input, context);
}
deserialize(output, context) {
return (0, Aws_query_1.de_GetSessionTokenCommand)(output, context);
}
}
exports.GetSessionTokenCommand = GetSessionTokenCommand;
/***/ }),
/***/ 55716:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(59802), exports);
tslib_1.__exportStar(__nccwpck_require__(72865), exports);
tslib_1.__exportStar(__nccwpck_require__(37451), exports);
tslib_1.__exportStar(__nccwpck_require__(74150), exports);
tslib_1.__exportStar(__nccwpck_require__(49804), exports);
tslib_1.__exportStar(__nccwpck_require__(24278), exports);
tslib_1.__exportStar(__nccwpck_require__(57552), exports);
tslib_1.__exportStar(__nccwpck_require__(43285), exports);
/***/ }),
/***/ 88028:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0;
const defaultStsRoleAssumers_1 = __nccwpck_require__(90048);
const STSClient_1 = __nccwpck_require__(64195);
const getCustomizableStsClientCtor = (baseCtor, customizations) => {
if (!customizations)
return baseCtor;
else
return class CustomizableSTSClient extends baseCtor {
constructor(config) {
super(config);
for (const customization of customizations) {
this.middlewareStack.use(customization);
}
}
};
};
const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumer)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins));
exports.getDefaultRoleAssumer = getDefaultRoleAssumer;
const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumerWithWebIdentity)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins));
exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity;
const decorateDefaultCredentialProvider = (provider) => (input) => provider({
roleAssumer: (0, exports.getDefaultRoleAssumer)(input),
roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input),
...input,
});
exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider;
/***/ }),
/***/ 90048:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0;
const AssumeRoleCommand_1 = __nccwpck_require__(59802);
const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(37451);
const ASSUME_ROLE_DEFAULT_REGION = "us-east-1";
const decorateDefaultRegion = (region) => {
if (typeof region !== "function") {
return region === undefined ? ASSUME_ROLE_DEFAULT_REGION : region;
}
return async () => {
try {
return await region();
}
catch (e) {
return ASSUME_ROLE_DEFAULT_REGION;
}
};
};
const getDefaultRoleAssumer = (stsOptions, stsClientCtor) => {
let stsClient;
let closureSourceCreds;
return async (sourceCreds, params) => {
closureSourceCreds = sourceCreds;
if (!stsClient) {
const { logger, region, requestHandler } = stsOptions;
stsClient = new stsClientCtor({
logger,
credentialDefaultProvider: () => async () => closureSourceCreds,
region: decorateDefaultRegion(region || stsOptions.region),
...(requestHandler ? { requestHandler } : {}),
});
}
const { Credentials } = await stsClient.send(new AssumeRoleCommand_1.AssumeRoleCommand(params));
if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) {
throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`);
}
return {
accessKeyId: Credentials.AccessKeyId,
secretAccessKey: Credentials.SecretAccessKey,
sessionToken: Credentials.SessionToken,
expiration: Credentials.Expiration,
};
};
};
exports.getDefaultRoleAssumer = getDefaultRoleAssumer;
const getDefaultRoleAssumerWithWebIdentity = (stsOptions, stsClientCtor) => {
let stsClient;
return async (params) => {
if (!stsClient) {
const { logger, region, requestHandler } = stsOptions;
stsClient = new stsClientCtor({
logger,
region: decorateDefaultRegion(region || stsOptions.region),
...(requestHandler ? { requestHandler } : {}),
});
}
const { Credentials } = await stsClient.send(new AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand(params));
if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) {
throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`);
}
return {
accessKeyId: Credentials.AccessKeyId,
secretAccessKey: Credentials.SecretAccessKey,
sessionToken: Credentials.SessionToken,
expiration: Credentials.Expiration,
};
};
};
exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity;
const decorateDefaultCredentialProvider = (provider) => (input) => provider({
roleAssumer: (0, exports.getDefaultRoleAssumer)(input, input.stsClientCtor),
roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input, input.stsClientCtor),
...input,
});
exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider;
/***/ }),
/***/ 20510:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveClientEndpointParameters = void 0;
const resolveClientEndpointParameters = (options) => {
return {
...options,
useDualstackEndpoint: options.useDualstackEndpoint ?? false,
useFipsEndpoint: options.useFipsEndpoint ?? false,
useGlobalEndpoint: options.useGlobalEndpoint ?? false,
defaultSigningName: "sts",
};
};
exports.resolveClientEndpointParameters = resolveClientEndpointParameters;
/***/ }),
/***/ 41203:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultEndpointResolver = void 0;
const util_endpoints_1 = __nccwpck_require__(45473);
const ruleset_1 = __nccwpck_require__(86882);
const defaultEndpointResolver = (endpointParams, context = {}) => {
return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, {
endpointParams: endpointParams,
logger: context.logger,
});
};
exports.defaultEndpointResolver = defaultEndpointResolver;
/***/ }),
/***/ 86882:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ruleSet = void 0;
const F = "required", G = "type", H = "fn", I = "argv", J = "ref";
const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y];
const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] };
exports.ruleSet = _data;
/***/ }),
/***/ 52209:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.STSServiceException = void 0;
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(64195), exports);
tslib_1.__exportStar(__nccwpck_require__(32605), exports);
tslib_1.__exportStar(__nccwpck_require__(55716), exports);
tslib_1.__exportStar(__nccwpck_require__(20106), exports);
tslib_1.__exportStar(__nccwpck_require__(88028), exports);
__nccwpck_require__(13350);
var STSServiceException_1 = __nccwpck_require__(26450);
Object.defineProperty(exports, "STSServiceException", ({ enumerable: true, get: function () { return STSServiceException_1.STSServiceException; } }));
/***/ }),
/***/ 26450:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.STSServiceException = exports.__ServiceException = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
Object.defineProperty(exports, "__ServiceException", ({ enumerable: true, get: function () { return smithy_client_1.ServiceException; } }));
class STSServiceException extends smithy_client_1.ServiceException {
constructor(options) {
super(options);
Object.setPrototypeOf(this, STSServiceException.prototype);
}
}
exports.STSServiceException = STSServiceException;
/***/ }),
/***/ 20106:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(21780), exports);
/***/ }),
/***/ 21780:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.GetSessionTokenResponseFilterSensitiveLog = exports.GetFederationTokenResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = exports.AssumeRoleResponseFilterSensitiveLog = exports.CredentialsFilterSensitiveLog = exports.InvalidAuthorizationMessageException = exports.IDPCommunicationErrorException = exports.InvalidIdentityTokenException = exports.IDPRejectedClaimException = exports.RegionDisabledException = exports.PackedPolicyTooLargeException = exports.MalformedPolicyDocumentException = exports.ExpiredTokenException = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const STSServiceException_1 = __nccwpck_require__(26450);
class ExpiredTokenException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "ExpiredTokenException",
$fault: "client",
...opts,
});
this.name = "ExpiredTokenException";
this.$fault = "client";
Object.setPrototypeOf(this, ExpiredTokenException.prototype);
}
}
exports.ExpiredTokenException = ExpiredTokenException;
class MalformedPolicyDocumentException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "MalformedPolicyDocumentException",
$fault: "client",
...opts,
});
this.name = "MalformedPolicyDocumentException";
this.$fault = "client";
Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype);
}
}
exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException;
class PackedPolicyTooLargeException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "PackedPolicyTooLargeException",
$fault: "client",
...opts,
});
this.name = "PackedPolicyTooLargeException";
this.$fault = "client";
Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype);
}
}
exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException;
class RegionDisabledException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "RegionDisabledException",
$fault: "client",
...opts,
});
this.name = "RegionDisabledException";
this.$fault = "client";
Object.setPrototypeOf(this, RegionDisabledException.prototype);
}
}
exports.RegionDisabledException = RegionDisabledException;
class IDPRejectedClaimException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "IDPRejectedClaimException",
$fault: "client",
...opts,
});
this.name = "IDPRejectedClaimException";
this.$fault = "client";
Object.setPrototypeOf(this, IDPRejectedClaimException.prototype);
}
}
exports.IDPRejectedClaimException = IDPRejectedClaimException;
class InvalidIdentityTokenException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "InvalidIdentityTokenException",
$fault: "client",
...opts,
});
this.name = "InvalidIdentityTokenException";
this.$fault = "client";
Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype);
}
}
exports.InvalidIdentityTokenException = InvalidIdentityTokenException;
class IDPCommunicationErrorException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "IDPCommunicationErrorException",
$fault: "client",
...opts,
});
this.name = "IDPCommunicationErrorException";
this.$fault = "client";
Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype);
}
}
exports.IDPCommunicationErrorException = IDPCommunicationErrorException;
class InvalidAuthorizationMessageException extends STSServiceException_1.STSServiceException {
constructor(opts) {
super({
name: "InvalidAuthorizationMessageException",
$fault: "client",
...opts,
});
this.name = "InvalidAuthorizationMessageException";
this.$fault = "client";
Object.setPrototypeOf(this, InvalidAuthorizationMessageException.prototype);
}
}
exports.InvalidAuthorizationMessageException = InvalidAuthorizationMessageException;
const CredentialsFilterSensitiveLog = (obj) => ({
...obj,
...(obj.SecretAccessKey && { SecretAccessKey: smithy_client_1.SENSITIVE_STRING }),
});
exports.CredentialsFilterSensitiveLog = CredentialsFilterSensitiveLog;
const AssumeRoleResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }),
});
exports.AssumeRoleResponseFilterSensitiveLog = AssumeRoleResponseFilterSensitiveLog;
const AssumeRoleWithSAMLRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.SAMLAssertion && { SAMLAssertion: smithy_client_1.SENSITIVE_STRING }),
});
exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = AssumeRoleWithSAMLRequestFilterSensitiveLog;
const AssumeRoleWithSAMLResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }),
});
exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = AssumeRoleWithSAMLResponseFilterSensitiveLog;
const AssumeRoleWithWebIdentityRequestFilterSensitiveLog = (obj) => ({
...obj,
...(obj.WebIdentityToken && { WebIdentityToken: smithy_client_1.SENSITIVE_STRING }),
});
exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = AssumeRoleWithWebIdentityRequestFilterSensitiveLog;
const AssumeRoleWithWebIdentityResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }),
});
exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = AssumeRoleWithWebIdentityResponseFilterSensitiveLog;
const GetFederationTokenResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }),
});
exports.GetFederationTokenResponseFilterSensitiveLog = GetFederationTokenResponseFilterSensitiveLog;
const GetSessionTokenResponseFilterSensitiveLog = (obj) => ({
...obj,
...(obj.Credentials && { Credentials: (0, exports.CredentialsFilterSensitiveLog)(obj.Credentials) }),
});
exports.GetSessionTokenResponseFilterSensitiveLog = GetSessionTokenResponseFilterSensitiveLog;
/***/ }),
/***/ 10740:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.de_GetSessionTokenCommand = exports.de_GetFederationTokenCommand = exports.de_GetCallerIdentityCommand = exports.de_GetAccessKeyInfoCommand = exports.de_DecodeAuthorizationMessageCommand = exports.de_AssumeRoleWithWebIdentityCommand = exports.de_AssumeRoleWithSAMLCommand = exports.de_AssumeRoleCommand = exports.se_GetSessionTokenCommand = exports.se_GetFederationTokenCommand = exports.se_GetCallerIdentityCommand = exports.se_GetAccessKeyInfoCommand = exports.se_DecodeAuthorizationMessageCommand = exports.se_AssumeRoleWithWebIdentityCommand = exports.se_AssumeRoleWithSAMLCommand = exports.se_AssumeRoleCommand = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const smithy_client_1 = __nccwpck_require__(63570);
const fast_xml_parser_1 = __nccwpck_require__(12603);
const models_0_1 = __nccwpck_require__(21780);
const STSServiceException_1 = __nccwpck_require__(26450);
const se_AssumeRoleCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_AssumeRoleRequest(input, context),
Action: "AssumeRole",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_AssumeRoleCommand = se_AssumeRoleCommand;
const se_AssumeRoleWithSAMLCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_AssumeRoleWithSAMLRequest(input, context),
Action: "AssumeRoleWithSAML",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_AssumeRoleWithSAMLCommand = se_AssumeRoleWithSAMLCommand;
const se_AssumeRoleWithWebIdentityCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_AssumeRoleWithWebIdentityRequest(input, context),
Action: "AssumeRoleWithWebIdentity",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_AssumeRoleWithWebIdentityCommand = se_AssumeRoleWithWebIdentityCommand;
const se_DecodeAuthorizationMessageCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_DecodeAuthorizationMessageRequest(input, context),
Action: "DecodeAuthorizationMessage",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_DecodeAuthorizationMessageCommand = se_DecodeAuthorizationMessageCommand;
const se_GetAccessKeyInfoCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_GetAccessKeyInfoRequest(input, context),
Action: "GetAccessKeyInfo",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_GetAccessKeyInfoCommand = se_GetAccessKeyInfoCommand;
const se_GetCallerIdentityCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_GetCallerIdentityRequest(input, context),
Action: "GetCallerIdentity",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_GetCallerIdentityCommand = se_GetCallerIdentityCommand;
const se_GetFederationTokenCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_GetFederationTokenRequest(input, context),
Action: "GetFederationToken",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_GetFederationTokenCommand = se_GetFederationTokenCommand;
const se_GetSessionTokenCommand = async (input, context) => {
const headers = SHARED_HEADERS;
let body;
body = buildFormUrlencodedString({
...se_GetSessionTokenRequest(input, context),
Action: "GetSessionToken",
Version: "2011-06-15",
});
return buildHttpRpcRequest(context, headers, "/", undefined, body);
};
exports.se_GetSessionTokenCommand = se_GetSessionTokenCommand;
const de_AssumeRoleCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_AssumeRoleCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_AssumeRoleResponse(data.AssumeRoleResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_AssumeRoleCommand = de_AssumeRoleCommand;
const de_AssumeRoleCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "ExpiredTokenException":
case "com.amazonaws.sts#ExpiredTokenException":
throw await de_ExpiredTokenExceptionRes(parsedOutput, context);
case "MalformedPolicyDocument":
case "com.amazonaws.sts#MalformedPolicyDocumentException":
throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context);
case "PackedPolicyTooLarge":
case "com.amazonaws.sts#PackedPolicyTooLargeException":
throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context);
case "RegionDisabledException":
case "com.amazonaws.sts#RegionDisabledException":
throw await de_RegionDisabledExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_AssumeRoleWithSAMLCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_AssumeRoleWithSAMLCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_AssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_AssumeRoleWithSAMLCommand = de_AssumeRoleWithSAMLCommand;
const de_AssumeRoleWithSAMLCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "ExpiredTokenException":
case "com.amazonaws.sts#ExpiredTokenException":
throw await de_ExpiredTokenExceptionRes(parsedOutput, context);
case "IDPRejectedClaim":
case "com.amazonaws.sts#IDPRejectedClaimException":
throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context);
case "InvalidIdentityToken":
case "com.amazonaws.sts#InvalidIdentityTokenException":
throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context);
case "MalformedPolicyDocument":
case "com.amazonaws.sts#MalformedPolicyDocumentException":
throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context);
case "PackedPolicyTooLarge":
case "com.amazonaws.sts#PackedPolicyTooLargeException":
throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context);
case "RegionDisabledException":
case "com.amazonaws.sts#RegionDisabledException":
throw await de_RegionDisabledExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_AssumeRoleWithWebIdentityCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_AssumeRoleWithWebIdentityCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_AssumeRoleWithWebIdentityCommand = de_AssumeRoleWithWebIdentityCommand;
const de_AssumeRoleWithWebIdentityCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "ExpiredTokenException":
case "com.amazonaws.sts#ExpiredTokenException":
throw await de_ExpiredTokenExceptionRes(parsedOutput, context);
case "IDPCommunicationError":
case "com.amazonaws.sts#IDPCommunicationErrorException":
throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context);
case "IDPRejectedClaim":
case "com.amazonaws.sts#IDPRejectedClaimException":
throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context);
case "InvalidIdentityToken":
case "com.amazonaws.sts#InvalidIdentityTokenException":
throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context);
case "MalformedPolicyDocument":
case "com.amazonaws.sts#MalformedPolicyDocumentException":
throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context);
case "PackedPolicyTooLarge":
case "com.amazonaws.sts#PackedPolicyTooLargeException":
throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context);
case "RegionDisabledException":
case "com.amazonaws.sts#RegionDisabledException":
throw await de_RegionDisabledExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_DecodeAuthorizationMessageCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_DecodeAuthorizationMessageCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_DecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_DecodeAuthorizationMessageCommand = de_DecodeAuthorizationMessageCommand;
const de_DecodeAuthorizationMessageCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InvalidAuthorizationMessageException":
case "com.amazonaws.sts#InvalidAuthorizationMessageException":
throw await de_InvalidAuthorizationMessageExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_GetAccessKeyInfoCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_GetAccessKeyInfoCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_GetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_GetAccessKeyInfoCommand = de_GetAccessKeyInfoCommand;
const de_GetAccessKeyInfoCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
};
const de_GetCallerIdentityCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_GetCallerIdentityCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_GetCallerIdentityResponse(data.GetCallerIdentityResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_GetCallerIdentityCommand = de_GetCallerIdentityCommand;
const de_GetCallerIdentityCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
};
const de_GetFederationTokenCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_GetFederationTokenCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_GetFederationTokenResponse(data.GetFederationTokenResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_GetFederationTokenCommand = de_GetFederationTokenCommand;
const de_GetFederationTokenCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "MalformedPolicyDocument":
case "com.amazonaws.sts#MalformedPolicyDocumentException":
throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context);
case "PackedPolicyTooLarge":
case "com.amazonaws.sts#PackedPolicyTooLargeException":
throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context);
case "RegionDisabledException":
case "com.amazonaws.sts#RegionDisabledException":
throw await de_RegionDisabledExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_GetSessionTokenCommand = async (output, context) => {
if (output.statusCode >= 300) {
return de_GetSessionTokenCommandError(output, context);
}
const data = await parseBody(output.body, context);
let contents = {};
contents = de_GetSessionTokenResponse(data.GetSessionTokenResult, context);
const response = {
$metadata: deserializeMetadata(output),
...contents,
};
return response;
};
exports.de_GetSessionTokenCommand = de_GetSessionTokenCommand;
const de_GetSessionTokenCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadQueryErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "RegionDisabledException":
case "com.amazonaws.sts#RegionDisabledException":
throw await de_RegionDisabledExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody: parsedBody.Error,
errorCode,
});
}
};
const de_ExpiredTokenExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_ExpiredTokenException(body.Error, context);
const exception = new models_0_1.ExpiredTokenException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_IDPCommunicationErrorExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_IDPCommunicationErrorException(body.Error, context);
const exception = new models_0_1.IDPCommunicationErrorException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_IDPRejectedClaimExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_IDPRejectedClaimException(body.Error, context);
const exception = new models_0_1.IDPRejectedClaimException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_InvalidAuthorizationMessageExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_InvalidAuthorizationMessageException(body.Error, context);
const exception = new models_0_1.InvalidAuthorizationMessageException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_InvalidIdentityTokenExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_InvalidIdentityTokenException(body.Error, context);
const exception = new models_0_1.InvalidIdentityTokenException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_MalformedPolicyDocumentExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_MalformedPolicyDocumentException(body.Error, context);
const exception = new models_0_1.MalformedPolicyDocumentException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_PackedPolicyTooLargeExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_PackedPolicyTooLargeException(body.Error, context);
const exception = new models_0_1.PackedPolicyTooLargeException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const de_RegionDisabledExceptionRes = async (parsedOutput, context) => {
const body = parsedOutput.body;
const deserialized = de_RegionDisabledException(body.Error, context);
const exception = new models_0_1.RegionDisabledException({
$metadata: deserializeMetadata(parsedOutput),
...deserialized,
});
return (0, smithy_client_1.decorateServiceException)(exception, body);
};
const se_AssumeRoleRequest = (input, context) => {
const entries = {};
if (input.RoleArn != null) {
entries["RoleArn"] = input.RoleArn;
}
if (input.RoleSessionName != null) {
entries["RoleSessionName"] = input.RoleSessionName;
}
if (input.PolicyArns != null) {
const memberEntries = se_policyDescriptorListType(input.PolicyArns, context);
if (input.PolicyArns?.length === 0) {
entries.PolicyArns = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `PolicyArns.${key}`;
entries[loc] = value;
});
}
if (input.Policy != null) {
entries["Policy"] = input.Policy;
}
if (input.DurationSeconds != null) {
entries["DurationSeconds"] = input.DurationSeconds;
}
if (input.Tags != null) {
const memberEntries = se_tagListType(input.Tags, context);
if (input.Tags?.length === 0) {
entries.Tags = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `Tags.${key}`;
entries[loc] = value;
});
}
if (input.TransitiveTagKeys != null) {
const memberEntries = se_tagKeyListType(input.TransitiveTagKeys, context);
if (input.TransitiveTagKeys?.length === 0) {
entries.TransitiveTagKeys = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `TransitiveTagKeys.${key}`;
entries[loc] = value;
});
}
if (input.ExternalId != null) {
entries["ExternalId"] = input.ExternalId;
}
if (input.SerialNumber != null) {
entries["SerialNumber"] = input.SerialNumber;
}
if (input.TokenCode != null) {
entries["TokenCode"] = input.TokenCode;
}
if (input.SourceIdentity != null) {
entries["SourceIdentity"] = input.SourceIdentity;
}
if (input.ProvidedContexts != null) {
const memberEntries = se_ProvidedContextsListType(input.ProvidedContexts, context);
if (input.ProvidedContexts?.length === 0) {
entries.ProvidedContexts = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `ProvidedContexts.${key}`;
entries[loc] = value;
});
}
return entries;
};
const se_AssumeRoleWithSAMLRequest = (input, context) => {
const entries = {};
if (input.RoleArn != null) {
entries["RoleArn"] = input.RoleArn;
}
if (input.PrincipalArn != null) {
entries["PrincipalArn"] = input.PrincipalArn;
}
if (input.SAMLAssertion != null) {
entries["SAMLAssertion"] = input.SAMLAssertion;
}
if (input.PolicyArns != null) {
const memberEntries = se_policyDescriptorListType(input.PolicyArns, context);
if (input.PolicyArns?.length === 0) {
entries.PolicyArns = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `PolicyArns.${key}`;
entries[loc] = value;
});
}
if (input.Policy != null) {
entries["Policy"] = input.Policy;
}
if (input.DurationSeconds != null) {
entries["DurationSeconds"] = input.DurationSeconds;
}
return entries;
};
const se_AssumeRoleWithWebIdentityRequest = (input, context) => {
const entries = {};
if (input.RoleArn != null) {
entries["RoleArn"] = input.RoleArn;
}
if (input.RoleSessionName != null) {
entries["RoleSessionName"] = input.RoleSessionName;
}
if (input.WebIdentityToken != null) {
entries["WebIdentityToken"] = input.WebIdentityToken;
}
if (input.ProviderId != null) {
entries["ProviderId"] = input.ProviderId;
}
if (input.PolicyArns != null) {
const memberEntries = se_policyDescriptorListType(input.PolicyArns, context);
if (input.PolicyArns?.length === 0) {
entries.PolicyArns = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `PolicyArns.${key}`;
entries[loc] = value;
});
}
if (input.Policy != null) {
entries["Policy"] = input.Policy;
}
if (input.DurationSeconds != null) {
entries["DurationSeconds"] = input.DurationSeconds;
}
return entries;
};
const se_DecodeAuthorizationMessageRequest = (input, context) => {
const entries = {};
if (input.EncodedMessage != null) {
entries["EncodedMessage"] = input.EncodedMessage;
}
return entries;
};
const se_GetAccessKeyInfoRequest = (input, context) => {
const entries = {};
if (input.AccessKeyId != null) {
entries["AccessKeyId"] = input.AccessKeyId;
}
return entries;
};
const se_GetCallerIdentityRequest = (input, context) => {
const entries = {};
return entries;
};
const se_GetFederationTokenRequest = (input, context) => {
const entries = {};
if (input.Name != null) {
entries["Name"] = input.Name;
}
if (input.Policy != null) {
entries["Policy"] = input.Policy;
}
if (input.PolicyArns != null) {
const memberEntries = se_policyDescriptorListType(input.PolicyArns, context);
if (input.PolicyArns?.length === 0) {
entries.PolicyArns = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `PolicyArns.${key}`;
entries[loc] = value;
});
}
if (input.DurationSeconds != null) {
entries["DurationSeconds"] = input.DurationSeconds;
}
if (input.Tags != null) {
const memberEntries = se_tagListType(input.Tags, context);
if (input.Tags?.length === 0) {
entries.Tags = [];
}
Object.entries(memberEntries).forEach(([key, value]) => {
const loc = `Tags.${key}`;
entries[loc] = value;
});
}
return entries;
};
const se_GetSessionTokenRequest = (input, context) => {
const entries = {};
if (input.DurationSeconds != null) {
entries["DurationSeconds"] = input.DurationSeconds;
}
if (input.SerialNumber != null) {
entries["SerialNumber"] = input.SerialNumber;
}
if (input.TokenCode != null) {
entries["TokenCode"] = input.TokenCode;
}
return entries;
};
const se_policyDescriptorListType = (input, context) => {
const entries = {};
let counter = 1;
for (const entry of input) {
if (entry === null) {
continue;
}
const memberEntries = se_PolicyDescriptorType(entry, context);
Object.entries(memberEntries).forEach(([key, value]) => {
entries[`member.${counter}.${key}`] = value;
});
counter++;
}
return entries;
};
const se_PolicyDescriptorType = (input, context) => {
const entries = {};
if (input.arn != null) {
entries["arn"] = input.arn;
}
return entries;
};
const se_ProvidedContext = (input, context) => {
const entries = {};
if (input.ProviderArn != null) {
entries["ProviderArn"] = input.ProviderArn;
}
if (input.ContextAssertion != null) {
entries["ContextAssertion"] = input.ContextAssertion;
}
return entries;
};
const se_ProvidedContextsListType = (input, context) => {
const entries = {};
let counter = 1;
for (const entry of input) {
if (entry === null) {
continue;
}
const memberEntries = se_ProvidedContext(entry, context);
Object.entries(memberEntries).forEach(([key, value]) => {
entries[`member.${counter}.${key}`] = value;
});
counter++;
}
return entries;
};
const se_Tag = (input, context) => {
const entries = {};
if (input.Key != null) {
entries["Key"] = input.Key;
}
if (input.Value != null) {
entries["Value"] = input.Value;
}
return entries;
};
const se_tagKeyListType = (input, context) => {
const entries = {};
let counter = 1;
for (const entry of input) {
if (entry === null) {
continue;
}
entries[`member.${counter}`] = entry;
counter++;
}
return entries;
};
const se_tagListType = (input, context) => {
const entries = {};
let counter = 1;
for (const entry of input) {
if (entry === null) {
continue;
}
const memberEntries = se_Tag(entry, context);
Object.entries(memberEntries).forEach(([key, value]) => {
entries[`member.${counter}.${key}`] = value;
});
counter++;
}
return entries;
};
const de_AssumedRoleUser = (output, context) => {
const contents = {};
if (output["AssumedRoleId"] !== undefined) {
contents.AssumedRoleId = (0, smithy_client_1.expectString)(output["AssumedRoleId"]);
}
if (output["Arn"] !== undefined) {
contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]);
}
return contents;
};
const de_AssumeRoleResponse = (output, context) => {
const contents = {};
if (output["Credentials"] !== undefined) {
contents.Credentials = de_Credentials(output["Credentials"], context);
}
if (output["AssumedRoleUser"] !== undefined) {
contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context);
}
if (output["PackedPolicySize"] !== undefined) {
contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]);
}
if (output["SourceIdentity"] !== undefined) {
contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]);
}
return contents;
};
const de_AssumeRoleWithSAMLResponse = (output, context) => {
const contents = {};
if (output["Credentials"] !== undefined) {
contents.Credentials = de_Credentials(output["Credentials"], context);
}
if (output["AssumedRoleUser"] !== undefined) {
contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context);
}
if (output["PackedPolicySize"] !== undefined) {
contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]);
}
if (output["Subject"] !== undefined) {
contents.Subject = (0, smithy_client_1.expectString)(output["Subject"]);
}
if (output["SubjectType"] !== undefined) {
contents.SubjectType = (0, smithy_client_1.expectString)(output["SubjectType"]);
}
if (output["Issuer"] !== undefined) {
contents.Issuer = (0, smithy_client_1.expectString)(output["Issuer"]);
}
if (output["Audience"] !== undefined) {
contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]);
}
if (output["NameQualifier"] !== undefined) {
contents.NameQualifier = (0, smithy_client_1.expectString)(output["NameQualifier"]);
}
if (output["SourceIdentity"] !== undefined) {
contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]);
}
return contents;
};
const de_AssumeRoleWithWebIdentityResponse = (output, context) => {
const contents = {};
if (output["Credentials"] !== undefined) {
contents.Credentials = de_Credentials(output["Credentials"], context);
}
if (output["SubjectFromWebIdentityToken"] !== undefined) {
contents.SubjectFromWebIdentityToken = (0, smithy_client_1.expectString)(output["SubjectFromWebIdentityToken"]);
}
if (output["AssumedRoleUser"] !== undefined) {
contents.AssumedRoleUser = de_AssumedRoleUser(output["AssumedRoleUser"], context);
}
if (output["PackedPolicySize"] !== undefined) {
contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]);
}
if (output["Provider"] !== undefined) {
contents.Provider = (0, smithy_client_1.expectString)(output["Provider"]);
}
if (output["Audience"] !== undefined) {
contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]);
}
if (output["SourceIdentity"] !== undefined) {
contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]);
}
return contents;
};
const de_Credentials = (output, context) => {
const contents = {};
if (output["AccessKeyId"] !== undefined) {
contents.AccessKeyId = (0, smithy_client_1.expectString)(output["AccessKeyId"]);
}
if (output["SecretAccessKey"] !== undefined) {
contents.SecretAccessKey = (0, smithy_client_1.expectString)(output["SecretAccessKey"]);
}
if (output["SessionToken"] !== undefined) {
contents.SessionToken = (0, smithy_client_1.expectString)(output["SessionToken"]);
}
if (output["Expiration"] !== undefined) {
contents.Expiration = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseRfc3339DateTimeWithOffset)(output["Expiration"]));
}
return contents;
};
const de_DecodeAuthorizationMessageResponse = (output, context) => {
const contents = {};
if (output["DecodedMessage"] !== undefined) {
contents.DecodedMessage = (0, smithy_client_1.expectString)(output["DecodedMessage"]);
}
return contents;
};
const de_ExpiredTokenException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_FederatedUser = (output, context) => {
const contents = {};
if (output["FederatedUserId"] !== undefined) {
contents.FederatedUserId = (0, smithy_client_1.expectString)(output["FederatedUserId"]);
}
if (output["Arn"] !== undefined) {
contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]);
}
return contents;
};
const de_GetAccessKeyInfoResponse = (output, context) => {
const contents = {};
if (output["Account"] !== undefined) {
contents.Account = (0, smithy_client_1.expectString)(output["Account"]);
}
return contents;
};
const de_GetCallerIdentityResponse = (output, context) => {
const contents = {};
if (output["UserId"] !== undefined) {
contents.UserId = (0, smithy_client_1.expectString)(output["UserId"]);
}
if (output["Account"] !== undefined) {
contents.Account = (0, smithy_client_1.expectString)(output["Account"]);
}
if (output["Arn"] !== undefined) {
contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]);
}
return contents;
};
const de_GetFederationTokenResponse = (output, context) => {
const contents = {};
if (output["Credentials"] !== undefined) {
contents.Credentials = de_Credentials(output["Credentials"], context);
}
if (output["FederatedUser"] !== undefined) {
contents.FederatedUser = de_FederatedUser(output["FederatedUser"], context);
}
if (output["PackedPolicySize"] !== undefined) {
contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]);
}
return contents;
};
const de_GetSessionTokenResponse = (output, context) => {
const contents = {};
if (output["Credentials"] !== undefined) {
contents.Credentials = de_Credentials(output["Credentials"], context);
}
return contents;
};
const de_IDPCommunicationErrorException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_IDPRejectedClaimException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_InvalidAuthorizationMessageException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_InvalidIdentityTokenException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_MalformedPolicyDocumentException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_PackedPolicyTooLargeException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const de_RegionDisabledException = (output, context) => {
const contents = {};
if (output["message"] !== undefined) {
contents.message = (0, smithy_client_1.expectString)(output["message"]);
}
return contents;
};
const deserializeMetadata = (output) => ({
httpStatusCode: output.statusCode,
requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"],
extendedRequestId: output.headers["x-amz-id-2"],
cfId: output.headers["x-amz-cf-id"],
});
const collectBodyString = (streamBody, context) => (0, smithy_client_1.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body));
const throwDefaultError = (0, smithy_client_1.withBaseException)(STSServiceException_1.STSServiceException);
const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const contents = {
protocol,
hostname,
port,
method: "POST",
path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path,
headers,
};
if (resolvedHostname !== undefined) {
contents.hostname = resolvedHostname;
}
if (body !== undefined) {
contents.body = body;
}
return new protocol_http_1.HttpRequest(contents);
};
const SHARED_HEADERS = {
"content-type": "application/x-www-form-urlencoded",
};
const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {
if (encoded.length) {
const parser = new fast_xml_parser_1.XMLParser({
attributeNamePrefix: "",
htmlEntities: true,
ignoreAttributes: false,
ignoreDeclaration: true,
parseTagValue: false,
trimValues: false,
tagValueProcessor: (_, val) => (val.trim() === "" && val.includes("\n") ? "" : undefined),
});
parser.addEntity("#xD", "\r");
parser.addEntity("#10", "\n");
const parsedObj = parser.parse(encoded);
const textNodeName = "#text";
const key = Object.keys(parsedObj)[0];
const parsedObjToReturn = parsedObj[key];
if (parsedObjToReturn[textNodeName]) {
parsedObjToReturn[key] = parsedObjToReturn[textNodeName];
delete parsedObjToReturn[textNodeName];
}
return (0, smithy_client_1.getValueFromTextNode)(parsedObjToReturn);
}
return {};
});
const parseErrorBody = async (errorBody, context) => {
const value = await parseBody(errorBody, context);
if (value.Error) {
value.Error.message = value.Error.message ?? value.Error.Message;
}
return value;
};
const buildFormUrlencodedString = (formEntries) => Object.entries(formEntries)
.map(([key, value]) => (0, smithy_client_1.extendedEncodeURIComponent)(key) + "=" + (0, smithy_client_1.extendedEncodeURIComponent)(value))
.join("&");
const loadQueryErrorCode = (output, data) => {
if (data.Error?.Code !== undefined) {
return data.Error.Code;
}
if (output.statusCode == 404) {
return "NotFound";
}
};
/***/ }),
/***/ 83405:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRuntimeConfig = void 0;
const tslib_1 = __nccwpck_require__(4351);
const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(7947));
const defaultStsRoleAssumers_1 = __nccwpck_require__(90048);
const core_1 = __nccwpck_require__(59963);
const credential_provider_node_1 = __nccwpck_require__(75531);
const util_user_agent_node_1 = __nccwpck_require__(98095);
const config_resolver_1 = __nccwpck_require__(53098);
const hash_node_1 = __nccwpck_require__(3081);
const middleware_retry_1 = __nccwpck_require__(96039);
const node_config_provider_1 = __nccwpck_require__(33461);
const node_http_handler_1 = __nccwpck_require__(20258);
const util_body_length_node_1 = __nccwpck_require__(68075);
const util_retry_1 = __nccwpck_require__(84902);
const runtimeConfig_shared_1 = __nccwpck_require__(52642);
const smithy_client_1 = __nccwpck_require__(63570);
const util_defaults_mode_node_1 = __nccwpck_require__(72429);
const smithy_client_2 = __nccwpck_require__(63570);
const getRuntimeConfig = (config) => {
(0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version);
const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode);
const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config);
(0, core_1.emitWarningIfUnsupportedVersion)(process.version);
return {
...clientSharedValues,
...config,
runtime: "node",
defaultsMode,
bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength,
credentialDefaultProvider: config?.credentialDefaultProvider ?? (0, defaultStsRoleAssumers_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider),
defaultUserAgentProvider: config?.defaultUserAgentProvider ??
(0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }),
maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS),
region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS),
requestHandler: config?.requestHandler ?? new node_http_handler_1.NodeHttpHandler(defaultConfigProvider),
retryMode: config?.retryMode ??
(0, node_config_provider_1.loadConfig)({
...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS,
default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
}),
sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"),
streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector,
useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS),
useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS),
};
};
exports.getRuntimeConfig = getRuntimeConfig;
/***/ }),
/***/ 52642:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRuntimeConfig = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const url_parser_1 = __nccwpck_require__(14681);
const util_base64_1 = __nccwpck_require__(75600);
const util_utf8_1 = __nccwpck_require__(41895);
const endpointResolver_1 = __nccwpck_require__(41203);
const getRuntimeConfig = (config) => {
return {
apiVersion: "2011-06-15",
base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64,
base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64,
disableHostPrefix: config?.disableHostPrefix ?? false,
endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver,
extensions: config?.extensions ?? [],
logger: config?.logger ?? new smithy_client_1.NoOpLogger(),
serviceId: config?.serviceId ?? "STS",
urlParser: config?.urlParser ?? url_parser_1.parseUrl,
utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8,
utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8,
};
};
exports.getRuntimeConfig = getRuntimeConfig;
/***/ }),
/***/ 32053:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveRuntimeExtensions = void 0;
const region_config_resolver_1 = __nccwpck_require__(18156);
const protocol_http_1 = __nccwpck_require__(64418);
const smithy_client_1 = __nccwpck_require__(63570);
const asPartial = (t) => t;
const resolveRuntimeExtensions = (runtimeConfig, extensions) => {
const extensionConfiguration = {
...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)),
...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)),
...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)),
};
extensions.forEach((extension) => extension.configure(extensionConfiguration));
return {
...runtimeConfig,
...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration),
...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration),
...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration),
};
};
exports.resolveRuntimeExtensions = resolveRuntimeExtensions;
/***/ }),
/***/ 14154:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.emitWarningIfUnsupportedVersion = void 0;
let warningEmitted = false;
const emitWarningIfUnsupportedVersion = (version) => {
if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) {
warningEmitted = true;
process.emitWarning(`NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will
no longer support Node.js 14.x on May 1, 2024.
To continue receiving updates to AWS services, bug fixes, and security
updates please upgrade to an active Node.js LTS version.
More information can be found at: https://a.co/dzr2AJd`);
}
};
exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
/***/ }),
/***/ 7249:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(14154), exports);
/***/ }),
/***/ 59963:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(7249), exports);
tslib_1.__exportStar(__nccwpck_require__(53069), exports);
/***/ }),
/***/ 26133:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports._toNum = exports._toBool = exports._toStr = void 0;
const _toStr = (val) => {
if (val == null) {
return val;
}
if (typeof val === "number" || typeof val === "bigint") {
const warning = new Error(`Received number ${val} where a string was expected.`);
warning.name = "Warning";
console.warn(warning);
return String(val);
}
if (typeof val === "boolean") {
const warning = new Error(`Received boolean ${val} where a string was expected.`);
warning.name = "Warning";
console.warn(warning);
return String(val);
}
return val;
};
exports._toStr = _toStr;
const _toBool = (val) => {
if (val == null) {
return val;
}
if (typeof val === "number") {
}
if (typeof val === "string") {
const lowercase = val.toLowerCase();
if (val !== "" && lowercase !== "false" && lowercase !== "true") {
const warning = new Error(`Received string "${val}" where a boolean was expected.`);
warning.name = "Warning";
console.warn(warning);
}
return val !== "" && lowercase !== "false";
}
return val;
};
exports._toBool = _toBool;
const _toNum = (val) => {
if (val == null) {
return val;
}
if (typeof val === "boolean") {
}
if (typeof val === "string") {
const num = Number(val);
if (num.toString() !== val) {
const warning = new Error(`Received string "${val}" where a number was expected.`);
warning.name = "Warning";
console.warn(warning);
return val;
}
return num;
}
return val;
};
exports._toNum = _toNum;
/***/ }),
/***/ 53069:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(26133), exports);
tslib_1.__exportStar(__nccwpck_require__(11823), exports);
/***/ }),
/***/ 11823:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.awsExpectUnion = void 0;
const smithy_client_1 = __nccwpck_require__(63570);
const awsExpectUnion = (value) => {
if (value == null) {
return undefined;
}
if (typeof value === "object" && "__type" in value) {
delete value.__type;
}
return (0, smithy_client_1.expectUnion)(value);
};
exports.awsExpectUnion = awsExpectUnion;
/***/ }),
/***/ 80255:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromEnv = exports.ENV_EXPIRATION = exports.ENV_SESSION = exports.ENV_SECRET = exports.ENV_KEY = void 0;
const property_provider_1 = __nccwpck_require__(79721);
exports.ENV_KEY = "AWS_ACCESS_KEY_ID";
exports.ENV_SECRET = "AWS_SECRET_ACCESS_KEY";
exports.ENV_SESSION = "AWS_SESSION_TOKEN";
exports.ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION";
const fromEnv = () => async () => {
const accessKeyId = process.env[exports.ENV_KEY];
const secretAccessKey = process.env[exports.ENV_SECRET];
const sessionToken = process.env[exports.ENV_SESSION];
const expiry = process.env[exports.ENV_EXPIRATION];
if (accessKeyId && secretAccessKey) {
return {
accessKeyId,
secretAccessKey,
...(sessionToken && { sessionToken }),
...(expiry && { expiration: new Date(expiry) }),
};
}
throw new property_provider_1.CredentialsProviderError("Unable to find environment variable credentials.");
};
exports.fromEnv = fromEnv;
/***/ }),
/***/ 15972:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(80255), exports);
/***/ }),
/***/ 55442:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromIni = void 0;
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const resolveProfileData_1 = __nccwpck_require__(95653);
const fromIni = (init = {}) => async () => {
const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init);
return (0, resolveProfileData_1.resolveProfileData)((0, shared_ini_file_loader_1.getProfileName)(init), profiles, init);
};
exports.fromIni = fromIni;
/***/ }),
/***/ 74203:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(55442), exports);
/***/ }),
/***/ 60853:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveAssumeRoleCredentials = exports.isAssumeRoleProfile = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const resolveCredentialSource_1 = __nccwpck_require__(82458);
const resolveProfileData_1 = __nccwpck_require__(95653);
const isAssumeRoleProfile = (arg) => Boolean(arg) &&
typeof arg === "object" &&
typeof arg.role_arn === "string" &&
["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 &&
["undefined", "string"].indexOf(typeof arg.external_id) > -1 &&
["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 &&
(isAssumeRoleWithSourceProfile(arg) || isAssumeRoleWithProviderProfile(arg));
exports.isAssumeRoleProfile = isAssumeRoleProfile;
const isAssumeRoleWithSourceProfile = (arg) => typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined";
const isAssumeRoleWithProviderProfile = (arg) => typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined";
const resolveAssumeRoleCredentials = async (profileName, profiles, options, visitedProfiles = {}) => {
const data = profiles[profileName];
if (!options.roleAssumer) {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires a role to be assumed, but no role assumption callback was provided.`, false);
}
const { source_profile } = data;
if (source_profile && source_profile in visitedProfiles) {
throw new property_provider_1.CredentialsProviderError(`Detected a cycle attempting to resolve credentials for profile` +
` ${(0, shared_ini_file_loader_1.getProfileName)(options)}. Profiles visited: ` +
Object.keys(visitedProfiles).join(", "), false);
}
const sourceCredsProvider = source_profile
? (0, resolveProfileData_1.resolveProfileData)(source_profile, profiles, options, {
...visitedProfiles,
[source_profile]: true,
})
: (0, resolveCredentialSource_1.resolveCredentialSource)(data.credential_source, profileName)();
const params = {
RoleArn: data.role_arn,
RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`,
ExternalId: data.external_id,
DurationSeconds: parseInt(data.duration_seconds || "3600", 10),
};
const { mfa_serial } = data;
if (mfa_serial) {
if (!options.mfaCodeProvider) {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, false);
}
params.SerialNumber = mfa_serial;
params.TokenCode = await options.mfaCodeProvider(mfa_serial);
}
const sourceCreds = await sourceCredsProvider;
return options.roleAssumer(sourceCreds, params);
};
exports.resolveAssumeRoleCredentials = resolveAssumeRoleCredentials;
/***/ }),
/***/ 82458:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveCredentialSource = void 0;
const credential_provider_env_1 = __nccwpck_require__(15972);
const credential_provider_imds_1 = __nccwpck_require__(7477);
const property_provider_1 = __nccwpck_require__(79721);
const resolveCredentialSource = (credentialSource, profileName) => {
const sourceProvidersMap = {
EcsContainer: credential_provider_imds_1.fromContainerMetadata,
Ec2InstanceMetadata: credential_provider_imds_1.fromInstanceMetadata,
Environment: credential_provider_env_1.fromEnv,
};
if (credentialSource in sourceProvidersMap) {
return sourceProvidersMap[credentialSource]();
}
else {
throw new property_provider_1.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, ` +
`expected EcsContainer or Ec2InstanceMetadata or Environment.`);
}
};
exports.resolveCredentialSource = resolveCredentialSource;
/***/ }),
/***/ 69993:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveProcessCredentials = exports.isProcessProfile = void 0;
const credential_provider_process_1 = __nccwpck_require__(89969);
const isProcessProfile = (arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string";
exports.isProcessProfile = isProcessProfile;
const resolveProcessCredentials = async (options, profile) => (0, credential_provider_process_1.fromProcess)({
...options,
profile,
})();
exports.resolveProcessCredentials = resolveProcessCredentials;
/***/ }),
/***/ 95653:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveProfileData = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const resolveAssumeRoleCredentials_1 = __nccwpck_require__(60853);
const resolveProcessCredentials_1 = __nccwpck_require__(69993);
const resolveSsoCredentials_1 = __nccwpck_require__(59867);
const resolveStaticCredentials_1 = __nccwpck_require__(33071);
const resolveWebIdentityCredentials_1 = __nccwpck_require__(58342);
const resolveProfileData = async (profileName, profiles, options, visitedProfiles = {}) => {
const data = profiles[profileName];
if (Object.keys(visitedProfiles).length > 0 && (0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) {
return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data);
}
if ((0, resolveAssumeRoleCredentials_1.isAssumeRoleProfile)(data)) {
return (0, resolveAssumeRoleCredentials_1.resolveAssumeRoleCredentials)(profileName, profiles, options, visitedProfiles);
}
if ((0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) {
return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data);
}
if ((0, resolveWebIdentityCredentials_1.isWebIdentityProfile)(data)) {
return (0, resolveWebIdentityCredentials_1.resolveWebIdentityCredentials)(data, options);
}
if ((0, resolveProcessCredentials_1.isProcessProfile)(data)) {
return (0, resolveProcessCredentials_1.resolveProcessCredentials)(options, profileName);
}
if ((0, resolveSsoCredentials_1.isSsoProfile)(data)) {
return (0, resolveSsoCredentials_1.resolveSsoCredentials)(data);
}
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found or parsed in shared credentials file.`);
};
exports.resolveProfileData = resolveProfileData;
/***/ }),
/***/ 59867:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveSsoCredentials = exports.isSsoProfile = void 0;
const credential_provider_sso_1 = __nccwpck_require__(26414);
var credential_provider_sso_2 = __nccwpck_require__(26414);
Object.defineProperty(exports, "isSsoProfile", ({ enumerable: true, get: function () { return credential_provider_sso_2.isSsoProfile; } }));
const resolveSsoCredentials = (data) => {
const { sso_start_url, sso_account_id, sso_session, sso_region, sso_role_name } = (0, credential_provider_sso_1.validateSsoProfile)(data);
return (0, credential_provider_sso_1.fromSSO)({
ssoStartUrl: sso_start_url,
ssoAccountId: sso_account_id,
ssoSession: sso_session,
ssoRegion: sso_region,
ssoRoleName: sso_role_name,
})();
};
exports.resolveSsoCredentials = resolveSsoCredentials;
/***/ }),
/***/ 33071:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveStaticCredentials = exports.isStaticCredsProfile = void 0;
const isStaticCredsProfile = (arg) => Boolean(arg) &&
typeof arg === "object" &&
typeof arg.aws_access_key_id === "string" &&
typeof arg.aws_secret_access_key === "string" &&
["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1;
exports.isStaticCredsProfile = isStaticCredsProfile;
const resolveStaticCredentials = (profile) => Promise.resolve({
accessKeyId: profile.aws_access_key_id,
secretAccessKey: profile.aws_secret_access_key,
sessionToken: profile.aws_session_token,
});
exports.resolveStaticCredentials = resolveStaticCredentials;
/***/ }),
/***/ 58342:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveWebIdentityCredentials = exports.isWebIdentityProfile = void 0;
const credential_provider_web_identity_1 = __nccwpck_require__(15646);
const isWebIdentityProfile = (arg) => Boolean(arg) &&
typeof arg === "object" &&
typeof arg.web_identity_token_file === "string" &&
typeof arg.role_arn === "string" &&
["undefined", "string"].indexOf(typeof arg.role_session_name) > -1;
exports.isWebIdentityProfile = isWebIdentityProfile;
const resolveWebIdentityCredentials = async (profile, options) => (0, credential_provider_web_identity_1.fromTokenFile)({
webIdentityTokenFile: profile.web_identity_token_file,
roleArn: profile.role_arn,
roleSessionName: profile.role_session_name,
roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity,
})();
exports.resolveWebIdentityCredentials = resolveWebIdentityCredentials;
/***/ }),
/***/ 15560:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultProvider = void 0;
const credential_provider_env_1 = __nccwpck_require__(15972);
const credential_provider_ini_1 = __nccwpck_require__(74203);
const credential_provider_process_1 = __nccwpck_require__(89969);
const credential_provider_sso_1 = __nccwpck_require__(26414);
const credential_provider_web_identity_1 = __nccwpck_require__(15646);
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const remoteProvider_1 = __nccwpck_require__(50626);
const defaultProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)(...(init.profile || process.env[shared_ini_file_loader_1.ENV_PROFILE] ? [] : [(0, credential_provider_env_1.fromEnv)()]), (0, credential_provider_sso_1.fromSSO)(init), (0, credential_provider_ini_1.fromIni)(init), (0, credential_provider_process_1.fromProcess)(init), (0, credential_provider_web_identity_1.fromTokenFile)(init), (0, remoteProvider_1.remoteProvider)(init), async () => {
throw new property_provider_1.CredentialsProviderError("Could not load credentials from any providers", false);
}), (credentials) => credentials.expiration !== undefined && credentials.expiration.getTime() - Date.now() < 300000, (credentials) => credentials.expiration !== undefined);
exports.defaultProvider = defaultProvider;
/***/ }),
/***/ 75531:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(15560), exports);
/***/ }),
/***/ 50626:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.remoteProvider = exports.ENV_IMDS_DISABLED = void 0;
const credential_provider_imds_1 = __nccwpck_require__(7477);
const property_provider_1 = __nccwpck_require__(79721);
exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED";
const remoteProvider = (init) => {
if (process.env[credential_provider_imds_1.ENV_CMDS_RELATIVE_URI] || process.env[credential_provider_imds_1.ENV_CMDS_FULL_URI]) {
return (0, credential_provider_imds_1.fromContainerMetadata)(init);
}
if (process.env[exports.ENV_IMDS_DISABLED]) {
return async () => {
throw new property_provider_1.CredentialsProviderError("EC2 Instance Metadata Service access disabled");
};
}
return (0, credential_provider_imds_1.fromInstanceMetadata)(init);
};
exports.remoteProvider = remoteProvider;
/***/ }),
/***/ 72650:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromProcess = void 0;
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const resolveProcessCredentials_1 = __nccwpck_require__(74926);
const fromProcess = (init = {}) => async () => {
const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init);
return (0, resolveProcessCredentials_1.resolveProcessCredentials)((0, shared_ini_file_loader_1.getProfileName)(init), profiles);
};
exports.fromProcess = fromProcess;
/***/ }),
/***/ 41104:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getValidatedProcessCredentials = void 0;
const getValidatedProcessCredentials = (profileName, data) => {
if (data.Version !== 1) {
throw Error(`Profile ${profileName} credential_process did not return Version 1.`);
}
if (data.AccessKeyId === undefined || data.SecretAccessKey === undefined) {
throw Error(`Profile ${profileName} credential_process returned invalid credentials.`);
}
if (data.Expiration) {
const currentTime = new Date();
const expireTime = new Date(data.Expiration);
if (expireTime < currentTime) {
throw Error(`Profile ${profileName} credential_process returned expired credentials.`);
}
}
return {
accessKeyId: data.AccessKeyId,
secretAccessKey: data.SecretAccessKey,
...(data.SessionToken && { sessionToken: data.SessionToken }),
...(data.Expiration && { expiration: new Date(data.Expiration) }),
};
};
exports.getValidatedProcessCredentials = getValidatedProcessCredentials;
/***/ }),
/***/ 89969:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(72650), exports);
/***/ }),
/***/ 74926:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveProcessCredentials = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const child_process_1 = __nccwpck_require__(32081);
const util_1 = __nccwpck_require__(73837);
const getValidatedProcessCredentials_1 = __nccwpck_require__(41104);
const resolveProcessCredentials = async (profileName, profiles) => {
const profile = profiles[profileName];
if (profiles[profileName]) {
const credentialProcess = profile["credential_process"];
if (credentialProcess !== undefined) {
const execPromise = (0, util_1.promisify)(child_process_1.exec);
try {
const { stdout } = await execPromise(credentialProcess);
let data;
try {
data = JSON.parse(stdout.trim());
}
catch (_a) {
throw Error(`Profile ${profileName} credential_process returned invalid JSON.`);
}
return (0, getValidatedProcessCredentials_1.getValidatedProcessCredentials)(profileName, data);
}
catch (error) {
throw new property_provider_1.CredentialsProviderError(error.message);
}
}
else {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`);
}
}
else {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`);
}
};
exports.resolveProcessCredentials = resolveProcessCredentials;
/***/ }),
/***/ 35959:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromSSO = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const isSsoProfile_1 = __nccwpck_require__(32572);
const resolveSSOCredentials_1 = __nccwpck_require__(94729);
const validateSsoProfile_1 = __nccwpck_require__(48098);
const fromSSO = (init = {}) => async () => {
const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, ssoSession } = init;
const profileName = (0, shared_ini_file_loader_1.getProfileName)(init);
if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) {
const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init);
const profile = profiles[profileName];
if (!profile) {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} was not found.`);
}
if (!(0, isSsoProfile_1.isSsoProfile)(profile)) {
throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`);
}
if (profile === null || profile === void 0 ? void 0 : profile.sso_session) {
const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init);
const session = ssoSessions[profile.sso_session];
const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`;
if (ssoRegion && ssoRegion !== session.sso_region) {
throw new property_provider_1.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, false);
}
if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) {
throw new property_provider_1.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, false);
}
profile.sso_region = session.sso_region;
profile.sso_start_url = session.sso_start_url;
}
const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = (0, validateSsoProfile_1.validateSsoProfile)(profile);
return (0, resolveSSOCredentials_1.resolveSSOCredentials)({
ssoStartUrl: sso_start_url,
ssoSession: sso_session,
ssoAccountId: sso_account_id,
ssoRegion: sso_region,
ssoRoleName: sso_role_name,
ssoClient: ssoClient,
profile: profileName,
});
}
else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) {
throw new property_provider_1.CredentialsProviderError("Incomplete configuration. The fromSSO() argument hash must include " +
'"ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"');
}
else {
return (0, resolveSSOCredentials_1.resolveSSOCredentials)({
ssoStartUrl,
ssoSession,
ssoAccountId,
ssoRegion,
ssoRoleName,
ssoClient,
profile: profileName,
});
}
};
exports.fromSSO = fromSSO;
/***/ }),
/***/ 26414:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(35959), exports);
tslib_1.__exportStar(__nccwpck_require__(32572), exports);
tslib_1.__exportStar(__nccwpck_require__(86623), exports);
tslib_1.__exportStar(__nccwpck_require__(48098), exports);
/***/ }),
/***/ 32572:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isSsoProfile = void 0;
const isSsoProfile = (arg) => arg &&
(typeof arg.sso_start_url === "string" ||
typeof arg.sso_account_id === "string" ||
typeof arg.sso_session === "string" ||
typeof arg.sso_region === "string" ||
typeof arg.sso_role_name === "string");
exports.isSsoProfile = isSsoProfile;
/***/ }),
/***/ 94729:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveSSOCredentials = void 0;
const client_sso_1 = __nccwpck_require__(82666);
const token_providers_1 = __nccwpck_require__(52843);
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const SHOULD_FAIL_CREDENTIAL_CHAIN = false;
const resolveSSOCredentials = async ({ ssoStartUrl, ssoSession, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, profile, }) => {
let token;
const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`;
if (ssoSession) {
try {
const _token = await (0, token_providers_1.fromSso)({ profile })();
token = {
accessToken: _token.token,
expiresAt: new Date(_token.expiration).toISOString(),
};
}
catch (e) {
throw new property_provider_1.CredentialsProviderError(e.message, SHOULD_FAIL_CREDENTIAL_CHAIN);
}
}
else {
try {
token = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoStartUrl);
}
catch (e) {
throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN);
}
}
if (new Date(token.expiresAt).getTime() - Date.now() <= 0) {
throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN);
}
const { accessToken } = token;
const sso = ssoClient || new client_sso_1.SSOClient({ region: ssoRegion });
let ssoResp;
try {
ssoResp = await sso.send(new client_sso_1.GetRoleCredentialsCommand({
accountId: ssoAccountId,
roleName: ssoRoleName,
accessToken,
}));
}
catch (e) {
throw property_provider_1.CredentialsProviderError.from(e, SHOULD_FAIL_CREDENTIAL_CHAIN);
}
const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration } = {} } = ssoResp;
if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) {
throw new property_provider_1.CredentialsProviderError("SSO returns an invalid temporary credential.", SHOULD_FAIL_CREDENTIAL_CHAIN);
}
return { accessKeyId, secretAccessKey, sessionToken, expiration: new Date(expiration) };
};
exports.resolveSSOCredentials = resolveSSOCredentials;
/***/ }),
/***/ 86623:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 48098:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.validateSsoProfile = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const validateSsoProfile = (profile) => {
const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile;
if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) {
throw new property_provider_1.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", ` +
`"sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}\nReference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, false);
}
return profile;
};
exports.validateSsoProfile = validateSsoProfile;
/***/ }),
/***/ 35614:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromTokenFile = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fs_1 = __nccwpck_require__(57147);
const fromWebToken_1 = __nccwpck_require__(47905);
const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE";
const ENV_ROLE_ARN = "AWS_ROLE_ARN";
const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME";
const fromTokenFile = (init = {}) => async () => {
var _a, _b, _c;
const webIdentityTokenFile = (_a = init === null || init === void 0 ? void 0 : init.webIdentityTokenFile) !== null && _a !== void 0 ? _a : process.env[ENV_TOKEN_FILE];
const roleArn = (_b = init === null || init === void 0 ? void 0 : init.roleArn) !== null && _b !== void 0 ? _b : process.env[ENV_ROLE_ARN];
const roleSessionName = (_c = init === null || init === void 0 ? void 0 : init.roleSessionName) !== null && _c !== void 0 ? _c : process.env[ENV_ROLE_SESSION_NAME];
if (!webIdentityTokenFile || !roleArn) {
throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified");
}
return (0, fromWebToken_1.fromWebToken)({
...init,
webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }),
roleArn,
roleSessionName,
})();
};
exports.fromTokenFile = fromTokenFile;
/***/ }),
/***/ 47905:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromWebToken = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fromWebToken = (init) => () => {
const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds, roleAssumerWithWebIdentity, } = init;
if (!roleAssumerWithWebIdentity) {
throw new property_provider_1.CredentialsProviderError(`Role Arn '${roleArn}' needs to be assumed with web identity,` +
` but no role assumption callback was provided.`, false);
}
return roleAssumerWithWebIdentity({
RoleArn: roleArn,
RoleSessionName: roleSessionName !== null && roleSessionName !== void 0 ? roleSessionName : `aws-sdk-js-session-${Date.now()}`,
WebIdentityToken: webIdentityToken,
ProviderId: providerId,
PolicyArns: policyArns,
Policy: policy,
DurationSeconds: durationSeconds,
});
};
exports.fromWebToken = fromWebToken;
/***/ }),
/***/ 15646:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(35614), exports);
tslib_1.__exportStar(__nccwpck_require__(47905), exports);
/***/ }),
/***/ 22545:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getHostHeaderPlugin = exports.hostHeaderMiddlewareOptions = exports.hostHeaderMiddleware = exports.resolveHostHeaderConfig = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
function resolveHostHeaderConfig(input) {
return input;
}
exports.resolveHostHeaderConfig = resolveHostHeaderConfig;
const hostHeaderMiddleware = (options) => (next) => async (args) => {
if (!protocol_http_1.HttpRequest.isInstance(args.request))
return next(args);
const { request } = args;
const { handlerProtocol = "" } = options.requestHandler.metadata || {};
if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) {
delete request.headers["host"];
request.headers[":authority"] = request.hostname + (request.port ? ":" + request.port : "");
}
else if (!request.headers["host"]) {
let host = request.hostname;
if (request.port != null)
host += `:${request.port}`;
request.headers["host"] = host;
}
return next(args);
};
exports.hostHeaderMiddleware = hostHeaderMiddleware;
exports.hostHeaderMiddlewareOptions = {
name: "hostHeaderMiddleware",
step: "build",
priority: "low",
tags: ["HOST"],
override: true,
};
const getHostHeaderPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.add((0, exports.hostHeaderMiddleware)(options), exports.hostHeaderMiddlewareOptions);
},
});
exports.getHostHeaderPlugin = getHostHeaderPlugin;
/***/ }),
/***/ 20014:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(9754), exports);
/***/ }),
/***/ 9754:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getLoggerPlugin = exports.loggerMiddlewareOptions = exports.loggerMiddleware = void 0;
const loggerMiddleware = () => (next, context) => async (args) => {
var _a, _b;
try {
const response = await next(args);
const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context;
const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions;
const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog;
const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog !== null && overrideOutputFilterSensitiveLog !== void 0 ? overrideOutputFilterSensitiveLog : context.outputFilterSensitiveLog;
const { $metadata, ...outputWithoutMetadata } = response.output;
(_a = logger === null || logger === void 0 ? void 0 : logger.info) === null || _a === void 0 ? void 0 : _a.call(logger, {
clientName,
commandName,
input: inputFilterSensitiveLog(args.input),
output: outputFilterSensitiveLog(outputWithoutMetadata),
metadata: $metadata,
});
return response;
}
catch (error) {
const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context;
const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions;
const inputFilterSensitiveLog = overrideInputFilterSensitiveLog !== null && overrideInputFilterSensitiveLog !== void 0 ? overrideInputFilterSensitiveLog : context.inputFilterSensitiveLog;
(_b = logger === null || logger === void 0 ? void 0 : logger.error) === null || _b === void 0 ? void 0 : _b.call(logger, {
clientName,
commandName,
input: inputFilterSensitiveLog(args.input),
error,
metadata: error.$metadata,
});
throw error;
}
};
exports.loggerMiddleware = loggerMiddleware;
exports.loggerMiddlewareOptions = {
name: "loggerMiddleware",
tags: ["LOGGER"],
step: "initialize",
override: true,
};
const getLoggerPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.add((0, exports.loggerMiddleware)(), exports.loggerMiddlewareOptions);
},
});
exports.getLoggerPlugin = getLoggerPlugin;
/***/ }),
/***/ 85525:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRecursionDetectionPlugin = exports.addRecursionDetectionMiddlewareOptions = exports.recursionDetectionMiddleware = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id";
const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME";
const ENV_TRACE_ID = "_X_AMZN_TRACE_ID";
const recursionDetectionMiddleware = (options) => (next) => async (args) => {
const { request } = args;
if (!protocol_http_1.HttpRequest.isInstance(request) ||
options.runtime !== "node" ||
request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) {
return next(args);
}
const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME];
const traceId = process.env[ENV_TRACE_ID];
const nonEmptyString = (str) => typeof str === "string" && str.length > 0;
if (nonEmptyString(functionName) && nonEmptyString(traceId)) {
request.headers[TRACE_ID_HEADER_NAME] = traceId;
}
return next({
...args,
request,
});
};
exports.recursionDetectionMiddleware = recursionDetectionMiddleware;
exports.addRecursionDetectionMiddlewareOptions = {
step: "build",
tags: ["RECURSION_DETECTION"],
name: "recursionDetectionMiddleware",
override: true,
priority: "low",
};
const getRecursionDetectionPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.add((0, exports.recursionDetectionMiddleware)(options), exports.addRecursionDetectionMiddlewareOptions);
},
});
exports.getRecursionDetectionPlugin = getRecursionDetectionPlugin;
/***/ }),
/***/ 55959:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveStsAuthConfig = void 0;
const middleware_signing_1 = __nccwpck_require__(14935);
const resolveStsAuthConfig = (input, { stsClientCtor }) => (0, middleware_signing_1.resolveAwsAuthConfig)({
...input,
stsClientCtor,
});
exports.resolveStsAuthConfig = resolveStsAuthConfig;
/***/ }),
/***/ 84193:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveSigV4AuthConfig = exports.resolveAwsAuthConfig = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const signature_v4_1 = __nccwpck_require__(11528);
const util_middleware_1 = __nccwpck_require__(2390);
const CREDENTIAL_EXPIRE_WINDOW = 300000;
const resolveAwsAuthConfig = (input) => {
const normalizedCreds = input.credentials
? normalizeCredentialProvider(input.credentials)
: input.credentialDefaultProvider(input);
const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input;
let signer;
if (input.signer) {
signer = (0, util_middleware_1.normalizeProvider)(input.signer);
}
else if (input.regionInfoProvider) {
signer = () => (0, util_middleware_1.normalizeProvider)(input.region)()
.then(async (region) => [
(await input.regionInfoProvider(region, {
useFipsEndpoint: await input.useFipsEndpoint(),
useDualstackEndpoint: await input.useDualstackEndpoint(),
})) || {},
region,
])
.then(([regionInfo, region]) => {
const { signingRegion, signingService } = regionInfo;
input.signingRegion = input.signingRegion || signingRegion || region;
input.signingName = input.signingName || signingService || input.serviceId;
const params = {
...input,
credentials: normalizedCreds,
region: input.signingRegion,
service: input.signingName,
sha256,
uriEscapePath: signingEscapePath,
};
const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4;
return new SignerCtor(params);
});
}
else {
signer = async (authScheme) => {
authScheme = Object.assign({}, {
name: "sigv4",
signingName: input.signingName || input.defaultSigningName,
signingRegion: await (0, util_middleware_1.normalizeProvider)(input.region)(),
properties: {},
}, authScheme);
const signingRegion = authScheme.signingRegion;
const signingService = authScheme.signingName;
input.signingRegion = input.signingRegion || signingRegion;
input.signingName = input.signingName || signingService || input.serviceId;
const params = {
...input,
credentials: normalizedCreds,
region: input.signingRegion,
service: input.signingName,
sha256,
uriEscapePath: signingEscapePath,
};
const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4;
return new SignerCtor(params);
};
}
return {
...input,
systemClockOffset,
signingEscapePath,
credentials: normalizedCreds,
signer,
};
};
exports.resolveAwsAuthConfig = resolveAwsAuthConfig;
const resolveSigV4AuthConfig = (input) => {
const normalizedCreds = input.credentials
? normalizeCredentialProvider(input.credentials)
: input.credentialDefaultProvider(input);
const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input;
let signer;
if (input.signer) {
signer = (0, util_middleware_1.normalizeProvider)(input.signer);
}
else {
signer = (0, util_middleware_1.normalizeProvider)(new signature_v4_1.SignatureV4({
credentials: normalizedCreds,
region: input.region,
service: input.signingName,
sha256,
uriEscapePath: signingEscapePath,
}));
}
return {
...input,
systemClockOffset,
signingEscapePath,
credentials: normalizedCreds,
signer,
};
};
exports.resolveSigV4AuthConfig = resolveSigV4AuthConfig;
const normalizeCredentialProvider = (credentials) => {
if (typeof credentials === "function") {
return (0, property_provider_1.memoize)(credentials, (credentials) => credentials.expiration !== undefined &&
credentials.expiration.getTime() - Date.now() < CREDENTIAL_EXPIRE_WINDOW, (credentials) => credentials.expiration !== undefined);
}
return (0, util_middleware_1.normalizeProvider)(credentials);
};
/***/ }),
/***/ 88053:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin = exports.awsAuthMiddlewareOptions = exports.awsAuthMiddleware = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const getSkewCorrectedDate_1 = __nccwpck_require__(68253);
const getUpdatedSystemClockOffset_1 = __nccwpck_require__(35863);
const awsAuthMiddleware = (options) => (next, context) => async function (args) {
var _a, _b, _c, _d;
if (!protocol_http_1.HttpRequest.isInstance(args.request))
return next(args);
const authScheme = (_c = (_b = (_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.properties) === null || _b === void 0 ? void 0 : _b.authSchemes) === null || _c === void 0 ? void 0 : _c[0];
const multiRegionOverride = (authScheme === null || authScheme === void 0 ? void 0 : authScheme.name) === "sigv4a" ? (_d = authScheme === null || authScheme === void 0 ? void 0 : authScheme.signingRegionSet) === null || _d === void 0 ? void 0 : _d.join(",") : undefined;
const signer = await options.signer(authScheme);
let signedRequest;
const signingOptions = {
signingDate: (0, getSkewCorrectedDate_1.getSkewCorrectedDate)(options.systemClockOffset),
signingRegion: multiRegionOverride || context["signing_region"],
signingService: context["signing_service"],
};
if (context.s3ExpressIdentity) {
const sigV4MultiRegion = signer;
signedRequest = await sigV4MultiRegion.signWithCredentials(args.request, context.s3ExpressIdentity, signingOptions);
if (signedRequest.headers["X-Amz-Security-Token"] || signedRequest.headers["x-amz-security-token"]) {
throw new Error("X-Amz-Security-Token must not be set for s3-express requests.");
}
}
else {
signedRequest = await signer.sign(args.request, signingOptions);
}
const output = await next({
...args,
request: signedRequest,
}).catch((error) => {
var _a;
const serverTime = (_a = error.ServerTime) !== null && _a !== void 0 ? _a : getDateHeader(error.$response);
if (serverTime) {
options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(serverTime, options.systemClockOffset);
}
throw error;
});
const dateHeader = getDateHeader(output.response);
if (dateHeader) {
options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(dateHeader, options.systemClockOffset);
}
return output;
};
exports.awsAuthMiddleware = awsAuthMiddleware;
const getDateHeader = (response) => { var _a, _b, _c; return protocol_http_1.HttpResponse.isInstance(response) ? (_b = (_a = response.headers) === null || _a === void 0 ? void 0 : _a.date) !== null && _b !== void 0 ? _b : (_c = response.headers) === null || _c === void 0 ? void 0 : _c.Date : undefined; };
exports.awsAuthMiddlewareOptions = {
name: "awsAuthMiddleware",
tags: ["SIGNATURE", "AWSAUTH"],
relation: "after",
toMiddleware: "retryMiddleware",
override: true,
};
const getAwsAuthPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.addRelativeTo((0, exports.awsAuthMiddleware)(options), exports.awsAuthMiddlewareOptions);
},
});
exports.getAwsAuthPlugin = getAwsAuthPlugin;
exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin;
/***/ }),
/***/ 14935:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(84193), exports);
tslib_1.__exportStar(__nccwpck_require__(88053), exports);
/***/ }),
/***/ 68253:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSkewCorrectedDate = void 0;
const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset);
exports.getSkewCorrectedDate = getSkewCorrectedDate;
/***/ }),
/***/ 35863:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getUpdatedSystemClockOffset = void 0;
const isClockSkewed_1 = __nccwpck_require__(85301);
const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => {
const clockTimeInMs = Date.parse(clockTime);
if ((0, isClockSkewed_1.isClockSkewed)(clockTimeInMs, currentSystemClockOffset)) {
return clockTimeInMs - Date.now();
}
return currentSystemClockOffset;
};
exports.getUpdatedSystemClockOffset = getUpdatedSystemClockOffset;
/***/ }),
/***/ 85301:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isClockSkewed = void 0;
const getSkewCorrectedDate_1 = __nccwpck_require__(68253);
const isClockSkewed = (clockTime, systemClockOffset) => Math.abs((0, getSkewCorrectedDate_1.getSkewCorrectedDate)(systemClockOffset).getTime() - clockTime) >= 300000;
exports.isClockSkewed = isClockSkewed;
/***/ }),
/***/ 36546:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveUserAgentConfig = void 0;
function resolveUserAgentConfig(input) {
return {
...input,
customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent,
};
}
exports.resolveUserAgentConfig = resolveUserAgentConfig;
/***/ }),
/***/ 28025:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.UA_ESCAPE_CHAR = exports.UA_VALUE_ESCAPE_REGEX = exports.UA_NAME_ESCAPE_REGEX = exports.UA_NAME_SEPARATOR = exports.SPACE = exports.X_AMZ_USER_AGENT = exports.USER_AGENT = void 0;
exports.USER_AGENT = "user-agent";
exports.X_AMZ_USER_AGENT = "x-amz-user-agent";
exports.SPACE = " ";
exports.UA_NAME_SEPARATOR = "/";
exports.UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g;
exports.UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g;
exports.UA_ESCAPE_CHAR = "-";
/***/ }),
/***/ 64688:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(36546), exports);
tslib_1.__exportStar(__nccwpck_require__(76236), exports);
/***/ }),
/***/ 76236:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getUserAgentPlugin = exports.getUserAgentMiddlewareOptions = exports.userAgentMiddleware = void 0;
const util_endpoints_1 = __nccwpck_require__(13350);
const protocol_http_1 = __nccwpck_require__(64418);
const constants_1 = __nccwpck_require__(28025);
const userAgentMiddleware = (options) => (next, context) => async (args) => {
var _a, _b;
const { request } = args;
if (!protocol_http_1.HttpRequest.isInstance(request))
return next(args);
const { headers } = request;
const userAgent = ((_a = context === null || context === void 0 ? void 0 : context.userAgent) === null || _a === void 0 ? void 0 : _a.map(escapeUserAgent)) || [];
const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent);
const customUserAgent = ((_b = options === null || options === void 0 ? void 0 : options.customUserAgent) === null || _b === void 0 ? void 0 : _b.map(escapeUserAgent)) || [];
const prefix = (0, util_endpoints_1.getUserAgentPrefix)();
const sdkUserAgentValue = (prefix ? [prefix] : [])
.concat([...defaultUserAgent, ...userAgent, ...customUserAgent])
.join(constants_1.SPACE);
const normalUAValue = [
...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")),
...customUserAgent,
].join(constants_1.SPACE);
if (options.runtime !== "browser") {
if (normalUAValue) {
headers[constants_1.X_AMZ_USER_AGENT] = headers[constants_1.X_AMZ_USER_AGENT]
? `${headers[constants_1.USER_AGENT]} ${normalUAValue}`
: normalUAValue;
}
headers[constants_1.USER_AGENT] = sdkUserAgentValue;
}
else {
headers[constants_1.X_AMZ_USER_AGENT] = sdkUserAgentValue;
}
return next({
...args,
request,
});
};
exports.userAgentMiddleware = userAgentMiddleware;
const escapeUserAgent = (userAgentPair) => {
var _a;
const name = userAgentPair[0]
.split(constants_1.UA_NAME_SEPARATOR)
.map((part) => part.replace(constants_1.UA_NAME_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR))
.join(constants_1.UA_NAME_SEPARATOR);
const version = (_a = userAgentPair[1]) === null || _a === void 0 ? void 0 : _a.replace(constants_1.UA_VALUE_ESCAPE_REGEX, constants_1.UA_ESCAPE_CHAR);
const prefixSeparatorIndex = name.indexOf(constants_1.UA_NAME_SEPARATOR);
const prefix = name.substring(0, prefixSeparatorIndex);
let uaName = name.substring(prefixSeparatorIndex + 1);
if (prefix === "api") {
uaName = uaName.toLowerCase();
}
return [prefix, uaName, version]
.filter((item) => item && item.length > 0)
.reduce((acc, item, index) => {
switch (index) {
case 0:
return item;
case 1:
return `${acc}/${item}`;
default:
return `${acc}#${item}`;
}
}, "");
};
exports.getUserAgentMiddlewareOptions = {
name: "getUserAgentMiddleware",
step: "build",
priority: "low",
tags: ["SET_USER_AGENT", "USER_AGENT"],
override: true,
};
const getUserAgentPlugin = (config) => ({
applyToStack: (clientStack) => {
clientStack.add((0, exports.userAgentMiddleware)(config), exports.getUserAgentMiddlewareOptions);
},
});
exports.getUserAgentPlugin = getUserAgentPlugin;
/***/ }),
/***/ 60079:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveAwsRegionExtensionConfiguration = exports.getAwsRegionExtensionConfiguration = void 0;
const getAwsRegionExtensionConfiguration = (runtimeConfig) => {
let runtimeConfigRegion = async () => {
if (runtimeConfig.region === undefined) {
throw new Error("Region is missing from runtimeConfig");
}
const region = runtimeConfig.region;
if (typeof region === "string") {
return region;
}
return region();
};
return {
setRegion(region) {
runtimeConfigRegion = region;
},
region() {
return runtimeConfigRegion;
},
};
};
exports.getAwsRegionExtensionConfiguration = getAwsRegionExtensionConfiguration;
const resolveAwsRegionExtensionConfiguration = (awsRegionExtensionConfiguration) => {
return {
region: awsRegionExtensionConfiguration.region(),
};
};
exports.resolveAwsRegionExtensionConfiguration = resolveAwsRegionExtensionConfiguration;
/***/ }),
/***/ 18156:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(60079), exports);
tslib_1.__exportStar(__nccwpck_require__(17177), exports);
/***/ }),
/***/ 60123:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0;
exports.REGION_ENV_NAME = "AWS_REGION";
exports.REGION_INI_NAME = "region";
exports.NODE_REGION_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME],
configFileSelector: (profile) => profile[exports.REGION_INI_NAME],
default: () => {
throw new Error("Region is missing");
},
};
exports.NODE_REGION_CONFIG_FILE_OPTIONS = {
preferredFile: "credentials",
};
/***/ }),
/***/ 30048:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRealRegion = void 0;
const isFipsRegion_1 = __nccwpck_require__(37257);
const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region)
? ["fips-aws-global", "aws-fips"].includes(region)
? "us-east-1"
: region.replace(/fips-(dkr-|prod-)?|-fips/, "")
: region;
exports.getRealRegion = getRealRegion;
/***/ }),
/***/ 17177:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(60123), exports);
tslib_1.__exportStar(__nccwpck_require__(46187), exports);
/***/ }),
/***/ 37257:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isFipsRegion = void 0;
const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips"));
exports.isFipsRegion = isFipsRegion;
/***/ }),
/***/ 46187:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveRegionConfig = void 0;
const getRealRegion_1 = __nccwpck_require__(30048);
const isFipsRegion_1 = __nccwpck_require__(37257);
const resolveRegionConfig = (input) => {
const { region, useFipsEndpoint } = input;
if (!region) {
throw new Error("Region is missing");
}
return {
...input,
region: async () => {
if (typeof region === "string") {
return (0, getRealRegion_1.getRealRegion)(region);
}
const providedRegion = await region();
return (0, getRealRegion_1.getRealRegion)(providedRegion);
},
useFipsEndpoint: async () => {
const providedRegion = typeof region === "string" ? region : await region();
if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) {
return true;
}
return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint();
},
};
};
exports.resolveRegionConfig = resolveRegionConfig;
/***/ }),
/***/ 52664:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.UnsupportedGrantTypeException = exports.UnauthorizedClientException = exports.SlowDownException = exports.SSOOIDCClient = exports.InvalidScopeException = exports.InvalidRequestException = exports.InvalidClientException = exports.InternalServerException = exports.ExpiredTokenException = exports.CreateTokenCommand = exports.AuthorizationPendingException = exports.AccessDeniedException = void 0;
const middleware_host_header_1 = __nccwpck_require__(22545);
const middleware_logger_1 = __nccwpck_require__(20014);
const middleware_recursion_detection_1 = __nccwpck_require__(85525);
const middleware_user_agent_1 = __nccwpck_require__(64688);
const config_resolver_1 = __nccwpck_require__(53098);
const middleware_content_length_1 = __nccwpck_require__(82800);
const middleware_endpoint_1 = __nccwpck_require__(82918);
const middleware_retry_1 = __nccwpck_require__(96039);
const smithy_client_1 = __nccwpck_require__(63570);
var resolveClientEndpointParameters = (options) => {
var _a, _b;
return {
...options,
useDualstackEndpoint: (_a = options.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false,
useFipsEndpoint: (_b = options.useFipsEndpoint) !== null && _b !== void 0 ? _b : false,
defaultSigningName: "awsssooidc",
};
};
var package_default = { version: "3.429.0" };
const util_user_agent_node_1 = __nccwpck_require__(98095);
const config_resolver_2 = __nccwpck_require__(53098);
const hash_node_1 = __nccwpck_require__(3081);
const middleware_retry_2 = __nccwpck_require__(96039);
const node_config_provider_1 = __nccwpck_require__(33461);
const node_http_handler_1 = __nccwpck_require__(20258);
const util_body_length_node_1 = __nccwpck_require__(68075);
const util_retry_1 = __nccwpck_require__(84902);
const smithy_client_2 = __nccwpck_require__(63570);
const url_parser_1 = __nccwpck_require__(14681);
const util_base64_1 = __nccwpck_require__(75600);
const util_utf8_1 = __nccwpck_require__(41895);
const util_endpoints_1 = __nccwpck_require__(45473);
var s = "required";
var t = "fn";
var u = "argv";
var v = "ref";
var a = "isSet";
var b = "tree";
var c = "error";
var d = "endpoint";
var e = "PartitionResult";
var f = "getAttr";
var g = { [s]: false, type: "String" };
var h = { [s]: true, default: false, type: "Boolean" };
var i = { [v]: "Endpoint" };
var j = { [t]: "booleanEquals", [u]: [{ [v]: "UseFIPS" }, true] };
var k = { [t]: "booleanEquals", [u]: [{ [v]: "UseDualStack" }, true] };
var l = {};
var m = { [t]: "booleanEquals", [u]: [true, { [t]: f, [u]: [{ [v]: e }, "supportsFIPS"] }] };
var n = { [v]: e };
var o = { [t]: "booleanEquals", [u]: [true, { [t]: f, [u]: [n, "supportsDualStack"] }] };
var p = [j];
var q = [k];
var r = [{ [v]: "Region" }];
var _data = {
version: "1.0",
parameters: { Region: g, UseDualStack: h, UseFIPS: h, Endpoint: g },
rules: [
{
conditions: [{ [t]: a, [u]: [i] }],
type: b,
rules: [
{ conditions: p, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: c },
{ conditions: q, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: c },
{ endpoint: { url: i, properties: l, headers: l }, type: d },
],
},
{
conditions: [{ [t]: a, [u]: r }],
type: b,
rules: [
{
conditions: [{ [t]: "aws.partition", [u]: r, assign: e }],
type: b,
rules: [
{
conditions: [j, k],
type: b,
rules: [
{
conditions: [m, o],
type: b,
rules: [
{
endpoint: {
url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}",
properties: l,
headers: l,
},
type: d,
},
],
},
{ error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: c },
],
},
{
conditions: p,
type: b,
rules: [
{
conditions: [m],
type: b,
rules: [
{
conditions: [{ [t]: "stringEquals", [u]: ["aws-us-gov", { [t]: f, [u]: [n, "name"] }] }],
endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: l, headers: l },
type: d,
},
{
endpoint: {
url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}",
properties: l,
headers: l,
},
type: d,
},
],
},
{ error: "FIPS is enabled but this partition does not support FIPS", type: c },
],
},
{
conditions: q,
type: b,
rules: [
{
conditions: [o],
type: b,
rules: [
{
endpoint: {
url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}",
properties: l,
headers: l,
},
type: d,
},
],
},
{ error: "DualStack is enabled but this partition does not support DualStack", type: c },
],
},
{
endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: l, headers: l },
type: d,
},
],
},
],
},
{ error: "Invalid Configuration: Missing Region", type: c },
],
};
var ruleSet = _data;
var defaultEndpointResolver = (endpointParams, context = {}) => {
return (0, util_endpoints_1.resolveEndpoint)(ruleSet, {
endpointParams,
logger: context.logger,
});
};
var getRuntimeConfig = (config) => {
var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k;
return ({
apiVersion: "2019-06-10",
base64Decoder: (_a = config === null || config === void 0 ? void 0 : config.base64Decoder) !== null && _a !== void 0 ? _a : util_base64_1.fromBase64,
base64Encoder: (_b = config === null || config === void 0 ? void 0 : config.base64Encoder) !== null && _b !== void 0 ? _b : util_base64_1.toBase64,
disableHostPrefix: (_c = config === null || config === void 0 ? void 0 : config.disableHostPrefix) !== null && _c !== void 0 ? _c : false,
endpointProvider: (_d = config === null || config === void 0 ? void 0 : config.endpointProvider) !== null && _d !== void 0 ? _d : defaultEndpointResolver,
extensions: (_e = config === null || config === void 0 ? void 0 : config.extensions) !== null && _e !== void 0 ? _e : [],
logger: (_f = config === null || config === void 0 ? void 0 : config.logger) !== null && _f !== void 0 ? _f : new smithy_client_2.NoOpLogger(),
serviceId: (_g = config === null || config === void 0 ? void 0 : config.serviceId) !== null && _g !== void 0 ? _g : "SSO OIDC",
urlParser: (_h = config === null || config === void 0 ? void 0 : config.urlParser) !== null && _h !== void 0 ? _h : url_parser_1.parseUrl,
utf8Decoder: (_j = config === null || config === void 0 ? void 0 : config.utf8Decoder) !== null && _j !== void 0 ? _j : util_utf8_1.fromUtf8,
utf8Encoder: (_k = config === null || config === void 0 ? void 0 : config.utf8Encoder) !== null && _k !== void 0 ? _k : util_utf8_1.toUtf8,
});
};
const smithy_client_3 = __nccwpck_require__(63570);
const util_defaults_mode_node_1 = __nccwpck_require__(72429);
const smithy_client_4 = __nccwpck_require__(63570);
var getRuntimeConfig2 = (config) => {
var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k;
(0, smithy_client_4.emitWarningIfUnsupportedVersion)(process.version);
const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config);
const defaultConfigProvider = () => defaultsMode().then(smithy_client_3.loadConfigsForDefaultMode);
const clientSharedValues = getRuntimeConfig(config);
return {
...clientSharedValues,
...config,
runtime: "node",
defaultsMode,
bodyLengthChecker: (_a = config === null || config === void 0 ? void 0 : config.bodyLengthChecker) !== null && _a !== void 0 ? _a : util_body_length_node_1.calculateBodyLength,
defaultUserAgentProvider: (_b = config === null || config === void 0 ? void 0 : config.defaultUserAgentProvider) !== null && _b !== void 0 ? _b : (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_default.version }),
maxAttempts: (_c = config === null || config === void 0 ? void 0 : config.maxAttempts) !== null && _c !== void 0 ? _c : (0, node_config_provider_1.loadConfig)(middleware_retry_2.NODE_MAX_ATTEMPT_CONFIG_OPTIONS),
region: (_d = config === null || config === void 0 ? void 0 : config.region) !== null && _d !== void 0 ? _d : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_REGION_CONFIG_OPTIONS, config_resolver_2.NODE_REGION_CONFIG_FILE_OPTIONS),
requestHandler: (_e = config === null || config === void 0 ? void 0 : config.requestHandler) !== null && _e !== void 0 ? _e : new node_http_handler_1.NodeHttpHandler(defaultConfigProvider),
retryMode: (_f = config === null || config === void 0 ? void 0 : config.retryMode) !== null && _f !== void 0 ? _f : (0, node_config_provider_1.loadConfig)({
...middleware_retry_2.NODE_RETRY_MODE_CONFIG_OPTIONS,
default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE,
}),
sha256: (_g = config === null || config === void 0 ? void 0 : config.sha256) !== null && _g !== void 0 ? _g : hash_node_1.Hash.bind(null, "sha256"),
streamCollector: (_h = config === null || config === void 0 ? void 0 : config.streamCollector) !== null && _h !== void 0 ? _h : node_http_handler_1.streamCollector,
useDualstackEndpoint: (_j = config === null || config === void 0 ? void 0 : config.useDualstackEndpoint) !== null && _j !== void 0 ? _j : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS),
useFipsEndpoint: (_k = config === null || config === void 0 ? void 0 : config.useFipsEndpoint) !== null && _k !== void 0 ? _k : (0, node_config_provider_1.loadConfig)(config_resolver_2.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS),
};
};
const region_config_resolver_1 = __nccwpck_require__(18156);
const protocol_http_1 = __nccwpck_require__(64418);
const smithy_client_5 = __nccwpck_require__(63570);
var asPartial = (t2) => t2;
var resolveRuntimeExtensions = (runtimeConfig, extensions) => {
const extensionConfiguration = {
...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)),
...asPartial((0, smithy_client_5.getDefaultExtensionConfiguration)(runtimeConfig)),
...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)),
};
extensions.forEach((extension) => extension.configure(extensionConfiguration));
return {
...runtimeConfig,
...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration),
...(0, smithy_client_5.resolveDefaultRuntimeConfig)(extensionConfiguration),
...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration),
};
};
var SSOOIDCClient = class extends smithy_client_1.Client {
constructor(...[configuration]) {
const _config_0 = getRuntimeConfig2(configuration || {});
const _config_1 = resolveClientEndpointParameters(_config_0);
const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1);
const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2);
const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3);
const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4);
const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5);
const _config_7 = resolveRuntimeExtensions(_config_6, (configuration === null || configuration === void 0 ? void 0 : configuration.extensions) || []);
super(_config_7);
this.config = _config_7;
this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config));
this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config));
this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config));
this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config));
this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config));
this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config));
}
destroy() {
super.destroy();
}
};
exports.SSOOIDCClient = SSOOIDCClient;
const smithy_client_6 = __nccwpck_require__(63570);
const middleware_endpoint_2 = __nccwpck_require__(82918);
const middleware_serde_1 = __nccwpck_require__(81238);
const smithy_client_7 = __nccwpck_require__(63570);
const types_1 = __nccwpck_require__(55756);
const protocol_http_2 = __nccwpck_require__(64418);
const smithy_client_8 = __nccwpck_require__(63570);
const smithy_client_9 = __nccwpck_require__(63570);
var SSOOIDCServiceException = class _SSOOIDCServiceException extends smithy_client_9.ServiceException {
constructor(options) {
super(options);
Object.setPrototypeOf(this, _SSOOIDCServiceException.prototype);
}
};
var AccessDeniedException = class _AccessDeniedException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "AccessDeniedException",
$fault: "client",
...opts,
});
this.name = "AccessDeniedException";
this.$fault = "client";
Object.setPrototypeOf(this, _AccessDeniedException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.AccessDeniedException = AccessDeniedException;
var AuthorizationPendingException = class _AuthorizationPendingException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "AuthorizationPendingException",
$fault: "client",
...opts,
});
this.name = "AuthorizationPendingException";
this.$fault = "client";
Object.setPrototypeOf(this, _AuthorizationPendingException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.AuthorizationPendingException = AuthorizationPendingException;
var ExpiredTokenException = class _ExpiredTokenException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "ExpiredTokenException",
$fault: "client",
...opts,
});
this.name = "ExpiredTokenException";
this.$fault = "client";
Object.setPrototypeOf(this, _ExpiredTokenException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.ExpiredTokenException = ExpiredTokenException;
var InternalServerException = class _InternalServerException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InternalServerException",
$fault: "server",
...opts,
});
this.name = "InternalServerException";
this.$fault = "server";
Object.setPrototypeOf(this, _InternalServerException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.InternalServerException = InternalServerException;
var InvalidClientException = class _InvalidClientException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InvalidClientException",
$fault: "client",
...opts,
});
this.name = "InvalidClientException";
this.$fault = "client";
Object.setPrototypeOf(this, _InvalidClientException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.InvalidClientException = InvalidClientException;
var InvalidGrantException = class _InvalidGrantException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InvalidGrantException",
$fault: "client",
...opts,
});
this.name = "InvalidGrantException";
this.$fault = "client";
Object.setPrototypeOf(this, _InvalidGrantException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
var InvalidRequestException = class _InvalidRequestException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InvalidRequestException",
$fault: "client",
...opts,
});
this.name = "InvalidRequestException";
this.$fault = "client";
Object.setPrototypeOf(this, _InvalidRequestException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.InvalidRequestException = InvalidRequestException;
var InvalidScopeException = class _InvalidScopeException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InvalidScopeException",
$fault: "client",
...opts,
});
this.name = "InvalidScopeException";
this.$fault = "client";
Object.setPrototypeOf(this, _InvalidScopeException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.InvalidScopeException = InvalidScopeException;
var SlowDownException = class _SlowDownException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "SlowDownException",
$fault: "client",
...opts,
});
this.name = "SlowDownException";
this.$fault = "client";
Object.setPrototypeOf(this, _SlowDownException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.SlowDownException = SlowDownException;
var UnauthorizedClientException = class _UnauthorizedClientException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "UnauthorizedClientException",
$fault: "client",
...opts,
});
this.name = "UnauthorizedClientException";
this.$fault = "client";
Object.setPrototypeOf(this, _UnauthorizedClientException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.UnauthorizedClientException = UnauthorizedClientException;
var UnsupportedGrantTypeException = class _UnsupportedGrantTypeException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "UnsupportedGrantTypeException",
$fault: "client",
...opts,
});
this.name = "UnsupportedGrantTypeException";
this.$fault = "client";
Object.setPrototypeOf(this, _UnsupportedGrantTypeException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
exports.UnsupportedGrantTypeException = UnsupportedGrantTypeException;
var InvalidClientMetadataException = class _InvalidClientMetadataException extends SSOOIDCServiceException {
constructor(opts) {
super({
name: "InvalidClientMetadataException",
$fault: "client",
...opts,
});
this.name = "InvalidClientMetadataException";
this.$fault = "client";
Object.setPrototypeOf(this, _InvalidClientMetadataException.prototype);
this.error = opts.error;
this.error_description = opts.error_description;
}
};
var se_CreateTokenCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = {
"content-type": "application/json",
};
const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/token`;
let body;
body = JSON.stringify((0, smithy_client_8.take)(input, {
clientId: [],
clientSecret: [],
code: [],
deviceCode: [],
grantType: [],
redirectUri: [],
refreshToken: [],
scope: (_) => (0, smithy_client_8._json)(_),
}));
return new protocol_http_2.HttpRequest({
protocol,
hostname,
port,
method: "POST",
headers,
path: resolvedPath,
body,
});
};
var se_RegisterClientCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = {
"content-type": "application/json",
};
const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/client/register`;
let body;
body = JSON.stringify((0, smithy_client_8.take)(input, {
clientName: [],
clientType: [],
scopes: (_) => (0, smithy_client_8._json)(_),
}));
return new protocol_http_2.HttpRequest({
protocol,
hostname,
port,
method: "POST",
headers,
path: resolvedPath,
body,
});
};
var se_StartDeviceAuthorizationCommand = async (input, context) => {
const { hostname, protocol = "https", port, path: basePath } = await context.endpoint();
const headers = {
"content-type": "application/json",
};
const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}/device_authorization`;
let body;
body = JSON.stringify((0, smithy_client_8.take)(input, {
clientId: [],
clientSecret: [],
startUrl: [],
}));
return new protocol_http_2.HttpRequest({
protocol,
hostname,
port,
method: "POST",
headers,
path: resolvedPath,
body,
});
};
var de_CreateTokenCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_CreateTokenCommandError(output, context);
}
const contents = (0, smithy_client_8.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_8.expectNonNull)((0, smithy_client_8.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_8.take)(data, {
accessToken: smithy_client_8.expectString,
expiresIn: smithy_client_8.expectInt32,
idToken: smithy_client_8.expectString,
refreshToken: smithy_client_8.expectString,
tokenType: smithy_client_8.expectString,
});
Object.assign(contents, doc);
return contents;
};
var de_CreateTokenCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "AccessDeniedException":
case "com.amazonaws.ssooidc#AccessDeniedException":
throw await de_AccessDeniedExceptionRes(parsedOutput, context);
case "AuthorizationPendingException":
case "com.amazonaws.ssooidc#AuthorizationPendingException":
throw await de_AuthorizationPendingExceptionRes(parsedOutput, context);
case "ExpiredTokenException":
case "com.amazonaws.ssooidc#ExpiredTokenException":
throw await de_ExpiredTokenExceptionRes(parsedOutput, context);
case "InternalServerException":
case "com.amazonaws.ssooidc#InternalServerException":
throw await de_InternalServerExceptionRes(parsedOutput, context);
case "InvalidClientException":
case "com.amazonaws.ssooidc#InvalidClientException":
throw await de_InvalidClientExceptionRes(parsedOutput, context);
case "InvalidGrantException":
case "com.amazonaws.ssooidc#InvalidGrantException":
throw await de_InvalidGrantExceptionRes(parsedOutput, context);
case "InvalidRequestException":
case "com.amazonaws.ssooidc#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "InvalidScopeException":
case "com.amazonaws.ssooidc#InvalidScopeException":
throw await de_InvalidScopeExceptionRes(parsedOutput, context);
case "SlowDownException":
case "com.amazonaws.ssooidc#SlowDownException":
throw await de_SlowDownExceptionRes(parsedOutput, context);
case "UnauthorizedClientException":
case "com.amazonaws.ssooidc#UnauthorizedClientException":
throw await de_UnauthorizedClientExceptionRes(parsedOutput, context);
case "UnsupportedGrantTypeException":
case "com.amazonaws.ssooidc#UnsupportedGrantTypeException":
throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
var de_RegisterClientCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_RegisterClientCommandError(output, context);
}
const contents = (0, smithy_client_8.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_8.expectNonNull)((0, smithy_client_8.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_8.take)(data, {
authorizationEndpoint: smithy_client_8.expectString,
clientId: smithy_client_8.expectString,
clientIdIssuedAt: smithy_client_8.expectLong,
clientSecret: smithy_client_8.expectString,
clientSecretExpiresAt: smithy_client_8.expectLong,
tokenEndpoint: smithy_client_8.expectString,
});
Object.assign(contents, doc);
return contents;
};
var de_RegisterClientCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InternalServerException":
case "com.amazonaws.ssooidc#InternalServerException":
throw await de_InternalServerExceptionRes(parsedOutput, context);
case "InvalidClientMetadataException":
case "com.amazonaws.ssooidc#InvalidClientMetadataException":
throw await de_InvalidClientMetadataExceptionRes(parsedOutput, context);
case "InvalidRequestException":
case "com.amazonaws.ssooidc#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "InvalidScopeException":
case "com.amazonaws.ssooidc#InvalidScopeException":
throw await de_InvalidScopeExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
var de_StartDeviceAuthorizationCommand = async (output, context) => {
if (output.statusCode !== 200 && output.statusCode >= 300) {
return de_StartDeviceAuthorizationCommandError(output, context);
}
const contents = (0, smithy_client_8.map)({
$metadata: deserializeMetadata(output),
});
const data = (0, smithy_client_8.expectNonNull)((0, smithy_client_8.expectObject)(await parseBody(output.body, context)), "body");
const doc = (0, smithy_client_8.take)(data, {
deviceCode: smithy_client_8.expectString,
expiresIn: smithy_client_8.expectInt32,
interval: smithy_client_8.expectInt32,
userCode: smithy_client_8.expectString,
verificationUri: smithy_client_8.expectString,
verificationUriComplete: smithy_client_8.expectString,
});
Object.assign(contents, doc);
return contents;
};
var de_StartDeviceAuthorizationCommandError = async (output, context) => {
const parsedOutput = {
...output,
body: await parseErrorBody(output.body, context),
};
const errorCode = loadRestJsonErrorCode(output, parsedOutput.body);
switch (errorCode) {
case "InternalServerException":
case "com.amazonaws.ssooidc#InternalServerException":
throw await de_InternalServerExceptionRes(parsedOutput, context);
case "InvalidClientException":
case "com.amazonaws.ssooidc#InvalidClientException":
throw await de_InvalidClientExceptionRes(parsedOutput, context);
case "InvalidRequestException":
case "com.amazonaws.ssooidc#InvalidRequestException":
throw await de_InvalidRequestExceptionRes(parsedOutput, context);
case "SlowDownException":
case "com.amazonaws.ssooidc#SlowDownException":
throw await de_SlowDownExceptionRes(parsedOutput, context);
case "UnauthorizedClientException":
case "com.amazonaws.ssooidc#UnauthorizedClientException":
throw await de_UnauthorizedClientExceptionRes(parsedOutput, context);
default:
const parsedBody = parsedOutput.body;
return throwDefaultError({
output,
parsedBody,
errorCode,
});
}
};
var throwDefaultError = (0, smithy_client_8.withBaseException)(SSOOIDCServiceException);
var de_AccessDeniedExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new AccessDeniedException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_AuthorizationPendingExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new AuthorizationPendingException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_ExpiredTokenExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new ExpiredTokenException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InternalServerExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InternalServerException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InvalidClientExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InvalidClientException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InvalidClientMetadataExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InvalidClientMetadataException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InvalidGrantExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InvalidGrantException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InvalidRequestExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InvalidRequestException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_InvalidScopeExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new InvalidScopeException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_SlowDownExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new SlowDownException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_UnauthorizedClientExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new UnauthorizedClientException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var de_UnsupportedGrantTypeExceptionRes = async (parsedOutput, context) => {
const contents = (0, smithy_client_8.map)({});
const data = parsedOutput.body;
const doc = (0, smithy_client_8.take)(data, {
error: smithy_client_8.expectString,
error_description: smithy_client_8.expectString,
});
Object.assign(contents, doc);
const exception = new UnsupportedGrantTypeException({
$metadata: deserializeMetadata(parsedOutput),
...contents,
});
return (0, smithy_client_8.decorateServiceException)(exception, parsedOutput.body);
};
var deserializeMetadata = (output) => {
var _a, _b;
return ({
httpStatusCode: output.statusCode,
requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"],
extendedRequestId: output.headers["x-amz-id-2"],
cfId: output.headers["x-amz-cf-id"],
});
};
var collectBodyString = (streamBody, context) => (0, smithy_client_8.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body));
var parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => {
if (encoded.length) {
return JSON.parse(encoded);
}
return {};
});
var parseErrorBody = async (errorBody, context) => {
var _a;
const value = await parseBody(errorBody, context);
value.message = (_a = value.message) !== null && _a !== void 0 ? _a : value.Message;
return value;
};
var loadRestJsonErrorCode = (output, data) => {
const findKey = (object, key) => Object.keys(object).find((k2) => k2.toLowerCase() === key.toLowerCase());
const sanitizeErrorCode = (rawValue) => {
let cleanValue = rawValue;
if (typeof cleanValue === "number") {
cleanValue = cleanValue.toString();
}
if (cleanValue.indexOf(",") >= 0) {
cleanValue = cleanValue.split(",")[0];
}
if (cleanValue.indexOf(":") >= 0) {
cleanValue = cleanValue.split(":")[0];
}
if (cleanValue.indexOf("#") >= 0) {
cleanValue = cleanValue.split("#")[1];
}
return cleanValue;
};
const headerKey = findKey(output.headers, "x-amzn-errortype");
if (headerKey !== void 0) {
return sanitizeErrorCode(output.headers[headerKey]);
}
if (data.code !== void 0) {
return sanitizeErrorCode(data.code);
}
if (data["__type"] !== void 0) {
return sanitizeErrorCode(data["__type"]);
}
};
var CreateTokenCommand = class _CreateTokenCommand extends smithy_client_7.Command {
constructor(input) {
super();
this.input = input;
}
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_2.getEndpointPlugin)(configuration, _CreateTokenCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOOIDCClient";
const commandName = "CreateTokenCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_1.SMITHY_CONTEXT_KEY]: {
service: "AWSSSOOIDCService",
operation: "CreateToken",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return se_CreateTokenCommand(input, context);
}
deserialize(output, context) {
return de_CreateTokenCommand(output, context);
}
};
exports.CreateTokenCommand = CreateTokenCommand;
const middleware_endpoint_3 = __nccwpck_require__(82918);
const middleware_serde_2 = __nccwpck_require__(81238);
const smithy_client_10 = __nccwpck_require__(63570);
const types_2 = __nccwpck_require__(55756);
var RegisterClientCommand = class _RegisterClientCommand extends smithy_client_10.Command {
constructor(input) {
super();
this.input = input;
}
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_2.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_3.getEndpointPlugin)(configuration, _RegisterClientCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOOIDCClient";
const commandName = "RegisterClientCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_2.SMITHY_CONTEXT_KEY]: {
service: "AWSSSOOIDCService",
operation: "RegisterClient",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return se_RegisterClientCommand(input, context);
}
deserialize(output, context) {
return de_RegisterClientCommand(output, context);
}
};
const middleware_endpoint_4 = __nccwpck_require__(82918);
const middleware_serde_3 = __nccwpck_require__(81238);
const smithy_client_11 = __nccwpck_require__(63570);
const types_3 = __nccwpck_require__(55756);
var StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends smithy_client_11.Command {
constructor(input) {
super();
this.input = input;
}
static getEndpointParameterInstructions() {
return {
UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" },
Endpoint: { type: "builtInParams", name: "endpoint" },
Region: { type: "builtInParams", name: "region" },
UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" },
};
}
resolveMiddleware(clientStack, configuration, options) {
this.middlewareStack.use((0, middleware_serde_3.getSerdePlugin)(configuration, this.serialize, this.deserialize));
this.middlewareStack.use((0, middleware_endpoint_4.getEndpointPlugin)(configuration, _StartDeviceAuthorizationCommand.getEndpointParameterInstructions()));
const stack = clientStack.concat(this.middlewareStack);
const { logger } = configuration;
const clientName = "SSOOIDCClient";
const commandName = "StartDeviceAuthorizationCommand";
const handlerExecutionContext = {
logger,
clientName,
commandName,
inputFilterSensitiveLog: (_) => _,
outputFilterSensitiveLog: (_) => _,
[types_3.SMITHY_CONTEXT_KEY]: {
service: "AWSSSOOIDCService",
operation: "StartDeviceAuthorization",
},
};
const { requestHandler } = configuration;
return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext);
}
serialize(input, context) {
return se_StartDeviceAuthorizationCommand(input, context);
}
deserialize(output, context) {
return de_StartDeviceAuthorizationCommand(output, context);
}
};
var commands = {
CreateTokenCommand,
RegisterClientCommand,
StartDeviceAuthorizationCommand,
};
var SSOOIDC = class extends SSOOIDCClient {
};
(0, smithy_client_6.createAggregatedClient)(commands, SSOOIDC);
/***/ }),
/***/ 92242:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.REFRESH_MESSAGE = exports.EXPIRE_WINDOW_MS = void 0;
exports.EXPIRE_WINDOW_MS = 5 * 60 * 1000;
exports.REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`;
/***/ }),
/***/ 85125:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromSso = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const constants_1 = __nccwpck_require__(92242);
const getNewSsoOidcToken_1 = __nccwpck_require__(93601);
const validateTokenExpiry_1 = __nccwpck_require__(28418);
const validateTokenKey_1 = __nccwpck_require__(2488);
const writeSSOTokenToFile_1 = __nccwpck_require__(48552);
const lastRefreshAttemptTime = new Date(0);
const fromSso = (init = {}) => async () => {
const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init);
const profileName = (0, shared_ini_file_loader_1.getProfileName)(init);
const profile = profiles[profileName];
if (!profile) {
throw new property_provider_1.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false);
}
else if (!profile["sso_session"]) {
throw new property_provider_1.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`);
}
const ssoSessionName = profile["sso_session"];
const ssoSessions = await (0, shared_ini_file_loader_1.loadSsoSessionData)(init);
const ssoSession = ssoSessions[ssoSessionName];
if (!ssoSession) {
throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' could not be found in shared credentials file.`, false);
}
for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) {
if (!ssoSession[ssoSessionRequiredKey]) {
throw new property_provider_1.TokenProviderError(`Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, false);
}
}
const ssoStartUrl = ssoSession["sso_start_url"];
const ssoRegion = ssoSession["sso_region"];
let ssoToken;
try {
ssoToken = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoSessionName);
}
catch (e) {
throw new property_provider_1.TokenProviderError(`The SSO session token associated with profile=${profileName} was not found or is invalid. ${constants_1.REFRESH_MESSAGE}`, false);
}
(0, validateTokenKey_1.validateTokenKey)("accessToken", ssoToken.accessToken);
(0, validateTokenKey_1.validateTokenKey)("expiresAt", ssoToken.expiresAt);
const { accessToken, expiresAt } = ssoToken;
const existingToken = { token: accessToken, expiration: new Date(expiresAt) };
if (existingToken.expiration.getTime() - Date.now() > constants_1.EXPIRE_WINDOW_MS) {
return existingToken;
}
if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1000) {
(0, validateTokenExpiry_1.validateTokenExpiry)(existingToken);
return existingToken;
}
(0, validateTokenKey_1.validateTokenKey)("clientId", ssoToken.clientId, true);
(0, validateTokenKey_1.validateTokenKey)("clientSecret", ssoToken.clientSecret, true);
(0, validateTokenKey_1.validateTokenKey)("refreshToken", ssoToken.refreshToken, true);
try {
lastRefreshAttemptTime.setTime(Date.now());
const newSsoOidcToken = await (0, getNewSsoOidcToken_1.getNewSsoOidcToken)(ssoToken, ssoRegion);
(0, validateTokenKey_1.validateTokenKey)("accessToken", newSsoOidcToken.accessToken);
(0, validateTokenKey_1.validateTokenKey)("expiresIn", newSsoOidcToken.expiresIn);
const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1000);
try {
await (0, writeSSOTokenToFile_1.writeSSOTokenToFile)(ssoSessionName, {
...ssoToken,
accessToken: newSsoOidcToken.accessToken,
expiresAt: newTokenExpiration.toISOString(),
refreshToken: newSsoOidcToken.refreshToken,
});
}
catch (error) {
}
return {
token: newSsoOidcToken.accessToken,
expiration: newTokenExpiration,
};
}
catch (error) {
(0, validateTokenExpiry_1.validateTokenExpiry)(existingToken);
return existingToken;
}
};
exports.fromSso = fromSso;
/***/ }),
/***/ 63258:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromStatic = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fromStatic = ({ token }) => async () => {
if (!token || !token.token) {
throw new property_provider_1.TokenProviderError(`Please pass a valid token to fromStatic`, false);
}
return token;
};
exports.fromStatic = fromStatic;
/***/ }),
/***/ 93601:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getNewSsoOidcToken = void 0;
const client_sso_oidc_node_1 = __nccwpck_require__(52664);
const getSsoOidcClient_1 = __nccwpck_require__(99775);
const getNewSsoOidcToken = (ssoToken, ssoRegion) => {
const ssoOidcClient = (0, getSsoOidcClient_1.getSsoOidcClient)(ssoRegion);
return ssoOidcClient.send(new client_sso_oidc_node_1.CreateTokenCommand({
clientId: ssoToken.clientId,
clientSecret: ssoToken.clientSecret,
refreshToken: ssoToken.refreshToken,
grantType: "refresh_token",
}));
};
exports.getNewSsoOidcToken = getNewSsoOidcToken;
/***/ }),
/***/ 99775:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSsoOidcClient = void 0;
const client_sso_oidc_node_1 = __nccwpck_require__(52664);
const ssoOidcClientsHash = {};
const getSsoOidcClient = (ssoRegion) => {
if (ssoOidcClientsHash[ssoRegion]) {
return ssoOidcClientsHash[ssoRegion];
}
const ssoOidcClient = new client_sso_oidc_node_1.SSOOIDCClient({ region: ssoRegion });
ssoOidcClientsHash[ssoRegion] = ssoOidcClient;
return ssoOidcClient;
};
exports.getSsoOidcClient = getSsoOidcClient;
/***/ }),
/***/ 52843:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(52664), exports);
tslib_1.__exportStar(__nccwpck_require__(85125), exports);
tslib_1.__exportStar(__nccwpck_require__(63258), exports);
tslib_1.__exportStar(__nccwpck_require__(70195), exports);
/***/ }),
/***/ 70195:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.nodeProvider = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fromSso_1 = __nccwpck_require__(85125);
const nodeProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromSso_1.fromSso)(init), async () => {
throw new property_provider_1.TokenProviderError("Could not load token from any providers", false);
}), (token) => token.expiration !== undefined && token.expiration.getTime() - Date.now() < 300000, (token) => token.expiration !== undefined);
exports.nodeProvider = nodeProvider;
/***/ }),
/***/ 28418:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.validateTokenExpiry = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const constants_1 = __nccwpck_require__(92242);
const validateTokenExpiry = (token) => {
if (token.expiration && token.expiration.getTime() < Date.now()) {
throw new property_provider_1.TokenProviderError(`Token is expired. ${constants_1.REFRESH_MESSAGE}`, false);
}
};
exports.validateTokenExpiry = validateTokenExpiry;
/***/ }),
/***/ 2488:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.validateTokenKey = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const constants_1 = __nccwpck_require__(92242);
const validateTokenKey = (key, value, forRefresh = false) => {
if (typeof value === "undefined") {
throw new property_provider_1.TokenProviderError(`Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${constants_1.REFRESH_MESSAGE}`, false);
}
};
exports.validateTokenKey = validateTokenKey;
/***/ }),
/***/ 48552:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.writeSSOTokenToFile = void 0;
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const fs_1 = __nccwpck_require__(57147);
const { writeFile } = fs_1.promises;
const writeSSOTokenToFile = (id, ssoToken) => {
const tokenFilepath = (0, shared_ini_file_loader_1.getSSOTokenFilepath)(id);
const tokenString = JSON.stringify(ssoToken, null, 2);
return writeFile(tokenFilepath, tokenString);
};
exports.writeSSOTokenToFile = writeSSOTokenToFile;
/***/ }),
/***/ 15011:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const util_endpoints_1 = __nccwpck_require__(45473);
const isVirtualHostableS3Bucket_1 = __nccwpck_require__(48079);
const parseArn_1 = __nccwpck_require__(34711);
const partition_1 = __nccwpck_require__(37482);
const awsEndpointFunctions = {
isVirtualHostableS3Bucket: isVirtualHostableS3Bucket_1.isVirtualHostableS3Bucket,
parseArn: parseArn_1.parseArn,
partition: partition_1.partition,
};
util_endpoints_1.customEndpointFunctions.aws = awsEndpointFunctions;
/***/ }),
/***/ 13350:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(15011), exports);
tslib_1.__exportStar(__nccwpck_require__(37482), exports);
tslib_1.__exportStar(__nccwpck_require__(73442), exports);
tslib_1.__exportStar(__nccwpck_require__(36563), exports);
tslib_1.__exportStar(__nccwpck_require__(57433), exports);
/***/ }),
/***/ 48079:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isVirtualHostableS3Bucket = void 0;
const util_endpoints_1 = __nccwpck_require__(45473);
const isIpAddress_1 = __nccwpck_require__(73442);
const isVirtualHostableS3Bucket = (value, allowSubDomains = false) => {
if (allowSubDomains) {
for (const label of value.split(".")) {
if (!(0, exports.isVirtualHostableS3Bucket)(label)) {
return false;
}
}
return true;
}
if (!(0, util_endpoints_1.isValidHostLabel)(value)) {
return false;
}
if (value.length < 3 || value.length > 63) {
return false;
}
if (value !== value.toLowerCase()) {
return false;
}
if ((0, isIpAddress_1.isIpAddress)(value)) {
return false;
}
return true;
};
exports.isVirtualHostableS3Bucket = isVirtualHostableS3Bucket;
/***/ }),
/***/ 34711:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseArn = void 0;
const parseArn = (value) => {
const segments = value.split(":");
if (segments.length < 6)
return null;
const [arn, partition, service, region, accountId, ...resourceId] = segments;
if (arn !== "arn" || partition === "" || service === "" || resourceId[0] === "")
return null;
return {
partition,
service,
region,
accountId,
resourceId: resourceId[0].includes("/") ? resourceId[0].split("/") : resourceId,
};
};
exports.parseArn = parseArn;
/***/ }),
/***/ 37482:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getUserAgentPrefix = exports.useDefaultPartitionInfo = exports.setPartitionInfo = exports.partition = void 0;
const tslib_1 = __nccwpck_require__(4351);
const partitions_json_1 = tslib_1.__importDefault(__nccwpck_require__(95367));
let selectedPartitionsInfo = partitions_json_1.default;
let selectedUserAgentPrefix = "";
const partition = (value) => {
const { partitions } = selectedPartitionsInfo;
for (const partition of partitions) {
const { regions, outputs } = partition;
for (const [region, regionData] of Object.entries(regions)) {
if (region === value) {
return {
...outputs,
...regionData,
};
}
}
}
for (const partition of partitions) {
const { regionRegex, outputs } = partition;
if (new RegExp(regionRegex).test(value)) {
return {
...outputs,
};
}
}
const DEFAULT_PARTITION = partitions.find((partition) => partition.id === "aws");
if (!DEFAULT_PARTITION) {
throw new Error("Provided region was not found in the partition array or regex," +
" and default partition with id 'aws' doesn't exist.");
}
return {
...DEFAULT_PARTITION.outputs,
};
};
exports.partition = partition;
const setPartitionInfo = (partitionsInfo, userAgentPrefix = "") => {
selectedPartitionsInfo = partitionsInfo;
selectedUserAgentPrefix = userAgentPrefix;
};
exports.setPartitionInfo = setPartitionInfo;
const useDefaultPartitionInfo = () => {
(0, exports.setPartitionInfo)(partitions_json_1.default, "");
};
exports.useDefaultPartitionInfo = useDefaultPartitionInfo;
const getUserAgentPrefix = () => selectedUserAgentPrefix;
exports.getUserAgentPrefix = getUserAgentPrefix;
/***/ }),
/***/ 73442:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isIpAddress = void 0;
var util_endpoints_1 = __nccwpck_require__(45473);
Object.defineProperty(exports, "isIpAddress", ({ enumerable: true, get: function () { return util_endpoints_1.isIpAddress; } }));
/***/ }),
/***/ 36563:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveEndpoint = void 0;
var util_endpoints_1 = __nccwpck_require__(45473);
Object.defineProperty(exports, "resolveEndpoint", ({ enumerable: true, get: function () { return util_endpoints_1.resolveEndpoint; } }));
/***/ }),
/***/ 82605:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.EndpointError = void 0;
var util_endpoints_1 = __nccwpck_require__(45473);
Object.defineProperty(exports, "EndpointError", ({ enumerable: true, get: function () { return util_endpoints_1.EndpointError; } }));
/***/ }),
/***/ 21261:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 20312:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 56083:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 21767:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 57433:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(82605), exports);
tslib_1.__exportStar(__nccwpck_require__(21261), exports);
tslib_1.__exportStar(__nccwpck_require__(20312), exports);
tslib_1.__exportStar(__nccwpck_require__(56083), exports);
tslib_1.__exportStar(__nccwpck_require__(21767), exports);
tslib_1.__exportStar(__nccwpck_require__(41811), exports);
/***/ }),
/***/ 41811:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 5865:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.crtAvailability = void 0;
exports.crtAvailability = {
isCrtAvailable: false,
};
/***/ }),
/***/ 98095:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultUserAgent = exports.UA_APP_ID_INI_NAME = exports.UA_APP_ID_ENV_NAME = exports.crtAvailability = void 0;
const node_config_provider_1 = __nccwpck_require__(33461);
const os_1 = __nccwpck_require__(22037);
const process_1 = __nccwpck_require__(77282);
const is_crt_available_1 = __nccwpck_require__(68390);
var crt_availability_1 = __nccwpck_require__(5865);
Object.defineProperty(exports, "crtAvailability", ({ enumerable: true, get: function () { return crt_availability_1.crtAvailability; } }));
exports.UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID";
exports.UA_APP_ID_INI_NAME = "sdk-ua-app-id";
const defaultUserAgent = ({ serviceId, clientVersion }) => {
const sections = [
["aws-sdk-js", clientVersion],
["ua", "2.0"],
[`os/${(0, os_1.platform)()}`, (0, os_1.release)()],
["lang/js"],
["md/nodejs", `${process_1.versions.node}`],
];
const crtAvailable = (0, is_crt_available_1.isCrtAvailable)();
if (crtAvailable) {
sections.push(crtAvailable);
}
if (serviceId) {
sections.push([`api/${serviceId}`, clientVersion]);
}
if (process_1.env.AWS_EXECUTION_ENV) {
sections.push([`exec-env/${process_1.env.AWS_EXECUTION_ENV}`]);
}
const appIdPromise = (0, node_config_provider_1.loadConfig)({
environmentVariableSelector: (env) => env[exports.UA_APP_ID_ENV_NAME],
configFileSelector: (profile) => profile[exports.UA_APP_ID_INI_NAME],
default: undefined,
})();
let resolvedUserAgent = undefined;
return async () => {
if (!resolvedUserAgent) {
const appId = await appIdPromise;
resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections];
}
return resolvedUserAgent;
};
};
exports.defaultUserAgent = defaultUserAgent;
/***/ }),
/***/ 68390:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isCrtAvailable = void 0;
const crt_availability_1 = __nccwpck_require__(5865);
const isCrtAvailable = () => {
if (crt_availability_1.crtAvailability.isCrtAvailable) {
return ["md/crt-avail"];
}
return null;
};
exports.isCrtAvailable = isCrtAvailable;
/***/ }),
/***/ 28172:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toUtf8 = exports.fromUtf8 = void 0;
const pureJs_1 = __nccwpck_require__(21590);
const whatwgEncodingApi_1 = __nccwpck_require__(89215);
const fromUtf8 = (input) => typeof TextEncoder === "function" ? (0, whatwgEncodingApi_1.fromUtf8)(input) : (0, pureJs_1.fromUtf8)(input);
exports.fromUtf8 = fromUtf8;
const toUtf8 = (input) => typeof TextDecoder === "function" ? (0, whatwgEncodingApi_1.toUtf8)(input) : (0, pureJs_1.toUtf8)(input);
exports.toUtf8 = toUtf8;
/***/ }),
/***/ 21590:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toUtf8 = exports.fromUtf8 = void 0;
const fromUtf8 = (input) => {
const bytes = [];
for (let i = 0, len = input.length; i < len; i++) {
const value = input.charCodeAt(i);
if (value < 0x80) {
bytes.push(value);
}
else if (value < 0x800) {
bytes.push((value >> 6) | 0b11000000, (value & 0b111111) | 0b10000000);
}
else if (i + 1 < input.length && (value & 0xfc00) === 0xd800 && (input.charCodeAt(i + 1) & 0xfc00) === 0xdc00) {
const surrogatePair = 0x10000 + ((value & 0b1111111111) << 10) + (input.charCodeAt(++i) & 0b1111111111);
bytes.push((surrogatePair >> 18) | 0b11110000, ((surrogatePair >> 12) & 0b111111) | 0b10000000, ((surrogatePair >> 6) & 0b111111) | 0b10000000, (surrogatePair & 0b111111) | 0b10000000);
}
else {
bytes.push((value >> 12) | 0b11100000, ((value >> 6) & 0b111111) | 0b10000000, (value & 0b111111) | 0b10000000);
}
}
return Uint8Array.from(bytes);
};
exports.fromUtf8 = fromUtf8;
const toUtf8 = (input) => {
let decoded = "";
for (let i = 0, len = input.length; i < len; i++) {
const byte = input[i];
if (byte < 0x80) {
decoded += String.fromCharCode(byte);
}
else if (0b11000000 <= byte && byte < 0b11100000) {
const nextByte = input[++i];
decoded += String.fromCharCode(((byte & 0b11111) << 6) | (nextByte & 0b111111));
}
else if (0b11110000 <= byte && byte < 0b101101101) {
const surrogatePair = [byte, input[++i], input[++i], input[++i]];
const encoded = "%" + surrogatePair.map((byteValue) => byteValue.toString(16)).join("%");
decoded += decodeURIComponent(encoded);
}
else {
decoded += String.fromCharCode(((byte & 0b1111) << 12) | ((input[++i] & 0b111111) << 6) | (input[++i] & 0b111111));
}
}
return decoded;
};
exports.toUtf8 = toUtf8;
/***/ }),
/***/ 89215:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toUtf8 = exports.fromUtf8 = void 0;
function fromUtf8(input) {
return new TextEncoder().encode(input);
}
exports.fromUtf8 = fromUtf8;
function toUtf8(input) {
return new TextDecoder("utf-8").decode(input);
}
exports.toUtf8 = toUtf8;
/***/ }),
/***/ 43779:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_DUALSTACK_ENDPOINT = exports.CONFIG_USE_DUALSTACK_ENDPOINT = exports.ENV_USE_DUALSTACK_ENDPOINT = void 0;
const util_config_provider_1 = __nccwpck_require__(83375);
exports.ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT";
exports.CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint";
exports.DEFAULT_USE_DUALSTACK_ENDPOINT = false;
exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.ENV),
configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.CONFIG),
default: false,
};
/***/ }),
/***/ 17994:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_FIPS_ENDPOINT = exports.CONFIG_USE_FIPS_ENDPOINT = exports.ENV_USE_FIPS_ENDPOINT = void 0;
const util_config_provider_1 = __nccwpck_require__(83375);
exports.ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT";
exports.CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint";
exports.DEFAULT_USE_FIPS_ENDPOINT = false;
exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.ENV),
configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.CONFIG),
default: false,
};
/***/ }),
/***/ 18421:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(43779), exports);
tslib_1.__exportStar(__nccwpck_require__(17994), exports);
tslib_1.__exportStar(__nccwpck_require__(37432), exports);
tslib_1.__exportStar(__nccwpck_require__(61892), exports);
/***/ }),
/***/ 37432:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveCustomEndpointsConfig = void 0;
const util_middleware_1 = __nccwpck_require__(2390);
const resolveCustomEndpointsConfig = (input) => {
var _a, _b;
const { endpoint, urlParser } = input;
return {
...input,
tls: (_a = input.tls) !== null && _a !== void 0 ? _a : true,
endpoint: (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint),
isCustomEndpoint: true,
useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false),
};
};
exports.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig;
/***/ }),
/***/ 61892:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveEndpointsConfig = void 0;
const util_middleware_1 = __nccwpck_require__(2390);
const getEndpointFromRegion_1 = __nccwpck_require__(48570);
const resolveEndpointsConfig = (input) => {
var _a, _b;
const useDualstackEndpoint = (0, util_middleware_1.normalizeProvider)((_a = input.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false);
const { endpoint, useFipsEndpoint, urlParser } = input;
return {
...input,
tls: (_b = input.tls) !== null && _b !== void 0 ? _b : true,
endpoint: endpoint
? (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint)
: () => (0, getEndpointFromRegion_1.getEndpointFromRegion)({ ...input, useDualstackEndpoint, useFipsEndpoint }),
isCustomEndpoint: !!endpoint,
useDualstackEndpoint,
};
};
exports.resolveEndpointsConfig = resolveEndpointsConfig;
/***/ }),
/***/ 48570:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointFromRegion = void 0;
const getEndpointFromRegion = async (input) => {
var _a;
const { tls = true } = input;
const region = await input.region();
const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/);
if (!dnsHostRegex.test(region)) {
throw new Error("Invalid region in client config");
}
const useDualstackEndpoint = await input.useDualstackEndpoint();
const useFipsEndpoint = await input.useFipsEndpoint();
const { hostname } = (_a = (await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }))) !== null && _a !== void 0 ? _a : {};
if (!hostname) {
throw new Error("Cannot resolve hostname from client config");
}
return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`);
};
exports.getEndpointFromRegion = getEndpointFromRegion;
/***/ }),
/***/ 53098:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(18421), exports);
tslib_1.__exportStar(__nccwpck_require__(221), exports);
tslib_1.__exportStar(__nccwpck_require__(86985), exports);
/***/ }),
/***/ 33898:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0;
exports.REGION_ENV_NAME = "AWS_REGION";
exports.REGION_INI_NAME = "region";
exports.NODE_REGION_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME],
configFileSelector: (profile) => profile[exports.REGION_INI_NAME],
default: () => {
throw new Error("Region is missing");
},
};
exports.NODE_REGION_CONFIG_FILE_OPTIONS = {
preferredFile: "credentials",
};
/***/ }),
/***/ 49506:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRealRegion = void 0;
const isFipsRegion_1 = __nccwpck_require__(43870);
const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region)
? ["fips-aws-global", "aws-fips"].includes(region)
? "us-east-1"
: region.replace(/fips-(dkr-|prod-)?|-fips/, "")
: region;
exports.getRealRegion = getRealRegion;
/***/ }),
/***/ 221:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(33898), exports);
tslib_1.__exportStar(__nccwpck_require__(87065), exports);
/***/ }),
/***/ 43870:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isFipsRegion = void 0;
const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips"));
exports.isFipsRegion = isFipsRegion;
/***/ }),
/***/ 87065:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveRegionConfig = void 0;
const getRealRegion_1 = __nccwpck_require__(49506);
const isFipsRegion_1 = __nccwpck_require__(43870);
const resolveRegionConfig = (input) => {
const { region, useFipsEndpoint } = input;
if (!region) {
throw new Error("Region is missing");
}
return {
...input,
region: async () => {
if (typeof region === "string") {
return (0, getRealRegion_1.getRealRegion)(region);
}
const providedRegion = await region();
return (0, getRealRegion_1.getRealRegion)(providedRegion);
},
useFipsEndpoint: async () => {
const providedRegion = typeof region === "string" ? region : await region();
if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) {
return true;
}
return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint();
},
};
};
exports.resolveRegionConfig = resolveRegionConfig;
/***/ }),
/***/ 19814:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 14832:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 99760:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getHostnameFromVariants = void 0;
const getHostnameFromVariants = (variants = [], { useFipsEndpoint, useDualstackEndpoint }) => {
var _a;
return (_a = variants.find(({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack"))) === null || _a === void 0 ? void 0 : _a.hostname;
};
exports.getHostnameFromVariants = getHostnameFromVariants;
/***/ }),
/***/ 77792:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRegionInfo = void 0;
const getHostnameFromVariants_1 = __nccwpck_require__(99760);
const getResolvedHostname_1 = __nccwpck_require__(1487);
const getResolvedPartition_1 = __nccwpck_require__(44441);
const getResolvedSigningRegion_1 = __nccwpck_require__(92281);
const getRegionInfo = (region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash, }) => {
var _a, _b, _c, _d, _e, _f;
const partition = (0, getResolvedPartition_1.getResolvedPartition)(region, { partitionHash });
const resolvedRegion = region in regionHash ? region : (_b = (_a = partitionHash[partition]) === null || _a === void 0 ? void 0 : _a.endpoint) !== null && _b !== void 0 ? _b : region;
const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint };
const regionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_c = regionHash[resolvedRegion]) === null || _c === void 0 ? void 0 : _c.variants, hostnameOptions);
const partitionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_d = partitionHash[partition]) === null || _d === void 0 ? void 0 : _d.variants, hostnameOptions);
const hostname = (0, getResolvedHostname_1.getResolvedHostname)(resolvedRegion, { regionHostname, partitionHostname });
if (hostname === undefined) {
throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`);
}
const signingRegion = (0, getResolvedSigningRegion_1.getResolvedSigningRegion)(hostname, {
signingRegion: (_e = regionHash[resolvedRegion]) === null || _e === void 0 ? void 0 : _e.signingRegion,
regionRegex: partitionHash[partition].regionRegex,
useFipsEndpoint,
});
return {
partition,
signingService,
hostname,
...(signingRegion && { signingRegion }),
...(((_f = regionHash[resolvedRegion]) === null || _f === void 0 ? void 0 : _f.signingService) && {
signingService: regionHash[resolvedRegion].signingService,
}),
};
};
exports.getRegionInfo = getRegionInfo;
/***/ }),
/***/ 1487:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getResolvedHostname = void 0;
const getResolvedHostname = (resolvedRegion, { regionHostname, partitionHostname }) => regionHostname
? regionHostname
: partitionHostname
? partitionHostname.replace("{region}", resolvedRegion)
: undefined;
exports.getResolvedHostname = getResolvedHostname;
/***/ }),
/***/ 44441:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getResolvedPartition = void 0;
const getResolvedPartition = (region, { partitionHash }) => { var _a; return (_a = Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region))) !== null && _a !== void 0 ? _a : "aws"; };
exports.getResolvedPartition = getResolvedPartition;
/***/ }),
/***/ 92281:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getResolvedSigningRegion = void 0;
const getResolvedSigningRegion = (hostname, { signingRegion, regionRegex, useFipsEndpoint }) => {
if (signingRegion) {
return signingRegion;
}
else if (useFipsEndpoint) {
const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\.");
const regionRegexmatchArray = hostname.match(regionRegexJs);
if (regionRegexmatchArray) {
return regionRegexmatchArray[0].slice(1, -1);
}
}
};
exports.getResolvedSigningRegion = getResolvedSigningRegion;
/***/ }),
/***/ 86985:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(19814), exports);
tslib_1.__exportStar(__nccwpck_require__(14832), exports);
tslib_1.__exportStar(__nccwpck_require__(77792), exports);
/***/ }),
/***/ 18044:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Endpoint = void 0;
var Endpoint;
(function (Endpoint) {
Endpoint["IPv4"] = "http://169.254.169.254";
Endpoint["IPv6"] = "http://[fd00:ec2::254]";
})(Endpoint = exports.Endpoint || (exports.Endpoint = {}));
/***/ }),
/***/ 57342:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ENDPOINT_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_NAME = exports.ENV_ENDPOINT_NAME = void 0;
exports.ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT";
exports.CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint";
exports.ENDPOINT_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_NAME],
configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_NAME],
default: undefined,
};
/***/ }),
/***/ 80991:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.EndpointMode = void 0;
var EndpointMode;
(function (EndpointMode) {
EndpointMode["IPv4"] = "IPv4";
EndpointMode["IPv6"] = "IPv6";
})(EndpointMode = exports.EndpointMode || (exports.EndpointMode = {}));
/***/ }),
/***/ 88337:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ENDPOINT_MODE_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_MODE_NAME = exports.ENV_ENDPOINT_MODE_NAME = void 0;
const EndpointMode_1 = __nccwpck_require__(80991);
exports.ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE";
exports.CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode";
exports.ENDPOINT_MODE_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_MODE_NAME],
configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_MODE_NAME],
default: EndpointMode_1.EndpointMode.IPv4,
};
/***/ }),
/***/ 58232:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.InstanceMetadataV1FallbackError = void 0;
const property_provider_1 = __nccwpck_require__(79721);
class InstanceMetadataV1FallbackError extends property_provider_1.CredentialsProviderError {
constructor(message, tryNextLink = true) {
super(message, tryNextLink);
this.tryNextLink = tryNextLink;
this.name = "InstanceMetadataV1FallbackError";
Object.setPrototypeOf(this, InstanceMetadataV1FallbackError.prototype);
}
}
exports.InstanceMetadataV1FallbackError = InstanceMetadataV1FallbackError;
/***/ }),
/***/ 89227:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromContainerMetadata = exports.ENV_CMDS_AUTH_TOKEN = exports.ENV_CMDS_RELATIVE_URI = exports.ENV_CMDS_FULL_URI = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const url_1 = __nccwpck_require__(57310);
const httpRequest_1 = __nccwpck_require__(32199);
const ImdsCredentials_1 = __nccwpck_require__(6894);
const RemoteProviderInit_1 = __nccwpck_require__(98533);
const retry_1 = __nccwpck_require__(91351);
exports.ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI";
exports.ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI";
exports.ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN";
const fromContainerMetadata = (init = {}) => {
const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init);
return () => (0, retry_1.retry)(async () => {
const requestOptions = await getCmdsUri();
const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions));
if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) {
throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service.");
}
return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse);
}, maxRetries);
};
exports.fromContainerMetadata = fromContainerMetadata;
const requestFromEcsImds = async (timeout, options) => {
if (process.env[exports.ENV_CMDS_AUTH_TOKEN]) {
options.headers = {
...options.headers,
Authorization: process.env[exports.ENV_CMDS_AUTH_TOKEN],
};
}
const buffer = await (0, httpRequest_1.httpRequest)({
...options,
timeout,
});
return buffer.toString();
};
const CMDS_IP = "169.254.170.2";
const GREENGRASS_HOSTS = {
localhost: true,
"127.0.0.1": true,
};
const GREENGRASS_PROTOCOLS = {
"http:": true,
"https:": true,
};
const getCmdsUri = async () => {
if (process.env[exports.ENV_CMDS_RELATIVE_URI]) {
return {
hostname: CMDS_IP,
path: process.env[exports.ENV_CMDS_RELATIVE_URI],
};
}
if (process.env[exports.ENV_CMDS_FULL_URI]) {
const parsed = (0, url_1.parse)(process.env[exports.ENV_CMDS_FULL_URI]);
if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) {
throw new property_provider_1.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, false);
}
if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) {
throw new property_provider_1.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, false);
}
return {
...parsed,
port: parsed.port ? parseInt(parsed.port, 10) : undefined,
};
}
throw new property_provider_1.CredentialsProviderError("The container metadata credential provider cannot be used unless" +
` the ${exports.ENV_CMDS_RELATIVE_URI} or ${exports.ENV_CMDS_FULL_URI} environment` +
" variable is set", false);
};
/***/ }),
/***/ 52207:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromInstanceMetadata = void 0;
const node_config_provider_1 = __nccwpck_require__(33461);
const property_provider_1 = __nccwpck_require__(79721);
const InstanceMetadataV1FallbackError_1 = __nccwpck_require__(58232);
const httpRequest_1 = __nccwpck_require__(32199);
const ImdsCredentials_1 = __nccwpck_require__(6894);
const RemoteProviderInit_1 = __nccwpck_require__(98533);
const retry_1 = __nccwpck_require__(91351);
const getInstanceMetadataEndpoint_1 = __nccwpck_require__(92460);
const staticStabilityProvider_1 = __nccwpck_require__(74035);
const IMDS_PATH = "/latest/meta-data/iam/security-credentials/";
const IMDS_TOKEN_PATH = "/latest/api/token";
const AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED";
const PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled";
const X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token";
const fromInstanceMetadata = (init = {}) => (0, staticStabilityProvider_1.staticStabilityProvider)(getInstanceImdsProvider(init), { logger: init.logger });
exports.fromInstanceMetadata = fromInstanceMetadata;
const getInstanceImdsProvider = (init) => {
let disableFetchToken = false;
const { logger, profile } = init;
const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init);
const getCredentials = async (maxRetries, options) => {
var _a;
const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) === null || _a === void 0 ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null;
if (isImdsV1Fallback) {
let fallbackBlockedFromProfile = false;
let fallbackBlockedFromProcessEnv = false;
const configValue = await (0, node_config_provider_1.loadConfig)({
environmentVariableSelector: (env) => {
const envValue = env[AWS_EC2_METADATA_V1_DISABLED];
fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false";
if (envValue === undefined) {
throw new property_provider_1.CredentialsProviderError(`${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`);
}
return fallbackBlockedFromProcessEnv;
},
configFileSelector: (profile) => {
const profileValue = profile[PROFILE_AWS_EC2_METADATA_V1_DISABLED];
fallbackBlockedFromProfile = !!profileValue && profileValue !== "false";
return fallbackBlockedFromProfile;
},
default: false,
}, {
profile,
})();
if (init.ec2MetadataV1Disabled || configValue) {
const causes = [];
if (init.ec2MetadataV1Disabled)
causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)");
if (fallbackBlockedFromProfile)
causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`);
if (fallbackBlockedFromProcessEnv)
causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`);
throw new InstanceMetadataV1FallbackError_1.InstanceMetadataV1FallbackError(`AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join(", ")}].`);
}
}
const imdsProfile = (await (0, retry_1.retry)(async () => {
let profile;
try {
profile = await getProfile(options);
}
catch (err) {
if (err.statusCode === 401) {
disableFetchToken = false;
}
throw err;
}
return profile;
}, maxRetries)).trim();
return (0, retry_1.retry)(async () => {
let creds;
try {
creds = await getCredentialsFromProfile(imdsProfile, options);
}
catch (err) {
if (err.statusCode === 401) {
disableFetchToken = false;
}
throw err;
}
return creds;
}, maxRetries);
};
return async () => {
const endpoint = await (0, getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint)();
if (disableFetchToken) {
logger === null || logger === void 0 ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)");
return getCredentials(maxRetries, { ...endpoint, timeout });
}
else {
let token;
try {
token = (await getMetadataToken({ ...endpoint, timeout })).toString();
}
catch (error) {
if ((error === null || error === void 0 ? void 0 : error.statusCode) === 400) {
throw Object.assign(error, {
message: "EC2 Metadata token request returned error",
});
}
else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) {
disableFetchToken = true;
}
logger === null || logger === void 0 ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)");
return getCredentials(maxRetries, { ...endpoint, timeout });
}
return getCredentials(maxRetries, {
...endpoint,
headers: {
[X_AWS_EC2_METADATA_TOKEN]: token,
},
timeout,
});
}
};
};
const getMetadataToken = async (options) => (0, httpRequest_1.httpRequest)({
...options,
path: IMDS_TOKEN_PATH,
method: "PUT",
headers: {
"x-aws-ec2-metadata-token-ttl-seconds": "21600",
},
});
const getProfile = async (options) => (await (0, httpRequest_1.httpRequest)({ ...options, path: IMDS_PATH })).toString();
const getCredentialsFromProfile = async (profile, options) => {
const credsResponse = JSON.parse((await (0, httpRequest_1.httpRequest)({
...options,
path: IMDS_PATH + profile,
})).toString());
if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) {
throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service.");
}
return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse);
};
/***/ }),
/***/ 7477:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getInstanceMetadataEndpoint = exports.httpRequest = void 0;
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(89227), exports);
tslib_1.__exportStar(__nccwpck_require__(52207), exports);
tslib_1.__exportStar(__nccwpck_require__(98533), exports);
tslib_1.__exportStar(__nccwpck_require__(45036), exports);
var httpRequest_1 = __nccwpck_require__(32199);
Object.defineProperty(exports, "httpRequest", ({ enumerable: true, get: function () { return httpRequest_1.httpRequest; } }));
var getInstanceMetadataEndpoint_1 = __nccwpck_require__(92460);
Object.defineProperty(exports, "getInstanceMetadataEndpoint", ({ enumerable: true, get: function () { return getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint; } }));
/***/ }),
/***/ 6894:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromImdsCredentials = exports.isImdsCredentials = void 0;
const isImdsCredentials = (arg) => Boolean(arg) &&
typeof arg === "object" &&
typeof arg.AccessKeyId === "string" &&
typeof arg.SecretAccessKey === "string" &&
typeof arg.Token === "string" &&
typeof arg.Expiration === "string";
exports.isImdsCredentials = isImdsCredentials;
const fromImdsCredentials = (creds) => ({
accessKeyId: creds.AccessKeyId,
secretAccessKey: creds.SecretAccessKey,
sessionToken: creds.Token,
expiration: new Date(creds.Expiration),
});
exports.fromImdsCredentials = fromImdsCredentials;
/***/ }),
/***/ 98533:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.providerConfigFromInit = exports.DEFAULT_MAX_RETRIES = exports.DEFAULT_TIMEOUT = void 0;
exports.DEFAULT_TIMEOUT = 1000;
exports.DEFAULT_MAX_RETRIES = 0;
const providerConfigFromInit = ({ maxRetries = exports.DEFAULT_MAX_RETRIES, timeout = exports.DEFAULT_TIMEOUT, }) => ({ maxRetries, timeout });
exports.providerConfigFromInit = providerConfigFromInit;
/***/ }),
/***/ 32199:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.httpRequest = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const buffer_1 = __nccwpck_require__(14300);
const http_1 = __nccwpck_require__(13685);
function httpRequest(options) {
return new Promise((resolve, reject) => {
var _a;
const req = (0, http_1.request)({
method: "GET",
...options,
hostname: (_a = options.hostname) === null || _a === void 0 ? void 0 : _a.replace(/^\[(.+)\]$/, "$1"),
});
req.on("error", (err) => {
reject(Object.assign(new property_provider_1.ProviderError("Unable to connect to instance metadata service"), err));
req.destroy();
});
req.on("timeout", () => {
reject(new property_provider_1.ProviderError("TimeoutError from instance metadata service"));
req.destroy();
});
req.on("response", (res) => {
const { statusCode = 400 } = res;
if (statusCode < 200 || 300 <= statusCode) {
reject(Object.assign(new property_provider_1.ProviderError("Error response received from instance metadata service"), { statusCode }));
req.destroy();
}
const chunks = [];
res.on("data", (chunk) => {
chunks.push(chunk);
});
res.on("end", () => {
resolve(buffer_1.Buffer.concat(chunks));
req.destroy();
});
});
req.end();
});
}
exports.httpRequest = httpRequest;
/***/ }),
/***/ 91351:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.retry = void 0;
const retry = (toRetry, maxRetries) => {
let promise = toRetry();
for (let i = 0; i < maxRetries; i++) {
promise = promise.catch(toRetry);
}
return promise;
};
exports.retry = retry;
/***/ }),
/***/ 45036:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 22666:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getExtendedInstanceMetadataCredentials = void 0;
const STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60;
const STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60;
const STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html";
const getExtendedInstanceMetadataCredentials = (credentials, logger) => {
var _a;
const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS +
Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS);
const newExpiration = new Date(Date.now() + refreshInterval * 1000);
logger.warn("Attempting credential expiration extension due to a credential service availability issue. A refresh of these " +
"credentials will be attempted after ${new Date(newExpiration)}.\nFor more information, please visit: " +
STATIC_STABILITY_DOC_URL);
const originalExpiration = (_a = credentials.originalExpiration) !== null && _a !== void 0 ? _a : credentials.expiration;
return {
...credentials,
...(originalExpiration ? { originalExpiration } : {}),
expiration: newExpiration,
};
};
exports.getExtendedInstanceMetadataCredentials = getExtendedInstanceMetadataCredentials;
/***/ }),
/***/ 92460:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getInstanceMetadataEndpoint = void 0;
const node_config_provider_1 = __nccwpck_require__(33461);
const url_parser_1 = __nccwpck_require__(14681);
const Endpoint_1 = __nccwpck_require__(18044);
const EndpointConfigOptions_1 = __nccwpck_require__(57342);
const EndpointMode_1 = __nccwpck_require__(80991);
const EndpointModeConfigOptions_1 = __nccwpck_require__(88337);
const getInstanceMetadataEndpoint = async () => (0, url_parser_1.parseUrl)((await getFromEndpointConfig()) || (await getFromEndpointModeConfig()));
exports.getInstanceMetadataEndpoint = getInstanceMetadataEndpoint;
const getFromEndpointConfig = async () => (0, node_config_provider_1.loadConfig)(EndpointConfigOptions_1.ENDPOINT_CONFIG_OPTIONS)();
const getFromEndpointModeConfig = async () => {
const endpointMode = await (0, node_config_provider_1.loadConfig)(EndpointModeConfigOptions_1.ENDPOINT_MODE_CONFIG_OPTIONS)();
switch (endpointMode) {
case EndpointMode_1.EndpointMode.IPv4:
return Endpoint_1.Endpoint.IPv4;
case EndpointMode_1.EndpointMode.IPv6:
return Endpoint_1.Endpoint.IPv6;
default:
throw new Error(`Unsupported endpoint mode: ${endpointMode}.` + ` Select from ${Object.values(EndpointMode_1.EndpointMode)}`);
}
};
/***/ }),
/***/ 74035:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.staticStabilityProvider = void 0;
const getExtendedInstanceMetadataCredentials_1 = __nccwpck_require__(22666);
const staticStabilityProvider = (provider, options = {}) => {
const logger = (options === null || options === void 0 ? void 0 : options.logger) || console;
let pastCredentials;
return async () => {
let credentials;
try {
credentials = await provider();
if (credentials.expiration && credentials.expiration.getTime() < Date.now()) {
credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(credentials, logger);
}
}
catch (e) {
if (pastCredentials) {
logger.warn("Credential renew failed: ", e);
credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(pastCredentials, logger);
}
else {
throw e;
}
}
pastCredentials = credentials;
return credentials;
};
};
exports.staticStabilityProvider = staticStabilityProvider;
/***/ }),
/***/ 11014:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.EventStreamCodec = void 0;
const crc32_1 = __nccwpck_require__(47327);
const HeaderMarshaller_1 = __nccwpck_require__(74712);
const splitMessage_1 = __nccwpck_require__(20597);
class EventStreamCodec {
constructor(toUtf8, fromUtf8) {
this.headerMarshaller = new HeaderMarshaller_1.HeaderMarshaller(toUtf8, fromUtf8);
this.messageBuffer = [];
this.isEndOfStream = false;
}
feed(message) {
this.messageBuffer.push(this.decode(message));
}
endOfStream() {
this.isEndOfStream = true;
}
getMessage() {
const message = this.messageBuffer.pop();
const isEndOfStream = this.isEndOfStream;
return {
getMessage() {
return message;
},
isEndOfStream() {
return isEndOfStream;
},
};
}
getAvailableMessages() {
const messages = this.messageBuffer;
this.messageBuffer = [];
const isEndOfStream = this.isEndOfStream;
return {
getMessages() {
return messages;
},
isEndOfStream() {
return isEndOfStream;
},
};
}
encode({ headers: rawHeaders, body }) {
const headers = this.headerMarshaller.format(rawHeaders);
const length = headers.byteLength + body.byteLength + 16;
const out = new Uint8Array(length);
const view = new DataView(out.buffer, out.byteOffset, out.byteLength);
const checksum = new crc32_1.Crc32();
view.setUint32(0, length, false);
view.setUint32(4, headers.byteLength, false);
view.setUint32(8, checksum.update(out.subarray(0, 8)).digest(), false);
out.set(headers, 12);
out.set(body, headers.byteLength + 12);
view.setUint32(length - 4, checksum.update(out.subarray(8, length - 4)).digest(), false);
return out;
}
decode(message) {
const { headers, body } = (0, splitMessage_1.splitMessage)(message);
return { headers: this.headerMarshaller.parse(headers), body };
}
formatHeaders(rawHeaders) {
return this.headerMarshaller.format(rawHeaders);
}
}
exports.EventStreamCodec = EventStreamCodec;
/***/ }),
/***/ 74712:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HeaderMarshaller = void 0;
const util_hex_encoding_1 = __nccwpck_require__(45364);
const Int64_1 = __nccwpck_require__(46086);
class HeaderMarshaller {
constructor(toUtf8, fromUtf8) {
this.toUtf8 = toUtf8;
this.fromUtf8 = fromUtf8;
}
format(headers) {
const chunks = [];
for (const headerName of Object.keys(headers)) {
const bytes = this.fromUtf8(headerName);
chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName]));
}
const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0));
let position = 0;
for (const chunk of chunks) {
out.set(chunk, position);
position += chunk.byteLength;
}
return out;
}
formatHeaderValue(header) {
switch (header.type) {
case "boolean":
return Uint8Array.from([header.value ? 0 : 1]);
case "byte":
return Uint8Array.from([2, header.value]);
case "short":
const shortView = new DataView(new ArrayBuffer(3));
shortView.setUint8(0, 3);
shortView.setInt16(1, header.value, false);
return new Uint8Array(shortView.buffer);
case "integer":
const intView = new DataView(new ArrayBuffer(5));
intView.setUint8(0, 4);
intView.setInt32(1, header.value, false);
return new Uint8Array(intView.buffer);
case "long":
const longBytes = new Uint8Array(9);
longBytes[0] = 5;
longBytes.set(header.value.bytes, 1);
return longBytes;
case "binary":
const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength));
binView.setUint8(0, 6);
binView.setUint16(1, header.value.byteLength, false);
const binBytes = new Uint8Array(binView.buffer);
binBytes.set(header.value, 3);
return binBytes;
case "string":
const utf8Bytes = this.fromUtf8(header.value);
const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength));
strView.setUint8(0, 7);
strView.setUint16(1, utf8Bytes.byteLength, false);
const strBytes = new Uint8Array(strView.buffer);
strBytes.set(utf8Bytes, 3);
return strBytes;
case "timestamp":
const tsBytes = new Uint8Array(9);
tsBytes[0] = 8;
tsBytes.set(Int64_1.Int64.fromNumber(header.value.valueOf()).bytes, 1);
return tsBytes;
case "uuid":
if (!UUID_PATTERN.test(header.value)) {
throw new Error(`Invalid UUID received: ${header.value}`);
}
const uuidBytes = new Uint8Array(17);
uuidBytes[0] = 9;
uuidBytes.set((0, util_hex_encoding_1.fromHex)(header.value.replace(/\-/g, "")), 1);
return uuidBytes;
}
}
parse(headers) {
const out = {};
let position = 0;
while (position < headers.byteLength) {
const nameLength = headers.getUint8(position++);
const name = this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, nameLength));
position += nameLength;
switch (headers.getUint8(position++)) {
case 0:
out[name] = {
type: BOOLEAN_TAG,
value: true,
};
break;
case 1:
out[name] = {
type: BOOLEAN_TAG,
value: false,
};
break;
case 2:
out[name] = {
type: BYTE_TAG,
value: headers.getInt8(position++),
};
break;
case 3:
out[name] = {
type: SHORT_TAG,
value: headers.getInt16(position, false),
};
position += 2;
break;
case 4:
out[name] = {
type: INT_TAG,
value: headers.getInt32(position, false),
};
position += 4;
break;
case 5:
out[name] = {
type: LONG_TAG,
value: new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)),
};
position += 8;
break;
case 6:
const binaryLength = headers.getUint16(position, false);
position += 2;
out[name] = {
type: BINARY_TAG,
value: new Uint8Array(headers.buffer, headers.byteOffset + position, binaryLength),
};
position += binaryLength;
break;
case 7:
const stringLength = headers.getUint16(position, false);
position += 2;
out[name] = {
type: STRING_TAG,
value: this.toUtf8(new Uint8Array(headers.buffer, headers.byteOffset + position, stringLength)),
};
position += stringLength;
break;
case 8:
out[name] = {
type: TIMESTAMP_TAG,
value: new Date(new Int64_1.Int64(new Uint8Array(headers.buffer, headers.byteOffset + position, 8)).valueOf()),
};
position += 8;
break;
case 9:
const uuidBytes = new Uint8Array(headers.buffer, headers.byteOffset + position, 16);
position += 16;
out[name] = {
type: UUID_TAG,
value: `${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(0, 4))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(4, 6))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(6, 8))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(8, 10))}-${(0, util_hex_encoding_1.toHex)(uuidBytes.subarray(10))}`,
};
break;
default:
throw new Error(`Unrecognized header type tag`);
}
}
return out;
}
}
exports.HeaderMarshaller = HeaderMarshaller;
var HEADER_VALUE_TYPE;
(function (HEADER_VALUE_TYPE) {
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolTrue"] = 0] = "boolTrue";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["boolFalse"] = 1] = "boolFalse";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byte"] = 2] = "byte";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["short"] = 3] = "short";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["integer"] = 4] = "integer";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["long"] = 5] = "long";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["byteArray"] = 6] = "byteArray";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["string"] = 7] = "string";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["timestamp"] = 8] = "timestamp";
HEADER_VALUE_TYPE[HEADER_VALUE_TYPE["uuid"] = 9] = "uuid";
})(HEADER_VALUE_TYPE || (HEADER_VALUE_TYPE = {}));
const BOOLEAN_TAG = "boolean";
const BYTE_TAG = "byte";
const SHORT_TAG = "short";
const INT_TAG = "integer";
const LONG_TAG = "long";
const BINARY_TAG = "binary";
const STRING_TAG = "string";
const TIMESTAMP_TAG = "timestamp";
const UUID_TAG = "uuid";
const UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/;
/***/ }),
/***/ 46086:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Int64 = void 0;
const util_hex_encoding_1 = __nccwpck_require__(45364);
class Int64 {
constructor(bytes) {
this.bytes = bytes;
if (bytes.byteLength !== 8) {
throw new Error("Int64 buffers must be exactly 8 bytes");
}
}
static fromNumber(number) {
if (number > 9223372036854776000 || number < -9223372036854776000) {
throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`);
}
const bytes = new Uint8Array(8);
for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) {
bytes[i] = remaining;
}
if (number < 0) {
negate(bytes);
}
return new Int64(bytes);
}
valueOf() {
const bytes = this.bytes.slice(0);
const negative = bytes[0] & 0b10000000;
if (negative) {
negate(bytes);
}
return parseInt((0, util_hex_encoding_1.toHex)(bytes), 16) * (negative ? -1 : 1);
}
toString() {
return String(this.valueOf());
}
}
exports.Int64 = Int64;
function negate(bytes) {
for (let i = 0; i < 8; i++) {
bytes[i] ^= 0xff;
}
for (let i = 7; i > -1; i--) {
bytes[i]++;
if (bytes[i] !== 0)
break;
}
}
/***/ }),
/***/ 73684:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 57255:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.MessageDecoderStream = void 0;
class MessageDecoderStream {
constructor(options) {
this.options = options;
}
[Symbol.asyncIterator]() {
return this.asyncIterator();
}
async *asyncIterator() {
for await (const bytes of this.options.inputStream) {
const decoded = this.options.decoder.decode(bytes);
yield decoded;
}
}
}
exports.MessageDecoderStream = MessageDecoderStream;
/***/ }),
/***/ 52362:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.MessageEncoderStream = void 0;
class MessageEncoderStream {
constructor(options) {
this.options = options;
}
[Symbol.asyncIterator]() {
return this.asyncIterator();
}
async *asyncIterator() {
for await (const msg of this.options.messageStream) {
const encoded = this.options.encoder.encode(msg);
yield encoded;
}
if (this.options.includeEndFrame) {
yield new Uint8Array(0);
}
}
}
exports.MessageEncoderStream = MessageEncoderStream;
/***/ }),
/***/ 62379:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SmithyMessageDecoderStream = void 0;
class SmithyMessageDecoderStream {
constructor(options) {
this.options = options;
}
[Symbol.asyncIterator]() {
return this.asyncIterator();
}
async *asyncIterator() {
for await (const message of this.options.messageStream) {
const deserialized = await this.options.deserializer(message);
if (deserialized === undefined)
continue;
yield deserialized;
}
}
}
exports.SmithyMessageDecoderStream = SmithyMessageDecoderStream;
/***/ }),
/***/ 12484:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SmithyMessageEncoderStream = void 0;
class SmithyMessageEncoderStream {
constructor(options) {
this.options = options;
}
[Symbol.asyncIterator]() {
return this.asyncIterator();
}
async *asyncIterator() {
for await (const chunk of this.options.inputStream) {
const payloadBuf = this.options.serializer(chunk);
yield payloadBuf;
}
}
}
exports.SmithyMessageEncoderStream = SmithyMessageEncoderStream;
/***/ }),
/***/ 56459:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(11014), exports);
tslib_1.__exportStar(__nccwpck_require__(74712), exports);
tslib_1.__exportStar(__nccwpck_require__(46086), exports);
tslib_1.__exportStar(__nccwpck_require__(73684), exports);
tslib_1.__exportStar(__nccwpck_require__(57255), exports);
tslib_1.__exportStar(__nccwpck_require__(52362), exports);
tslib_1.__exportStar(__nccwpck_require__(62379), exports);
tslib_1.__exportStar(__nccwpck_require__(12484), exports);
/***/ }),
/***/ 20597:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.splitMessage = void 0;
const crc32_1 = __nccwpck_require__(47327);
const PRELUDE_MEMBER_LENGTH = 4;
const PRELUDE_LENGTH = PRELUDE_MEMBER_LENGTH * 2;
const CHECKSUM_LENGTH = 4;
const MINIMUM_MESSAGE_LENGTH = PRELUDE_LENGTH + CHECKSUM_LENGTH * 2;
function splitMessage({ byteLength, byteOffset, buffer }) {
if (byteLength < MINIMUM_MESSAGE_LENGTH) {
throw new Error("Provided message too short to accommodate event stream message overhead");
}
const view = new DataView(buffer, byteOffset, byteLength);
const messageLength = view.getUint32(0, false);
if (byteLength !== messageLength) {
throw new Error("Reported message length does not match received message length");
}
const headerLength = view.getUint32(PRELUDE_MEMBER_LENGTH, false);
const expectedPreludeChecksum = view.getUint32(PRELUDE_LENGTH, false);
const expectedMessageChecksum = view.getUint32(byteLength - CHECKSUM_LENGTH, false);
const checksummer = new crc32_1.Crc32().update(new Uint8Array(buffer, byteOffset, PRELUDE_LENGTH));
if (expectedPreludeChecksum !== checksummer.digest()) {
throw new Error(`The prelude checksum specified in the message (${expectedPreludeChecksum}) does not match the calculated CRC32 checksum (${checksummer.digest()})`);
}
checksummer.update(new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH, byteLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH)));
if (expectedMessageChecksum !== checksummer.digest()) {
throw new Error(`The message checksum (${checksummer.digest()}) did not match the expected value of ${expectedMessageChecksum}`);
}
return {
headers: new DataView(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH, headerLength),
body: new Uint8Array(buffer, byteOffset + PRELUDE_LENGTH + CHECKSUM_LENGTH + headerLength, messageLength - headerLength - (PRELUDE_LENGTH + CHECKSUM_LENGTH + CHECKSUM_LENGTH)),
};
}
exports.splitMessage = splitMessage;
/***/ }),
/***/ 3081:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Hash = void 0;
const util_buffer_from_1 = __nccwpck_require__(31381);
const util_utf8_1 = __nccwpck_require__(41895);
const buffer_1 = __nccwpck_require__(14300);
const crypto_1 = __nccwpck_require__(6113);
class Hash {
constructor(algorithmIdentifier, secret) {
this.algorithmIdentifier = algorithmIdentifier;
this.secret = secret;
this.reset();
}
update(toHash, encoding) {
this.hash.update((0, util_utf8_1.toUint8Array)(castSourceData(toHash, encoding)));
}
digest() {
return Promise.resolve(this.hash.digest());
}
reset() {
this.hash = this.secret
? (0, crypto_1.createHmac)(this.algorithmIdentifier, castSourceData(this.secret))
: (0, crypto_1.createHash)(this.algorithmIdentifier);
}
}
exports.Hash = Hash;
function castSourceData(toCast, encoding) {
if (buffer_1.Buffer.isBuffer(toCast)) {
return toCast;
}
if (typeof toCast === "string") {
return (0, util_buffer_from_1.fromString)(toCast, encoding);
}
if (ArrayBuffer.isView(toCast)) {
return (0, util_buffer_from_1.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength);
}
return (0, util_buffer_from_1.fromArrayBuffer)(toCast);
}
/***/ }),
/***/ 10780:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isArrayBuffer = void 0;
const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) ||
Object.prototype.toString.call(arg) === "[object ArrayBuffer]";
exports.isArrayBuffer = isArrayBuffer;
/***/ }),
/***/ 82800:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getContentLengthPlugin = exports.contentLengthMiddlewareOptions = exports.contentLengthMiddleware = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const CONTENT_LENGTH_HEADER = "content-length";
function contentLengthMiddleware(bodyLengthChecker) {
return (next) => async (args) => {
const request = args.request;
if (protocol_http_1.HttpRequest.isInstance(request)) {
const { body, headers } = request;
if (body &&
Object.keys(headers)
.map((str) => str.toLowerCase())
.indexOf(CONTENT_LENGTH_HEADER) === -1) {
try {
const length = bodyLengthChecker(body);
request.headers = {
...request.headers,
[CONTENT_LENGTH_HEADER]: String(length),
};
}
catch (error) {
}
}
}
return next({
...args,
request,
});
};
}
exports.contentLengthMiddleware = contentLengthMiddleware;
exports.contentLengthMiddlewareOptions = {
step: "build",
tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"],
name: "contentLengthMiddleware",
override: true,
};
const getContentLengthPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), exports.contentLengthMiddlewareOptions);
},
});
exports.getContentLengthPlugin = getContentLengthPlugin;
/***/ }),
/***/ 465:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.createConfigValueProvider = void 0;
const createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => {
const configProvider = async () => {
var _a;
const configValue = (_a = config[configKey]) !== null && _a !== void 0 ? _a : config[canonicalEndpointParamKey];
if (typeof configValue === "function") {
return configValue();
}
return configValue;
};
if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") {
return async () => {
const endpoint = await configProvider();
if (endpoint && typeof endpoint === "object") {
if ("url" in endpoint) {
return endpoint.url.href;
}
if ("hostname" in endpoint) {
const { protocol, hostname, port, path } = endpoint;
return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`;
}
}
return endpoint;
};
}
return configProvider;
};
exports.createConfigValueProvider = createConfigValueProvider;
/***/ }),
/***/ 31518:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointFromConfig = void 0;
const node_config_provider_1 = __nccwpck_require__(33461);
const getEndpointUrlConfig_1 = __nccwpck_require__(7574);
const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId))();
exports.getEndpointFromConfig = getEndpointFromConfig;
/***/ }),
/***/ 73929:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveParams = exports.getEndpointFromInstructions = void 0;
const service_customizations_1 = __nccwpck_require__(13105);
const createConfigValueProvider_1 = __nccwpck_require__(465);
const getEndpointFromConfig_1 = __nccwpck_require__(31518);
const toEndpointV1_1 = __nccwpck_require__(38938);
const getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => {
if (!clientConfig.endpoint) {
const endpointFromConfig = await (0, getEndpointFromConfig_1.getEndpointFromConfig)(clientConfig.serviceId || "");
if (endpointFromConfig) {
clientConfig.endpoint = () => Promise.resolve((0, toEndpointV1_1.toEndpointV1)(endpointFromConfig));
}
}
const endpointParams = await (0, exports.resolveParams)(commandInput, instructionsSupplier, clientConfig);
if (typeof clientConfig.endpointProvider !== "function") {
throw new Error("config.endpointProvider is not set.");
}
const endpoint = clientConfig.endpointProvider(endpointParams, context);
return endpoint;
};
exports.getEndpointFromInstructions = getEndpointFromInstructions;
const resolveParams = async (commandInput, instructionsSupplier, clientConfig) => {
var _a;
const endpointParams = {};
const instructions = ((_a = instructionsSupplier === null || instructionsSupplier === void 0 ? void 0 : instructionsSupplier.getEndpointParameterInstructions) === null || _a === void 0 ? void 0 : _a.call(instructionsSupplier)) || {};
for (const [name, instruction] of Object.entries(instructions)) {
switch (instruction.type) {
case "staticContextParams":
endpointParams[name] = instruction.value;
break;
case "contextParams":
endpointParams[name] = commandInput[instruction.name];
break;
case "clientContextParams":
case "builtInParams":
endpointParams[name] = await (0, createConfigValueProvider_1.createConfigValueProvider)(instruction.name, name, clientConfig)();
break;
default:
throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction));
}
}
if (Object.keys(instructions).length === 0) {
Object.assign(endpointParams, clientConfig);
}
if (String(clientConfig.serviceId).toLowerCase() === "s3") {
await (0, service_customizations_1.resolveParamsForS3)(endpointParams);
}
return endpointParams;
};
exports.resolveParams = resolveParams;
/***/ }),
/***/ 7574:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointUrlConfig = void 0;
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL";
const CONFIG_ENDPOINT_URL = "endpoint_url";
const getEndpointUrlConfig = (serviceId) => ({
environmentVariableSelector: (env) => {
const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase());
const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")];
if (serviceEndpointUrl)
return serviceEndpointUrl;
const endpointUrl = env[ENV_ENDPOINT_URL];
if (endpointUrl)
return endpointUrl;
return undefined;
},
configFileSelector: (profile, config) => {
if (config && profile.services) {
const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)];
if (servicesSection) {
const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase());
const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)];
if (endpointUrl)
return endpointUrl;
}
}
const endpointUrl = profile[CONFIG_ENDPOINT_URL];
if (endpointUrl)
return endpointUrl;
return undefined;
},
default: undefined,
});
exports.getEndpointUrlConfig = getEndpointUrlConfig;
/***/ }),
/***/ 50890:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(73929), exports);
tslib_1.__exportStar(__nccwpck_require__(38938), exports);
/***/ }),
/***/ 38938:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toEndpointV1 = void 0;
const url_parser_1 = __nccwpck_require__(14681);
const toEndpointV1 = (endpoint) => {
if (typeof endpoint === "object") {
if ("url" in endpoint) {
return (0, url_parser_1.parseUrl)(endpoint.url);
}
return endpoint;
}
return (0, url_parser_1.parseUrl)(endpoint);
};
exports.toEndpointV1 = toEndpointV1;
/***/ }),
/***/ 55520:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.endpointMiddleware = void 0;
const util_middleware_1 = __nccwpck_require__(2390);
const getEndpointFromInstructions_1 = __nccwpck_require__(73929);
const endpointMiddleware = ({ config, instructions, }) => {
return (next, context) => async (args) => {
var _a, _b, _c;
const endpoint = await (0, getEndpointFromInstructions_1.getEndpointFromInstructions)(args.input, {
getEndpointParameterInstructions() {
return instructions;
},
}, { ...config }, context);
context.endpointV2 = endpoint;
context.authSchemes = (_a = endpoint.properties) === null || _a === void 0 ? void 0 : _a.authSchemes;
const authScheme = (_b = context.authSchemes) === null || _b === void 0 ? void 0 : _b[0];
if (authScheme) {
context["signing_region"] = authScheme.signingRegion;
context["signing_service"] = authScheme.signingName;
const smithyContext = (0, util_middleware_1.getSmithyContext)(context);
const httpAuthOption = (_c = smithyContext === null || smithyContext === void 0 ? void 0 : smithyContext.selectedHttpAuthScheme) === null || _c === void 0 ? void 0 : _c.httpAuthOption;
if (httpAuthOption) {
httpAuthOption.signingProperties = Object.assign(httpAuthOption.signingProperties || {}, {
signing_region: authScheme.signingRegion,
signingRegion: authScheme.signingRegion,
signing_service: authScheme.signingName,
signingName: authScheme.signingName,
signingRegionSet: authScheme.signingRegionSet,
}, authScheme.properties);
}
}
return next({
...args,
});
};
};
exports.endpointMiddleware = endpointMiddleware;
/***/ }),
/***/ 71329:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointPlugin = exports.endpointMiddlewareOptions = void 0;
const middleware_serde_1 = __nccwpck_require__(81238);
const endpointMiddleware_1 = __nccwpck_require__(55520);
exports.endpointMiddlewareOptions = {
step: "serialize",
tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"],
name: "endpointV2Middleware",
override: true,
relation: "before",
toMiddleware: middleware_serde_1.serializerMiddlewareOption.name,
};
const getEndpointPlugin = (config, instructions) => ({
applyToStack: (clientStack) => {
clientStack.addRelativeTo((0, endpointMiddleware_1.endpointMiddleware)({
config,
instructions,
}), exports.endpointMiddlewareOptions);
},
});
exports.getEndpointPlugin = getEndpointPlugin;
/***/ }),
/***/ 82918:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(50890), exports);
tslib_1.__exportStar(__nccwpck_require__(55520), exports);
tslib_1.__exportStar(__nccwpck_require__(71329), exports);
tslib_1.__exportStar(__nccwpck_require__(74139), exports);
tslib_1.__exportStar(__nccwpck_require__(39720), exports);
/***/ }),
/***/ 74139:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveEndpointConfig = void 0;
const util_middleware_1 = __nccwpck_require__(2390);
const toEndpointV1_1 = __nccwpck_require__(38938);
const resolveEndpointConfig = (input) => {
var _a, _b, _c;
const tls = (_a = input.tls) !== null && _a !== void 0 ? _a : true;
const { endpoint } = input;
const customEndpointProvider = endpoint != null ? async () => (0, toEndpointV1_1.toEndpointV1)(await (0, util_middleware_1.normalizeProvider)(endpoint)()) : undefined;
const isCustomEndpoint = !!endpoint;
return {
...input,
endpoint: customEndpointProvider,
tls,
isCustomEndpoint,
useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false),
useFipsEndpoint: (0, util_middleware_1.normalizeProvider)((_c = input.useFipsEndpoint) !== null && _c !== void 0 ? _c : false),
};
};
exports.resolveEndpointConfig = resolveEndpointConfig;
/***/ }),
/***/ 13105:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(19194), exports);
/***/ }),
/***/ 19194:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isArnBucketName = exports.isDnsCompatibleBucketName = exports.S3_HOSTNAME_PATTERN = exports.DOT_PATTERN = exports.resolveParamsForS3 = void 0;
const resolveParamsForS3 = async (endpointParams) => {
const bucket = (endpointParams === null || endpointParams === void 0 ? void 0 : endpointParams.Bucket) || "";
if (typeof endpointParams.Bucket === "string") {
endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?"));
}
if ((0, exports.isArnBucketName)(bucket)) {
if (endpointParams.ForcePathStyle === true) {
throw new Error("Path-style addressing cannot be used with ARN buckets");
}
}
else if (!(0, exports.isDnsCompatibleBucketName)(bucket) ||
(bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:")) ||
bucket.toLowerCase() !== bucket ||
bucket.length < 3) {
endpointParams.ForcePathStyle = true;
}
if (endpointParams.DisableMultiRegionAccessPoints) {
endpointParams.disableMultiRegionAccessPoints = true;
endpointParams.DisableMRAP = true;
}
return endpointParams;
};
exports.resolveParamsForS3 = resolveParamsForS3;
const DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/;
const IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/;
const DOTS_PATTERN = /\.\./;
exports.DOT_PATTERN = /\./;
exports.S3_HOSTNAME_PATTERN = /^(.+\.)?s3(-fips)?(\.dualstack)?[.-]([a-z0-9-]+)\./;
const isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName);
exports.isDnsCompatibleBucketName = isDnsCompatibleBucketName;
const isArnBucketName = (bucketName) => {
const [arn, partition, service, region, account, typeOrId] = bucketName.split(":");
const isArn = arn === "arn" && bucketName.split(":").length >= 6;
const isValidArn = [arn, partition, service, account, typeOrId].filter(Boolean).length === 5;
if (isArn && !isValidArn) {
throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`);
}
return arn === "arn" && !!partition && !!service && !!account && !!typeOrId;
};
exports.isArnBucketName = isArnBucketName;
/***/ }),
/***/ 39720:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 80155:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AdaptiveRetryStrategy = void 0;
const util_retry_1 = __nccwpck_require__(84902);
const StandardRetryStrategy_1 = __nccwpck_require__(94582);
class AdaptiveRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy {
constructor(maxAttemptsProvider, options) {
const { rateLimiter, ...superOptions } = options !== null && options !== void 0 ? options : {};
super(maxAttemptsProvider, superOptions);
this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new util_retry_1.DefaultRateLimiter();
this.mode = util_retry_1.RETRY_MODES.ADAPTIVE;
}
async retry(next, args) {
return super.retry(next, args, {
beforeRequest: async () => {
return this.rateLimiter.getSendToken();
},
afterRequest: (response) => {
this.rateLimiter.updateClientSendingRate(response);
},
});
}
}
exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy;
/***/ }),
/***/ 94582:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.StandardRetryStrategy = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const service_error_classification_1 = __nccwpck_require__(6375);
const util_retry_1 = __nccwpck_require__(84902);
const uuid_1 = __nccwpck_require__(75840);
const defaultRetryQuota_1 = __nccwpck_require__(29991);
const delayDecider_1 = __nccwpck_require__(9465);
const retryDecider_1 = __nccwpck_require__(67653);
const util_1 = __nccwpck_require__(42827);
class StandardRetryStrategy {
constructor(maxAttemptsProvider, options) {
var _a, _b, _c;
this.maxAttemptsProvider = maxAttemptsProvider;
this.mode = util_retry_1.RETRY_MODES.STANDARD;
this.retryDecider = (_a = options === null || options === void 0 ? void 0 : options.retryDecider) !== null && _a !== void 0 ? _a : retryDecider_1.defaultRetryDecider;
this.delayDecider = (_b = options === null || options === void 0 ? void 0 : options.delayDecider) !== null && _b !== void 0 ? _b : delayDecider_1.defaultDelayDecider;
this.retryQuota = (_c = options === null || options === void 0 ? void 0 : options.retryQuota) !== null && _c !== void 0 ? _c : (0, defaultRetryQuota_1.getDefaultRetryQuota)(util_retry_1.INITIAL_RETRY_TOKENS);
}
shouldRetry(error, attempts, maxAttempts) {
return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error);
}
async getMaxAttempts() {
let maxAttempts;
try {
maxAttempts = await this.maxAttemptsProvider();
}
catch (error) {
maxAttempts = util_retry_1.DEFAULT_MAX_ATTEMPTS;
}
return maxAttempts;
}
async retry(next, args, options) {
let retryTokenAmount;
let attempts = 0;
let totalDelay = 0;
const maxAttempts = await this.getMaxAttempts();
const { request } = args;
if (protocol_http_1.HttpRequest.isInstance(request)) {
request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)();
}
while (true) {
try {
if (protocol_http_1.HttpRequest.isInstance(request)) {
request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`;
}
if (options === null || options === void 0 ? void 0 : options.beforeRequest) {
await options.beforeRequest();
}
const { response, output } = await next(args);
if (options === null || options === void 0 ? void 0 : options.afterRequest) {
options.afterRequest(response);
}
this.retryQuota.releaseRetryTokens(retryTokenAmount);
output.$metadata.attempts = attempts + 1;
output.$metadata.totalRetryDelay = totalDelay;
return { response, output };
}
catch (e) {
const err = (0, util_1.asSdkError)(e);
attempts++;
if (this.shouldRetry(err, attempts, maxAttempts)) {
retryTokenAmount = this.retryQuota.retrieveRetryTokens(err);
const delayFromDecider = this.delayDecider((0, service_error_classification_1.isThrottlingError)(err) ? util_retry_1.THROTTLING_RETRY_DELAY_BASE : util_retry_1.DEFAULT_RETRY_DELAY_BASE, attempts);
const delayFromResponse = getDelayFromRetryAfterHeader(err.$response);
const delay = Math.max(delayFromResponse || 0, delayFromDecider);
totalDelay += delay;
await new Promise((resolve) => setTimeout(resolve, delay));
continue;
}
if (!err.$metadata) {
err.$metadata = {};
}
err.$metadata.attempts = attempts;
err.$metadata.totalRetryDelay = totalDelay;
throw err;
}
}
}
}
exports.StandardRetryStrategy = StandardRetryStrategy;
const getDelayFromRetryAfterHeader = (response) => {
if (!protocol_http_1.HttpResponse.isInstance(response))
return;
const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after");
if (!retryAfterHeaderName)
return;
const retryAfter = response.headers[retryAfterHeaderName];
const retryAfterSeconds = Number(retryAfter);
if (!Number.isNaN(retryAfterSeconds))
return retryAfterSeconds * 1000;
const retryAfterDate = new Date(retryAfter);
return retryAfterDate.getTime() - Date.now();
};
/***/ }),
/***/ 58709:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_RETRY_MODE_CONFIG_OPTIONS = exports.CONFIG_RETRY_MODE = exports.ENV_RETRY_MODE = exports.resolveRetryConfig = exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = exports.CONFIG_MAX_ATTEMPTS = exports.ENV_MAX_ATTEMPTS = void 0;
const util_middleware_1 = __nccwpck_require__(2390);
const util_retry_1 = __nccwpck_require__(84902);
exports.ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS";
exports.CONFIG_MAX_ATTEMPTS = "max_attempts";
exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => {
const value = env[exports.ENV_MAX_ATTEMPTS];
if (!value)
return undefined;
const maxAttempt = parseInt(value);
if (Number.isNaN(maxAttempt)) {
throw new Error(`Environment variable ${exports.ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`);
}
return maxAttempt;
},
configFileSelector: (profile) => {
const value = profile[exports.CONFIG_MAX_ATTEMPTS];
if (!value)
return undefined;
const maxAttempt = parseInt(value);
if (Number.isNaN(maxAttempt)) {
throw new Error(`Shared config file entry ${exports.CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`);
}
return maxAttempt;
},
default: util_retry_1.DEFAULT_MAX_ATTEMPTS,
};
const resolveRetryConfig = (input) => {
var _a;
const { retryStrategy } = input;
const maxAttempts = (0, util_middleware_1.normalizeProvider)((_a = input.maxAttempts) !== null && _a !== void 0 ? _a : util_retry_1.DEFAULT_MAX_ATTEMPTS);
return {
...input,
maxAttempts,
retryStrategy: async () => {
if (retryStrategy) {
return retryStrategy;
}
const retryMode = await (0, util_middleware_1.normalizeProvider)(input.retryMode)();
if (retryMode === util_retry_1.RETRY_MODES.ADAPTIVE) {
return new util_retry_1.AdaptiveRetryStrategy(maxAttempts);
}
return new util_retry_1.StandardRetryStrategy(maxAttempts);
},
};
};
exports.resolveRetryConfig = resolveRetryConfig;
exports.ENV_RETRY_MODE = "AWS_RETRY_MODE";
exports.CONFIG_RETRY_MODE = "retry_mode";
exports.NODE_RETRY_MODE_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => env[exports.ENV_RETRY_MODE],
configFileSelector: (profile) => profile[exports.CONFIG_RETRY_MODE],
default: util_retry_1.DEFAULT_RETRY_MODE,
};
/***/ }),
/***/ 29991:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getDefaultRetryQuota = void 0;
const util_retry_1 = __nccwpck_require__(84902);
const getDefaultRetryQuota = (initialRetryTokens, options) => {
var _a, _b, _c;
const MAX_CAPACITY = initialRetryTokens;
const noRetryIncrement = (_a = options === null || options === void 0 ? void 0 : options.noRetryIncrement) !== null && _a !== void 0 ? _a : util_retry_1.NO_RETRY_INCREMENT;
const retryCost = (_b = options === null || options === void 0 ? void 0 : options.retryCost) !== null && _b !== void 0 ? _b : util_retry_1.RETRY_COST;
const timeoutRetryCost = (_c = options === null || options === void 0 ? void 0 : options.timeoutRetryCost) !== null && _c !== void 0 ? _c : util_retry_1.TIMEOUT_RETRY_COST;
let availableCapacity = initialRetryTokens;
const getCapacityAmount = (error) => (error.name === "TimeoutError" ? timeoutRetryCost : retryCost);
const hasRetryTokens = (error) => getCapacityAmount(error) <= availableCapacity;
const retrieveRetryTokens = (error) => {
if (!hasRetryTokens(error)) {
throw new Error("No retry token available");
}
const capacityAmount = getCapacityAmount(error);
availableCapacity -= capacityAmount;
return capacityAmount;
};
const releaseRetryTokens = (capacityReleaseAmount) => {
availableCapacity += capacityReleaseAmount !== null && capacityReleaseAmount !== void 0 ? capacityReleaseAmount : noRetryIncrement;
availableCapacity = Math.min(availableCapacity, MAX_CAPACITY);
};
return Object.freeze({
hasRetryTokens,
retrieveRetryTokens,
releaseRetryTokens,
});
};
exports.getDefaultRetryQuota = getDefaultRetryQuota;
/***/ }),
/***/ 9465:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultDelayDecider = void 0;
const util_retry_1 = __nccwpck_require__(84902);
const defaultDelayDecider = (delayBase, attempts) => Math.floor(Math.min(util_retry_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase));
exports.defaultDelayDecider = defaultDelayDecider;
/***/ }),
/***/ 96039:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(80155), exports);
tslib_1.__exportStar(__nccwpck_require__(94582), exports);
tslib_1.__exportStar(__nccwpck_require__(58709), exports);
tslib_1.__exportStar(__nccwpck_require__(9465), exports);
tslib_1.__exportStar(__nccwpck_require__(76556), exports);
tslib_1.__exportStar(__nccwpck_require__(67653), exports);
tslib_1.__exportStar(__nccwpck_require__(81434), exports);
/***/ }),
/***/ 76556:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getOmitRetryHeadersPlugin = exports.omitRetryHeadersMiddlewareOptions = exports.omitRetryHeadersMiddleware = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const util_retry_1 = __nccwpck_require__(84902);
const omitRetryHeadersMiddleware = () => (next) => async (args) => {
const { request } = args;
if (protocol_http_1.HttpRequest.isInstance(request)) {
delete request.headers[util_retry_1.INVOCATION_ID_HEADER];
delete request.headers[util_retry_1.REQUEST_HEADER];
}
return next(args);
};
exports.omitRetryHeadersMiddleware = omitRetryHeadersMiddleware;
exports.omitRetryHeadersMiddlewareOptions = {
name: "omitRetryHeadersMiddleware",
tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"],
relation: "before",
toMiddleware: "awsAuthMiddleware",
override: true,
};
const getOmitRetryHeadersPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.addRelativeTo((0, exports.omitRetryHeadersMiddleware)(), exports.omitRetryHeadersMiddlewareOptions);
},
});
exports.getOmitRetryHeadersPlugin = getOmitRetryHeadersPlugin;
/***/ }),
/***/ 67653:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.defaultRetryDecider = void 0;
const service_error_classification_1 = __nccwpck_require__(6375);
const defaultRetryDecider = (error) => {
if (!error) {
return false;
}
return (0, service_error_classification_1.isRetryableByTrait)(error) || (0, service_error_classification_1.isClockSkewError)(error) || (0, service_error_classification_1.isThrottlingError)(error) || (0, service_error_classification_1.isTransientError)(error);
};
exports.defaultRetryDecider = defaultRetryDecider;
/***/ }),
/***/ 81434:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getRetryAfterHint = exports.getRetryPlugin = exports.retryMiddlewareOptions = exports.retryMiddleware = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const service_error_classification_1 = __nccwpck_require__(6375);
const util_retry_1 = __nccwpck_require__(84902);
const uuid_1 = __nccwpck_require__(75840);
const util_1 = __nccwpck_require__(42827);
const retryMiddleware = (options) => (next, context) => async (args) => {
let retryStrategy = await options.retryStrategy();
const maxAttempts = await options.maxAttempts();
if (isRetryStrategyV2(retryStrategy)) {
retryStrategy = retryStrategy;
let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]);
let lastError = new Error();
let attempts = 0;
let totalRetryDelay = 0;
const { request } = args;
if (protocol_http_1.HttpRequest.isInstance(request)) {
request.headers[util_retry_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)();
}
while (true) {
try {
if (protocol_http_1.HttpRequest.isInstance(request)) {
request.headers[util_retry_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`;
}
const { response, output } = await next(args);
retryStrategy.recordSuccess(retryToken);
output.$metadata.attempts = attempts + 1;
output.$metadata.totalRetryDelay = totalRetryDelay;
return { response, output };
}
catch (e) {
const retryErrorInfo = getRetryErrorInfo(e);
lastError = (0, util_1.asSdkError)(e);
try {
retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo);
}
catch (refreshError) {
if (!lastError.$metadata) {
lastError.$metadata = {};
}
lastError.$metadata.attempts = attempts + 1;
lastError.$metadata.totalRetryDelay = totalRetryDelay;
throw lastError;
}
attempts = retryToken.getRetryCount();
const delay = retryToken.getRetryDelay();
totalRetryDelay += delay;
await new Promise((resolve) => setTimeout(resolve, delay));
}
}
}
else {
retryStrategy = retryStrategy;
if (retryStrategy === null || retryStrategy === void 0 ? void 0 : retryStrategy.mode)
context.userAgent = [...(context.userAgent || []), ["cfg/retry-mode", retryStrategy.mode]];
return retryStrategy.retry(next, args);
}
};
exports.retryMiddleware = retryMiddleware;
const isRetryStrategyV2 = (retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" &&
typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" &&
typeof retryStrategy.recordSuccess !== "undefined";
const getRetryErrorInfo = (error) => {
const errorInfo = {
errorType: getRetryErrorType(error),
};
const retryAfterHint = (0, exports.getRetryAfterHint)(error.$response);
if (retryAfterHint) {
errorInfo.retryAfterHint = retryAfterHint;
}
return errorInfo;
};
const getRetryErrorType = (error) => {
if ((0, service_error_classification_1.isThrottlingError)(error))
return "THROTTLING";
if ((0, service_error_classification_1.isTransientError)(error))
return "TRANSIENT";
if ((0, service_error_classification_1.isServerError)(error))
return "SERVER_ERROR";
return "CLIENT_ERROR";
};
exports.retryMiddlewareOptions = {
name: "retryMiddleware",
tags: ["RETRY"],
step: "finalizeRequest",
priority: "high",
override: true,
};
const getRetryPlugin = (options) => ({
applyToStack: (clientStack) => {
clientStack.add((0, exports.retryMiddleware)(options), exports.retryMiddlewareOptions);
},
});
exports.getRetryPlugin = getRetryPlugin;
const getRetryAfterHint = (response) => {
if (!protocol_http_1.HttpResponse.isInstance(response))
return;
const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after");
if (!retryAfterHeaderName)
return;
const retryAfter = response.headers[retryAfterHeaderName];
const retryAfterSeconds = Number(retryAfter);
if (!Number.isNaN(retryAfterSeconds))
return new Date(retryAfterSeconds * 1000);
const retryAfterDate = new Date(retryAfter);
return retryAfterDate;
};
exports.getRetryAfterHint = getRetryAfterHint;
/***/ }),
/***/ 42827:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.asSdkError = void 0;
const asSdkError = (error) => {
if (error instanceof Error)
return error;
if (error instanceof Object)
return Object.assign(new Error(), error);
if (typeof error === "string")
return new Error(error);
return new Error(`AWS SDK error wrapper for ${error}`);
};
exports.asSdkError = asSdkError;
/***/ }),
/***/ 21595:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.deserializerMiddleware = void 0;
const deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => {
const { response } = await next(args);
try {
const parsed = await deserializer(response, options);
return {
response,
output: parsed,
};
}
catch (error) {
Object.defineProperty(error, "$response", {
value: response,
});
if (!("$metadata" in error)) {
const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`;
error.message += "\n " + hint;
}
throw error;
}
};
exports.deserializerMiddleware = deserializerMiddleware;
/***/ }),
/***/ 81238:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(21595), exports);
tslib_1.__exportStar(__nccwpck_require__(72338), exports);
tslib_1.__exportStar(__nccwpck_require__(23566), exports);
/***/ }),
/***/ 72338:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSerdePlugin = exports.serializerMiddlewareOption = exports.deserializerMiddlewareOption = void 0;
const deserializerMiddleware_1 = __nccwpck_require__(21595);
const serializerMiddleware_1 = __nccwpck_require__(23566);
exports.deserializerMiddlewareOption = {
name: "deserializerMiddleware",
step: "deserialize",
tags: ["DESERIALIZER"],
override: true,
};
exports.serializerMiddlewareOption = {
name: "serializerMiddleware",
step: "serialize",
tags: ["SERIALIZER"],
override: true,
};
function getSerdePlugin(config, serializer, deserializer) {
return {
applyToStack: (commandStack) => {
commandStack.add((0, deserializerMiddleware_1.deserializerMiddleware)(config, deserializer), exports.deserializerMiddlewareOption);
commandStack.add((0, serializerMiddleware_1.serializerMiddleware)(config, serializer), exports.serializerMiddlewareOption);
},
};
}
exports.getSerdePlugin = getSerdePlugin;
/***/ }),
/***/ 23566:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.serializerMiddleware = void 0;
const serializerMiddleware = (options, serializer) => (next, context) => async (args) => {
var _a;
const endpoint = ((_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.url) && options.urlParser
? async () => options.urlParser(context.endpointV2.url)
: options.endpoint;
if (!endpoint) {
throw new Error("No valid endpoint provider available.");
}
const request = await serializer(args.input, { ...options, endpoint });
return next({
...args,
request,
});
};
exports.serializerMiddleware = serializerMiddleware;
/***/ }),
/***/ 2404:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.constructStack = void 0;
const getAllAliases = (name, aliases) => {
const _aliases = [];
if (name) {
_aliases.push(name);
}
if (aliases) {
for (const alias of aliases) {
_aliases.push(alias);
}
}
return _aliases;
};
const getMiddlewareNameWithAliases = (name, aliases) => {
return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`;
};
const constructStack = () => {
let absoluteEntries = [];
let relativeEntries = [];
let identifyOnResolve = false;
const entriesNameSet = new Set();
const sort = (entries) => entries.sort((a, b) => stepWeights[b.step] - stepWeights[a.step] ||
priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"]);
const removeByName = (toRemove) => {
let isRemoved = false;
const filterCb = (entry) => {
const aliases = getAllAliases(entry.name, entry.aliases);
if (aliases.includes(toRemove)) {
isRemoved = true;
for (const alias of aliases) {
entriesNameSet.delete(alias);
}
return false;
}
return true;
};
absoluteEntries = absoluteEntries.filter(filterCb);
relativeEntries = relativeEntries.filter(filterCb);
return isRemoved;
};
const removeByReference = (toRemove) => {
let isRemoved = false;
const filterCb = (entry) => {
if (entry.middleware === toRemove) {
isRemoved = true;
for (const alias of getAllAliases(entry.name, entry.aliases)) {
entriesNameSet.delete(alias);
}
return false;
}
return true;
};
absoluteEntries = absoluteEntries.filter(filterCb);
relativeEntries = relativeEntries.filter(filterCb);
return isRemoved;
};
const cloneTo = (toStack) => {
var _a;
absoluteEntries.forEach((entry) => {
toStack.add(entry.middleware, { ...entry });
});
relativeEntries.forEach((entry) => {
toStack.addRelativeTo(entry.middleware, { ...entry });
});
(_a = toStack.identifyOnResolve) === null || _a === void 0 ? void 0 : _a.call(toStack, stack.identifyOnResolve());
return toStack;
};
const expandRelativeMiddlewareList = (from) => {
const expandedMiddlewareList = [];
from.before.forEach((entry) => {
if (entry.before.length === 0 && entry.after.length === 0) {
expandedMiddlewareList.push(entry);
}
else {
expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry));
}
});
expandedMiddlewareList.push(from);
from.after.reverse().forEach((entry) => {
if (entry.before.length === 0 && entry.after.length === 0) {
expandedMiddlewareList.push(entry);
}
else {
expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry));
}
});
return expandedMiddlewareList;
};
const getMiddlewareList = (debug = false) => {
const normalizedAbsoluteEntries = [];
const normalizedRelativeEntries = [];
const normalizedEntriesNameMap = {};
absoluteEntries.forEach((entry) => {
const normalizedEntry = {
...entry,
before: [],
after: [],
};
for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) {
normalizedEntriesNameMap[alias] = normalizedEntry;
}
normalizedAbsoluteEntries.push(normalizedEntry);
});
relativeEntries.forEach((entry) => {
const normalizedEntry = {
...entry,
before: [],
after: [],
};
for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) {
normalizedEntriesNameMap[alias] = normalizedEntry;
}
normalizedRelativeEntries.push(normalizedEntry);
});
normalizedRelativeEntries.forEach((entry) => {
if (entry.toMiddleware) {
const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware];
if (toMiddleware === undefined) {
if (debug) {
return;
}
throw new Error(`${entry.toMiddleware} is not found when adding ` +
`${getMiddlewareNameWithAliases(entry.name, entry.aliases)} ` +
`middleware ${entry.relation} ${entry.toMiddleware}`);
}
if (entry.relation === "after") {
toMiddleware.after.push(entry);
}
if (entry.relation === "before") {
toMiddleware.before.push(entry);
}
}
});
const mainChain = sort(normalizedAbsoluteEntries)
.map(expandRelativeMiddlewareList)
.reduce((wholeList, expandedMiddlewareList) => {
wholeList.push(...expandedMiddlewareList);
return wholeList;
}, []);
return mainChain;
};
const stack = {
add: (middleware, options = {}) => {
const { name, override, aliases: _aliases } = options;
const entry = {
step: "initialize",
priority: "normal",
middleware,
...options,
};
const aliases = getAllAliases(name, _aliases);
if (aliases.length > 0) {
if (aliases.some((alias) => entriesNameSet.has(alias))) {
if (!override)
throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`);
for (const alias of aliases) {
const toOverrideIndex = absoluteEntries.findIndex((entry) => { var _a; return entry.name === alias || ((_a = entry.aliases) === null || _a === void 0 ? void 0 : _a.some((a) => a === alias)); });
if (toOverrideIndex === -1) {
continue;
}
const toOverride = absoluteEntries[toOverrideIndex];
if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) {
throw new Error(`"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ` +
`${toOverride.priority} priority in ${toOverride.step} step cannot ` +
`be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ` +
`${entry.priority} priority in ${entry.step} step.`);
}
absoluteEntries.splice(toOverrideIndex, 1);
}
}
for (const alias of aliases) {
entriesNameSet.add(alias);
}
}
absoluteEntries.push(entry);
},
addRelativeTo: (middleware, options) => {
const { name, override, aliases: _aliases } = options;
const entry = {
middleware,
...options,
};
const aliases = getAllAliases(name, _aliases);
if (aliases.length > 0) {
if (aliases.some((alias) => entriesNameSet.has(alias))) {
if (!override)
throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`);
for (const alias of aliases) {
const toOverrideIndex = relativeEntries.findIndex((entry) => { var _a; return entry.name === alias || ((_a = entry.aliases) === null || _a === void 0 ? void 0 : _a.some((a) => a === alias)); });
if (toOverrideIndex === -1) {
continue;
}
const toOverride = relativeEntries[toOverrideIndex];
if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) {
throw new Error(`"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ` +
`${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden ` +
`by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} ` +
`"${entry.toMiddleware}" middleware.`);
}
relativeEntries.splice(toOverrideIndex, 1);
}
}
for (const alias of aliases) {
entriesNameSet.add(alias);
}
}
relativeEntries.push(entry);
},
clone: () => cloneTo((0, exports.constructStack)()),
use: (plugin) => {
plugin.applyToStack(stack);
},
remove: (toRemove) => {
if (typeof toRemove === "string")
return removeByName(toRemove);
else
return removeByReference(toRemove);
},
removeByTag: (toRemove) => {
let isRemoved = false;
const filterCb = (entry) => {
const { tags, name, aliases: _aliases } = entry;
if (tags && tags.includes(toRemove)) {
const aliases = getAllAliases(name, _aliases);
for (const alias of aliases) {
entriesNameSet.delete(alias);
}
isRemoved = true;
return false;
}
return true;
};
absoluteEntries = absoluteEntries.filter(filterCb);
relativeEntries = relativeEntries.filter(filterCb);
return isRemoved;
},
concat: (from) => {
var _a, _b;
const cloned = cloneTo((0, exports.constructStack)());
cloned.use(from);
cloned.identifyOnResolve(identifyOnResolve || cloned.identifyOnResolve() || ((_b = (_a = from.identifyOnResolve) === null || _a === void 0 ? void 0 : _a.call(from)) !== null && _b !== void 0 ? _b : false));
return cloned;
},
applyToStack: cloneTo,
identify: () => {
return getMiddlewareList(true).map((mw) => {
var _a;
const step = (_a = mw.step) !== null && _a !== void 0 ? _a : mw.relation +
" " +
mw.toMiddleware;
return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step;
});
},
identifyOnResolve(toggle) {
if (typeof toggle === "boolean")
identifyOnResolve = toggle;
return identifyOnResolve;
},
resolve: (handler, context) => {
for (const middleware of getMiddlewareList()
.map((entry) => entry.middleware)
.reverse()) {
handler = middleware(handler, context);
}
if (identifyOnResolve) {
console.log(stack.identify());
}
return handler;
},
};
return stack;
};
exports.constructStack = constructStack;
const stepWeights = {
initialize: 5,
serialize: 4,
build: 3,
finalizeRequest: 2,
deserialize: 1,
};
const priorityWeights = {
high: 3,
normal: 2,
low: 1,
};
/***/ }),
/***/ 97911:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(2404), exports);
/***/ }),
/***/ 54766:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.loadConfig = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fromEnv_1 = __nccwpck_require__(15606);
const fromSharedConfigFiles_1 = __nccwpck_require__(45784);
const fromStatic_1 = __nccwpck_require__(23091);
const loadConfig = ({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromEnv_1.fromEnv)(environmentVariableSelector), (0, fromSharedConfigFiles_1.fromSharedConfigFiles)(configFileSelector, configuration), (0, fromStatic_1.fromStatic)(defaultValue)));
exports.loadConfig = loadConfig;
/***/ }),
/***/ 15606:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromEnv = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const fromEnv = (envVarSelector) => async () => {
try {
const config = envVarSelector(process.env);
if (config === undefined) {
throw new Error();
}
return config;
}
catch (e) {
throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config from environment variables with getter: ${envVarSelector}`);
}
};
exports.fromEnv = fromEnv;
/***/ }),
/***/ 45784:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromSharedConfigFiles = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const shared_ini_file_loader_1 = __nccwpck_require__(43507);
const fromSharedConfigFiles = (configSelector, { preferredFile = "config", ...init } = {}) => async () => {
const profile = (0, shared_ini_file_loader_1.getProfileName)(init);
const { configFile, credentialsFile } = await (0, shared_ini_file_loader_1.loadSharedConfigFiles)(init);
const profileFromCredentials = credentialsFile[profile] || {};
const profileFromConfig = configFile[profile] || {};
const mergedProfile = preferredFile === "config"
? { ...profileFromCredentials, ...profileFromConfig }
: { ...profileFromConfig, ...profileFromCredentials };
try {
const cfgFile = preferredFile === "config" ? configFile : credentialsFile;
const configValue = configSelector(mergedProfile, cfgFile);
if (configValue === undefined) {
throw new Error();
}
return configValue;
}
catch (e) {
throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config for profile ${profile} in SDK configuration files with getter: ${configSelector}`);
}
};
exports.fromSharedConfigFiles = fromSharedConfigFiles;
/***/ }),
/***/ 23091:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromStatic = void 0;
const property_provider_1 = __nccwpck_require__(79721);
const isFunction = (func) => typeof func === "function";
const fromStatic = (defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, property_provider_1.fromStatic)(defaultValue);
exports.fromStatic = fromStatic;
/***/ }),
/***/ 33461:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(54766), exports);
/***/ }),
/***/ 33946:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODEJS_TIMEOUT_ERROR_CODES = void 0;
exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"];
/***/ }),
/***/ 70508:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getTransformedHeaders = void 0;
const getTransformedHeaders = (headers) => {
const transformedHeaders = {};
for (const name of Object.keys(headers)) {
const headerValues = headers[name];
transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues;
}
return transformedHeaders;
};
exports.getTransformedHeaders = getTransformedHeaders;
/***/ }),
/***/ 20258:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(96948), exports);
tslib_1.__exportStar(__nccwpck_require__(46999), exports);
tslib_1.__exportStar(__nccwpck_require__(81030), exports);
/***/ }),
/***/ 96948:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NodeHttpHandler = exports.DEFAULT_REQUEST_TIMEOUT = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const querystring_builder_1 = __nccwpck_require__(68031);
const http_1 = __nccwpck_require__(13685);
const https_1 = __nccwpck_require__(95687);
const constants_1 = __nccwpck_require__(33946);
const get_transformed_headers_1 = __nccwpck_require__(70508);
const set_connection_timeout_1 = __nccwpck_require__(25545);
const set_socket_keep_alive_1 = __nccwpck_require__(83751);
const set_socket_timeout_1 = __nccwpck_require__(42618);
const write_request_body_1 = __nccwpck_require__(73766);
exports.DEFAULT_REQUEST_TIMEOUT = 0;
class NodeHttpHandler {
constructor(options) {
this.metadata = { handlerProtocol: "http/1.1" };
this.configProvider = new Promise((resolve, reject) => {
if (typeof options === "function") {
options()
.then((_options) => {
resolve(this.resolveDefaultConfig(_options));
})
.catch(reject);
}
else {
resolve(this.resolveDefaultConfig(options));
}
});
}
resolveDefaultConfig(options) {
const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {};
const keepAlive = true;
const maxSockets = 50;
return {
connectionTimeout,
requestTimeout: requestTimeout !== null && requestTimeout !== void 0 ? requestTimeout : socketTimeout,
httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }),
httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }),
};
}
destroy() {
var _a, _b, _c, _d;
(_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy();
(_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy();
}
async handle(request, { abortSignal } = {}) {
if (!this.config) {
this.config = await this.configProvider;
}
return new Promise((_resolve, _reject) => {
var _a, _b;
let writeRequestBodyPromise = undefined;
const resolve = async (arg) => {
await writeRequestBodyPromise;
_resolve(arg);
};
const reject = async (arg) => {
await writeRequestBodyPromise;
_reject(arg);
};
if (!this.config) {
throw new Error("Node HTTP request handler config is not resolved");
}
if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) {
const abortError = new Error("Request aborted");
abortError.name = "AbortError";
reject(abortError);
return;
}
const isSSL = request.protocol === "https:";
const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {});
let auth = undefined;
if (request.username != null || request.password != null) {
const username = (_a = request.username) !== null && _a !== void 0 ? _a : "";
const password = (_b = request.password) !== null && _b !== void 0 ? _b : "";
auth = `${username}:${password}`;
}
let path = request.path;
if (queryString) {
path += `?${queryString}`;
}
if (request.fragment) {
path += `#${request.fragment}`;
}
const nodeHttpsOptions = {
headers: request.headers,
host: request.hostname,
method: request.method,
path,
port: request.port,
agent: isSSL ? this.config.httpsAgent : this.config.httpAgent,
auth,
};
const requestFunc = isSSL ? https_1.request : http_1.request;
const req = requestFunc(nodeHttpsOptions, (res) => {
const httpResponse = new protocol_http_1.HttpResponse({
statusCode: res.statusCode || -1,
reason: res.statusMessage,
headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers),
body: res,
});
resolve({ response: httpResponse });
});
req.on("error", (err) => {
if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) {
reject(Object.assign(err, { name: "TimeoutError" }));
}
else {
reject(err);
}
});
(0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout);
(0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.requestTimeout);
if (abortSignal) {
abortSignal.onabort = () => {
req.abort();
const abortError = new Error("Request aborted");
abortError.name = "AbortError";
reject(abortError);
};
}
const httpAgent = nodeHttpsOptions.agent;
if (typeof httpAgent === "object" && "keepAlive" in httpAgent) {
(0, set_socket_keep_alive_1.setSocketKeepAlive)(req, {
keepAlive: httpAgent.keepAlive,
keepAliveMsecs: httpAgent.keepAliveMsecs,
});
}
writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, this.config.requestTimeout).catch(_reject);
});
}
updateHttpClientConfig(key, value) {
this.config = undefined;
this.configProvider = this.configProvider.then((config) => {
return {
...config,
[key]: value,
};
});
}
httpHandlerConfigs() {
var _a;
return (_a = this.config) !== null && _a !== void 0 ? _a : {};
}
}
exports.NodeHttpHandler = NodeHttpHandler;
/***/ }),
/***/ 5771:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NodeHttp2ConnectionManager = void 0;
const tslib_1 = __nccwpck_require__(4351);
const http2_1 = tslib_1.__importDefault(__nccwpck_require__(85158));
const node_http2_connection_pool_1 = __nccwpck_require__(95157);
class NodeHttp2ConnectionManager {
constructor(config) {
this.sessionCache = new Map();
this.config = config;
if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) {
throw new RangeError("maxConcurrency must be greater than zero.");
}
}
lease(requestContext, connectionConfiguration) {
const url = this.getUrlString(requestContext);
const existingPool = this.sessionCache.get(url);
if (existingPool) {
const existingSession = existingPool.poll();
if (existingSession && !this.config.disableConcurrency) {
return existingSession;
}
}
const session = http2_1.default.connect(url);
if (this.config.maxConcurrency) {
session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => {
if (err) {
throw new Error("Fail to set maxConcurrentStreams to " +
this.config.maxConcurrency +
"when creating new session for " +
requestContext.destination.toString());
}
});
}
session.unref();
const destroySessionCb = () => {
session.destroy();
this.deleteSession(url, session);
};
session.on("goaway", destroySessionCb);
session.on("error", destroySessionCb);
session.on("frameError", destroySessionCb);
session.on("close", () => this.deleteSession(url, session));
if (connectionConfiguration.requestTimeout) {
session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb);
}
const connectionPool = this.sessionCache.get(url) || new node_http2_connection_pool_1.NodeHttp2ConnectionPool();
connectionPool.offerLast(session);
this.sessionCache.set(url, connectionPool);
return session;
}
deleteSession(authority, session) {
const existingConnectionPool = this.sessionCache.get(authority);
if (!existingConnectionPool) {
return;
}
if (!existingConnectionPool.contains(session)) {
return;
}
existingConnectionPool.remove(session);
this.sessionCache.set(authority, existingConnectionPool);
}
release(requestContext, session) {
var _a;
const cacheKey = this.getUrlString(requestContext);
(_a = this.sessionCache.get(cacheKey)) === null || _a === void 0 ? void 0 : _a.offerLast(session);
}
destroy() {
for (const [key, connectionPool] of this.sessionCache) {
for (const session of connectionPool) {
if (!session.destroyed) {
session.destroy();
}
connectionPool.remove(session);
}
this.sessionCache.delete(key);
}
}
setMaxConcurrentStreams(maxConcurrentStreams) {
if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) {
throw new RangeError("maxConcurrentStreams must be greater than zero.");
}
this.config.maxConcurrency = maxConcurrentStreams;
}
setDisableConcurrentStreams(disableConcurrentStreams) {
this.config.disableConcurrency = disableConcurrentStreams;
}
getUrlString(request) {
return request.destination.toString();
}
}
exports.NodeHttp2ConnectionManager = NodeHttp2ConnectionManager;
/***/ }),
/***/ 95157:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NodeHttp2ConnectionPool = void 0;
class NodeHttp2ConnectionPool {
constructor(sessions) {
this.sessions = [];
this.sessions = sessions !== null && sessions !== void 0 ? sessions : [];
}
poll() {
if (this.sessions.length > 0) {
return this.sessions.shift();
}
}
offerLast(session) {
this.sessions.push(session);
}
contains(session) {
return this.sessions.includes(session);
}
remove(session) {
this.sessions = this.sessions.filter((s) => s !== session);
}
[Symbol.iterator]() {
return this.sessions[Symbol.iterator]();
}
destroy(connection) {
for (const session of this.sessions) {
if (session === connection) {
if (!session.destroyed) {
session.destroy();
}
}
}
}
}
exports.NodeHttp2ConnectionPool = NodeHttp2ConnectionPool;
/***/ }),
/***/ 46999:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NodeHttp2Handler = void 0;
const protocol_http_1 = __nccwpck_require__(64418);
const querystring_builder_1 = __nccwpck_require__(68031);
const http2_1 = __nccwpck_require__(85158);
const get_transformed_headers_1 = __nccwpck_require__(70508);
const node_http2_connection_manager_1 = __nccwpck_require__(5771);
const write_request_body_1 = __nccwpck_require__(73766);
class NodeHttp2Handler {
constructor(options) {
this.metadata = { handlerProtocol: "h2" };
this.connectionManager = new node_http2_connection_manager_1.NodeHttp2ConnectionManager({});
this.configProvider = new Promise((resolve, reject) => {
if (typeof options === "function") {
options()
.then((opts) => {
resolve(opts || {});
})
.catch(reject);
}
else {
resolve(options || {});
}
});
}
destroy() {
this.connectionManager.destroy();
}
async handle(request, { abortSignal } = {}) {
if (!this.config) {
this.config = await this.configProvider;
this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false);
if (this.config.maxConcurrentStreams) {
this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams);
}
}
const { requestTimeout, disableConcurrentStreams } = this.config;
return new Promise((_resolve, _reject) => {
var _a, _b, _c;
let fulfilled = false;
let writeRequestBodyPromise = undefined;
const resolve = async (arg) => {
await writeRequestBodyPromise;
_resolve(arg);
};
const reject = async (arg) => {
await writeRequestBodyPromise;
_reject(arg);
};
if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) {
fulfilled = true;
const abortError = new Error("Request aborted");
abortError.name = "AbortError";
reject(abortError);
return;
}
const { hostname, method, port, protocol, query } = request;
let auth = "";
if (request.username != null || request.password != null) {
const username = (_a = request.username) !== null && _a !== void 0 ? _a : "";
const password = (_b = request.password) !== null && _b !== void 0 ? _b : "";
auth = `${username}:${password}@`;
}
const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`;
const requestContext = { destination: new URL(authority) };
const session = this.connectionManager.lease(requestContext, {
requestTimeout: (_c = this.config) === null || _c === void 0 ? void 0 : _c.sessionTimeout,
disableConcurrentStreams: disableConcurrentStreams || false,
});
const rejectWithDestroy = (err) => {
if (disableConcurrentStreams) {
this.destroySession(session);
}
fulfilled = true;
reject(err);
};
const queryString = (0, querystring_builder_1.buildQueryString)(query || {});
let path = request.path;
if (queryString) {
path += `?${queryString}`;
}
if (request.fragment) {
path += `#${request.fragment}`;
}
const req = session.request({
...request.headers,
[http2_1.constants.HTTP2_HEADER_PATH]: path,
[http2_1.constants.HTTP2_HEADER_METHOD]: method,
});
session.ref();
req.on("response", (headers) => {
const httpResponse = new protocol_http_1.HttpResponse({
statusCode: headers[":status"] || -1,
headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers),
body: req,
});
fulfilled = true;
resolve({ response: httpResponse });
if (disableConcurrentStreams) {
session.close();
this.connectionManager.deleteSession(authority, session);
}
});
if (requestTimeout) {
req.setTimeout(requestTimeout, () => {
req.close();
const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`);
timeoutError.name = "TimeoutError";
rejectWithDestroy(timeoutError);
});
}
if (abortSignal) {
abortSignal.onabort = () => {
req.close();
const abortError = new Error("Request aborted");
abortError.name = "AbortError";
rejectWithDestroy(abortError);
};
}
req.on("frameError", (type, code, id) => {
rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`));
});
req.on("error", rejectWithDestroy);
req.on("aborted", () => {
rejectWithDestroy(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`));
});
req.on("close", () => {
session.unref();
if (disableConcurrentStreams) {
session.destroy();
}
if (!fulfilled) {
rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response"));
}
});
writeRequestBodyPromise = (0, write_request_body_1.writeRequestBody)(req, request, requestTimeout);
});
}
updateHttpClientConfig(key, value) {
this.config = undefined;
this.configProvider = this.configProvider.then((config) => {
return {
...config,
[key]: value,
};
});
}
httpHandlerConfigs() {
var _a;
return (_a = this.config) !== null && _a !== void 0 ? _a : {};
}
destroySession(session) {
if (!session.destroyed) {
session.destroy();
}
}
}
exports.NodeHttp2Handler = NodeHttp2Handler;
/***/ }),
/***/ 25545:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.setConnectionTimeout = void 0;
const setConnectionTimeout = (request, reject, timeoutInMs = 0) => {
if (!timeoutInMs) {
return;
}
const timeoutId = setTimeout(() => {
request.destroy();
reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), {
name: "TimeoutError",
}));
}, timeoutInMs);
request.on("socket", (socket) => {
if (socket.connecting) {
socket.on("connect", () => {
clearTimeout(timeoutId);
});
}
else {
clearTimeout(timeoutId);
}
});
};
exports.setConnectionTimeout = setConnectionTimeout;
/***/ }),
/***/ 83751:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.setSocketKeepAlive = void 0;
const setSocketKeepAlive = (request, { keepAlive, keepAliveMsecs }) => {
if (keepAlive !== true) {
return;
}
request.on("socket", (socket) => {
socket.setKeepAlive(keepAlive, keepAliveMsecs || 0);
});
};
exports.setSocketKeepAlive = setSocketKeepAlive;
/***/ }),
/***/ 42618:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.setSocketTimeout = void 0;
const setSocketTimeout = (request, reject, timeoutInMs = 0) => {
request.setTimeout(timeoutInMs, () => {
request.destroy();
reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" }));
});
};
exports.setSocketTimeout = setSocketTimeout;
/***/ }),
/***/ 23211:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Collector = void 0;
const stream_1 = __nccwpck_require__(12781);
class Collector extends stream_1.Writable {
constructor() {
super(...arguments);
this.bufferedBytes = [];
}
_write(chunk, encoding, callback) {
this.bufferedBytes.push(chunk);
callback();
}
}
exports.Collector = Collector;
/***/ }),
/***/ 81030:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.streamCollector = void 0;
const collector_1 = __nccwpck_require__(23211);
const streamCollector = (stream) => new Promise((resolve, reject) => {
const collector = new collector_1.Collector();
stream.pipe(collector);
stream.on("error", (err) => {
collector.end();
reject(err);
});
collector.on("error", reject);
collector.on("finish", function () {
const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes));
resolve(bytes);
});
});
exports.streamCollector = streamCollector;
/***/ }),
/***/ 73766:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.writeRequestBody = void 0;
const stream_1 = __nccwpck_require__(12781);
const MIN_WAIT_TIME = 1000;
async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) {
var _a;
const headers = (_a = request.headers) !== null && _a !== void 0 ? _a : {};
const expect = headers["Expect"] || headers["expect"];
let timeoutId = -1;
let hasError = false;
if (expect === "100-continue") {
await Promise.race([
new Promise((resolve) => {
timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs)));
}),
new Promise((resolve) => {
httpRequest.on("continue", () => {
clearTimeout(timeoutId);
resolve();
});
httpRequest.on("error", () => {
hasError = true;
clearTimeout(timeoutId);
resolve();
});
}),
]);
}
if (!hasError) {
writeBody(httpRequest, request.body);
}
}
exports.writeRequestBody = writeRequestBody;
function writeBody(httpRequest, body) {
if (body instanceof stream_1.Readable) {
body.pipe(httpRequest);
}
else if (body) {
httpRequest.end(Buffer.from(body));
}
else {
httpRequest.end();
}
}
/***/ }),
/***/ 63936:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.CredentialsProviderError = void 0;
const ProviderError_1 = __nccwpck_require__(23324);
class CredentialsProviderError extends ProviderError_1.ProviderError {
constructor(message, tryNextLink = true) {
super(message, tryNextLink);
this.tryNextLink = tryNextLink;
this.name = "CredentialsProviderError";
Object.setPrototypeOf(this, CredentialsProviderError.prototype);
}
}
exports.CredentialsProviderError = CredentialsProviderError;
/***/ }),
/***/ 23324:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ProviderError = void 0;
class ProviderError extends Error {
constructor(message, tryNextLink = true) {
super(message);
this.tryNextLink = tryNextLink;
this.name = "ProviderError";
Object.setPrototypeOf(this, ProviderError.prototype);
}
static from(error, tryNextLink = true) {
return Object.assign(new this(error.message, tryNextLink), error);
}
}
exports.ProviderError = ProviderError;
/***/ }),
/***/ 50429:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.TokenProviderError = void 0;
const ProviderError_1 = __nccwpck_require__(23324);
class TokenProviderError extends ProviderError_1.ProviderError {
constructor(message, tryNextLink = true) {
super(message, tryNextLink);
this.tryNextLink = tryNextLink;
this.name = "TokenProviderError";
Object.setPrototypeOf(this, TokenProviderError.prototype);
}
}
exports.TokenProviderError = TokenProviderError;
/***/ }),
/***/ 45079:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.chain = void 0;
const ProviderError_1 = __nccwpck_require__(23324);
const chain = (...providers) => async () => {
if (providers.length === 0) {
throw new ProviderError_1.ProviderError("No providers in chain");
}
let lastProviderError;
for (const provider of providers) {
try {
const credentials = await provider();
return credentials;
}
catch (err) {
lastProviderError = err;
if (err === null || err === void 0 ? void 0 : err.tryNextLink) {
continue;
}
throw err;
}
}
throw lastProviderError;
};
exports.chain = chain;
/***/ }),
/***/ 51322:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromStatic = void 0;
const fromStatic = (staticValue) => () => Promise.resolve(staticValue);
exports.fromStatic = fromStatic;
/***/ }),
/***/ 79721:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(63936), exports);
tslib_1.__exportStar(__nccwpck_require__(23324), exports);
tslib_1.__exportStar(__nccwpck_require__(50429), exports);
tslib_1.__exportStar(__nccwpck_require__(45079), exports);
tslib_1.__exportStar(__nccwpck_require__(51322), exports);
tslib_1.__exportStar(__nccwpck_require__(49762), exports);
/***/ }),
/***/ 49762:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.memoize = void 0;
const memoize = (provider, isExpired, requiresRefresh) => {
let resolved;
let pending;
let hasResult;
let isConstant = false;
const coalesceProvider = async () => {
if (!pending) {
pending = provider();
}
try {
resolved = await pending;
hasResult = true;
isConstant = false;
}
finally {
pending = undefined;
}
return resolved;
};
if (isExpired === undefined) {
return async (options) => {
if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) {
resolved = await coalesceProvider();
}
return resolved;
};
}
return async (options) => {
if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) {
resolved = await coalesceProvider();
}
if (isConstant) {
return resolved;
}
if (requiresRefresh && !requiresRefresh(resolved)) {
isConstant = true;
return resolved;
}
if (isExpired(resolved)) {
await coalesceProvider();
return resolved;
}
return resolved;
};
};
exports.memoize = memoize;
/***/ }),
/***/ 89179:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Field = void 0;
const types_1 = __nccwpck_require__(55756);
class Field {
constructor({ name, kind = types_1.FieldPosition.HEADER, values = [] }) {
this.name = name;
this.kind = kind;
this.values = values;
}
add(value) {
this.values.push(value);
}
set(values) {
this.values = values;
}
remove(value) {
this.values = this.values.filter((v) => v !== value);
}
toString() {
return this.values.map((v) => (v.includes(",") || v.includes(" ") ? `"${v}"` : v)).join(", ");
}
get() {
return this.values;
}
}
exports.Field = Field;
/***/ }),
/***/ 99242:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Fields = void 0;
class Fields {
constructor({ fields = [], encoding = "utf-8" }) {
this.entries = {};
fields.forEach(this.setField.bind(this));
this.encoding = encoding;
}
setField(field) {
this.entries[field.name.toLowerCase()] = field;
}
getField(name) {
return this.entries[name.toLowerCase()];
}
removeField(name) {
delete this.entries[name.toLowerCase()];
}
getByType(kind) {
return Object.values(this.entries).filter((field) => field.kind === kind);
}
}
exports.Fields = Fields;
/***/ }),
/***/ 22474:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveHttpHandlerRuntimeConfig = exports.getHttpHandlerExtensionConfiguration = void 0;
const getHttpHandlerExtensionConfiguration = (runtimeConfig) => {
let httpHandler = runtimeConfig.httpHandler;
return {
setHttpHandler(handler) {
httpHandler = handler;
},
httpHandler() {
return httpHandler;
},
updateHttpClientConfig(key, value) {
httpHandler.updateHttpClientConfig(key, value);
},
httpHandlerConfigs() {
return httpHandler.httpHandlerConfigs();
},
};
};
exports.getHttpHandlerExtensionConfiguration = getHttpHandlerExtensionConfiguration;
const resolveHttpHandlerRuntimeConfig = (httpHandlerExtensionConfiguration) => {
return {
httpHandler: httpHandlerExtensionConfiguration.httpHandler(),
};
};
exports.resolveHttpHandlerRuntimeConfig = resolveHttpHandlerRuntimeConfig;
/***/ }),
/***/ 91654:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(22474), exports);
/***/ }),
/***/ 63206:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 38746:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HttpRequest = void 0;
class HttpRequest {
constructor(options) {
this.method = options.method || "GET";
this.hostname = options.hostname || "localhost";
this.port = options.port;
this.query = options.query || {};
this.headers = options.headers || {};
this.body = options.body;
this.protocol = options.protocol
? options.protocol.slice(-1) !== ":"
? `${options.protocol}:`
: options.protocol
: "https:";
this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/";
this.username = options.username;
this.password = options.password;
this.fragment = options.fragment;
}
static isInstance(request) {
if (!request)
return false;
const req = request;
return ("method" in req &&
"protocol" in req &&
"hostname" in req &&
"path" in req &&
typeof req["query"] === "object" &&
typeof req["headers"] === "object");
}
clone() {
const cloned = new HttpRequest({
...this,
headers: { ...this.headers },
});
if (cloned.query)
cloned.query = cloneQuery(cloned.query);
return cloned;
}
}
exports.HttpRequest = HttpRequest;
function cloneQuery(query) {
return Object.keys(query).reduce((carry, paramName) => {
const param = query[paramName];
return {
...carry,
[paramName]: Array.isArray(param) ? [...param] : param,
};
}, {});
}
/***/ }),
/***/ 26322:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HttpResponse = void 0;
class HttpResponse {
constructor(options) {
this.statusCode = options.statusCode;
this.reason = options.reason;
this.headers = options.headers || {};
this.body = options.body;
}
static isInstance(response) {
if (!response)
return false;
const resp = response;
return typeof resp.statusCode === "number" && typeof resp.headers === "object";
}
}
exports.HttpResponse = HttpResponse;
/***/ }),
/***/ 64418:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(91654), exports);
tslib_1.__exportStar(__nccwpck_require__(89179), exports);
tslib_1.__exportStar(__nccwpck_require__(99242), exports);
tslib_1.__exportStar(__nccwpck_require__(63206), exports);
tslib_1.__exportStar(__nccwpck_require__(38746), exports);
tslib_1.__exportStar(__nccwpck_require__(26322), exports);
tslib_1.__exportStar(__nccwpck_require__(61466), exports);
tslib_1.__exportStar(__nccwpck_require__(19135), exports);
/***/ }),
/***/ 61466:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isValidHostname = void 0;
function isValidHostname(hostname) {
const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/;
return hostPattern.test(hostname);
}
exports.isValidHostname = isValidHostname;
/***/ }),
/***/ 19135:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 68031:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.buildQueryString = void 0;
const util_uri_escape_1 = __nccwpck_require__(54197);
function buildQueryString(query) {
const parts = [];
for (let key of Object.keys(query).sort()) {
const value = query[key];
key = (0, util_uri_escape_1.escapeUri)(key);
if (Array.isArray(value)) {
for (let i = 0, iLen = value.length; i < iLen; i++) {
parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`);
}
}
else {
let qsEntry = key;
if (value || typeof value === "string") {
qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`;
}
parts.push(qsEntry);
}
}
return parts.join("&");
}
exports.buildQueryString = buildQueryString;
/***/ }),
/***/ 4769:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseQueryString = void 0;
function parseQueryString(querystring) {
const query = {};
querystring = querystring.replace(/^\?/, "");
if (querystring) {
for (const pair of querystring.split("&")) {
let [key, value = null] = pair.split("=");
key = decodeURIComponent(key);
if (value) {
value = decodeURIComponent(value);
}
if (!(key in query)) {
query[key] = value;
}
else if (Array.isArray(query[key])) {
query[key].push(value);
}
else {
query[key] = [query[key], value];
}
}
}
return query;
}
exports.parseQueryString = parseQueryString;
/***/ }),
/***/ 68415:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODEJS_TIMEOUT_ERROR_CODES = exports.TRANSIENT_ERROR_STATUS_CODES = exports.TRANSIENT_ERROR_CODES = exports.THROTTLING_ERROR_CODES = exports.CLOCK_SKEW_ERROR_CODES = void 0;
exports.CLOCK_SKEW_ERROR_CODES = [
"AuthFailure",
"InvalidSignatureException",
"RequestExpired",
"RequestInTheFuture",
"RequestTimeTooSkewed",
"SignatureDoesNotMatch",
];
exports.THROTTLING_ERROR_CODES = [
"BandwidthLimitExceeded",
"EC2ThrottledException",
"LimitExceededException",
"PriorRequestNotComplete",
"ProvisionedThroughputExceededException",
"RequestLimitExceeded",
"RequestThrottled",
"RequestThrottledException",
"SlowDown",
"ThrottledException",
"Throttling",
"ThrottlingException",
"TooManyRequestsException",
"TransactionInProgressException",
];
exports.TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"];
exports.TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504];
exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"];
/***/ }),
/***/ 6375:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isServerError = exports.isTransientError = exports.isThrottlingError = exports.isClockSkewError = exports.isRetryableByTrait = void 0;
const constants_1 = __nccwpck_require__(68415);
const isRetryableByTrait = (error) => error.$retryable !== undefined;
exports.isRetryableByTrait = isRetryableByTrait;
const isClockSkewError = (error) => constants_1.CLOCK_SKEW_ERROR_CODES.includes(error.name);
exports.isClockSkewError = isClockSkewError;
const isThrottlingError = (error) => {
var _a, _b;
return ((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) === 429 ||
constants_1.THROTTLING_ERROR_CODES.includes(error.name) ||
((_b = error.$retryable) === null || _b === void 0 ? void 0 : _b.throttling) == true;
};
exports.isThrottlingError = isThrottlingError;
const isTransientError = (error) => {
var _a;
return constants_1.TRANSIENT_ERROR_CODES.includes(error.name) ||
constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes((error === null || error === void 0 ? void 0 : error.code) || "") ||
constants_1.TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) || 0);
};
exports.isTransientError = isTransientError;
const isServerError = (error) => {
var _a;
if (((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) !== undefined) {
const statusCode = error.$metadata.httpStatusCode;
if (500 <= statusCode && statusCode <= 599 && !(0, exports.isTransientError)(error)) {
return true;
}
return false;
}
return false;
};
exports.isServerError = isServerError;
/***/ }),
/***/ 46062:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getConfigData = void 0;
const types_1 = __nccwpck_require__(55756);
const loadSharedConfigFiles_1 = __nccwpck_require__(41879);
const getConfigData = (data) => Object.entries(data)
.filter(([key]) => {
const sections = key.split(loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR);
if (sections.length === 2 && Object.values(types_1.IniSectionType).includes(sections[0])) {
return true;
}
return false;
})
.reduce((acc, [key, value]) => {
const updatedKey = key.startsWith(types_1.IniSectionType.PROFILE) ? key.split(loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR)[1] : key;
acc[updatedKey] = value;
return acc;
}, {
...(data.default && { default: data.default }),
});
exports.getConfigData = getConfigData;
/***/ }),
/***/ 47237:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getConfigFilepath = exports.ENV_CONFIG_PATH = void 0;
const path_1 = __nccwpck_require__(71017);
const getHomeDir_1 = __nccwpck_require__(68340);
exports.ENV_CONFIG_PATH = "AWS_CONFIG_FILE";
const getConfigFilepath = () => process.env[exports.ENV_CONFIG_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "config");
exports.getConfigFilepath = getConfigFilepath;
/***/ }),
/***/ 99036:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getCredentialsFilepath = exports.ENV_CREDENTIALS_PATH = void 0;
const path_1 = __nccwpck_require__(71017);
const getHomeDir_1 = __nccwpck_require__(68340);
exports.ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE";
const getCredentialsFilepath = () => process.env[exports.ENV_CREDENTIALS_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "credentials");
exports.getCredentialsFilepath = getCredentialsFilepath;
/***/ }),
/***/ 68340:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getHomeDir = void 0;
const os_1 = __nccwpck_require__(22037);
const path_1 = __nccwpck_require__(71017);
const homeDirCache = {};
const getHomeDirCacheKey = () => {
if (process && process.geteuid) {
return `${process.geteuid()}`;
}
return "DEFAULT";
};
const getHomeDir = () => {
const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env;
if (HOME)
return HOME;
if (USERPROFILE)
return USERPROFILE;
if (HOMEPATH)
return `${HOMEDRIVE}${HOMEPATH}`;
const homeDirCacheKey = getHomeDirCacheKey();
if (!homeDirCache[homeDirCacheKey])
homeDirCache[homeDirCacheKey] = (0, os_1.homedir)();
return homeDirCache[homeDirCacheKey];
};
exports.getHomeDir = getHomeDir;
/***/ }),
/***/ 52802:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getProfileName = exports.DEFAULT_PROFILE = exports.ENV_PROFILE = void 0;
exports.ENV_PROFILE = "AWS_PROFILE";
exports.DEFAULT_PROFILE = "default";
const getProfileName = (init) => init.profile || process.env[exports.ENV_PROFILE] || exports.DEFAULT_PROFILE;
exports.getProfileName = getProfileName;
/***/ }),
/***/ 24740:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSSOTokenFilepath = void 0;
const crypto_1 = __nccwpck_require__(6113);
const path_1 = __nccwpck_require__(71017);
const getHomeDir_1 = __nccwpck_require__(68340);
const getSSOTokenFilepath = (id) => {
const hasher = (0, crypto_1.createHash)("sha1");
const cacheName = hasher.update(id).digest("hex");
return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`);
};
exports.getSSOTokenFilepath = getSSOTokenFilepath;
/***/ }),
/***/ 69678:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSSOTokenFromFile = void 0;
const fs_1 = __nccwpck_require__(57147);
const getSSOTokenFilepath_1 = __nccwpck_require__(24740);
const { readFile } = fs_1.promises;
const getSSOTokenFromFile = async (id) => {
const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id);
const ssoTokenText = await readFile(ssoTokenFilepath, "utf8");
return JSON.parse(ssoTokenText);
};
exports.getSSOTokenFromFile = getSSOTokenFromFile;
/***/ }),
/***/ 82820:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSsoSessionData = void 0;
const types_1 = __nccwpck_require__(55756);
const loadSharedConfigFiles_1 = __nccwpck_require__(41879);
const getSsoSessionData = (data) => Object.entries(data)
.filter(([key]) => key.startsWith(types_1.IniSectionType.SSO_SESSION + loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR))
.reduce((acc, [key, value]) => ({ ...acc, [key.split(loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR)[1]]: value }), {});
exports.getSsoSessionData = getSsoSessionData;
/***/ }),
/***/ 43507:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(68340), exports);
tslib_1.__exportStar(__nccwpck_require__(52802), exports);
tslib_1.__exportStar(__nccwpck_require__(24740), exports);
tslib_1.__exportStar(__nccwpck_require__(69678), exports);
tslib_1.__exportStar(__nccwpck_require__(41879), exports);
tslib_1.__exportStar(__nccwpck_require__(34649), exports);
tslib_1.__exportStar(__nccwpck_require__(2546), exports);
tslib_1.__exportStar(__nccwpck_require__(63191), exports);
/***/ }),
/***/ 41879:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.loadSharedConfigFiles = exports.CONFIG_PREFIX_SEPARATOR = void 0;
const getConfigData_1 = __nccwpck_require__(46062);
const getConfigFilepath_1 = __nccwpck_require__(47237);
const getCredentialsFilepath_1 = __nccwpck_require__(99036);
const parseIni_1 = __nccwpck_require__(54262);
const slurpFile_1 = __nccwpck_require__(19155);
const swallowError = () => ({});
exports.CONFIG_PREFIX_SEPARATOR = ".";
const loadSharedConfigFiles = async (init = {}) => {
const { filepath = (0, getCredentialsFilepath_1.getCredentialsFilepath)(), configFilepath = (0, getConfigFilepath_1.getConfigFilepath)() } = init;
const parsedFiles = await Promise.all([
(0, slurpFile_1.slurpFile)(configFilepath, {
ignoreCache: init.ignoreCache,
})
.then(parseIni_1.parseIni)
.then(getConfigData_1.getConfigData)
.catch(swallowError),
(0, slurpFile_1.slurpFile)(filepath, {
ignoreCache: init.ignoreCache,
})
.then(parseIni_1.parseIni)
.catch(swallowError),
]);
return {
configFile: parsedFiles[0],
credentialsFile: parsedFiles[1],
};
};
exports.loadSharedConfigFiles = loadSharedConfigFiles;
/***/ }),
/***/ 34649:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.loadSsoSessionData = void 0;
const getConfigFilepath_1 = __nccwpck_require__(47237);
const getSsoSessionData_1 = __nccwpck_require__(82820);
const parseIni_1 = __nccwpck_require__(54262);
const slurpFile_1 = __nccwpck_require__(19155);
const swallowError = () => ({});
const loadSsoSessionData = async (init = {}) => {
var _a;
return (0, slurpFile_1.slurpFile)((_a = init.configFilepath) !== null && _a !== void 0 ? _a : (0, getConfigFilepath_1.getConfigFilepath)())
.then(parseIni_1.parseIni)
.then(getSsoSessionData_1.getSsoSessionData)
.catch(swallowError);
};
exports.loadSsoSessionData = loadSsoSessionData;
/***/ }),
/***/ 19447:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.mergeConfigFiles = void 0;
const mergeConfigFiles = (...files) => {
const merged = {};
for (const file of files) {
for (const [key, values] of Object.entries(file)) {
if (merged[key] !== undefined) {
Object.assign(merged[key], values);
}
else {
merged[key] = values;
}
}
}
return merged;
};
exports.mergeConfigFiles = mergeConfigFiles;
/***/ }),
/***/ 54262:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseIni = void 0;
const types_1 = __nccwpck_require__(55756);
const loadSharedConfigFiles_1 = __nccwpck_require__(41879);
const prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/;
const profileNameBlockList = ["__proto__", "profile __proto__"];
const parseIni = (iniData) => {
const map = {};
let currentSection;
let currentSubSection;
for (const iniLine of iniData.split(/\r?\n/)) {
const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim();
const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]";
if (isSection) {
currentSection = undefined;
currentSubSection = undefined;
const sectionName = trimmedLine.substring(1, trimmedLine.length - 1);
const matches = prefixKeyRegex.exec(sectionName);
if (matches) {
const [, prefix, , name] = matches;
if (Object.values(types_1.IniSectionType).includes(prefix)) {
currentSection = [prefix, name].join(loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR);
}
}
else {
currentSection = sectionName;
}
if (profileNameBlockList.includes(sectionName)) {
throw new Error(`Found invalid profile name "${sectionName}"`);
}
}
else if (currentSection) {
const indexOfEqualsSign = trimmedLine.indexOf("=");
if (![0, -1].includes(indexOfEqualsSign)) {
const [name, value] = [
trimmedLine.substring(0, indexOfEqualsSign).trim(),
trimmedLine.substring(indexOfEqualsSign + 1).trim(),
];
if (value === "") {
currentSubSection = name;
}
else {
if (currentSubSection && iniLine.trimStart() === iniLine) {
currentSubSection = undefined;
}
map[currentSection] = map[currentSection] || {};
const key = currentSubSection ? [currentSubSection, name].join(loadSharedConfigFiles_1.CONFIG_PREFIX_SEPARATOR) : name;
map[currentSection][key] = value;
}
}
}
}
return map;
};
exports.parseIni = parseIni;
/***/ }),
/***/ 2546:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseKnownFiles = void 0;
const loadSharedConfigFiles_1 = __nccwpck_require__(41879);
const mergeConfigFiles_1 = __nccwpck_require__(19447);
const parseKnownFiles = async (init) => {
const parsedFiles = await (0, loadSharedConfigFiles_1.loadSharedConfigFiles)(init);
return (0, mergeConfigFiles_1.mergeConfigFiles)(parsedFiles.configFile, parsedFiles.credentialsFile);
};
exports.parseKnownFiles = parseKnownFiles;
/***/ }),
/***/ 19155:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.slurpFile = void 0;
const fs_1 = __nccwpck_require__(57147);
const { readFile } = fs_1.promises;
const filePromisesHash = {};
const slurpFile = (path, options) => {
if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) {
filePromisesHash[path] = readFile(path, "utf8");
}
return filePromisesHash[path];
};
exports.slurpFile = slurpFile;
/***/ }),
/***/ 63191:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 39733:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SignatureV4 = void 0;
const eventstream_codec_1 = __nccwpck_require__(56459);
const util_hex_encoding_1 = __nccwpck_require__(45364);
const util_middleware_1 = __nccwpck_require__(2390);
const util_utf8_1 = __nccwpck_require__(41895);
const constants_1 = __nccwpck_require__(48644);
const credentialDerivation_1 = __nccwpck_require__(19623);
const getCanonicalHeaders_1 = __nccwpck_require__(51393);
const getCanonicalQuery_1 = __nccwpck_require__(33243);
const getPayloadHash_1 = __nccwpck_require__(48545);
const headerUtil_1 = __nccwpck_require__(62179);
const moveHeadersToQuery_1 = __nccwpck_require__(49828);
const prepareRequest_1 = __nccwpck_require__(60075);
const utilDate_1 = __nccwpck_require__(39299);
class SignatureV4 {
constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) {
this.headerMarshaller = new eventstream_codec_1.HeaderMarshaller(util_utf8_1.toUtf8, util_utf8_1.fromUtf8);
this.service = service;
this.sha256 = sha256;
this.uriEscapePath = uriEscapePath;
this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true;
this.regionProvider = (0, util_middleware_1.normalizeProvider)(region);
this.credentialProvider = (0, util_middleware_1.normalizeProvider)(credentials);
}
async presign(originalRequest, options = {}) {
const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, signingRegion, signingService, } = options;
const credentials = await this.credentialProvider();
this.validateResolvedCredentials(credentials);
const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider());
const { longDate, shortDate } = formatDate(signingDate);
if (expiresIn > constants_1.MAX_PRESIGNED_TTL) {
return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future");
}
const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service);
const request = (0, moveHeadersToQuery_1.moveHeadersToQuery)((0, prepareRequest_1.prepareRequest)(originalRequest), { unhoistableHeaders });
if (credentials.sessionToken) {
request.query[constants_1.TOKEN_QUERY_PARAM] = credentials.sessionToken;
}
request.query[constants_1.ALGORITHM_QUERY_PARAM] = constants_1.ALGORITHM_IDENTIFIER;
request.query[constants_1.CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`;
request.query[constants_1.AMZ_DATE_QUERY_PARAM] = longDate;
request.query[constants_1.EXPIRES_QUERY_PARAM] = expiresIn.toString(10);
const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders);
request.query[constants_1.SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders);
request.query[constants_1.SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await (0, getPayloadHash_1.getPayloadHash)(originalRequest, this.sha256)));
return request;
}
async sign(toSign, options) {
if (typeof toSign === "string") {
return this.signString(toSign, options);
}
else if (toSign.headers && toSign.payload) {
return this.signEvent(toSign, options);
}
else if (toSign.message) {
return this.signMessage(toSign, options);
}
else {
return this.signRequest(toSign, options);
}
}
async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) {
const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider());
const { shortDate, longDate } = formatDate(signingDate);
const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service);
const hashedPayload = await (0, getPayloadHash_1.getPayloadHash)({ headers: {}, body: payload }, this.sha256);
const hash = new this.sha256();
hash.update(headers);
const hashedHeaders = (0, util_hex_encoding_1.toHex)(await hash.digest());
const stringToSign = [
constants_1.EVENT_ALGORITHM_IDENTIFIER,
longDate,
scope,
priorSignature,
hashedHeaders,
hashedPayload,
].join("\n");
return this.signString(stringToSign, { signingDate, signingRegion: region, signingService });
}
async signMessage(signableMessage, { signingDate = new Date(), signingRegion, signingService }) {
const promise = this.signEvent({
headers: this.headerMarshaller.format(signableMessage.message.headers),
payload: signableMessage.message.body,
}, {
signingDate,
signingRegion,
signingService,
priorSignature: signableMessage.priorSignature,
});
return promise.then((signature) => {
return { message: signableMessage.message, signature };
});
}
async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) {
const credentials = await this.credentialProvider();
this.validateResolvedCredentials(credentials);
const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider());
const { shortDate } = formatDate(signingDate);
const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService));
hash.update((0, util_utf8_1.toUint8Array)(stringToSign));
return (0, util_hex_encoding_1.toHex)(await hash.digest());
}
async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) {
const credentials = await this.credentialProvider();
this.validateResolvedCredentials(credentials);
const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider());
const request = (0, prepareRequest_1.prepareRequest)(requestToSign);
const { longDate, shortDate } = formatDate(signingDate);
const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service);
request.headers[constants_1.AMZ_DATE_HEADER] = longDate;
if (credentials.sessionToken) {
request.headers[constants_1.TOKEN_HEADER] = credentials.sessionToken;
}
const payloadHash = await (0, getPayloadHash_1.getPayloadHash)(request, this.sha256);
if (!(0, headerUtil_1.hasHeader)(constants_1.SHA256_HEADER, request.headers) && this.applyChecksum) {
request.headers[constants_1.SHA256_HEADER] = payloadHash;
}
const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders);
const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash));
request.headers[constants_1.AUTH_HEADER] =
`${constants_1.ALGORITHM_IDENTIFIER} ` +
`Credential=${credentials.accessKeyId}/${scope}, ` +
`SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, ` +
`Signature=${signature}`;
return request;
}
createCanonicalRequest(request, canonicalHeaders, payloadHash) {
const sortedHeaders = Object.keys(canonicalHeaders).sort();
return `${request.method}
${this.getCanonicalPath(request)}
${(0, getCanonicalQuery_1.getCanonicalQuery)(request)}
${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")}
${sortedHeaders.join(";")}
${payloadHash}`;
}
async createStringToSign(longDate, credentialScope, canonicalRequest) {
const hash = new this.sha256();
hash.update((0, util_utf8_1.toUint8Array)(canonicalRequest));
const hashedRequest = await hash.digest();
return `${constants_1.ALGORITHM_IDENTIFIER}
${longDate}
${credentialScope}
${(0, util_hex_encoding_1.toHex)(hashedRequest)}`;
}
getCanonicalPath({ path }) {
if (this.uriEscapePath) {
const normalizedPathSegments = [];
for (const pathSegment of path.split("/")) {
if ((pathSegment === null || pathSegment === void 0 ? void 0 : pathSegment.length) === 0)
continue;
if (pathSegment === ".")
continue;
if (pathSegment === "..") {
normalizedPathSegments.pop();
}
else {
normalizedPathSegments.push(pathSegment);
}
}
const normalizedPath = `${(path === null || path === void 0 ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path === null || path === void 0 ? void 0 : path.endsWith("/")) ? "/" : ""}`;
const doubleEncoded = encodeURIComponent(normalizedPath);
return doubleEncoded.replace(/%2F/g, "/");
}
return path;
}
async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) {
const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest);
const hash = new this.sha256(await keyPromise);
hash.update((0, util_utf8_1.toUint8Array)(stringToSign));
return (0, util_hex_encoding_1.toHex)(await hash.digest());
}
getSigningKey(credentials, region, shortDate, service) {
return (0, credentialDerivation_1.getSigningKey)(this.sha256, credentials, shortDate, region, service || this.service);
}
validateResolvedCredentials(credentials) {
if (typeof credentials !== "object" ||
typeof credentials.accessKeyId !== "string" ||
typeof credentials.secretAccessKey !== "string") {
throw new Error("Resolved credential object is not valid");
}
}
}
exports.SignatureV4 = SignatureV4;
const formatDate = (now) => {
const longDate = (0, utilDate_1.iso8601)(now).replace(/[\-:]/g, "");
return {
longDate,
shortDate: longDate.slice(0, 8),
};
};
const getCanonicalHeaderList = (headers) => Object.keys(headers).sort().join(";");
/***/ }),
/***/ 69098:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.cloneQuery = exports.cloneRequest = void 0;
const cloneRequest = ({ headers, query, ...rest }) => ({
...rest,
headers: { ...headers },
query: query ? (0, exports.cloneQuery)(query) : undefined,
});
exports.cloneRequest = cloneRequest;
const cloneQuery = (query) => Object.keys(query).reduce((carry, paramName) => {
const param = query[paramName];
return {
...carry,
[paramName]: Array.isArray(param) ? [...param] : param,
};
}, {});
exports.cloneQuery = cloneQuery;
/***/ }),
/***/ 48644:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.MAX_PRESIGNED_TTL = exports.KEY_TYPE_IDENTIFIER = exports.MAX_CACHE_SIZE = exports.UNSIGNED_PAYLOAD = exports.EVENT_ALGORITHM_IDENTIFIER = exports.ALGORITHM_IDENTIFIER_V4A = exports.ALGORITHM_IDENTIFIER = exports.UNSIGNABLE_PATTERNS = exports.SEC_HEADER_PATTERN = exports.PROXY_HEADER_PATTERN = exports.ALWAYS_UNSIGNABLE_HEADERS = exports.HOST_HEADER = exports.TOKEN_HEADER = exports.SHA256_HEADER = exports.SIGNATURE_HEADER = exports.GENERATED_HEADERS = exports.DATE_HEADER = exports.AMZ_DATE_HEADER = exports.AUTH_HEADER = exports.REGION_SET_PARAM = exports.TOKEN_QUERY_PARAM = exports.SIGNATURE_QUERY_PARAM = exports.EXPIRES_QUERY_PARAM = exports.SIGNED_HEADERS_QUERY_PARAM = exports.AMZ_DATE_QUERY_PARAM = exports.CREDENTIAL_QUERY_PARAM = exports.ALGORITHM_QUERY_PARAM = void 0;
exports.ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm";
exports.CREDENTIAL_QUERY_PARAM = "X-Amz-Credential";
exports.AMZ_DATE_QUERY_PARAM = "X-Amz-Date";
exports.SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders";
exports.EXPIRES_QUERY_PARAM = "X-Amz-Expires";
exports.SIGNATURE_QUERY_PARAM = "X-Amz-Signature";
exports.TOKEN_QUERY_PARAM = "X-Amz-Security-Token";
exports.REGION_SET_PARAM = "X-Amz-Region-Set";
exports.AUTH_HEADER = "authorization";
exports.AMZ_DATE_HEADER = exports.AMZ_DATE_QUERY_PARAM.toLowerCase();
exports.DATE_HEADER = "date";
exports.GENERATED_HEADERS = [exports.AUTH_HEADER, exports.AMZ_DATE_HEADER, exports.DATE_HEADER];
exports.SIGNATURE_HEADER = exports.SIGNATURE_QUERY_PARAM.toLowerCase();
exports.SHA256_HEADER = "x-amz-content-sha256";
exports.TOKEN_HEADER = exports.TOKEN_QUERY_PARAM.toLowerCase();
exports.HOST_HEADER = "host";
exports.ALWAYS_UNSIGNABLE_HEADERS = {
authorization: true,
"cache-control": true,
connection: true,
expect: true,
from: true,
"keep-alive": true,
"max-forwards": true,
pragma: true,
referer: true,
te: true,
trailer: true,
"transfer-encoding": true,
upgrade: true,
"user-agent": true,
"x-amzn-trace-id": true,
};
exports.PROXY_HEADER_PATTERN = /^proxy-/;
exports.SEC_HEADER_PATTERN = /^sec-/;
exports.UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i];
exports.ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256";
exports.ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256";
exports.EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD";
exports.UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD";
exports.MAX_CACHE_SIZE = 50;
exports.KEY_TYPE_IDENTIFIER = "aws4_request";
exports.MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7;
/***/ }),
/***/ 19623:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.clearCredentialCache = exports.getSigningKey = exports.createScope = void 0;
const util_hex_encoding_1 = __nccwpck_require__(45364);
const util_utf8_1 = __nccwpck_require__(41895);
const constants_1 = __nccwpck_require__(48644);
const signingKeyCache = {};
const cacheQueue = [];
const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${constants_1.KEY_TYPE_IDENTIFIER}`;
exports.createScope = createScope;
const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => {
const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId);
const cacheKey = `${shortDate}:${region}:${service}:${(0, util_hex_encoding_1.toHex)(credsHash)}:${credentials.sessionToken}`;
if (cacheKey in signingKeyCache) {
return signingKeyCache[cacheKey];
}
cacheQueue.push(cacheKey);
while (cacheQueue.length > constants_1.MAX_CACHE_SIZE) {
delete signingKeyCache[cacheQueue.shift()];
}
let key = `AWS4${credentials.secretAccessKey}`;
for (const signable of [shortDate, region, service, constants_1.KEY_TYPE_IDENTIFIER]) {
key = await hmac(sha256Constructor, key, signable);
}
return (signingKeyCache[cacheKey] = key);
};
exports.getSigningKey = getSigningKey;
const clearCredentialCache = () => {
cacheQueue.length = 0;
Object.keys(signingKeyCache).forEach((cacheKey) => {
delete signingKeyCache[cacheKey];
});
};
exports.clearCredentialCache = clearCredentialCache;
const hmac = (ctor, secret, data) => {
const hash = new ctor(secret);
hash.update((0, util_utf8_1.toUint8Array)(data));
return hash.digest();
};
/***/ }),
/***/ 51393:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getCanonicalHeaders = void 0;
const constants_1 = __nccwpck_require__(48644);
const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => {
const canonical = {};
for (const headerName of Object.keys(headers).sort()) {
if (headers[headerName] == undefined) {
continue;
}
const canonicalHeaderName = headerName.toLowerCase();
if (canonicalHeaderName in constants_1.ALWAYS_UNSIGNABLE_HEADERS ||
(unsignableHeaders === null || unsignableHeaders === void 0 ? void 0 : unsignableHeaders.has(canonicalHeaderName)) ||
constants_1.PROXY_HEADER_PATTERN.test(canonicalHeaderName) ||
constants_1.SEC_HEADER_PATTERN.test(canonicalHeaderName)) {
if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) {
continue;
}
}
canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " ");
}
return canonical;
};
exports.getCanonicalHeaders = getCanonicalHeaders;
/***/ }),
/***/ 33243:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getCanonicalQuery = void 0;
const util_uri_escape_1 = __nccwpck_require__(54197);
const constants_1 = __nccwpck_require__(48644);
const getCanonicalQuery = ({ query = {} }) => {
const keys = [];
const serialized = {};
for (const key of Object.keys(query).sort()) {
if (key.toLowerCase() === constants_1.SIGNATURE_HEADER) {
continue;
}
keys.push(key);
const value = query[key];
if (typeof value === "string") {
serialized[key] = `${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`;
}
else if (Array.isArray(value)) {
serialized[key] = value
.slice(0)
.reduce((encoded, value) => encoded.concat([`${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`]), [])
.sort()
.join("&");
}
}
return keys
.map((key) => serialized[key])
.filter((serialized) => serialized)
.join("&");
};
exports.getCanonicalQuery = getCanonicalQuery;
/***/ }),
/***/ 48545:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getPayloadHash = void 0;
const is_array_buffer_1 = __nccwpck_require__(10780);
const util_hex_encoding_1 = __nccwpck_require__(45364);
const util_utf8_1 = __nccwpck_require__(41895);
const constants_1 = __nccwpck_require__(48644);
const getPayloadHash = async ({ headers, body }, hashConstructor) => {
for (const headerName of Object.keys(headers)) {
if (headerName.toLowerCase() === constants_1.SHA256_HEADER) {
return headers[headerName];
}
}
if (body == undefined) {
return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855";
}
else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, is_array_buffer_1.isArrayBuffer)(body)) {
const hashCtor = new hashConstructor();
hashCtor.update((0, util_utf8_1.toUint8Array)(body));
return (0, util_hex_encoding_1.toHex)(await hashCtor.digest());
}
return constants_1.UNSIGNED_PAYLOAD;
};
exports.getPayloadHash = getPayloadHash;
/***/ }),
/***/ 62179:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.deleteHeader = exports.getHeaderValue = exports.hasHeader = void 0;
const hasHeader = (soughtHeader, headers) => {
soughtHeader = soughtHeader.toLowerCase();
for (const headerName of Object.keys(headers)) {
if (soughtHeader === headerName.toLowerCase()) {
return true;
}
}
return false;
};
exports.hasHeader = hasHeader;
const getHeaderValue = (soughtHeader, headers) => {
soughtHeader = soughtHeader.toLowerCase();
for (const headerName of Object.keys(headers)) {
if (soughtHeader === headerName.toLowerCase()) {
return headers[headerName];
}
}
return undefined;
};
exports.getHeaderValue = getHeaderValue;
const deleteHeader = (soughtHeader, headers) => {
soughtHeader = soughtHeader.toLowerCase();
for (const headerName of Object.keys(headers)) {
if (soughtHeader === headerName.toLowerCase()) {
delete headers[headerName];
}
}
};
exports.deleteHeader = deleteHeader;
/***/ }),
/***/ 11528:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.prepareRequest = exports.moveHeadersToQuery = exports.getPayloadHash = exports.getCanonicalQuery = exports.getCanonicalHeaders = void 0;
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(39733), exports);
var getCanonicalHeaders_1 = __nccwpck_require__(51393);
Object.defineProperty(exports, "getCanonicalHeaders", ({ enumerable: true, get: function () { return getCanonicalHeaders_1.getCanonicalHeaders; } }));
var getCanonicalQuery_1 = __nccwpck_require__(33243);
Object.defineProperty(exports, "getCanonicalQuery", ({ enumerable: true, get: function () { return getCanonicalQuery_1.getCanonicalQuery; } }));
var getPayloadHash_1 = __nccwpck_require__(48545);
Object.defineProperty(exports, "getPayloadHash", ({ enumerable: true, get: function () { return getPayloadHash_1.getPayloadHash; } }));
var moveHeadersToQuery_1 = __nccwpck_require__(49828);
Object.defineProperty(exports, "moveHeadersToQuery", ({ enumerable: true, get: function () { return moveHeadersToQuery_1.moveHeadersToQuery; } }));
var prepareRequest_1 = __nccwpck_require__(60075);
Object.defineProperty(exports, "prepareRequest", ({ enumerable: true, get: function () { return prepareRequest_1.prepareRequest; } }));
tslib_1.__exportStar(__nccwpck_require__(19623), exports);
/***/ }),
/***/ 49828:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.moveHeadersToQuery = void 0;
const cloneRequest_1 = __nccwpck_require__(69098);
const moveHeadersToQuery = (request, options = {}) => {
var _a;
const { headers, query = {} } = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request);
for (const name of Object.keys(headers)) {
const lname = name.toLowerCase();
if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) === null || _a === void 0 ? void 0 : _a.has(lname))) {
query[name] = headers[name];
delete headers[name];
}
}
return {
...request,
headers,
query,
};
};
exports.moveHeadersToQuery = moveHeadersToQuery;
/***/ }),
/***/ 60075:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.prepareRequest = void 0;
const cloneRequest_1 = __nccwpck_require__(69098);
const constants_1 = __nccwpck_require__(48644);
const prepareRequest = (request) => {
request = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request);
for (const headerName of Object.keys(request.headers)) {
if (constants_1.GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) {
delete request.headers[headerName];
}
}
return request;
};
exports.prepareRequest = prepareRequest;
/***/ }),
/***/ 39299:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toDate = exports.iso8601 = void 0;
const iso8601 = (time) => (0, exports.toDate)(time)
.toISOString()
.replace(/\.\d{3}Z$/, "Z");
exports.iso8601 = iso8601;
const toDate = (time) => {
if (typeof time === "number") {
return new Date(time * 1000);
}
if (typeof time === "string") {
if (Number(time)) {
return new Date(Number(time) * 1000);
}
return new Date(time);
}
return time;
};
exports.toDate = toDate;
/***/ }),
/***/ 70438:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NoOpLogger = void 0;
class NoOpLogger {
trace() { }
debug() { }
info() { }
warn() { }
error() { }
}
exports.NoOpLogger = NoOpLogger;
/***/ }),
/***/ 61600:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Client = void 0;
const middleware_stack_1 = __nccwpck_require__(97911);
class Client {
constructor(config) {
this.middlewareStack = (0, middleware_stack_1.constructStack)();
this.config = config;
}
send(command, optionsOrCb, cb) {
const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined;
const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb;
const handler = command.resolveMiddleware(this.middlewareStack, this.config, options);
if (callback) {
handler(command)
.then((result) => callback(null, result.output), (err) => callback(err))
.catch(() => { });
}
else {
return handler(command).then((result) => result.output);
}
}
destroy() {
if (this.config.requestHandler.destroy)
this.config.requestHandler.destroy();
}
}
exports.Client = Client;
/***/ }),
/***/ 32813:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.collectBody = void 0;
const util_stream_1 = __nccwpck_require__(96607);
const collectBody = async (streamBody = new Uint8Array(), context) => {
if (streamBody instanceof Uint8Array) {
return util_stream_1.Uint8ArrayBlobAdapter.mutate(streamBody);
}
if (!streamBody) {
return util_stream_1.Uint8ArrayBlobAdapter.mutate(new Uint8Array());
}
const fromContext = context.streamCollector(streamBody);
return util_stream_1.Uint8ArrayBlobAdapter.mutate(await fromContext);
};
exports.collectBody = collectBody;
/***/ }),
/***/ 75414:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Command = void 0;
const middleware_stack_1 = __nccwpck_require__(97911);
class Command {
constructor() {
this.middlewareStack = (0, middleware_stack_1.constructStack)();
}
}
exports.Command = Command;
/***/ }),
/***/ 92541:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SENSITIVE_STRING = void 0;
exports.SENSITIVE_STRING = "***SensitiveInformation***";
/***/ }),
/***/ 56929:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.createAggregatedClient = void 0;
const createAggregatedClient = (commands, Client) => {
for (const command of Object.keys(commands)) {
const CommandCtor = commands[command];
const methodImpl = async function (args, optionsOrCb, cb) {
const command = new CommandCtor(args);
if (typeof optionsOrCb === "function") {
this.send(command, optionsOrCb);
}
else if (typeof cb === "function") {
if (typeof optionsOrCb !== "object")
throw new Error(`Expected http options but got ${typeof optionsOrCb}`);
this.send(command, optionsOrCb || {}, cb);
}
else {
return this.send(command, optionsOrCb);
}
};
const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, "");
Client.prototype[methodName] = methodImpl;
}
};
exports.createAggregatedClient = createAggregatedClient;
/***/ }),
/***/ 21737:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseEpochTimestamp = exports.parseRfc7231DateTime = exports.parseRfc3339DateTimeWithOffset = exports.parseRfc3339DateTime = exports.dateToUtcString = void 0;
const parse_utils_1 = __nccwpck_require__(74857);
const DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"];
const MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
function dateToUtcString(date) {
const year = date.getUTCFullYear();
const month = date.getUTCMonth();
const dayOfWeek = date.getUTCDay();
const dayOfMonthInt = date.getUTCDate();
const hoursInt = date.getUTCHours();
const minutesInt = date.getUTCMinutes();
const secondsInt = date.getUTCSeconds();
const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`;
const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`;
const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`;
const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`;
return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`;
}
exports.dateToUtcString = dateToUtcString;
const RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/);
const parseRfc3339DateTime = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value !== "string") {
throw new TypeError("RFC-3339 date-times must be expressed as strings");
}
const match = RFC3339.exec(value);
if (!match) {
throw new TypeError("Invalid RFC-3339 date-time value");
}
const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match;
const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr));
const month = parseDateValue(monthStr, "month", 1, 12);
const day = parseDateValue(dayStr, "day", 1, 31);
return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds });
};
exports.parseRfc3339DateTime = parseRfc3339DateTime;
const RFC3339_WITH_OFFSET = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/);
const parseRfc3339DateTimeWithOffset = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value !== "string") {
throw new TypeError("RFC-3339 date-times must be expressed as strings");
}
const match = RFC3339_WITH_OFFSET.exec(value);
if (!match) {
throw new TypeError("Invalid RFC-3339 date-time value");
}
const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match;
const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr));
const month = parseDateValue(monthStr, "month", 1, 12);
const day = parseDateValue(dayStr, "day", 1, 31);
const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds });
if (offsetStr.toUpperCase() != "Z") {
date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr));
}
return date;
};
exports.parseRfc3339DateTimeWithOffset = parseRfc3339DateTimeWithOffset;
const IMF_FIXDATE = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/);
const RFC_850_DATE = new RegExp(/^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/);
const ASC_TIME = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/);
const parseRfc7231DateTime = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value !== "string") {
throw new TypeError("RFC-7231 date-times must be expressed as strings");
}
let match = IMF_FIXDATE.exec(value);
if (match) {
const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match;
return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds });
}
match = RFC_850_DATE.exec(value);
if (match) {
const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match;
return adjustRfc850Year(buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), {
hours,
minutes,
seconds,
fractionalMilliseconds,
}));
}
match = ASC_TIME.exec(value);
if (match) {
const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match;
return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr.trimLeft(), "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds });
}
throw new TypeError("Invalid RFC-7231 date-time value");
};
exports.parseRfc7231DateTime = parseRfc7231DateTime;
const parseEpochTimestamp = (value) => {
if (value === null || value === undefined) {
return undefined;
}
let valueAsDouble;
if (typeof value === "number") {
valueAsDouble = value;
}
else if (typeof value === "string") {
valueAsDouble = (0, parse_utils_1.strictParseDouble)(value);
}
else {
throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation");
}
if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) {
throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics");
}
return new Date(Math.round(valueAsDouble * 1000));
};
exports.parseEpochTimestamp = parseEpochTimestamp;
const buildDate = (year, month, day, time) => {
const adjustedMonth = month - 1;
validateDayOfMonth(year, adjustedMonth, day);
return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, "hour", 0, 23), parseDateValue(time.minutes, "minute", 0, 59), parseDateValue(time.seconds, "seconds", 0, 60), parseMilliseconds(time.fractionalMilliseconds)));
};
const parseTwoDigitYear = (value) => {
const thisYear = new Date().getUTCFullYear();
const valueInThisCentury = Math.floor(thisYear / 100) * 100 + (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(value));
if (valueInThisCentury < thisYear) {
return valueInThisCentury + 100;
}
return valueInThisCentury;
};
const FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1000;
const adjustRfc850Year = (input) => {
if (input.getTime() - new Date().getTime() > FIFTY_YEARS_IN_MILLIS) {
return new Date(Date.UTC(input.getUTCFullYear() - 100, input.getUTCMonth(), input.getUTCDate(), input.getUTCHours(), input.getUTCMinutes(), input.getUTCSeconds(), input.getUTCMilliseconds()));
}
return input;
};
const parseMonthByShortName = (value) => {
const monthIdx = MONTHS.indexOf(value);
if (monthIdx < 0) {
throw new TypeError(`Invalid month: ${value}`);
}
return monthIdx + 1;
};
const DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
const validateDayOfMonth = (year, month, day) => {
let maxDays = DAYS_IN_MONTH[month];
if (month === 1 && isLeapYear(year)) {
maxDays = 29;
}
if (day > maxDays) {
throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`);
}
};
const isLeapYear = (year) => {
return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
};
const parseDateValue = (value, type, lower, upper) => {
const dateVal = (0, parse_utils_1.strictParseByte)(stripLeadingZeroes(value));
if (dateVal < lower || dateVal > upper) {
throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`);
}
return dateVal;
};
const parseMilliseconds = (value) => {
if (value === null || value === undefined) {
return 0;
}
return (0, parse_utils_1.strictParseFloat32)("0." + value) * 1000;
};
const parseOffsetToMilliseconds = (value) => {
const directionStr = value[0];
let direction = 1;
if (directionStr == "+") {
direction = 1;
}
else if (directionStr == "-") {
direction = -1;
}
else {
throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`);
}
const hour = Number(value.substring(1, 3));
const minute = Number(value.substring(4, 6));
return direction * (hour * 60 + minute) * 60 * 1000;
};
const stripLeadingZeroes = (value) => {
let idx = 0;
while (idx < value.length - 1 && value.charAt(idx) === "0") {
idx++;
}
if (idx === 0) {
return value;
}
return value.slice(idx);
};
/***/ }),
/***/ 9681:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.withBaseException = exports.throwDefaultError = void 0;
const exceptions_1 = __nccwpck_require__(88074);
const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => {
const $metadata = deserializeMetadata(output);
const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined;
const response = new exceptionCtor({
name: (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.code) || (parsedBody === null || parsedBody === void 0 ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError",
$fault: "client",
$metadata,
});
throw (0, exceptions_1.decorateServiceException)(response, parsedBody);
};
exports.throwDefaultError = throwDefaultError;
const withBaseException = (ExceptionCtor) => {
return ({ output, parsedBody, errorCode }) => {
(0, exports.throwDefaultError)({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode });
};
};
exports.withBaseException = withBaseException;
const deserializeMetadata = (output) => {
var _a, _b;
return ({
httpStatusCode: output.statusCode,
requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"],
extendedRequestId: output.headers["x-amz-id-2"],
cfId: output.headers["x-amz-cf-id"],
});
};
/***/ }),
/***/ 11163:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.loadConfigsForDefaultMode = void 0;
const loadConfigsForDefaultMode = (mode) => {
switch (mode) {
case "standard":
return {
retryMode: "standard",
connectionTimeout: 3100,
};
case "in-region":
return {
retryMode: "standard",
connectionTimeout: 1100,
};
case "cross-region":
return {
retryMode: "standard",
connectionTimeout: 3100,
};
case "mobile":
return {
retryMode: "standard",
connectionTimeout: 30000,
};
default:
return {};
}
};
exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode;
/***/ }),
/***/ 91809:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.emitWarningIfUnsupportedVersion = void 0;
let warningEmitted = false;
const emitWarningIfUnsupportedVersion = (version) => {
if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 14) {
warningEmitted = true;
}
};
exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion;
/***/ }),
/***/ 88074:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.decorateServiceException = exports.ServiceException = void 0;
class ServiceException extends Error {
constructor(options) {
super(options.message);
Object.setPrototypeOf(this, ServiceException.prototype);
this.name = options.name;
this.$fault = options.$fault;
this.$metadata = options.$metadata;
}
}
exports.ServiceException = ServiceException;
const decorateServiceException = (exception, additions = {}) => {
Object.entries(additions)
.filter(([, v]) => v !== undefined)
.forEach(([k, v]) => {
if (exception[k] == undefined || exception[k] === "") {
exception[k] = v;
}
});
const message = exception.message || exception.Message || "UnknownError";
exception.message = message;
delete exception.Message;
return exception;
};
exports.decorateServiceException = decorateServiceException;
/***/ }),
/***/ 76016:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.extendedEncodeURIComponent = void 0;
function extendedEncodeURIComponent(str) {
return encodeURIComponent(str).replace(/[!'()*]/g, function (c) {
return "%" + c.charCodeAt(0).toString(16).toUpperCase();
});
}
exports.extendedEncodeURIComponent = extendedEncodeURIComponent;
/***/ }),
/***/ 30941:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0;
const types_1 = __nccwpck_require__(55756);
Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return types_1.AlgorithmId; } }));
const getChecksumConfiguration = (runtimeConfig) => {
const checksumAlgorithms = [];
for (const id in types_1.AlgorithmId) {
const algorithmId = types_1.AlgorithmId[id];
if (runtimeConfig[algorithmId] === undefined) {
continue;
}
checksumAlgorithms.push({
algorithmId: () => algorithmId,
checksumConstructor: () => runtimeConfig[algorithmId],
});
}
return {
_checksumAlgorithms: checksumAlgorithms,
addChecksumAlgorithm(algo) {
this._checksumAlgorithms.push(algo);
},
checksumAlgorithms() {
return this._checksumAlgorithms;
},
};
};
exports.getChecksumConfiguration = getChecksumConfiguration;
const resolveChecksumRuntimeConfig = (clientConfig) => {
const runtimeConfig = {};
clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
});
return runtimeConfig;
};
exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig;
/***/ }),
/***/ 78643:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = exports.getDefaultExtensionConfiguration = void 0;
const checksum_1 = __nccwpck_require__(30941);
const retry_1 = __nccwpck_require__(67367);
const getDefaultExtensionConfiguration = (runtimeConfig) => {
return {
...(0, checksum_1.getChecksumConfiguration)(runtimeConfig),
...(0, retry_1.getRetryConfiguration)(runtimeConfig),
};
};
exports.getDefaultExtensionConfiguration = getDefaultExtensionConfiguration;
exports.getDefaultClientConfiguration = exports.getDefaultExtensionConfiguration;
const resolveDefaultRuntimeConfig = (config) => {
return {
...(0, checksum_1.resolveChecksumRuntimeConfig)(config),
...(0, retry_1.resolveRetryRuntimeConfig)(config),
};
};
exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
/***/ }),
/***/ 1822:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(78643), exports);
/***/ }),
/***/ 67367:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveRetryRuntimeConfig = exports.getRetryConfiguration = void 0;
const getRetryConfiguration = (runtimeConfig) => {
let _retryStrategy = runtimeConfig.retryStrategy;
return {
setRetryStrategy(retryStrategy) {
_retryStrategy = retryStrategy;
},
retryStrategy() {
return _retryStrategy;
},
};
};
exports.getRetryConfiguration = getRetryConfiguration;
const resolveRetryRuntimeConfig = (retryStrategyConfiguration) => {
const runtimeConfig = {};
runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy();
return runtimeConfig;
};
exports.resolveRetryRuntimeConfig = resolveRetryRuntimeConfig;
/***/ }),
/***/ 42638:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getArrayIfSingleItem = void 0;
const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray];
exports.getArrayIfSingleItem = getArrayIfSingleItem;
/***/ }),
/***/ 92188:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getValueFromTextNode = void 0;
const getValueFromTextNode = (obj) => {
const textNodeName = "#text";
for (const key in obj) {
if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) {
obj[key] = obj[key][textNodeName];
}
else if (typeof obj[key] === "object" && obj[key] !== null) {
obj[key] = (0, exports.getValueFromTextNode)(obj[key]);
}
}
return obj;
};
exports.getValueFromTextNode = getValueFromTextNode;
/***/ }),
/***/ 63570:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(70438), exports);
tslib_1.__exportStar(__nccwpck_require__(61600), exports);
tslib_1.__exportStar(__nccwpck_require__(32813), exports);
tslib_1.__exportStar(__nccwpck_require__(75414), exports);
tslib_1.__exportStar(__nccwpck_require__(92541), exports);
tslib_1.__exportStar(__nccwpck_require__(56929), exports);
tslib_1.__exportStar(__nccwpck_require__(21737), exports);
tslib_1.__exportStar(__nccwpck_require__(9681), exports);
tslib_1.__exportStar(__nccwpck_require__(11163), exports);
tslib_1.__exportStar(__nccwpck_require__(91809), exports);
tslib_1.__exportStar(__nccwpck_require__(1822), exports);
tslib_1.__exportStar(__nccwpck_require__(88074), exports);
tslib_1.__exportStar(__nccwpck_require__(76016), exports);
tslib_1.__exportStar(__nccwpck_require__(42638), exports);
tslib_1.__exportStar(__nccwpck_require__(92188), exports);
tslib_1.__exportStar(__nccwpck_require__(32964), exports);
tslib_1.__exportStar(__nccwpck_require__(83495), exports);
tslib_1.__exportStar(__nccwpck_require__(74857), exports);
tslib_1.__exportStar(__nccwpck_require__(15342), exports);
tslib_1.__exportStar(__nccwpck_require__(59796), exports);
tslib_1.__exportStar(__nccwpck_require__(1752), exports);
tslib_1.__exportStar(__nccwpck_require__(92480), exports);
/***/ }),
/***/ 32964:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.LazyJsonString = exports.StringWrapper = void 0;
const StringWrapper = function () {
const Class = Object.getPrototypeOf(this).constructor;
const Constructor = Function.bind.apply(String, [null, ...arguments]);
const instance = new Constructor();
Object.setPrototypeOf(instance, Class.prototype);
return instance;
};
exports.StringWrapper = StringWrapper;
exports.StringWrapper.prototype = Object.create(String.prototype, {
constructor: {
value: exports.StringWrapper,
enumerable: false,
writable: true,
configurable: true,
},
});
Object.setPrototypeOf(exports.StringWrapper, String);
class LazyJsonString extends exports.StringWrapper {
deserializeJSON() {
return JSON.parse(super.toString());
}
toJSON() {
return super.toString();
}
static fromObject(object) {
if (object instanceof LazyJsonString) {
return object;
}
else if (object instanceof String || typeof object === "string") {
return new LazyJsonString(object);
}
return new LazyJsonString(JSON.stringify(object));
}
}
exports.LazyJsonString = LazyJsonString;
/***/ }),
/***/ 83495:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.take = exports.convertMap = exports.map = void 0;
function map(arg0, arg1, arg2) {
let target;
let filter;
let instructions;
if (typeof arg1 === "undefined" && typeof arg2 === "undefined") {
target = {};
instructions = arg0;
}
else {
target = arg0;
if (typeof arg1 === "function") {
filter = arg1;
instructions = arg2;
return mapWithFilter(target, filter, instructions);
}
else {
instructions = arg1;
}
}
for (const key of Object.keys(instructions)) {
if (!Array.isArray(instructions[key])) {
target[key] = instructions[key];
continue;
}
applyInstruction(target, null, instructions, key);
}
return target;
}
exports.map = map;
const convertMap = (target) => {
const output = {};
for (const [k, v] of Object.entries(target || {})) {
output[k] = [, v];
}
return output;
};
exports.convertMap = convertMap;
const take = (source, instructions) => {
const out = {};
for (const key in instructions) {
applyInstruction(out, source, instructions, key);
}
return out;
};
exports.take = take;
const mapWithFilter = (target, filter, instructions) => {
return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => {
if (Array.isArray(value)) {
_instructions[key] = value;
}
else {
if (typeof value === "function") {
_instructions[key] = [filter, value()];
}
else {
_instructions[key] = [filter, value];
}
}
return _instructions;
}, {}));
};
const applyInstruction = (target, source, instructions, targetKey) => {
if (source !== null) {
let instruction = instructions[targetKey];
if (typeof instruction === "function") {
instruction = [, instruction];
}
const [filter = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction;
if ((typeof filter === "function" && filter(source[sourceKey])) || (typeof filter !== "function" && !!filter)) {
target[targetKey] = valueFn(source[sourceKey]);
}
return;
}
let [filter, value] = instructions[targetKey];
if (typeof value === "function") {
let _value;
const defaultFilterPassed = filter === undefined && (_value = value()) != null;
const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter);
if (defaultFilterPassed) {
target[targetKey] = _value;
}
else if (customFilterPassed) {
target[targetKey] = value();
}
}
else {
const defaultFilterPassed = filter === undefined && value != null;
const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter);
if (defaultFilterPassed || customFilterPassed) {
target[targetKey] = value;
}
}
};
const nonNullish = (_) => _ != null;
const pass = (_) => _;
/***/ }),
/***/ 74857:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.logger = exports.strictParseByte = exports.strictParseShort = exports.strictParseInt32 = exports.strictParseInt = exports.strictParseLong = exports.limitedParseFloat32 = exports.limitedParseFloat = exports.handleFloat = exports.limitedParseDouble = exports.strictParseFloat32 = exports.strictParseFloat = exports.strictParseDouble = exports.expectUnion = exports.expectString = exports.expectObject = exports.expectNonNull = exports.expectByte = exports.expectShort = exports.expectInt32 = exports.expectInt = exports.expectLong = exports.expectFloat32 = exports.expectNumber = exports.expectBoolean = exports.parseBoolean = void 0;
const parseBoolean = (value) => {
switch (value) {
case "true":
return true;
case "false":
return false;
default:
throw new Error(`Unable to parse boolean value "${value}"`);
}
};
exports.parseBoolean = parseBoolean;
const expectBoolean = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value === "number") {
if (value === 0 || value === 1) {
exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`));
}
if (value === 0) {
return false;
}
if (value === 1) {
return true;
}
}
if (typeof value === "string") {
const lower = value.toLowerCase();
if (lower === "false" || lower === "true") {
exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`));
}
if (lower === "false") {
return false;
}
if (lower === "true") {
return true;
}
}
if (typeof value === "boolean") {
return value;
}
throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`);
};
exports.expectBoolean = expectBoolean;
const expectNumber = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value === "string") {
const parsed = parseFloat(value);
if (!Number.isNaN(parsed)) {
if (String(parsed) !== String(value)) {
exports.logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`));
}
return parsed;
}
}
if (typeof value === "number") {
return value;
}
throw new TypeError(`Expected number, got ${typeof value}: ${value}`);
};
exports.expectNumber = expectNumber;
const MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23));
const expectFloat32 = (value) => {
const expected = (0, exports.expectNumber)(value);
if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) {
if (Math.abs(expected) > MAX_FLOAT) {
throw new TypeError(`Expected 32-bit float, got ${value}`);
}
}
return expected;
};
exports.expectFloat32 = expectFloat32;
const expectLong = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (Number.isInteger(value) && !Number.isNaN(value)) {
return value;
}
throw new TypeError(`Expected integer, got ${typeof value}: ${value}`);
};
exports.expectLong = expectLong;
exports.expectInt = exports.expectLong;
const expectInt32 = (value) => expectSizedInt(value, 32);
exports.expectInt32 = expectInt32;
const expectShort = (value) => expectSizedInt(value, 16);
exports.expectShort = expectShort;
const expectByte = (value) => expectSizedInt(value, 8);
exports.expectByte = expectByte;
const expectSizedInt = (value, size) => {
const expected = (0, exports.expectLong)(value);
if (expected !== undefined && castInt(expected, size) !== expected) {
throw new TypeError(`Expected ${size}-bit integer, got ${value}`);
}
return expected;
};
const castInt = (value, size) => {
switch (size) {
case 32:
return Int32Array.of(value)[0];
case 16:
return Int16Array.of(value)[0];
case 8:
return Int8Array.of(value)[0];
}
};
const expectNonNull = (value, location) => {
if (value === null || value === undefined) {
if (location) {
throw new TypeError(`Expected a non-null value for ${location}`);
}
throw new TypeError("Expected a non-null value");
}
return value;
};
exports.expectNonNull = expectNonNull;
const expectObject = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value === "object" && !Array.isArray(value)) {
return value;
}
const receivedType = Array.isArray(value) ? "array" : typeof value;
throw new TypeError(`Expected object, got ${receivedType}: ${value}`);
};
exports.expectObject = expectObject;
const expectString = (value) => {
if (value === null || value === undefined) {
return undefined;
}
if (typeof value === "string") {
return value;
}
if (["boolean", "number", "bigint"].includes(typeof value)) {
exports.logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`));
return String(value);
}
throw new TypeError(`Expected string, got ${typeof value}: ${value}`);
};
exports.expectString = expectString;
const expectUnion = (value) => {
if (value === null || value === undefined) {
return undefined;
}
const asObject = (0, exports.expectObject)(value);
const setKeys = Object.entries(asObject)
.filter(([, v]) => v != null)
.map(([k]) => k);
if (setKeys.length === 0) {
throw new TypeError(`Unions must have exactly one non-null member. None were found.`);
}
if (setKeys.length > 1) {
throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`);
}
return asObject;
};
exports.expectUnion = expectUnion;
const strictParseDouble = (value) => {
if (typeof value == "string") {
return (0, exports.expectNumber)(parseNumber(value));
}
return (0, exports.expectNumber)(value);
};
exports.strictParseDouble = strictParseDouble;
exports.strictParseFloat = exports.strictParseDouble;
const strictParseFloat32 = (value) => {
if (typeof value == "string") {
return (0, exports.expectFloat32)(parseNumber(value));
}
return (0, exports.expectFloat32)(value);
};
exports.strictParseFloat32 = strictParseFloat32;
const NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g;
const parseNumber = (value) => {
const matches = value.match(NUMBER_REGEX);
if (matches === null || matches[0].length !== value.length) {
throw new TypeError(`Expected real number, got implicit NaN`);
}
return parseFloat(value);
};
const limitedParseDouble = (value) => {
if (typeof value == "string") {
return parseFloatString(value);
}
return (0, exports.expectNumber)(value);
};
exports.limitedParseDouble = limitedParseDouble;
exports.handleFloat = exports.limitedParseDouble;
exports.limitedParseFloat = exports.limitedParseDouble;
const limitedParseFloat32 = (value) => {
if (typeof value == "string") {
return parseFloatString(value);
}
return (0, exports.expectFloat32)(value);
};
exports.limitedParseFloat32 = limitedParseFloat32;
const parseFloatString = (value) => {
switch (value) {
case "NaN":
return NaN;
case "Infinity":
return Infinity;
case "-Infinity":
return -Infinity;
default:
throw new Error(`Unable to parse float value: ${value}`);
}
};
const strictParseLong = (value) => {
if (typeof value === "string") {
return (0, exports.expectLong)(parseNumber(value));
}
return (0, exports.expectLong)(value);
};
exports.strictParseLong = strictParseLong;
exports.strictParseInt = exports.strictParseLong;
const strictParseInt32 = (value) => {
if (typeof value === "string") {
return (0, exports.expectInt32)(parseNumber(value));
}
return (0, exports.expectInt32)(value);
};
exports.strictParseInt32 = strictParseInt32;
const strictParseShort = (value) => {
if (typeof value === "string") {
return (0, exports.expectShort)(parseNumber(value));
}
return (0, exports.expectShort)(value);
};
exports.strictParseShort = strictParseShort;
const strictParseByte = (value) => {
if (typeof value === "string") {
return (0, exports.expectByte)(parseNumber(value));
}
return (0, exports.expectByte)(value);
};
exports.strictParseByte = strictParseByte;
const stackTraceWarning = (message) => {
return String(new TypeError(message).stack || message)
.split("\n")
.slice(0, 5)
.filter((s) => !s.includes("stackTraceWarning"))
.join("\n");
};
exports.logger = {
warn: console.warn,
};
/***/ }),
/***/ 15342:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolvedPath = void 0;
const extended_encode_uri_component_1 = __nccwpck_require__(76016);
const resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => {
if (input != null && input[memberName] !== undefined) {
const labelValue = labelValueProvider();
if (labelValue.length <= 0) {
throw new Error("Empty value provided for input HTTP label: " + memberName + ".");
}
resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel
? labelValue
.split("/")
.map((segment) => (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(segment))
.join("/")
: (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(labelValue));
}
else {
throw new Error("No value provided for input HTTP label: " + memberName + ".");
}
return resolvedPath;
};
exports.resolvedPath = resolvedPath;
/***/ }),
/***/ 59796:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.serializeFloat = void 0;
const serializeFloat = (value) => {
if (value !== value) {
return "NaN";
}
switch (value) {
case Infinity:
return "Infinity";
case -Infinity:
return "-Infinity";
default:
return value;
}
};
exports.serializeFloat = serializeFloat;
/***/ }),
/***/ 1752:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports._json = void 0;
const _json = (obj) => {
if (obj == null) {
return {};
}
if (Array.isArray(obj)) {
return obj.filter((_) => _ != null);
}
if (typeof obj === "object") {
const target = {};
for (const key of Object.keys(obj)) {
if (obj[key] == null) {
continue;
}
target[key] = (0, exports._json)(obj[key]);
}
return target;
}
return obj;
};
exports._json = _json;
/***/ }),
/***/ 92480:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.splitEvery = void 0;
function splitEvery(value, delimiter, numDelimiters) {
if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) {
throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery.");
}
const segments = value.split(delimiter);
if (numDelimiters === 1) {
return segments;
}
const compoundSegments = [];
let currentSegment = "";
for (let i = 0; i < segments.length; i++) {
if (currentSegment === "") {
currentSegment = segments[i];
}
else {
currentSegment += delimiter + segments[i];
}
if ((i + 1) % numDelimiters === 0) {
compoundSegments.push(currentSegment);
currentSegment = "";
}
}
if (currentSegment !== "") {
compoundSegments.push(currentSegment);
}
return compoundSegments;
}
exports.splitEvery = splitEvery;
/***/ }),
/***/ 74075:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 93242:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HttpApiKeyAuthLocation = void 0;
var HttpApiKeyAuthLocation;
(function (HttpApiKeyAuthLocation) {
HttpApiKeyAuthLocation["HEADER"] = "header";
HttpApiKeyAuthLocation["QUERY"] = "query";
})(HttpApiKeyAuthLocation = exports.HttpApiKeyAuthLocation || (exports.HttpApiKeyAuthLocation = {}));
/***/ }),
/***/ 81851:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 91530:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 74020:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 52263:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 79467:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.HttpAuthLocation = void 0;
var HttpAuthLocation;
(function (HttpAuthLocation) {
HttpAuthLocation["HEADER"] = "header";
HttpAuthLocation["QUERY"] = "query";
})(HttpAuthLocation = exports.HttpAuthLocation || (exports.HttpAuthLocation = {}));
/***/ }),
/***/ 11239:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(79467), exports);
tslib_1.__exportStar(__nccwpck_require__(93242), exports);
tslib_1.__exportStar(__nccwpck_require__(81851), exports);
tslib_1.__exportStar(__nccwpck_require__(91530), exports);
tslib_1.__exportStar(__nccwpck_require__(74020), exports);
tslib_1.__exportStar(__nccwpck_require__(52263), exports);
/***/ }),
/***/ 63274:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 78340:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 4744:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 68270:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 39580:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 57628:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(39580), exports);
tslib_1.__exportStar(__nccwpck_require__(98398), exports);
tslib_1.__exportStar(__nccwpck_require__(76522), exports);
/***/ }),
/***/ 98398:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 76522:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 89035:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 7225:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 54126:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.EndpointURLScheme = void 0;
var EndpointURLScheme;
(function (EndpointURLScheme) {
EndpointURLScheme["HTTP"] = "http";
EndpointURLScheme["HTTPS"] = "https";
})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {}));
/***/ }),
/***/ 55612:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 43084:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 89843:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 63799:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 21550:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(55612), exports);
tslib_1.__exportStar(__nccwpck_require__(43084), exports);
tslib_1.__exportStar(__nccwpck_require__(89843), exports);
tslib_1.__exportStar(__nccwpck_require__(57658), exports);
tslib_1.__exportStar(__nccwpck_require__(63799), exports);
/***/ }),
/***/ 57658:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 88508:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 8947:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveChecksumRuntimeConfig = exports.getChecksumConfiguration = exports.AlgorithmId = void 0;
var AlgorithmId;
(function (AlgorithmId) {
AlgorithmId["MD5"] = "md5";
AlgorithmId["CRC32"] = "crc32";
AlgorithmId["CRC32C"] = "crc32c";
AlgorithmId["SHA1"] = "sha1";
AlgorithmId["SHA256"] = "sha256";
})(AlgorithmId = exports.AlgorithmId || (exports.AlgorithmId = {}));
const getChecksumConfiguration = (runtimeConfig) => {
const checksumAlgorithms = [];
if (runtimeConfig.sha256 !== undefined) {
checksumAlgorithms.push({
algorithmId: () => AlgorithmId.SHA256,
checksumConstructor: () => runtimeConfig.sha256,
});
}
if (runtimeConfig.md5 != undefined) {
checksumAlgorithms.push({
algorithmId: () => AlgorithmId.MD5,
checksumConstructor: () => runtimeConfig.md5,
});
}
return {
_checksumAlgorithms: checksumAlgorithms,
addChecksumAlgorithm(algo) {
this._checksumAlgorithms.push(algo);
},
checksumAlgorithms() {
return this._checksumAlgorithms;
},
};
};
exports.getChecksumConfiguration = getChecksumConfiguration;
const resolveChecksumRuntimeConfig = (clientConfig) => {
const runtimeConfig = {};
clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => {
runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor();
});
return runtimeConfig;
};
exports.resolveChecksumRuntimeConfig = resolveChecksumRuntimeConfig;
/***/ }),
/***/ 89169:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveDefaultRuntimeConfig = exports.getDefaultClientConfiguration = void 0;
const checksum_1 = __nccwpck_require__(8947);
const getDefaultClientConfiguration = (runtimeConfig) => {
return {
...(0, checksum_1.getChecksumConfiguration)(runtimeConfig),
};
};
exports.getDefaultClientConfiguration = getDefaultClientConfiguration;
const resolveDefaultRuntimeConfig = (config) => {
return {
...(0, checksum_1.resolveChecksumRuntimeConfig)(config),
};
};
exports.resolveDefaultRuntimeConfig = resolveDefaultRuntimeConfig;
/***/ }),
/***/ 32245:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 47447:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AlgorithmId = void 0;
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(89169), exports);
tslib_1.__exportStar(__nccwpck_require__(32245), exports);
var checksum_1 = __nccwpck_require__(8947);
Object.defineProperty(exports, "AlgorithmId", ({ enumerable: true, get: function () { return checksum_1.AlgorithmId; } }));
/***/ }),
/***/ 18883:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.FieldPosition = void 0;
var FieldPosition;
(function (FieldPosition) {
FieldPosition[FieldPosition["HEADER"] = 0] = "HEADER";
FieldPosition[FieldPosition["TRAILER"] = 1] = "TRAILER";
})(FieldPosition = exports.FieldPosition || (exports.FieldPosition = {}));
/***/ }),
/***/ 197:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 7545:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 49123:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 28006:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(197), exports);
tslib_1.__exportStar(__nccwpck_require__(7545), exports);
tslib_1.__exportStar(__nccwpck_require__(49123), exports);
tslib_1.__exportStar(__nccwpck_require__(84476), exports);
/***/ }),
/***/ 84476:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 55756:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(74075), exports);
tslib_1.__exportStar(__nccwpck_require__(11239), exports);
tslib_1.__exportStar(__nccwpck_require__(63274), exports);
tslib_1.__exportStar(__nccwpck_require__(78340), exports);
tslib_1.__exportStar(__nccwpck_require__(4744), exports);
tslib_1.__exportStar(__nccwpck_require__(68270), exports);
tslib_1.__exportStar(__nccwpck_require__(57628), exports);
tslib_1.__exportStar(__nccwpck_require__(89035), exports);
tslib_1.__exportStar(__nccwpck_require__(7225), exports);
tslib_1.__exportStar(__nccwpck_require__(54126), exports);
tslib_1.__exportStar(__nccwpck_require__(21550), exports);
tslib_1.__exportStar(__nccwpck_require__(88508), exports);
tslib_1.__exportStar(__nccwpck_require__(47447), exports);
tslib_1.__exportStar(__nccwpck_require__(18883), exports);
tslib_1.__exportStar(__nccwpck_require__(28006), exports);
tslib_1.__exportStar(__nccwpck_require__(52866), exports);
tslib_1.__exportStar(__nccwpck_require__(17756), exports);
tslib_1.__exportStar(__nccwpck_require__(45489), exports);
tslib_1.__exportStar(__nccwpck_require__(26524), exports);
tslib_1.__exportStar(__nccwpck_require__(14603), exports);
tslib_1.__exportStar(__nccwpck_require__(83752), exports);
tslib_1.__exportStar(__nccwpck_require__(30774), exports);
tslib_1.__exportStar(__nccwpck_require__(14089), exports);
tslib_1.__exportStar(__nccwpck_require__(45678), exports);
tslib_1.__exportStar(__nccwpck_require__(69926), exports);
tslib_1.__exportStar(__nccwpck_require__(9945), exports);
tslib_1.__exportStar(__nccwpck_require__(28564), exports);
tslib_1.__exportStar(__nccwpck_require__(61285), exports);
tslib_1.__exportStar(__nccwpck_require__(50364), exports);
tslib_1.__exportStar(__nccwpck_require__(69304), exports);
tslib_1.__exportStar(__nccwpck_require__(46098), exports);
tslib_1.__exportStar(__nccwpck_require__(10375), exports);
tslib_1.__exportStar(__nccwpck_require__(66894), exports);
tslib_1.__exportStar(__nccwpck_require__(57887), exports);
tslib_1.__exportStar(__nccwpck_require__(66255), exports);
/***/ }),
/***/ 52866:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 17756:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.SMITHY_CONTEXT_KEY = void 0;
exports.SMITHY_CONTEXT_KEY = "__smithy_context";
/***/ }),
/***/ 45489:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 26524:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.IniSectionType = void 0;
var IniSectionType;
(function (IniSectionType) {
IniSectionType["PROFILE"] = "profile";
IniSectionType["SSO_SESSION"] = "sso-session";
IniSectionType["SERVICES"] = "services";
})(IniSectionType = exports.IniSectionType || (exports.IniSectionType = {}));
/***/ }),
/***/ 14603:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 83752:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 30774:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 14089:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 45678:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 69926:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 9945:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 28564:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 61285:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 50364:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.RequestHandlerProtocol = void 0;
var RequestHandlerProtocol;
(function (RequestHandlerProtocol) {
RequestHandlerProtocol["HTTP_0_9"] = "http/0.9";
RequestHandlerProtocol["HTTP_1_0"] = "http/1.0";
RequestHandlerProtocol["TDS_8_0"] = "tds/8.0";
})(RequestHandlerProtocol = exports.RequestHandlerProtocol || (exports.RequestHandlerProtocol = {}));
/***/ }),
/***/ 69304:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 46098:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 10375:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 66894:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 57887:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 66255:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 14681:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseUrl = void 0;
const querystring_parser_1 = __nccwpck_require__(4769);
const parseUrl = (url) => {
if (typeof url === "string") {
return (0, exports.parseUrl)(new URL(url));
}
const { hostname, pathname, port, protocol, search } = url;
let query;
if (search) {
query = (0, querystring_parser_1.parseQueryString)(search);
}
return {
hostname,
port: port ? parseInt(port) : undefined,
protocol,
path: pathname,
query,
};
};
exports.parseUrl = parseUrl;
/***/ }),
/***/ 30305:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromBase64 = void 0;
const util_buffer_from_1 = __nccwpck_require__(31381);
const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/;
const fromBase64 = (input) => {
if ((input.length * 3) % 4 !== 0) {
throw new TypeError(`Incorrect padding on base64 string.`);
}
if (!BASE64_REGEX.exec(input)) {
throw new TypeError(`Invalid base64 string.`);
}
const buffer = (0, util_buffer_from_1.fromString)(input, "base64");
return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength);
};
exports.fromBase64 = fromBase64;
/***/ }),
/***/ 75600:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(30305), exports);
tslib_1.__exportStar(__nccwpck_require__(74730), exports);
/***/ }),
/***/ 74730:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toBase64 = void 0;
const util_buffer_from_1 = __nccwpck_require__(31381);
const toBase64 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64");
exports.toBase64 = toBase64;
/***/ }),
/***/ 54880:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.calculateBodyLength = void 0;
const fs_1 = __nccwpck_require__(57147);
const calculateBodyLength = (body) => {
if (!body) {
return 0;
}
if (typeof body === "string") {
return Buffer.from(body).length;
}
else if (typeof body.byteLength === "number") {
return body.byteLength;
}
else if (typeof body.size === "number") {
return body.size;
}
else if (typeof body.start === "number" && typeof body.end === "number") {
return body.end + 1 - body.start;
}
else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) {
return (0, fs_1.lstatSync)(body.path).size;
}
else if (typeof body.fd === "number") {
return (0, fs_1.fstatSync)(body.fd).size;
}
throw new Error(`Body Length computation failed for ${body}`);
};
exports.calculateBodyLength = calculateBodyLength;
/***/ }),
/***/ 68075:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(54880), exports);
/***/ }),
/***/ 31381:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromString = exports.fromArrayBuffer = void 0;
const is_array_buffer_1 = __nccwpck_require__(10780);
const buffer_1 = __nccwpck_require__(14300);
const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => {
if (!(0, is_array_buffer_1.isArrayBuffer)(input)) {
throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`);
}
return buffer_1.Buffer.from(input, offset, length);
};
exports.fromArrayBuffer = fromArrayBuffer;
const fromString = (input, encoding) => {
if (typeof input !== "string") {
throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`);
}
return encoding ? buffer_1.Buffer.from(input, encoding) : buffer_1.Buffer.from(input);
};
exports.fromString = fromString;
/***/ }),
/***/ 42491:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.booleanSelector = exports.SelectorType = void 0;
var SelectorType;
(function (SelectorType) {
SelectorType["ENV"] = "env";
SelectorType["CONFIG"] = "shared config entry";
})(SelectorType = exports.SelectorType || (exports.SelectorType = {}));
const booleanSelector = (obj, key, type) => {
if (!(key in obj))
return undefined;
if (obj[key] === "true")
return true;
if (obj[key] === "false")
return false;
throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`);
};
exports.booleanSelector = booleanSelector;
/***/ }),
/***/ 83375:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(42491), exports);
/***/ }),
/***/ 56470:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.IMDS_REGION_PATH = exports.DEFAULTS_MODE_OPTIONS = exports.ENV_IMDS_DISABLED = exports.AWS_DEFAULT_REGION_ENV = exports.AWS_REGION_ENV = exports.AWS_EXECUTION_ENV = void 0;
exports.AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV";
exports.AWS_REGION_ENV = "AWS_REGION";
exports.AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION";
exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED";
exports.DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"];
exports.IMDS_REGION_PATH = "/latest/meta-data/placement/region";
/***/ }),
/***/ 15577:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = void 0;
const AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE";
const AWS_DEFAULTS_MODE_CONFIG = "defaults_mode";
exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = {
environmentVariableSelector: (env) => {
return env[AWS_DEFAULTS_MODE_ENV];
},
configFileSelector: (profile) => {
return profile[AWS_DEFAULTS_MODE_CONFIG];
},
default: "legacy",
};
/***/ }),
/***/ 72429:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(46217), exports);
/***/ }),
/***/ 46217:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveDefaultsModeConfig = void 0;
const config_resolver_1 = __nccwpck_require__(53098);
const credential_provider_imds_1 = __nccwpck_require__(7477);
const node_config_provider_1 = __nccwpck_require__(33461);
const property_provider_1 = __nccwpck_require__(79721);
const constants_1 = __nccwpck_require__(56470);
const defaultsModeConfig_1 = __nccwpck_require__(15577);
const resolveDefaultsModeConfig = ({ region = (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS), defaultsMode = (0, node_config_provider_1.loadConfig)(defaultsModeConfig_1.NODE_DEFAULTS_MODE_CONFIG_OPTIONS), } = {}) => (0, property_provider_1.memoize)(async () => {
const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode;
switch (mode === null || mode === void 0 ? void 0 : mode.toLowerCase()) {
case "auto":
return resolveNodeDefaultsModeAuto(region);
case "in-region":
case "cross-region":
case "mobile":
case "standard":
case "legacy":
return Promise.resolve(mode === null || mode === void 0 ? void 0 : mode.toLocaleLowerCase());
case undefined:
return Promise.resolve("legacy");
default:
throw new Error(`Invalid parameter for "defaultsMode", expect ${constants_1.DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}`);
}
});
exports.resolveDefaultsModeConfig = resolveDefaultsModeConfig;
const resolveNodeDefaultsModeAuto = async (clientRegion) => {
if (clientRegion) {
const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion;
const inferredRegion = await inferPhysicalRegion();
if (!inferredRegion) {
return "standard";
}
if (resolvedRegion === inferredRegion) {
return "in-region";
}
else {
return "cross-region";
}
}
return "standard";
};
const inferPhysicalRegion = async () => {
var _a;
if (process.env[constants_1.AWS_EXECUTION_ENV] && (process.env[constants_1.AWS_REGION_ENV] || process.env[constants_1.AWS_DEFAULT_REGION_ENV])) {
return (_a = process.env[constants_1.AWS_REGION_ENV]) !== null && _a !== void 0 ? _a : process.env[constants_1.AWS_DEFAULT_REGION_ENV];
}
if (!process.env[constants_1.ENV_IMDS_DISABLED]) {
try {
const endpoint = await (0, credential_provider_imds_1.getInstanceMetadataEndpoint)();
return (await (0, credential_provider_imds_1.httpRequest)({ ...endpoint, path: constants_1.IMDS_REGION_PATH })).toString();
}
catch (e) {
}
}
};
/***/ }),
/***/ 71280:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.debugId = void 0;
exports.debugId = "endpoints";
/***/ }),
/***/ 30540:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(71280), exports);
tslib_1.__exportStar(__nccwpck_require__(48927), exports);
/***/ }),
/***/ 48927:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toDebugString = void 0;
function toDebugString(input) {
if (typeof input !== "object" || input == null) {
return input;
}
if ("ref" in input) {
return `$${toDebugString(input.ref)}`;
}
if ("fn" in input) {
return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`;
}
return JSON.stringify(input, null, 2);
}
exports.toDebugString = toDebugString;
/***/ }),
/***/ 45473:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(55402), exports);
tslib_1.__exportStar(__nccwpck_require__(55021), exports);
tslib_1.__exportStar(__nccwpck_require__(38824), exports);
tslib_1.__exportStar(__nccwpck_require__(78693), exports);
tslib_1.__exportStar(__nccwpck_require__(75442), exports);
/***/ }),
/***/ 29132:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.booleanEquals = void 0;
const booleanEquals = (value1, value2) => value1 === value2;
exports.booleanEquals = booleanEquals;
/***/ }),
/***/ 84624:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getAttr = void 0;
const types_1 = __nccwpck_require__(75442);
const getAttrPathList_1 = __nccwpck_require__(91311);
const getAttr = (value, path) => (0, getAttrPathList_1.getAttrPathList)(path).reduce((acc, index) => {
if (typeof acc !== "object") {
throw new types_1.EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`);
}
else if (Array.isArray(acc)) {
return acc[parseInt(index)];
}
return acc[index];
}, value);
exports.getAttr = getAttr;
/***/ }),
/***/ 91311:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getAttrPathList = void 0;
const types_1 = __nccwpck_require__(75442);
const getAttrPathList = (path) => {
const parts = path.split(".");
const pathList = [];
for (const part of parts) {
const squareBracketIndex = part.indexOf("[");
if (squareBracketIndex !== -1) {
if (part.indexOf("]") !== part.length - 1) {
throw new types_1.EndpointError(`Path: '${path}' does not end with ']'`);
}
const arrayIndex = part.slice(squareBracketIndex + 1, -1);
if (Number.isNaN(parseInt(arrayIndex))) {
throw new types_1.EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`);
}
if (squareBracketIndex !== 0) {
pathList.push(part.slice(0, squareBracketIndex));
}
pathList.push(arrayIndex);
}
else {
pathList.push(part);
}
}
return pathList;
};
exports.getAttrPathList = getAttrPathList;
/***/ }),
/***/ 36559:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(29132), exports);
tslib_1.__exportStar(__nccwpck_require__(84624), exports);
tslib_1.__exportStar(__nccwpck_require__(71231), exports);
tslib_1.__exportStar(__nccwpck_require__(55021), exports);
tslib_1.__exportStar(__nccwpck_require__(42249), exports);
tslib_1.__exportStar(__nccwpck_require__(84654), exports);
tslib_1.__exportStar(__nccwpck_require__(72512), exports);
tslib_1.__exportStar(__nccwpck_require__(49245), exports);
tslib_1.__exportStar(__nccwpck_require__(51482), exports);
/***/ }),
/***/ 55402:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isIpAddress = void 0;
const IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$`);
const isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith("[") && value.endsWith("]"));
exports.isIpAddress = isIpAddress;
/***/ }),
/***/ 71231:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isSet = void 0;
const isSet = (value) => value != null;
exports.isSet = isSet;
/***/ }),
/***/ 55021:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.isValidHostLabel = void 0;
const VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`);
const isValidHostLabel = (value, allowSubDomains = false) => {
if (!allowSubDomains) {
return VALID_HOST_LABEL_REGEX.test(value);
}
const labels = value.split(".");
for (const label of labels) {
if (!(0, exports.isValidHostLabel)(label)) {
return false;
}
}
return true;
};
exports.isValidHostLabel = isValidHostLabel;
/***/ }),
/***/ 42249:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.not = void 0;
const not = (value) => !value;
exports.not = not;
/***/ }),
/***/ 84654:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.parseURL = void 0;
const types_1 = __nccwpck_require__(55756);
const isIpAddress_1 = __nccwpck_require__(55402);
const DEFAULT_PORTS = {
[types_1.EndpointURLScheme.HTTP]: 80,
[types_1.EndpointURLScheme.HTTPS]: 443,
};
const parseURL = (value) => {
const whatwgURL = (() => {
try {
if (value instanceof URL) {
return value;
}
if (typeof value === "object" && "hostname" in value) {
const { hostname, port, protocol = "", path = "", query = {} } = value;
const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : ""}${path}`);
url.search = Object.entries(query)
.map(([k, v]) => `${k}=${v}`)
.join("&");
return url;
}
return new URL(value);
}
catch (error) {
return null;
}
})();
if (!whatwgURL) {
console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`);
return null;
}
const urlString = whatwgURL.href;
const { host, hostname, pathname, protocol, search } = whatwgURL;
if (search) {
return null;
}
const scheme = protocol.slice(0, -1);
if (!Object.values(types_1.EndpointURLScheme).includes(scheme)) {
return null;
}
const isIp = (0, isIpAddress_1.isIpAddress)(hostname);
const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) ||
(typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`));
const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`;
return {
scheme,
authority,
path: pathname,
normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`,
isIp,
};
};
exports.parseURL = parseURL;
/***/ }),
/***/ 72512:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.stringEquals = void 0;
const stringEquals = (value1, value2) => value1 === value2;
exports.stringEquals = stringEquals;
/***/ }),
/***/ 49245:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.substring = void 0;
const substring = (input, start, stop, reverse) => {
if (start >= stop || input.length < stop) {
return null;
}
if (!reverse) {
return input.substring(start, stop);
}
return input.substring(input.length - stop, input.length - start);
};
exports.substring = substring;
/***/ }),
/***/ 51482:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.uriEncode = void 0;
const uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`);
exports.uriEncode = uriEncode;
/***/ }),
/***/ 78693:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.resolveEndpoint = void 0;
const debug_1 = __nccwpck_require__(30540);
const types_1 = __nccwpck_require__(75442);
const utils_1 = __nccwpck_require__(96871);
const resolveEndpoint = (ruleSetObject, options) => {
var _a, _b, _c, _d, _e, _f;
const { endpointParams, logger } = options;
const { parameters, rules } = ruleSetObject;
(_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, `${debug_1.debugId} Initial EndpointParams: ${(0, debug_1.toDebugString)(endpointParams)}`);
const paramsWithDefault = Object.entries(parameters)
.filter(([, v]) => v.default != null)
.map(([k, v]) => [k, v.default]);
if (paramsWithDefault.length > 0) {
for (const [paramKey, paramDefaultValue] of paramsWithDefault) {
endpointParams[paramKey] = (_c = endpointParams[paramKey]) !== null && _c !== void 0 ? _c : paramDefaultValue;
}
}
const requiredParams = Object.entries(parameters)
.filter(([, v]) => v.required)
.map(([k]) => k);
for (const requiredParam of requiredParams) {
if (endpointParams[requiredParam] == null) {
throw new types_1.EndpointError(`Missing required parameter: '${requiredParam}'`);
}
}
const endpoint = (0, utils_1.evaluateRules)(rules, { endpointParams, logger, referenceRecord: {} });
if ((_d = options.endpointParams) === null || _d === void 0 ? void 0 : _d.Endpoint) {
try {
const givenEndpoint = new URL(options.endpointParams.Endpoint);
const { protocol, port } = givenEndpoint;
endpoint.url.protocol = protocol;
endpoint.url.port = port;
}
catch (e) {
}
}
(_f = (_e = options.logger) === null || _e === void 0 ? void 0 : _e.debug) === null || _f === void 0 ? void 0 : _f.call(_e, `${debug_1.debugId} Resolved endpoint: ${(0, debug_1.toDebugString)(endpoint)}`);
return endpoint;
};
exports.resolveEndpoint = resolveEndpoint;
/***/ }),
/***/ 84213:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.EndpointError = void 0;
class EndpointError extends Error {
constructor(message) {
super(message);
this.name = "EndpointError";
}
}
exports.EndpointError = EndpointError;
/***/ }),
/***/ 34073:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 72533:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 63135:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 19136:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 28344:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 75442:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(84213), exports);
tslib_1.__exportStar(__nccwpck_require__(34073), exports);
tslib_1.__exportStar(__nccwpck_require__(72533), exports);
tslib_1.__exportStar(__nccwpck_require__(63135), exports);
tslib_1.__exportStar(__nccwpck_require__(19136), exports);
tslib_1.__exportStar(__nccwpck_require__(28344), exports);
tslib_1.__exportStar(__nccwpck_require__(42535), exports);
/***/ }),
/***/ 42535:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 66318:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.callFunction = void 0;
const customEndpointFunctions_1 = __nccwpck_require__(38824);
const endpointFunctions_1 = __nccwpck_require__(70953);
const evaluateExpression_1 = __nccwpck_require__(91692);
const callFunction = ({ fn, argv }, options) => {
const evaluatedArgs = argv.map((arg) => ["boolean", "number"].includes(typeof arg) ? arg : (0, evaluateExpression_1.evaluateExpression)(arg, "arg", options));
const fnSegments = fn.split(".");
if (fnSegments[0] in customEndpointFunctions_1.customEndpointFunctions && fnSegments[1] != null) {
return customEndpointFunctions_1.customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs);
}
return endpointFunctions_1.endpointFunctions[fn](...evaluatedArgs);
};
exports.callFunction = callFunction;
/***/ }),
/***/ 38824:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.customEndpointFunctions = void 0;
exports.customEndpointFunctions = {};
/***/ }),
/***/ 70953:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.endpointFunctions = void 0;
const lib_1 = __nccwpck_require__(36559);
exports.endpointFunctions = {
booleanEquals: lib_1.booleanEquals,
getAttr: lib_1.getAttr,
isSet: lib_1.isSet,
isValidHostLabel: lib_1.isValidHostLabel,
not: lib_1.not,
parseURL: lib_1.parseURL,
stringEquals: lib_1.stringEquals,
substring: lib_1.substring,
uriEncode: lib_1.uriEncode,
};
/***/ }),
/***/ 42138:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateCondition = void 0;
const debug_1 = __nccwpck_require__(30540);
const types_1 = __nccwpck_require__(75442);
const callFunction_1 = __nccwpck_require__(66318);
const evaluateCondition = ({ assign, ...fnArgs }, options) => {
var _a, _b;
if (assign && assign in options.referenceRecord) {
throw new types_1.EndpointError(`'${assign}' is already defined in Reference Record.`);
}
const value = (0, callFunction_1.callFunction)(fnArgs, options);
(_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `evaluateCondition: ${(0, debug_1.toDebugString)(fnArgs)} = ${(0, debug_1.toDebugString)(value)}`);
return {
result: value === "" ? true : !!value,
...(assign != null && { toAssign: { name: assign, value } }),
};
};
exports.evaluateCondition = evaluateCondition;
/***/ }),
/***/ 69584:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateConditions = void 0;
const debug_1 = __nccwpck_require__(30540);
const evaluateCondition_1 = __nccwpck_require__(42138);
const evaluateConditions = (conditions = [], options) => {
var _a, _b;
const conditionsReferenceRecord = {};
for (const condition of conditions) {
const { result, toAssign } = (0, evaluateCondition_1.evaluateCondition)(condition, {
...options,
referenceRecord: {
...options.referenceRecord,
...conditionsReferenceRecord,
},
});
if (!result) {
return { result };
}
if (toAssign) {
conditionsReferenceRecord[toAssign.name] = toAssign.value;
(_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `assign: ${toAssign.name} := ${(0, debug_1.toDebugString)(toAssign.value)}`);
}
}
return { result: true, referenceRecord: conditionsReferenceRecord };
};
exports.evaluateConditions = evaluateConditions;
/***/ }),
/***/ 14405:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateEndpointRule = void 0;
const debug_1 = __nccwpck_require__(30540);
const evaluateConditions_1 = __nccwpck_require__(69584);
const getEndpointHeaders_1 = __nccwpck_require__(57225);
const getEndpointProperties_1 = __nccwpck_require__(83067);
const getEndpointUrl_1 = __nccwpck_require__(25672);
const evaluateEndpointRule = (endpointRule, options) => {
var _a, _b;
const { conditions, endpoint } = endpointRule;
const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options);
if (!result) {
return;
}
const endpointRuleOptions = {
...options,
referenceRecord: { ...options.referenceRecord, ...referenceRecord },
};
const { url, properties, headers } = endpoint;
(_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `Resolving endpoint from template: ${(0, debug_1.toDebugString)(endpoint)}`);
return {
...(headers != undefined && {
headers: (0, getEndpointHeaders_1.getEndpointHeaders)(headers, endpointRuleOptions),
}),
...(properties != undefined && {
properties: (0, getEndpointProperties_1.getEndpointProperties)(properties, endpointRuleOptions),
}),
url: (0, getEndpointUrl_1.getEndpointUrl)(url, endpointRuleOptions),
};
};
exports.evaluateEndpointRule = evaluateEndpointRule;
/***/ }),
/***/ 57563:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateErrorRule = void 0;
const types_1 = __nccwpck_require__(75442);
const evaluateConditions_1 = __nccwpck_require__(69584);
const evaluateExpression_1 = __nccwpck_require__(91692);
const evaluateErrorRule = (errorRule, options) => {
const { conditions, error } = errorRule;
const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options);
if (!result) {
return;
}
throw new types_1.EndpointError((0, evaluateExpression_1.evaluateExpression)(error, "Error", {
...options,
referenceRecord: { ...options.referenceRecord, ...referenceRecord },
}));
};
exports.evaluateErrorRule = evaluateErrorRule;
/***/ }),
/***/ 91692:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateExpression = void 0;
const types_1 = __nccwpck_require__(75442);
const callFunction_1 = __nccwpck_require__(66318);
const evaluateTemplate_1 = __nccwpck_require__(21922);
const getReferenceValue_1 = __nccwpck_require__(17142);
const evaluateExpression = (obj, keyName, options) => {
if (typeof obj === "string") {
return (0, evaluateTemplate_1.evaluateTemplate)(obj, options);
}
else if (obj["fn"]) {
return (0, callFunction_1.callFunction)(obj, options);
}
else if (obj["ref"]) {
return (0, getReferenceValue_1.getReferenceValue)(obj, options);
}
throw new types_1.EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`);
};
exports.evaluateExpression = evaluateExpression;
/***/ }),
/***/ 48830:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateRules = void 0;
const types_1 = __nccwpck_require__(75442);
const evaluateEndpointRule_1 = __nccwpck_require__(14405);
const evaluateErrorRule_1 = __nccwpck_require__(57563);
const evaluateTreeRule_1 = __nccwpck_require__(55085);
const evaluateRules = (rules, options) => {
for (const rule of rules) {
if (rule.type === "endpoint") {
const endpointOrUndefined = (0, evaluateEndpointRule_1.evaluateEndpointRule)(rule, options);
if (endpointOrUndefined) {
return endpointOrUndefined;
}
}
else if (rule.type === "error") {
(0, evaluateErrorRule_1.evaluateErrorRule)(rule, options);
}
else if (rule.type === "tree") {
const endpointOrUndefined = (0, evaluateTreeRule_1.evaluateTreeRule)(rule, options);
if (endpointOrUndefined) {
return endpointOrUndefined;
}
}
else {
throw new types_1.EndpointError(`Unknown endpoint rule: ${rule}`);
}
}
throw new types_1.EndpointError(`Rules evaluation failed`);
};
exports.evaluateRules = evaluateRules;
/***/ }),
/***/ 21922:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateTemplate = void 0;
const lib_1 = __nccwpck_require__(36559);
const evaluateTemplate = (template, options) => {
const evaluatedTemplateArr = [];
const templateContext = {
...options.endpointParams,
...options.referenceRecord,
};
let currentIndex = 0;
while (currentIndex < template.length) {
const openingBraceIndex = template.indexOf("{", currentIndex);
if (openingBraceIndex === -1) {
evaluatedTemplateArr.push(template.slice(currentIndex));
break;
}
evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex));
const closingBraceIndex = template.indexOf("}", openingBraceIndex);
if (closingBraceIndex === -1) {
evaluatedTemplateArr.push(template.slice(openingBraceIndex));
break;
}
if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") {
evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex));
currentIndex = closingBraceIndex + 2;
}
const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex);
if (parameterName.includes("#")) {
const [refName, attrName] = parameterName.split("#");
evaluatedTemplateArr.push((0, lib_1.getAttr)(templateContext[refName], attrName));
}
else {
evaluatedTemplateArr.push(templateContext[parameterName]);
}
currentIndex = closingBraceIndex + 1;
}
return evaluatedTemplateArr.join("");
};
exports.evaluateTemplate = evaluateTemplate;
/***/ }),
/***/ 55085:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.evaluateTreeRule = void 0;
const evaluateConditions_1 = __nccwpck_require__(69584);
const evaluateRules_1 = __nccwpck_require__(48830);
const evaluateTreeRule = (treeRule, options) => {
const { conditions, rules } = treeRule;
const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options);
if (!result) {
return;
}
return (0, evaluateRules_1.evaluateRules)(rules, {
...options,
referenceRecord: { ...options.referenceRecord, ...referenceRecord },
});
};
exports.evaluateTreeRule = evaluateTreeRule;
/***/ }),
/***/ 57225:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointHeaders = void 0;
const types_1 = __nccwpck_require__(75442);
const evaluateExpression_1 = __nccwpck_require__(91692);
const getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({
...acc,
[headerKey]: headerVal.map((headerValEntry) => {
const processedExpr = (0, evaluateExpression_1.evaluateExpression)(headerValEntry, "Header value entry", options);
if (typeof processedExpr !== "string") {
throw new types_1.EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`);
}
return processedExpr;
}),
}), {});
exports.getEndpointHeaders = getEndpointHeaders;
/***/ }),
/***/ 83067:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointProperties = void 0;
const getEndpointProperty_1 = __nccwpck_require__(26152);
const getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({
...acc,
[propertyKey]: (0, getEndpointProperty_1.getEndpointProperty)(propertyVal, options),
}), {});
exports.getEndpointProperties = getEndpointProperties;
/***/ }),
/***/ 26152:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointProperty = void 0;
const types_1 = __nccwpck_require__(75442);
const evaluateTemplate_1 = __nccwpck_require__(21922);
const getEndpointProperties_1 = __nccwpck_require__(83067);
const getEndpointProperty = (property, options) => {
if (Array.isArray(property)) {
return property.map((propertyEntry) => (0, exports.getEndpointProperty)(propertyEntry, options));
}
switch (typeof property) {
case "string":
return (0, evaluateTemplate_1.evaluateTemplate)(property, options);
case "object":
if (property === null) {
throw new types_1.EndpointError(`Unexpected endpoint property: ${property}`);
}
return (0, getEndpointProperties_1.getEndpointProperties)(property, options);
case "boolean":
return property;
default:
throw new types_1.EndpointError(`Unexpected endpoint property type: ${typeof property}`);
}
};
exports.getEndpointProperty = getEndpointProperty;
/***/ }),
/***/ 25672:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getEndpointUrl = void 0;
const types_1 = __nccwpck_require__(75442);
const evaluateExpression_1 = __nccwpck_require__(91692);
const getEndpointUrl = (endpointUrl, options) => {
const expression = (0, evaluateExpression_1.evaluateExpression)(endpointUrl, "Endpoint URL", options);
if (typeof expression === "string") {
try {
return new URL(expression);
}
catch (error) {
console.error(`Failed to construct URL with ${expression}`, error);
throw error;
}
}
throw new types_1.EndpointError(`Endpoint URL must be a string, got ${typeof expression}`);
};
exports.getEndpointUrl = getEndpointUrl;
/***/ }),
/***/ 17142:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getReferenceValue = void 0;
const getReferenceValue = ({ ref }, options) => {
const referenceRecord = {
...options.endpointParams,
...options.referenceRecord,
};
return referenceRecord[ref];
};
exports.getReferenceValue = getReferenceValue;
/***/ }),
/***/ 96871:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(38824), exports);
tslib_1.__exportStar(__nccwpck_require__(48830), exports);
/***/ }),
/***/ 45364:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toHex = exports.fromHex = void 0;
const SHORT_TO_HEX = {};
const HEX_TO_SHORT = {};
for (let i = 0; i < 256; i++) {
let encodedByte = i.toString(16).toLowerCase();
if (encodedByte.length === 1) {
encodedByte = `0${encodedByte}`;
}
SHORT_TO_HEX[i] = encodedByte;
HEX_TO_SHORT[encodedByte] = i;
}
function fromHex(encoded) {
if (encoded.length % 2 !== 0) {
throw new Error("Hex encoded strings must have an even number length");
}
const out = new Uint8Array(encoded.length / 2);
for (let i = 0; i < encoded.length; i += 2) {
const encodedByte = encoded.slice(i, i + 2).toLowerCase();
if (encodedByte in HEX_TO_SHORT) {
out[i / 2] = HEX_TO_SHORT[encodedByte];
}
else {
throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`);
}
}
return out;
}
exports.fromHex = fromHex;
function toHex(bytes) {
let out = "";
for (let i = 0; i < bytes.byteLength; i++) {
out += SHORT_TO_HEX[bytes[i]];
}
return out;
}
exports.toHex = toHex;
/***/ }),
/***/ 85730:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getSmithyContext = void 0;
const types_1 = __nccwpck_require__(55756);
const getSmithyContext = (context) => context[types_1.SMITHY_CONTEXT_KEY] || (context[types_1.SMITHY_CONTEXT_KEY] = {});
exports.getSmithyContext = getSmithyContext;
/***/ }),
/***/ 2390:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(85730), exports);
tslib_1.__exportStar(__nccwpck_require__(80149), exports);
/***/ }),
/***/ 80149:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.normalizeProvider = void 0;
const normalizeProvider = (input) => {
if (typeof input === "function")
return input;
const promisified = Promise.resolve(input);
return () => promisified;
};
exports.normalizeProvider = normalizeProvider;
/***/ }),
/***/ 65053:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.AdaptiveRetryStrategy = void 0;
const config_1 = __nccwpck_require__(93435);
const DefaultRateLimiter_1 = __nccwpck_require__(22234);
const StandardRetryStrategy_1 = __nccwpck_require__(48361);
class AdaptiveRetryStrategy {
constructor(maxAttemptsProvider, options) {
this.maxAttemptsProvider = maxAttemptsProvider;
this.mode = config_1.RETRY_MODES.ADAPTIVE;
const { rateLimiter } = options !== null && options !== void 0 ? options : {};
this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new DefaultRateLimiter_1.DefaultRateLimiter();
this.standardRetryStrategy = new StandardRetryStrategy_1.StandardRetryStrategy(maxAttemptsProvider);
}
async acquireInitialRetryToken(retryTokenScope) {
await this.rateLimiter.getSendToken();
return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope);
}
async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
this.rateLimiter.updateClientSendingRate(errorInfo);
return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
}
recordSuccess(token) {
this.rateLimiter.updateClientSendingRate({});
this.standardRetryStrategy.recordSuccess(token);
}
}
exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy;
/***/ }),
/***/ 25689:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.ConfiguredRetryStrategy = void 0;
const constants_1 = __nccwpck_require__(66302);
const StandardRetryStrategy_1 = __nccwpck_require__(48361);
class ConfiguredRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy {
constructor(maxAttempts, computeNextBackoffDelay = constants_1.DEFAULT_RETRY_DELAY_BASE) {
super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts);
if (typeof computeNextBackoffDelay === "number") {
this.computeNextBackoffDelay = () => computeNextBackoffDelay;
}
else {
this.computeNextBackoffDelay = computeNextBackoffDelay;
}
}
async refreshRetryTokenForRetry(tokenToRenew, errorInfo) {
const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo);
token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount());
return token;
}
}
exports.ConfiguredRetryStrategy = ConfiguredRetryStrategy;
/***/ }),
/***/ 22234:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.DefaultRateLimiter = void 0;
const service_error_classification_1 = __nccwpck_require__(6375);
class DefaultRateLimiter {
constructor(options) {
var _a, _b, _c, _d, _e;
this.currentCapacity = 0;
this.enabled = false;
this.lastMaxRate = 0;
this.measuredTxRate = 0;
this.requestCount = 0;
this.lastTimestamp = 0;
this.timeWindow = 0;
this.beta = (_a = options === null || options === void 0 ? void 0 : options.beta) !== null && _a !== void 0 ? _a : 0.7;
this.minCapacity = (_b = options === null || options === void 0 ? void 0 : options.minCapacity) !== null && _b !== void 0 ? _b : 1;
this.minFillRate = (_c = options === null || options === void 0 ? void 0 : options.minFillRate) !== null && _c !== void 0 ? _c : 0.5;
this.scaleConstant = (_d = options === null || options === void 0 ? void 0 : options.scaleConstant) !== null && _d !== void 0 ? _d : 0.4;
this.smooth = (_e = options === null || options === void 0 ? void 0 : options.smooth) !== null && _e !== void 0 ? _e : 0.8;
const currentTimeInSeconds = this.getCurrentTimeInSeconds();
this.lastThrottleTime = currentTimeInSeconds;
this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds());
this.fillRate = this.minFillRate;
this.maxCapacity = this.minCapacity;
}
getCurrentTimeInSeconds() {
return Date.now() / 1000;
}
async getSendToken() {
return this.acquireTokenBucket(1);
}
async acquireTokenBucket(amount) {
if (!this.enabled) {
return;
}
this.refillTokenBucket();
if (amount > this.currentCapacity) {
const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000;
await new Promise((resolve) => setTimeout(resolve, delay));
}
this.currentCapacity = this.currentCapacity - amount;
}
refillTokenBucket() {
const timestamp = this.getCurrentTimeInSeconds();
if (!this.lastTimestamp) {
this.lastTimestamp = timestamp;
return;
}
const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate;
this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount);
this.lastTimestamp = timestamp;
}
updateClientSendingRate(response) {
let calculatedRate;
this.updateMeasuredRate();
if ((0, service_error_classification_1.isThrottlingError)(response)) {
const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate);
this.lastMaxRate = rateToUse;
this.calculateTimeWindow();
this.lastThrottleTime = this.getCurrentTimeInSeconds();
calculatedRate = this.cubicThrottle(rateToUse);
this.enableTokenBucket();
}
else {
this.calculateTimeWindow();
calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds());
}
const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate);
this.updateTokenBucketRate(newRate);
}
calculateTimeWindow() {
this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3));
}
cubicThrottle(rateToUse) {
return this.getPrecise(rateToUse * this.beta);
}
cubicSuccess(timestamp) {
return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate);
}
enableTokenBucket() {
this.enabled = true;
}
updateTokenBucketRate(newRate) {
this.refillTokenBucket();
this.fillRate = Math.max(newRate, this.minFillRate);
this.maxCapacity = Math.max(newRate, this.minCapacity);
this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity);
}
updateMeasuredRate() {
const t = this.getCurrentTimeInSeconds();
const timeBucket = Math.floor(t * 2) / 2;
this.requestCount++;
if (timeBucket > this.lastTxRateBucket) {
const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket);
this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth));
this.requestCount = 0;
this.lastTxRateBucket = timeBucket;
}
}
getPrecise(num) {
return parseFloat(num.toFixed(8));
}
}
exports.DefaultRateLimiter = DefaultRateLimiter;
/***/ }),
/***/ 48361:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.StandardRetryStrategy = void 0;
const config_1 = __nccwpck_require__(93435);
const constants_1 = __nccwpck_require__(66302);
const defaultRetryBackoffStrategy_1 = __nccwpck_require__(21337);
const defaultRetryToken_1 = __nccwpck_require__(1127);
class StandardRetryStrategy {
constructor(maxAttempts) {
this.maxAttempts = maxAttempts;
this.mode = config_1.RETRY_MODES.STANDARD;
this.capacity = constants_1.INITIAL_RETRY_TOKENS;
this.retryBackoffStrategy = (0, defaultRetryBackoffStrategy_1.getDefaultRetryBackoffStrategy)();
this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts;
}
async acquireInitialRetryToken(retryTokenScope) {
return (0, defaultRetryToken_1.createDefaultRetryToken)({
retryDelay: constants_1.DEFAULT_RETRY_DELAY_BASE,
retryCount: 0,
});
}
async refreshRetryTokenForRetry(token, errorInfo) {
const maxAttempts = await this.getMaxAttempts();
if (this.shouldRetry(token, errorInfo, maxAttempts)) {
const errorType = errorInfo.errorType;
this.retryBackoffStrategy.setDelayBase(errorType === "THROTTLING" ? constants_1.THROTTLING_RETRY_DELAY_BASE : constants_1.DEFAULT_RETRY_DELAY_BASE);
const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount());
const retryDelay = errorInfo.retryAfterHint
? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType)
: delayFromErrorType;
const capacityCost = this.getCapacityCost(errorType);
this.capacity -= capacityCost;
return (0, defaultRetryToken_1.createDefaultRetryToken)({
retryDelay,
retryCount: token.getRetryCount() + 1,
retryCost: capacityCost,
});
}
throw new Error("No retry token available");
}
recordSuccess(token) {
var _a;
this.capacity = Math.max(constants_1.INITIAL_RETRY_TOKENS, this.capacity + ((_a = token.getRetryCost()) !== null && _a !== void 0 ? _a : constants_1.NO_RETRY_INCREMENT));
}
getCapacity() {
return this.capacity;
}
async getMaxAttempts() {
try {
return await this.maxAttemptsProvider();
}
catch (error) {
console.warn(`Max attempts provider could not resolve. Using default of ${config_1.DEFAULT_MAX_ATTEMPTS}`);
return config_1.DEFAULT_MAX_ATTEMPTS;
}
}
shouldRetry(tokenToRenew, errorInfo, maxAttempts) {
const attempts = tokenToRenew.getRetryCount() + 1;
return (attempts < maxAttempts &&
this.capacity >= this.getCapacityCost(errorInfo.errorType) &&
this.isRetryableError(errorInfo.errorType));
}
getCapacityCost(errorType) {
return errorType === "TRANSIENT" ? constants_1.TIMEOUT_RETRY_COST : constants_1.RETRY_COST;
}
isRetryableError(errorType) {
return errorType === "THROTTLING" || errorType === "TRANSIENT";
}
}
exports.StandardRetryStrategy = StandardRetryStrategy;
/***/ }),
/***/ 93435:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.DEFAULT_RETRY_MODE = exports.DEFAULT_MAX_ATTEMPTS = exports.RETRY_MODES = void 0;
var RETRY_MODES;
(function (RETRY_MODES) {
RETRY_MODES["STANDARD"] = "standard";
RETRY_MODES["ADAPTIVE"] = "adaptive";
})(RETRY_MODES = exports.RETRY_MODES || (exports.RETRY_MODES = {}));
exports.DEFAULT_MAX_ATTEMPTS = 3;
exports.DEFAULT_RETRY_MODE = RETRY_MODES.STANDARD;
/***/ }),
/***/ 66302:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.REQUEST_HEADER = exports.INVOCATION_ID_HEADER = exports.NO_RETRY_INCREMENT = exports.TIMEOUT_RETRY_COST = exports.RETRY_COST = exports.INITIAL_RETRY_TOKENS = exports.THROTTLING_RETRY_DELAY_BASE = exports.MAXIMUM_RETRY_DELAY = exports.DEFAULT_RETRY_DELAY_BASE = void 0;
exports.DEFAULT_RETRY_DELAY_BASE = 100;
exports.MAXIMUM_RETRY_DELAY = 20 * 1000;
exports.THROTTLING_RETRY_DELAY_BASE = 500;
exports.INITIAL_RETRY_TOKENS = 500;
exports.RETRY_COST = 5;
exports.TIMEOUT_RETRY_COST = 10;
exports.NO_RETRY_INCREMENT = 1;
exports.INVOCATION_ID_HEADER = "amz-sdk-invocation-id";
exports.REQUEST_HEADER = "amz-sdk-request";
/***/ }),
/***/ 21337:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getDefaultRetryBackoffStrategy = void 0;
const constants_1 = __nccwpck_require__(66302);
const getDefaultRetryBackoffStrategy = () => {
let delayBase = constants_1.DEFAULT_RETRY_DELAY_BASE;
const computeNextBackoffDelay = (attempts) => {
return Math.floor(Math.min(constants_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase));
};
const setDelayBase = (delay) => {
delayBase = delay;
};
return {
computeNextBackoffDelay,
setDelayBase,
};
};
exports.getDefaultRetryBackoffStrategy = getDefaultRetryBackoffStrategy;
/***/ }),
/***/ 1127:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.createDefaultRetryToken = void 0;
const constants_1 = __nccwpck_require__(66302);
const createDefaultRetryToken = ({ retryDelay, retryCount, retryCost, }) => {
const getRetryCount = () => retryCount;
const getRetryDelay = () => Math.min(constants_1.MAXIMUM_RETRY_DELAY, retryDelay);
const getRetryCost = () => retryCost;
return {
getRetryCount,
getRetryDelay,
getRetryCost,
};
};
exports.createDefaultRetryToken = createDefaultRetryToken;
/***/ }),
/***/ 84902:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(65053), exports);
tslib_1.__exportStar(__nccwpck_require__(25689), exports);
tslib_1.__exportStar(__nccwpck_require__(22234), exports);
tslib_1.__exportStar(__nccwpck_require__(48361), exports);
tslib_1.__exportStar(__nccwpck_require__(93435), exports);
tslib_1.__exportStar(__nccwpck_require__(66302), exports);
tslib_1.__exportStar(__nccwpck_require__(75427), exports);
/***/ }),
/***/ 75427:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
/***/ }),
/***/ 22094:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.Uint8ArrayBlobAdapter = void 0;
const transforms_1 = __nccwpck_require__(82098);
class Uint8ArrayBlobAdapter extends Uint8Array {
static fromString(source, encoding = "utf-8") {
switch (typeof source) {
case "string":
return (0, transforms_1.transformFromString)(source, encoding);
default:
throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`);
}
}
static mutate(source) {
Object.setPrototypeOf(source, Uint8ArrayBlobAdapter.prototype);
return source;
}
transformToString(encoding = "utf-8") {
return (0, transforms_1.transformToString)(this, encoding);
}
}
exports.Uint8ArrayBlobAdapter = Uint8ArrayBlobAdapter;
/***/ }),
/***/ 82098:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.transformFromString = exports.transformToString = void 0;
const util_base64_1 = __nccwpck_require__(75600);
const util_utf8_1 = __nccwpck_require__(41895);
const Uint8ArrayBlobAdapter_1 = __nccwpck_require__(22094);
function transformToString(payload, encoding = "utf-8") {
if (encoding === "base64") {
return (0, util_base64_1.toBase64)(payload);
}
return (0, util_utf8_1.toUtf8)(payload);
}
exports.transformToString = transformToString;
function transformFromString(str, encoding) {
if (encoding === "base64") {
return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_base64_1.fromBase64)(str));
}
return Uint8ArrayBlobAdapter_1.Uint8ArrayBlobAdapter.mutate((0, util_utf8_1.fromUtf8)(str));
}
exports.transformFromString = transformFromString;
/***/ }),
/***/ 23636:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.getAwsChunkedEncodingStream = void 0;
const stream_1 = __nccwpck_require__(12781);
const getAwsChunkedEncodingStream = (readableStream, options) => {
const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options;
const checksumRequired = base64Encoder !== undefined &&
checksumAlgorithmFn !== undefined &&
checksumLocationName !== undefined &&
streamHasher !== undefined;
const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined;
const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } });
readableStream.on("data", (data) => {
const length = bodyLengthChecker(data) || 0;
awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`);
awsChunkedEncodingStream.push(data);
awsChunkedEncodingStream.push("\r\n");
});
readableStream.on("end", async () => {
awsChunkedEncodingStream.push(`0\r\n`);
if (checksumRequired) {
const checksum = base64Encoder(await digest);
awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`);
awsChunkedEncodingStream.push(`\r\n`);
}
awsChunkedEncodingStream.push(null);
});
return awsChunkedEncodingStream;
};
exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream;
/***/ }),
/***/ 96607:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(22094), exports);
tslib_1.__exportStar(__nccwpck_require__(23636), exports);
tslib_1.__exportStar(__nccwpck_require__(4515), exports);
/***/ }),
/***/ 4515:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.sdkStreamMixin = void 0;
const node_http_handler_1 = __nccwpck_require__(20258);
const util_buffer_from_1 = __nccwpck_require__(31381);
const stream_1 = __nccwpck_require__(12781);
const util_1 = __nccwpck_require__(73837);
const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed.";
const sdkStreamMixin = (stream) => {
var _a, _b;
if (!(stream instanceof stream_1.Readable)) {
const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream;
throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`);
}
let transformed = false;
const transformToByteArray = async () => {
if (transformed) {
throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED);
}
transformed = true;
return await (0, node_http_handler_1.streamCollector)(stream);
};
return Object.assign(stream, {
transformToByteArray,
transformToString: async (encoding) => {
const buf = await transformToByteArray();
if (encoding === undefined || Buffer.isEncoding(encoding)) {
return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding);
}
else {
const decoder = new util_1.TextDecoder(encoding);
return decoder.decode(buf);
}
},
transformToWebStream: () => {
if (transformed) {
throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED);
}
if (stream.readableFlowing !== null) {
throw new Error("The stream has been consumed by other callbacks.");
}
if (typeof stream_1.Readable.toWeb !== "function") {
throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available.");
}
transformed = true;
return stream_1.Readable.toWeb(stream);
},
});
};
exports.sdkStreamMixin = sdkStreamMixin;
/***/ }),
/***/ 26174:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.escapeUriPath = void 0;
const escape_uri_1 = __nccwpck_require__(60010);
const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/");
exports.escapeUriPath = escapeUriPath;
/***/ }),
/***/ 60010:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.escapeUri = void 0;
const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode);
exports.escapeUri = escapeUri;
const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`;
/***/ }),
/***/ 54197:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(60010), exports);
tslib_1.__exportStar(__nccwpck_require__(26174), exports);
/***/ }),
/***/ 45917:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.fromUtf8 = void 0;
const util_buffer_from_1 = __nccwpck_require__(31381);
const fromUtf8 = (input) => {
const buf = (0, util_buffer_from_1.fromString)(input, "utf8");
return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT);
};
exports.fromUtf8 = fromUtf8;
/***/ }),
/***/ 41895:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
const tslib_1 = __nccwpck_require__(4351);
tslib_1.__exportStar(__nccwpck_require__(45917), exports);
tslib_1.__exportStar(__nccwpck_require__(95470), exports);
tslib_1.__exportStar(__nccwpck_require__(99960), exports);
/***/ }),
/***/ 95470:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toUint8Array = void 0;
const fromUtf8_1 = __nccwpck_require__(45917);
const toUint8Array = (data) => {
if (typeof data === "string") {
return (0, fromUtf8_1.fromUtf8)(data);
}
if (ArrayBuffer.isView(data)) {
return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT);
}
return new Uint8Array(data);
};
exports.toUint8Array = toUint8Array;
/***/ }),
/***/ 99960:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
exports.toUtf8 = void 0;
const util_buffer_from_1 = __nccwpck_require__(31381);
const toUtf8 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8");
exports.toUtf8 = toUtf8;
/***/ }),
/***/ 49690:
/***/ (function(module, __unused_webpack_exports, __nccwpck_require__) {
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
const events_1 = __nccwpck_require__(82361);
const debug_1 = __importDefault(__nccwpck_require__(38237));
const promisify_1 = __importDefault(__nccwpck_require__(66570));
const debug = debug_1.default('agent-base');
function isAgent(v) {
return Boolean(v) && typeof v.addRequest === 'function';
}
function isSecureEndpoint() {
const { stack } = new Error();
if (typeof stack !== 'string')
return false;
return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1);
}
function createAgent(callback, opts) {
return new createAgent.Agent(callback, opts);
}
(function (createAgent) {
/**
* Base `http.Agent` implementation.
* No pooling/keep-alive is implemented by default.
*
* @param {Function} callback
* @api public
*/
class Agent extends events_1.EventEmitter {
constructor(callback, _opts) {
super();
let opts = _opts;
if (typeof callback === 'function') {
this.callback = callback;
}
else if (callback) {
opts = callback;
}
// Timeout for the socket to be returned from the callback
this.timeout = null;
if (opts && typeof opts.timeout === 'number') {
this.timeout = opts.timeout;
}
// These aren't actually used by `agent-base`, but are required
// for the TypeScript definition files in `@types/node` :/
this.maxFreeSockets = 1;
this.maxSockets = 1;
this.maxTotalSockets = Infinity;
this.sockets = {};
this.freeSockets = {};
this.requests = {};
this.options = {};
}
get defaultPort() {
if (typeof this.explicitDefaultPort === 'number') {
return this.explicitDefaultPort;
}
return isSecureEndpoint() ? 443 : 80;
}
set defaultPort(v) {
this.explicitDefaultPort = v;
}
get protocol() {
if (typeof this.explicitProtocol === 'string') {
return this.explicitProtocol;
}
return isSecureEndpoint() ? 'https:' : 'http:';
}
set protocol(v) {
this.explicitProtocol = v;
}
callback(req, opts, fn) {
throw new Error('"agent-base" has no default implementation, you must subclass and override `callback()`');
}
/**
* Called by node-core's "_http_client.js" module when creating
* a new HTTP request with this Agent instance.
*
* @api public
*/
addRequest(req, _opts) {
const opts = Object.assign({}, _opts);
if (typeof opts.secureEndpoint !== 'boolean') {
opts.secureEndpoint = isSecureEndpoint();
}
if (opts.host == null) {
opts.host = 'localhost';
}
if (opts.port == null) {
opts.port = opts.secureEndpoint ? 443 : 80;
}
if (opts.protocol == null) {
opts.protocol = opts.secureEndpoint ? 'https:' : 'http:';
}
if (opts.host && opts.path) {
// If both a `host` and `path` are specified then it's most
// likely the result of a `url.parse()` call... we need to
// remove the `path` portion so that `net.connect()` doesn't
// attempt to open that as a unix socket file.
delete opts.path;
}
delete opts.agent;
delete opts.hostname;
delete opts._defaultAgent;
delete opts.defaultPort;
delete opts.createConnection;
// Hint to use "Connection: close"
// XXX: non-documented `http` module API :(
req._last = true;
req.shouldKeepAlive = false;
let timedOut = false;
let timeoutId = null;
const timeoutMs = opts.timeout || this.timeout;
const onerror = (err) => {
if (req._hadError)
return;
req.emit('error', err);
// For Safety. Some additional errors might fire later on
// and we need to make sure we don't double-fire the error event.
req._hadError = true;
};
const ontimeout = () => {
timeoutId = null;
timedOut = true;
const err = new Error(`A "socket" was not created for HTTP request before ${timeoutMs}ms`);
err.code = 'ETIMEOUT';
onerror(err);
};
const callbackError = (err) => {
if (timedOut)
return;
if (timeoutId !== null) {
clearTimeout(timeoutId);
timeoutId = null;
}
onerror(err);
};
const onsocket = (socket) => {
if (timedOut)
return;
if (timeoutId != null) {
clearTimeout(timeoutId);
timeoutId = null;
}
if (isAgent(socket)) {
// `socket` is actually an `http.Agent` instance, so
// relinquish responsibility for this `req` to the Agent
// from here on
debug('Callback returned another Agent instance %o', socket.constructor.name);
socket.addRequest(req, opts);
return;
}
if (socket) {
socket.once('free', () => {
this.freeSocket(socket, opts);
});
req.onSocket(socket);
return;
}
const err = new Error(`no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``);
onerror(err);
};
if (typeof this.callback !== 'function') {
onerror(new Error('`callback` is not defined'));
return;
}
if (!this.promisifiedCallback) {
if (this.callback.length >= 3) {
debug('Converting legacy callback function to promise');
this.promisifiedCallback = promisify_1.default(this.callback);
}
else {
this.promisifiedCallback = this.callback;
}
}
if (typeof timeoutMs === 'number' && timeoutMs > 0) {
timeoutId = setTimeout(ontimeout, timeoutMs);
}
if ('port' in opts && typeof opts.port !== 'number') {
opts.port = Number(opts.port);
}
try {
debug('Resolving socket for %o request: %o', opts.protocol, `${req.method} ${req.path}`);
Promise.resolve(this.promisifiedCallback(req, opts)).then(onsocket, callbackError);
}
catch (err) {
Promise.reject(err).catch(callbackError);
}
}
freeSocket(socket, opts) {
debug('Freeing socket %o %o', socket.constructor.name, opts);
socket.destroy();
}
destroy() {
debug('Destroying agent %o', this.constructor.name);
}
}
createAgent.Agent = Agent;
// So that `instanceof` works correctly
createAgent.prototype = createAgent.Agent.prototype;
})(createAgent || (createAgent = {}));
module.exports = createAgent;
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 66570:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({ value: true }));
function promisify(fn) {
return function (req, opts) {
return new Promise((resolve, reject) => {
fn.call(this, req, opts, (err, rtn) => {
if (err) {
reject(err);
}
else {
resolve(rtn);
}
});
});
};
}
exports["default"] = promisify;
//# sourceMappingURL=promisify.js.map
/***/ }),
/***/ 28222:
/***/ ((module, exports, __nccwpck_require__) => {
/* eslint-env browser */
/**
* This is the web browser implementation of `debug()`.
*/
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.storage = localstorage();
exports.destroy = (() => {
let warned = false;
return () => {
if (!warned) {
warned = true;
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
};
})();
/**
* Colors.
*/
exports.colors = [
'#0000CC',
'#0000FF',
'#0033CC',
'#0033FF',
'#0066CC',
'#0066FF',
'#0099CC',
'#0099FF',
'#00CC00',
'#00CC33',
'#00CC66',
'#00CC99',
'#00CCCC',
'#00CCFF',
'#3300CC',
'#3300FF',
'#3333CC',
'#3333FF',
'#3366CC',
'#3366FF',
'#3399CC',
'#3399FF',
'#33CC00',
'#33CC33',
'#33CC66',
'#33CC99',
'#33CCCC',
'#33CCFF',
'#6600CC',
'#6600FF',
'#6633CC',
'#6633FF',
'#66CC00',
'#66CC33',
'#9900CC',
'#9900FF',
'#9933CC',
'#9933FF',
'#99CC00',
'#99CC33',
'#CC0000',
'#CC0033',
'#CC0066',
'#CC0099',
'#CC00CC',
'#CC00FF',
'#CC3300',
'#CC3333',
'#CC3366',
'#CC3399',
'#CC33CC',
'#CC33FF',
'#CC6600',
'#CC6633',
'#CC9900',
'#CC9933',
'#CCCC00',
'#CCCC33',
'#FF0000',
'#FF0033',
'#FF0066',
'#FF0099',
'#FF00CC',
'#FF00FF',
'#FF3300',
'#FF3333',
'#FF3366',
'#FF3399',
'#FF33CC',
'#FF33FF',
'#FF6600',
'#FF6633',
'#FF9900',
'#FF9933',
'#FFCC00',
'#FFCC33'
];
/**
* Currently only WebKit-based Web Inspectors, Firefox >= v31,
* and the Firebug extension (any Firefox version) are known
* to support "%c" CSS customizations.
*
* TODO: add a `localStorage` variable to explicitly enable/disable colors
*/
// eslint-disable-next-line complexity
function useColors() {
// NB: In an Electron preload script, document will be defined but not fully
// initialized. Since we know we're in Chrome, we'll just detect this case
// explicitly
if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
return true;
}
// Internet Explorer and Edge do not support colors.
if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
return false;
}
// Is webkit? http://stackoverflow.com/a/16459606/376773
// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
// Is firebug? http://stackoverflow.com/a/398120/376773
(typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
// Is firefox >= v31?
// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
// Double check webkit in userAgent just in case we are in a worker
(typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
}
/**
* Colorize log arguments if enabled.
*
* @api public
*/
function formatArgs(args) {
args[0] = (this.useColors ? '%c' : '') +
this.namespace +
(this.useColors ? ' %c' : ' ') +
args[0] +
(this.useColors ? '%c ' : ' ') +
'+' + module.exports.humanize(this.diff);
if (!this.useColors) {
return;
}
const c = 'color: ' + this.color;
args.splice(1, 0, c, 'color: inherit');
// The final "%c" is somewhat tricky, because there could be other
// arguments passed either before or after the %c, so we need to
// figure out the correct index to insert the CSS into
let index = 0;
let lastC = 0;
args[0].replace(/%[a-zA-Z%]/g, match => {
if (match === '%%') {
return;
}
index++;
if (match === '%c') {
// We only are interested in the *last* %c
// (the user may have provided their own)
lastC = index;
}
});
args.splice(lastC, 0, c);
}
/**
* Invokes `console.debug()` when available.
* No-op when `console.debug` is not a "function".
* If `console.debug` is not available, falls back
* to `console.log`.
*
* @api public
*/
exports.log = console.debug || console.log || (() => {});
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
try {
if (namespaces) {
exports.storage.setItem('debug', namespaces);
} else {
exports.storage.removeItem('debug');
}
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
let r;
try {
r = exports.storage.getItem('debug');
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
if (!r && typeof process !== 'undefined' && 'env' in process) {
r = process.env.DEBUG;
}
return r;
}
/**
* Localstorage attempts to return the localstorage.
*
* This is necessary because safari throws
* when a user disables cookies/localstorage
* and you attempt to access it.
*
* @return {LocalStorage}
* @api private
*/
function localstorage() {
try {
// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
// The Browser also has localStorage in the global context.
return localStorage;
} catch (error) {
// Swallow
// XXX (@Qix-) should we be logging these?
}
}
module.exports = __nccwpck_require__(46243)(exports);
const {formatters} = module.exports;
/**
* Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
*/
formatters.j = function (v) {
try {
return JSON.stringify(v);
} catch (error) {
return '[UnexpectedJSONParseError]: ' + error.message;
}
};
/***/ }),
/***/ 46243:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
/**
* This is the common logic for both the Node.js and web browser
* implementations of `debug()`.
*/
function setup(env) {
createDebug.debug = createDebug;
createDebug.default = createDebug;
createDebug.coerce = coerce;
createDebug.disable = disable;
createDebug.enable = enable;
createDebug.enabled = enabled;
createDebug.humanize = __nccwpck_require__(80900);
createDebug.destroy = destroy;
Object.keys(env).forEach(key => {
createDebug[key] = env[key];
});
/**
* The currently active debug mode names, and names to skip.
*/
createDebug.names = [];
createDebug.skips = [];
/**
* Map of special "%n" handling functions, for the debug "format" argument.
*
* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
*/
createDebug.formatters = {};
/**
* Selects a color for a debug namespace
* @param {String} namespace The namespace string for the debug instance to be colored
* @return {Number|String} An ANSI color code for the given namespace
* @api private
*/
function selectColor(namespace) {
let hash = 0;
for (let i = 0; i < namespace.length; i++) {
hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
hash |= 0; // Convert to 32bit integer
}
return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
}
createDebug.selectColor = selectColor;
/**
* Create a debugger with the given `namespace`.
*
* @param {String} namespace
* @return {Function}
* @api public
*/
function createDebug(namespace) {
let prevTime;
let enableOverride = null;
let namespacesCache;
let enabledCache;
function debug(...args) {
// Disabled?
if (!debug.enabled) {
return;
}
const self = debug;
// Set `diff` timestamp
const curr = Number(new Date());
const ms = curr - (prevTime || curr);
self.diff = ms;
self.prev = prevTime;
self.curr = curr;
prevTime = curr;
args[0] = createDebug.coerce(args[0]);
if (typeof args[0] !== 'string') {
// Anything else let's inspect with %O
args.unshift('%O');
}
// Apply any `formatters` transformations
let index = 0;
args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => {
// If we encounter an escaped % then don't increase the array index
if (match === '%%') {
return '%';
}
index++;
const formatter = createDebug.formatters[format];
if (typeof formatter === 'function') {
const val = args[index];
match = formatter.call(self, val);
// Now we need to remove `args[index]` since it's inlined in the `format`
args.splice(index, 1);
index--;
}
return match;
});
// Apply env-specific formatting (colors, etc.)
createDebug.formatArgs.call(self, args);
const logFn = self.log || createDebug.log;
logFn.apply(self, args);
}
debug.namespace = namespace;
debug.useColors = createDebug.useColors();
debug.color = createDebug.selectColor(namespace);
debug.extend = extend;
debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
Object.defineProperty(debug, 'enabled', {
enumerable: true,
configurable: false,
get: () => {
if (enableOverride !== null) {
return enableOverride;
}
if (namespacesCache !== createDebug.namespaces) {
namespacesCache = createDebug.namespaces;
enabledCache = createDebug.enabled(namespace);
}
return enabledCache;
},
set: v => {
enableOverride = v;
}
});
// Env-specific initialization logic for debug instances
if (typeof createDebug.init === 'function') {
createDebug.init(debug);
}
return debug;
}
function extend(namespace, delimiter) {
const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
newDebug.log = this.log;
return newDebug;
}
/**
* Enables a debug mode by namespaces. This can include modes
* separated by a colon and wildcards.
*
* @param {String} namespaces
* @api public
*/
function enable(namespaces) {
createDebug.save(namespaces);
createDebug.namespaces = namespaces;
createDebug.names = [];
createDebug.skips = [];
let i;
const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
const len = split.length;
for (i = 0; i < len; i++) {
if (!split[i]) {
// ignore empty strings
continue;
}
namespaces = split[i].replace(/\*/g, '.*?');
if (namespaces[0] === '-') {
createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$'));
} else {
createDebug.names.push(new RegExp('^' + namespaces + '$'));
}
}
}
/**
* Disable debug output.
*
* @return {String} namespaces
* @api public
*/
function disable() {
const namespaces = [
...createDebug.names.map(toNamespace),
...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace)
].join(',');
createDebug.enable('');
return namespaces;
}
/**
* Returns true if the given mode name is enabled, false otherwise.
*
* @param {String} name
* @return {Boolean}
* @api public
*/
function enabled(name) {
if (name[name.length - 1] === '*') {
return true;
}
let i;
let len;
for (i = 0, len = createDebug.skips.length; i < len; i++) {
if (createDebug.skips[i].test(name)) {
return false;
}
}
for (i = 0, len = createDebug.names.length; i < len; i++) {
if (createDebug.names[i].test(name)) {
return true;
}
}
return false;
}
/**
* Convert regexp to namespace
*
* @param {RegExp} regxep
* @return {String} namespace
* @api private
*/
function toNamespace(regexp) {
return regexp.toString()
.substring(2, regexp.toString().length - 2)
.replace(/\.\*\?$/, '*');
}
/**
* Coerce `val`.
*
* @param {Mixed} val
* @return {Mixed}
* @api private
*/
function coerce(val) {
if (val instanceof Error) {
return val.stack || val.message;
}
return val;
}
/**
* XXX DO NOT USE. This is a temporary stub function.
* XXX It WILL be removed in the next major release.
*/
function destroy() {
console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.');
}
createDebug.enable(createDebug.load());
return createDebug;
}
module.exports = setup;
/***/ }),
/***/ 38237:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
/**
* Detect Electron renderer / nwjs process, which is node, but we should
* treat as a browser.
*/
if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
module.exports = __nccwpck_require__(28222);
} else {
module.exports = __nccwpck_require__(35332);
}
/***/ }),
/***/ 35332:
/***/ ((module, exports, __nccwpck_require__) => {
/**
* Module dependencies.
*/
const tty = __nccwpck_require__(76224);
const util = __nccwpck_require__(73837);
/**
* This is the Node.js implementation of `debug()`.
*/
exports.init = init;
exports.log = log;
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.destroy = util.deprecate(
() => {},
'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'
);
/**
* Colors.
*/
exports.colors = [6, 2, 3, 4, 5, 1];
try {
// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
// eslint-disable-next-line import/no-extraneous-dependencies
const supportsColor = __nccwpck_require__(59318);
if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
exports.colors = [
20,
21,
26,
27,
32,
33,
38,
39,
40,
41,
42,
43,
44,
45,
56,
57,
62,
63,
68,
69,
74,
75,
76,
77,
78,
79,
80,
81,
92,
93,
98,
99,
112,
113,
128,
129,
134,
135,
148,
149,
160,
161,
162,
163,
164,
165,
166,
167,
168,
169,
170,
171,
172,
173,
178,
179,
184,
185,
196,
197,
198,
199,
200,
201,
202,
203,
204,
205,
206,
207,
208,
209,
214,
215,
220,
221
];
}
} catch (error) {
// Swallow - we only care if `supports-color` is available; it doesn't have to be.
}
/**
* Build up the default `inspectOpts` object from the environment variables.
*
* $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
*/
exports.inspectOpts = Object.keys(process.env).filter(key => {
return /^debug_/i.test(key);
}).reduce((obj, key) => {
// Camel-case
const prop = key
.substring(6)
.toLowerCase()
.replace(/_([a-z])/g, (_, k) => {
return k.toUpperCase();
});
// Coerce string value into JS value
let val = process.env[key];
if (/^(yes|on|true|enabled)$/i.test(val)) {
val = true;
} else if (/^(no|off|false|disabled)$/i.test(val)) {
val = false;
} else if (val === 'null') {
val = null;
} else {
val = Number(val);
}
obj[prop] = val;
return obj;
}, {});
/**
* Is stdout a TTY? Colored output is enabled when `true`.
*/
function useColors() {
return 'colors' in exports.inspectOpts ?
Boolean(exports.inspectOpts.colors) :
tty.isatty(process.stderr.fd);
}
/**
* Adds ANSI color escape codes if enabled.
*
* @api public
*/
function formatArgs(args) {
const {namespace: name, useColors} = this;
if (useColors) {
const c = this.color;
const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c);
const prefix = ` ${colorCode};1m${name} \u001B[0m`;
args[0] = prefix + args[0].split('\n').join('\n' + prefix);
args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m');
} else {
args[0] = getDate() + name + ' ' + args[0];
}
}
function getDate() {
if (exports.inspectOpts.hideDate) {
return '';
}
return new Date().toISOString() + ' ';
}
/**
* Invokes `util.format()` with the specified arguments and writes to stderr.
*/
function log(...args) {
return process.stderr.write(util.format(...args) + '\n');
}
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
if (namespaces) {
process.env.DEBUG = namespaces;
} else {
// If you set a process.env field to null or undefined, it gets cast to the
// string 'null' or 'undefined'. Just delete instead.
delete process.env.DEBUG;
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
return process.env.DEBUG;
}
/**
* Init logic for `debug` instances.
*
* Create a new `inspectOpts` object in case `useColors` is set
* differently for a particular `debug` instance.
*/
function init(debug) {
debug.inspectOpts = {};
const keys = Object.keys(exports.inspectOpts);
for (let i = 0; i < keys.length; i++) {
debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
}
}
module.exports = __nccwpck_require__(46243)(exports);
const {formatters} = module.exports;
/**
* Map %o to `util.inspect()`, all on a single line.
*/
formatters.o = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts)
.split('\n')
.map(str => str.trim())
.join(' ');
};
/**
* Map %O to `util.inspect()`, allowing multiple lines if needed.
*/
formatters.O = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts);
};
/***/ }),
/***/ 12603:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
"use strict";
const validator = __nccwpck_require__(61739);
const XMLParser = __nccwpck_require__(42380);
const XMLBuilder = __nccwpck_require__(80660);
module.exports = {
XMLParser: XMLParser,
XMLValidator: validator,
XMLBuilder: XMLBuilder
}
/***/ }),
/***/ 38280:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
const nameStartChar = ':A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD';
const nameChar = nameStartChar + '\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040';
const nameRegexp = '[' + nameStartChar + '][' + nameChar + ']*'
const regexName = new RegExp('^' + nameRegexp + '$');
const getAllMatches = function(string, regex) {
const matches = [];
let match = regex.exec(string);
while (match) {
const allmatches = [];
allmatches.startIndex = regex.lastIndex - match[0].length;
const len = match.length;
for (let index = 0; index < len; index++) {
allmatches.push(match[index]);
}
matches.push(allmatches);
match = regex.exec(string);
}
return matches;
};
const isName = function(string) {
const match = regexName.exec(string);
return !(match === null || typeof match === 'undefined');
};
exports.isExist = function(v) {
return typeof v !== 'undefined';
};
exports.isEmptyObject = function(obj) {
return Object.keys(obj).length === 0;
};
/**
* Copy all the properties of a into b.
* @param {*} target
* @param {*} a
*/
exports.merge = function(target, a, arrayMode) {
if (a) {
const keys = Object.keys(a); // will return an array of own properties
const len = keys.length; //don't make it inline
for (let i = 0; i < len; i++) {
if (arrayMode === 'strict') {
target[keys[i]] = [ a[keys[i]] ];
} else {
target[keys[i]] = a[keys[i]];
}
}
}
};
/* exports.merge =function (b,a){
return Object.assign(b,a);
} */
exports.getValue = function(v) {
if (exports.isExist(v)) {
return v;
} else {
return '';
}
};
// const fakeCall = function(a) {return a;};
// const fakeCallNoReturn = function() {};
exports.isName = isName;
exports.getAllMatches = getAllMatches;
exports.nameRegexp = nameRegexp;
/***/ }),
/***/ 61739:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
const util = __nccwpck_require__(38280);
const defaultOptions = {
allowBooleanAttributes: false, //A tag can have attributes without any value
unpairedTags: []
};
//const tagsPattern = new RegExp("<\\/?([\\w:\\-_\.]+)\\s*\/?>","g");
exports.validate = function (xmlData, options) {
options = Object.assign({}, defaultOptions, options);
//xmlData = xmlData.replace(/(\r\n|\n|\r)/gm,"");//make it single line
//xmlData = xmlData.replace(/(^\s*<\?xml.*?\?>)/g,"");//Remove XML starting tag
//xmlData = xmlData.replace(/(<!DOCTYPE[\s\w\"\.\/\-\:]+(\[.*\])*\s*>)/g,"");//Remove DOCTYPE
const tags = [];
let tagFound = false;
//indicates that the root tag has been closed (aka. depth 0 has been reached)
let reachedRoot = false;
if (xmlData[0] === '\ufeff') {
// check for byte order mark (BOM)
xmlData = xmlData.substr(1);
}
for (let i = 0; i < xmlData.length; i++) {
if (xmlData[i] === '<' && xmlData[i+1] === '?') {
i+=2;
i = readPI(xmlData,i);
if (i.err) return i;
}else if (xmlData[i] === '<') {
//starting of tag
//read until you reach to '>' avoiding any '>' in attribute value
let tagStartPos = i;
i++;
if (xmlData[i] === '!') {
i = readCommentAndCDATA(xmlData, i);
continue;
} else {
let closingTag = false;
if (xmlData[i] === '/') {
//closing tag
closingTag = true;
i++;
}
//read tagname
let tagName = '';
for (; i < xmlData.length &&
xmlData[i] !== '>' &&
xmlData[i] !== ' ' &&
xmlData[i] !== '\t' &&
xmlData[i] !== '\n' &&
xmlData[i] !== '\r'; i++
) {
tagName += xmlData[i];
}
tagName = tagName.trim();
//console.log(tagName);
if (tagName[tagName.length - 1] === '/') {
//self closing tag without attributes
tagName = tagName.substring(0, tagName.length - 1);
//continue;
i--;
}
if (!validateTagName(tagName)) {
let msg;
if (tagName.trim().length === 0) {
msg = "Invalid space after '<'.";
} else {
msg = "Tag '"+tagName+"' is an invalid name.";
}
return getErrorObject('InvalidTag', msg, getLineNumberForPosition(xmlData, i));
}
const result = readAttributeStr(xmlData, i);
if (result === false) {
return getErrorObject('InvalidAttr', "Attributes for '"+tagName+"' have open quote.", getLineNumberForPosition(xmlData, i));
}
let attrStr = result.value;
i = result.index;
if (attrStr[attrStr.length - 1] === '/') {
//self closing tag
const attrStrStart = i - attrStr.length;
attrStr = attrStr.substring(0, attrStr.length - 1);
const isValid = validateAttributeString(attrStr, options);
if (isValid === true) {
tagFound = true;
//continue; //text may presents after self closing tag
} else {
//the result from the nested function returns the position of the error within the attribute
//in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute
//this gives us the absolute index in the entire xml, which we can use to find the line at last
return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line));
}
} else if (closingTag) {
if (!result.tagClosed) {
return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' doesn't have proper closing.", getLineNumberForPosition(xmlData, i));
} else if (attrStr.trim().length > 0) {
return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos));
} else {
const otg = tags.pop();
if (tagName !== otg.tagName) {
let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos);
return getErrorObject('InvalidTag',
"Expected closing tag '"+otg.tagName+"' (opened in line "+openPos.line+", col "+openPos.col+") instead of closing tag '"+tagName+"'.",
getLineNumberForPosition(xmlData, tagStartPos));
}
//when there are no more tags, we reached the root level.
if (tags.length == 0) {
reachedRoot = true;
}
}
} else {
const isValid = validateAttributeString(attrStr, options);
if (isValid !== true) {
//the result from the nested function returns the position of the error within the attribute
//in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute
//this gives us the absolute index in the entire xml, which we can use to find the line at last
return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line));
}
//if the root level has been reached before ...
if (reachedRoot === true) {
return getErrorObject('InvalidXml', 'Multiple possible root nodes found.', getLineNumberForPosition(xmlData, i));
} else if(options.unpairedTags.indexOf(tagName) !== -1){
//don't push into stack
} else {
tags.push({tagName, tagStartPos});
}
tagFound = true;
}
//skip tag text value
//It may include comments and CDATA value
for (i++; i < xmlData.length; i++) {
if (xmlData[i] === '<') {
if (xmlData[i + 1] === '!') {
//comment or CADATA
i++;
i = readCommentAndCDATA(xmlData, i);
continue;
} else if (xmlData[i+1] === '?') {
i = readPI(xmlData, ++i);
if (i.err) return i;
} else{
break;
}
} else if (xmlData[i] === '&') {
const afterAmp = validateAmpersand(xmlData, i);
if (afterAmp == -1)
return getErrorObject('InvalidChar', "char '&' is not expected.", getLineNumberForPosition(xmlData, i));
i = afterAmp;
}else{
if (reachedRoot === true && !isWhiteSpace(xmlData[i])) {
return getErrorObject('InvalidXml', "Extra text at the end", getLineNumberForPosition(xmlData, i));
}
}
} //end of reading tag text value
if (xmlData[i] === '<') {
i--;
}
}
} else {
if ( isWhiteSpace(xmlData[i])) {
continue;
}
return getErrorObject('InvalidChar', "char '"+xmlData[i]+"' is not expected.", getLineNumberForPosition(xmlData, i));
}
}
if (!tagFound) {
return getErrorObject('InvalidXml', 'Start tag expected.', 1);
}else if (tags.length == 1) {
return getErrorObject('InvalidTag', "Unclosed tag '"+tags[0].tagName+"'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos));
}else if (tags.length > 0) {
return getErrorObject('InvalidXml', "Invalid '"+
JSON.stringify(tags.map(t => t.tagName), null, 4).replace(/\r?\n/g, '')+
"' found.", {line: 1, col: 1});
}
return true;
};
function isWhiteSpace(char){
return char === ' ' || char === '\t' || char === '\n' || char === '\r';
}
/**
* Read Processing insstructions and skip
* @param {*} xmlData
* @param {*} i
*/
function readPI(xmlData, i) {
const start = i;
for (; i < xmlData.length; i++) {
if (xmlData[i] == '?' || xmlData[i] == ' ') {
//tagname
const tagname = xmlData.substr(start, i - start);
if (i > 5 && tagname === 'xml') {
return getErrorObject('InvalidXml', 'XML declaration allowed only at the start of the document.', getLineNumberForPosition(xmlData, i));
} else if (xmlData[i] == '?' && xmlData[i + 1] == '>') {
//check if valid attribut string
i++;
break;
} else {
continue;
}
}
}
return i;
}
function readCommentAndCDATA(xmlData, i) {
if (xmlData.length > i + 5 && xmlData[i + 1] === '-' && xmlData[i + 2] === '-') {
//comment
for (i += 3; i < xmlData.length; i++) {
if (xmlData[i] === '-' && xmlData[i + 1] === '-' && xmlData[i + 2] === '>') {
i += 2;
break;
}
}
} else if (
xmlData.length > i + 8 &&
xmlData[i + 1] === 'D' &&
xmlData[i + 2] === 'O' &&
xmlData[i + 3] === 'C' &&
xmlData[i + 4] === 'T' &&
xmlData[i + 5] === 'Y' &&
xmlData[i + 6] === 'P' &&
xmlData[i + 7] === 'E'
) {
let angleBracketsCount = 1;
for (i += 8; i < xmlData.length; i++) {
if (xmlData[i] === '<') {
angleBracketsCount++;
} else if (xmlData[i] === '>') {
angleBracketsCount--;
if (angleBracketsCount === 0) {
break;
}
}
}
} else if (
xmlData.length > i + 9 &&
xmlData[i + 1] === '[' &&
xmlData[i + 2] === 'C' &&
xmlData[i + 3] === 'D' &&
xmlData[i + 4] === 'A' &&
xmlData[i + 5] === 'T' &&
xmlData[i + 6] === 'A' &&
xmlData[i + 7] === '['
) {
for (i += 8; i < xmlData.length; i++) {
if (xmlData[i] === ']' && xmlData[i + 1] === ']' && xmlData[i + 2] === '>') {
i += 2;
break;
}
}
}
return i;
}
const doubleQuote = '"';
const singleQuote = "'";
/**
* Keep reading xmlData until '<' is found outside the attribute value.
* @param {string} xmlData
* @param {number} i
*/
function readAttributeStr(xmlData, i) {
let attrStr = '';
let startChar = '';
let tagClosed = false;
for (; i < xmlData.length; i++) {
if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) {
if (startChar === '') {
startChar = xmlData[i];
} else if (startChar !== xmlData[i]) {
//if vaue is enclosed with double quote then single quotes are allowed inside the value and vice versa
} else {
startChar = '';
}
} else if (xmlData[i] === '>') {
if (startChar === '') {
tagClosed = true;
break;
}
}
attrStr += xmlData[i];
}
if (startChar !== '') {
return false;
}
return {
value: attrStr,
index: i,
tagClosed: tagClosed
};
}
/**
* Select all the attributes whether valid or invalid.
*/
const validAttrStrRegxp = new RegExp('(\\s*)([^\\s=]+)(\\s*=)?(\\s*([\'"])(([\\s\\S])*?)\\5)?', 'g');
//attr, ="sd", a="amit's", a="sd"b="saf", ab cd=""
function validateAttributeString(attrStr, options) {
//console.log("start:"+attrStr+":end");
//if(attrStr.trim().length === 0) return true; //empty string
const matches = util.getAllMatches(attrStr, validAttrStrRegxp);
const attrNames = {};
for (let i = 0; i < matches.length; i++) {
if (matches[i][1].length === 0) {
//nospace before attribute name: a="sd"b="saf"
return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' has no space in starting.", getPositionFromMatch(matches[i]))
} else if (matches[i][3] !== undefined && matches[i][4] === undefined) {
return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' is without value.", getPositionFromMatch(matches[i]));
} else if (matches[i][3] === undefined && !options.allowBooleanAttributes) {
//independent attribute: ab
return getErrorObject('InvalidAttr', "boolean attribute '"+matches[i][2]+"' is not allowed.", getPositionFromMatch(matches[i]));
}
/* else if(matches[i][6] === undefined){//attribute without value: ab=
return { err: { code:"InvalidAttr",msg:"attribute " + matches[i][2] + " has no value assigned."}};
} */
const attrName = matches[i][2];
if (!validateAttrName(attrName)) {
return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is an invalid name.", getPositionFromMatch(matches[i]));
}
if (!attrNames.hasOwnProperty(attrName)) {
//check for duplicate attribute.
attrNames[attrName] = 1;
} else {
return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is repeated.", getPositionFromMatch(matches[i]));
}
}
return true;
}
function validateNumberAmpersand(xmlData, i) {
let re = /\d/;
if (xmlData[i] === 'x') {
i++;
re = /[\da-fA-F]/;
}
for (; i < xmlData.length; i++) {
if (xmlData[i] === ';')
return i;
if (!xmlData[i].match(re))
break;
}
return -1;
}
function validateAmpersand(xmlData, i) {
// https://www.w3.org/TR/xml/#dt-charref
i++;
if (xmlData[i] === ';')
return -1;
if (xmlData[i] === '#') {
i++;
return validateNumberAmpersand(xmlData, i);
}
let count = 0;
for (; i < xmlData.length; i++, count++) {
if (xmlData[i].match(/\w/) && count < 20)
continue;
if (xmlData[i] === ';')
break;
return -1;
}
return i;
}
function getErrorObject(code, message, lineNumber) {
return {
err: {
code: code,
msg: message,
line: lineNumber.line || lineNumber,
col: lineNumber.col,
},
};
}
function validateAttrName(attrName) {
return util.isName(attrName);
}
// const startsWithXML = /^xml/i;
function validateTagName(tagname) {
return util.isName(tagname) /* && !tagname.match(startsWithXML) */;
}
//this function returns the line number for the character at the given index
function getLineNumberForPosition(xmlData, index) {
const lines = xmlData.substring(0, index).split(/\r?\n/);
return {
line: lines.length,
// column number is last line's length + 1, because column numbering starts at 1:
col: lines[lines.length - 1].length + 1
};
}
//this function returns the position of the first character of match within attrStr
function getPositionFromMatch(match) {
return match.startIndex + match[1].length;
}
/***/ }),
/***/ 80660:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
"use strict";
//parse Empty Node as self closing node
const buildFromOrderedJs = __nccwpck_require__(72462);
const defaultOptions = {
attributeNamePrefix: '@_',
attributesGroupName: false,
textNodeName: '#text',
ignoreAttributes: true,
cdataPropName: false,
format: false,
indentBy: ' ',
suppressEmptyNode: false,
suppressUnpairedNode: true,
suppressBooleanAttributes: true,
tagValueProcessor: function(key, a) {
return a;
},
attributeValueProcessor: function(attrName, a) {
return a;
},
preserveOrder: false,
commentPropName: false,
unpairedTags: [],
entities: [
{ regex: new RegExp("&", "g"), val: "&amp;" },//it must be on top
{ regex: new RegExp(">", "g"), val: "&gt;" },
{ regex: new RegExp("<", "g"), val: "&lt;" },
{ regex: new RegExp("\'", "g"), val: "&apos;" },
{ regex: new RegExp("\"", "g"), val: "&quot;" }
],
processEntities: true,
stopNodes: [],
// transformTagName: false,
// transformAttributeName: false,
oneListGroup: false
};
function Builder(options) {
this.options = Object.assign({}, defaultOptions, options);
if (this.options.ignoreAttributes || this.options.attributesGroupName) {
this.isAttribute = function(/*a*/) {
return false;
};
} else {
this.attrPrefixLen = this.options.attributeNamePrefix.length;
this.isAttribute = isAttribute;
}
this.processTextOrObjNode = processTextOrObjNode
if (this.options.format) {
this.indentate = indentate;
this.tagEndChar = '>\n';
this.newLine = '\n';
} else {
this.indentate = function() {
return '';
};
this.tagEndChar = '>';
this.newLine = '';
}
}
Builder.prototype.build = function(jObj) {
if(this.options.preserveOrder){
return buildFromOrderedJs(jObj, this.options);
}else {
if(Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1){
jObj = {
[this.options.arrayNodeName] : jObj
}
}
return this.j2x(jObj, 0).val;
}
};
Builder.prototype.j2x = function(jObj, level) {
let attrStr = '';
let val = '';
for (let key in jObj) {
if (typeof jObj[key] === 'undefined') {
// supress undefined node
} else if (jObj[key] === null) {
if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar;
else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;
// val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;
} else if (jObj[key] instanceof Date) {
val += this.buildTextValNode(jObj[key], key, '', level);
} else if (typeof jObj[key] !== 'object') {
//premitive type
const attr = this.isAttribute(key);
if (attr) {
attrStr += this.buildAttrPairStr(attr, '' + jObj[key]);
}else {
//tag value
if (key === this.options.textNodeName) {
let newval = this.options.tagValueProcessor(key, '' + jObj[key]);
val += this.replaceEntitiesValue(newval);
} else {
val += this.buildTextValNode(jObj[key], key, '', level);
}
}
} else if (Array.isArray(jObj[key])) {
//repeated nodes
const arrLen = jObj[key].length;
let listTagVal = "";
for (let j = 0; j < arrLen; j++) {
const item = jObj[key][j];
if (typeof item === 'undefined') {
// supress undefined node
} else if (item === null) {
if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar;
else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;
// val += this.indentate(level) + '<' + key + '/' + this.tagEndChar;
} else if (typeof item === 'object') {
if(this.options.oneListGroup ){
listTagVal += this.j2x(item, level + 1).val;
}else{
listTagVal += this.processTextOrObjNode(item, key, level)
}
} else {
listTagVal += this.buildTextValNode(item, key, '', level);
}
}
if(this.options.oneListGroup){
listTagVal = this.buildObjectNode(listTagVal, key, '', level);
}
val += listTagVal;
} else {
//nested node
if (this.options.attributesGroupName && key === this.options.attributesGroupName) {
const Ks = Object.keys(jObj[key]);
const L = Ks.length;
for (let j = 0; j < L; j++) {
attrStr += this.buildAttrPairStr(Ks[j], '' + jObj[key][Ks[j]]);
}
} else {
val += this.processTextOrObjNode(jObj[key], key, level)
}
}
}
return {attrStr: attrStr, val: val};
};
Builder.prototype.buildAttrPairStr = function(attrName, val){
val = this.options.attributeValueProcessor(attrName, '' + val);
val = this.replaceEntitiesValue(val);
if (this.options.suppressBooleanAttributes && val === "true") {
return ' ' + attrName;
} else return ' ' + attrName + '="' + val + '"';
}
function processTextOrObjNode (object, key, level) {
const result = this.j2x(object, level + 1);
if (object[this.options.textNodeName] !== undefined && Object.keys(object).length === 1) {
return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level);
} else {
return this.buildObjectNode(result.val, key, result.attrStr, level);
}
}
Builder.prototype.buildObjectNode = function(val, key, attrStr, level) {
if(val === ""){
if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar;
else {
return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar;
}
}else{
let tagEndExp = '</' + key + this.tagEndChar;
let piClosingChar = "";
if(key[0] === "?") {
piClosingChar = "?";
tagEndExp = "";
}
if (attrStr && val.indexOf('<') === -1) {
return ( this.indentate(level) + '<' + key + attrStr + piClosingChar + '>' + val + tagEndExp );
} else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) {
return this.indentate(level) + `<!--${val}-->` + this.newLine;
}else {
return (
this.indentate(level) + '<' + key + attrStr + piClosingChar + this.tagEndChar +
val +
this.indentate(level) + tagEndExp );
}
}
}
Builder.prototype.closeTag = function(key){
let closeTag = "";
if(this.options.unpairedTags.indexOf(key) !== -1){ //unpaired
if(!this.options.suppressUnpairedNode) closeTag = "/"
}else if(this.options.suppressEmptyNode){ //empty
closeTag = "/";
}else{
closeTag = `></${key}`
}
return closeTag;
}
function buildEmptyObjNode(val, key, attrStr, level) {
if (val !== '') {
return this.buildObjectNode(val, key, attrStr, level);
} else {
if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar;
else {
return this.indentate(level) + '<' + key + attrStr + '/' + this.tagEndChar;
// return this.buildTagStr(level,key, attrStr);
}
}
}
Builder.prototype.buildTextValNode = function(val, key, attrStr, level) {
if (this.options.cdataPropName !== false && key === this.options.cdataPropName) {
return this.indentate(level) + `<![CDATA[${val}]]>` + this.newLine;
}else if (this.options.commentPropName !== false && key === this.options.commentPropName) {
return this.indentate(level) + `<!--${val}-->` + this.newLine;
}else if(key[0] === "?") {//PI tag
return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar;
}else{
let textValue = this.options.tagValueProcessor(key, val);
textValue = this.replaceEntitiesValue(textValue);
if( textValue === ''){
return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar;
}else{
return this.indentate(level) + '<' + key + attrStr + '>' +
textValue +
'</' + key + this.tagEndChar;
}
}
}
Builder.prototype.replaceEntitiesValue = function(textValue){
if(textValue && textValue.length > 0 && this.options.processEntities){
for (let i=0; i<this.options.entities.length; i++) {
const entity = this.options.entities[i];
textValue = textValue.replace(entity.regex, entity.val);
}
}
return textValue;
}
function indentate(level) {
return this.options.indentBy.repeat(level);
}
function isAttribute(name /*, options*/) {
if (name.startsWith(this.options.attributeNamePrefix)) {
return name.substr(this.attrPrefixLen);
} else {
return false;
}
}
module.exports = Builder;
/***/ }),
/***/ 72462:
/***/ ((module) => {
const EOL = "\n";
/**
*
* @param {array} jArray
* @param {any} options
* @returns
*/
function toXml(jArray, options) {
let indentation = "";
if (options.format && options.indentBy.length > 0) {
indentation = EOL;
}
return arrToStr(jArray, options, "", indentation);
}
function arrToStr(arr, options, jPath, indentation) {
let xmlStr = "";
let isPreviousElementTag = false;
for (let i = 0; i < arr.length; i++) {
const tagObj = arr[i];
const tagName = propName(tagObj);
let newJPath = "";
if (jPath.length === 0) newJPath = tagName
else newJPath = `${jPath}.${tagName}`;
if (tagName === options.textNodeName) {
let tagText = tagObj[tagName];
if (!isStopNode(newJPath, options)) {
tagText = options.tagValueProcessor(tagName, tagText);
tagText = replaceEntitiesValue(tagText, options);
}
if (isPreviousElementTag) {
xmlStr += indentation;
}
xmlStr += tagText;
isPreviousElementTag = false;
continue;
} else if (tagName === options.cdataPropName) {
if (isPreviousElementTag) {
xmlStr += indentation;
}
xmlStr += `<![CDATA[${tagObj[tagName][0][options.textNodeName]}]]>`;
isPreviousElementTag = false;
continue;
} else if (tagName === options.commentPropName) {
xmlStr += indentation + `<!--${tagObj[tagName][0][options.textNodeName]}-->`;
isPreviousElementTag = true;
continue;
} else if (tagName[0] === "?") {
const attStr = attr_to_str(tagObj[":@"], options);
const tempInd = tagName === "?xml" ? "" : indentation;
let piTextNodeName = tagObj[tagName][0][options.textNodeName];
piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; //remove extra spacing
xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr}?>`;
isPreviousElementTag = true;
continue;
}
let newIdentation = indentation;
if (newIdentation !== "") {
newIdentation += options.indentBy;
}
const attStr = attr_to_str(tagObj[":@"], options);
const tagStart = indentation + `<${tagName}${attStr}`;
const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation);
if (options.unpairedTags.indexOf(tagName) !== -1) {
if (options.suppressUnpairedNode) xmlStr += tagStart + ">";
else xmlStr += tagStart + "/>";
} else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) {
xmlStr += tagStart + "/>";
} else if (tagValue && tagValue.endsWith(">")) {
xmlStr += tagStart + `>${tagValue}${indentation}</${tagName}>`;
} else {
xmlStr += tagStart + ">";
if (tagValue && indentation !== "" && (tagValue.includes("/>") || tagValue.includes("</"))) {
xmlStr += indentation + options.indentBy + tagValue + indentation;
} else {
xmlStr += tagValue;
}
xmlStr += `</${tagName}>`;
}
isPreviousElementTag = true;
}
return xmlStr;
}
function propName(obj) {
const keys = Object.keys(obj);
for (let i = 0; i < keys.length; i++) {
const key = keys[i];
if (key !== ":@") return key;
}
}
function attr_to_str(attrMap, options) {
let attrStr = "";
if (attrMap && !options.ignoreAttributes) {
for (let attr in attrMap) {
let attrVal = options.attributeValueProcessor(attr, attrMap[attr]);
attrVal = replaceEntitiesValue(attrVal, options);
if (attrVal === true && options.suppressBooleanAttributes) {
attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`;
} else {
attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`;
}
}
}
return attrStr;
}
function isStopNode(jPath, options) {
jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1);
let tagName = jPath.substr(jPath.lastIndexOf(".") + 1);
for (let index in options.stopNodes) {
if (options.stopNodes[index] === jPath || options.stopNodes[index] === "*." + tagName) return true;
}
return false;
}
function replaceEntitiesValue(textValue, options) {
if (textValue && textValue.length > 0 && options.processEntities) {
for (let i = 0; i < options.entities.length; i++) {
const entity = options.entities[i];
textValue = textValue.replace(entity.regex, entity.val);
}
}
return textValue;
}
module.exports = toXml;
/***/ }),
/***/ 6072:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
const util = __nccwpck_require__(38280);
//TODO: handle comments
function readDocType(xmlData, i){
const entities = {};
if( xmlData[i + 3] === 'O' &&
xmlData[i + 4] === 'C' &&
xmlData[i + 5] === 'T' &&
xmlData[i + 6] === 'Y' &&
xmlData[i + 7] === 'P' &&
xmlData[i + 8] === 'E')
{
i = i+9;
let angleBracketsCount = 1;
let hasBody = false, comment = false;
let exp = "";
for(;i<xmlData.length;i++){
if (xmlData[i] === '<' && !comment) { //Determine the tag type
if( hasBody && isEntity(xmlData, i)){
i += 7;
[entityName, val,i] = readEntityExp(xmlData,i+1);
if(val.indexOf("&") === -1) //Parameter entities are not supported
entities[ validateEntityName(entityName) ] = {
regx : RegExp( `&${entityName};`,"g"),
val: val
};
}
else if( hasBody && isElement(xmlData, i)) i += 8;//Not supported
else if( hasBody && isAttlist(xmlData, i)) i += 8;//Not supported
else if( hasBody && isNotation(xmlData, i)) i += 9;//Not supported
else if( isComment) comment = true;
else throw new Error("Invalid DOCTYPE");
angleBracketsCount++;
exp = "";
} else if (xmlData[i] === '>') { //Read tag content
if(comment){
if( xmlData[i - 1] === "-" && xmlData[i - 2] === "-"){
comment = false;
angleBracketsCount--;
}
}else{
angleBracketsCount--;
}
if (angleBracketsCount === 0) {
break;
}
}else if( xmlData[i] === '['){
hasBody = true;
}else{
exp += xmlData[i];
}
}
if(angleBracketsCount !== 0){
throw new Error(`Unclosed DOCTYPE`);
}
}else{
throw new Error(`Invalid Tag instead of DOCTYPE`);
}
return {entities, i};
}
function readEntityExp(xmlData,i){
//External entities are not supported
// <!ENTITY ext SYSTEM "http://normal-website.com" >
//Parameter entities are not supported
// <!ENTITY entityname "&anotherElement;">
//Internal entities are supported
// <!ENTITY entityname "replacement text">
//read EntityName
let entityName = "";
for (; i < xmlData.length && (xmlData[i] !== "'" && xmlData[i] !== '"' ); i++) {
// if(xmlData[i] === " ") continue;
// else
entityName += xmlData[i];
}
entityName = entityName.trim();
if(entityName.indexOf(" ") !== -1) throw new Error("External entites are not supported");
//read Entity Value
const startChar = xmlData[i++];
let val = ""
for (; i < xmlData.length && xmlData[i] !== startChar ; i++) {
val += xmlData[i];
}
return [entityName, val, i];
}
function isComment(xmlData, i){
if(xmlData[i+1] === '!' &&
xmlData[i+2] === '-' &&
xmlData[i+3] === '-') return true
return false
}
function isEntity(xmlData, i){
if(xmlData[i+1] === '!' &&
xmlData[i+2] === 'E' &&
xmlData[i+3] === 'N' &&
xmlData[i+4] === 'T' &&
xmlData[i+5] === 'I' &&
xmlData[i+6] === 'T' &&
xmlData[i+7] === 'Y') return true
return false
}
function isElement(xmlData, i){
if(xmlData[i+1] === '!' &&
xmlData[i+2] === 'E' &&
xmlData[i+3] === 'L' &&
xmlData[i+4] === 'E' &&
xmlData[i+5] === 'M' &&
xmlData[i+6] === 'E' &&
xmlData[i+7] === 'N' &&
xmlData[i+8] === 'T') return true
return false
}
function isAttlist(xmlData, i){
if(xmlData[i+1] === '!' &&
xmlData[i+2] === 'A' &&
xmlData[i+3] === 'T' &&
xmlData[i+4] === 'T' &&
xmlData[i+5] === 'L' &&
xmlData[i+6] === 'I' &&
xmlData[i+7] === 'S' &&
xmlData[i+8] === 'T') return true
return false
}
function isNotation(xmlData, i){
if(xmlData[i+1] === '!' &&
xmlData[i+2] === 'N' &&
xmlData[i+3] === 'O' &&
xmlData[i+4] === 'T' &&
xmlData[i+5] === 'A' &&
xmlData[i+6] === 'T' &&
xmlData[i+7] === 'I' &&
xmlData[i+8] === 'O' &&
xmlData[i+9] === 'N') return true
return false
}
function validateEntityName(name){
if (util.isName(name))
return name;
else
throw new Error(`Invalid entity name ${name}`);
}
module.exports = readDocType;
/***/ }),
/***/ 86993:
/***/ ((__unused_webpack_module, exports) => {
const defaultOptions = {
preserveOrder: false,
attributeNamePrefix: '@_',
attributesGroupName: false,
textNodeName: '#text',
ignoreAttributes: true,
removeNSPrefix: false, // remove NS from tag name or attribute name if true
allowBooleanAttributes: false, //a tag can have attributes without any value
//ignoreRootElement : false,
parseTagValue: true,
parseAttributeValue: false,
trimValues: true, //Trim string values of tag and attributes
cdataPropName: false,
numberParseOptions: {
hex: true,
leadingZeros: true,
eNotation: true
},
tagValueProcessor: function(tagName, val) {
return val;
},
attributeValueProcessor: function(attrName, val) {
return val;
},
stopNodes: [], //nested tags will not be parsed even for errors
alwaysCreateTextNode: false,
isArray: () => false,
commentPropName: false,
unpairedTags: [],
processEntities: true,
htmlEntities: false,
ignoreDeclaration: false,
ignorePiTags: false,
transformTagName: false,
transformAttributeName: false,
updateTag: function(tagName, jPath, attrs){
return tagName
},
// skipEmptyListItem: false
};
const buildOptions = function(options) {
return Object.assign({}, defaultOptions, options);
};
exports.buildOptions = buildOptions;
exports.defaultOptions = defaultOptions;
/***/ }),
/***/ 25832:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
"use strict";
///@ts-check
const util = __nccwpck_require__(38280);
const xmlNode = __nccwpck_require__(7462);
const readDocType = __nccwpck_require__(6072);
const toNumber = __nccwpck_require__(14526);
const regx =
'<((!\\[CDATA\\[([\\s\\S]*?)(]]>))|((NAME:)?(NAME))([^>]*)>|((\\/)(NAME)\\s*>))([^<]*)'
.replace(/NAME/g, util.nameRegexp);
//const tagsRegx = new RegExp("<(\\/?[\\w:\\-\._]+)([^>]*)>(\\s*"+cdataRegx+")*([^<]+)?","g");
//const tagsRegx = new RegExp("<(\\/?)((\\w*:)?([\\w:\\-\._]+))([^>]*)>([^<]*)("+cdataRegx+"([^<]*))*([^<]+)?","g");
class OrderedObjParser{
constructor(options){
this.options = options;
this.currentNode = null;
this.tagsNodeStack = [];
this.docTypeEntities = {};
this.lastEntities = {
"apos" : { regex: /&(apos|#39|#x27);/g, val : "'"},
"gt" : { regex: /&(gt|#62|#x3E);/g, val : ">"},
"lt" : { regex: /&(lt|#60|#x3C);/g, val : "<"},
"quot" : { regex: /&(quot|#34|#x22);/g, val : "\""},
};
this.ampEntity = { regex: /&(amp|#38|#x26);/g, val : "&"};
this.htmlEntities = {
"space": { regex: /&(nbsp|#160);/g, val: " " },
// "lt" : { regex: /&(lt|#60);/g, val: "<" },
// "gt" : { regex: /&(gt|#62);/g, val: ">" },
// "amp" : { regex: /&(amp|#38);/g, val: "&" },
// "quot" : { regex: /&(quot|#34);/g, val: "\"" },
// "apos" : { regex: /&(apos|#39);/g, val: "'" },
"cent" : { regex: /&(cent|#162);/g, val: "¢" },
"pound" : { regex: /&(pound|#163);/g, val: "£" },
"yen" : { regex: /&(yen|#165);/g, val: "¥" },
"euro" : { regex: /&(euro|#8364);/g, val: "€" },
"copyright" : { regex: /&(copy|#169);/g, val: "©" },
"reg" : { regex: /&(reg|#174);/g, val: "®" },
"inr" : { regex: /&(inr|#8377);/g, val: "₹" },
};
this.addExternalEntities = addExternalEntities;
this.parseXml = parseXml;
this.parseTextData = parseTextData;
this.resolveNameSpace = resolveNameSpace;
this.buildAttributesMap = buildAttributesMap;
this.isItStopNode = isItStopNode;
this.replaceEntitiesValue = replaceEntitiesValue;
this.readStopNodeData = readStopNodeData;
this.saveTextToParentTag = saveTextToParentTag;
this.addChild = addChild;
}
}
function addExternalEntities(externalEntities){
const entKeys = Object.keys(externalEntities);
for (let i = 0; i < entKeys.length; i++) {
const ent = entKeys[i];
this.lastEntities[ent] = {
regex: new RegExp("&"+ent+";","g"),
val : externalEntities[ent]
}
}
}
/**
* @param {string} val
* @param {string} tagName
* @param {string} jPath
* @param {boolean} dontTrim
* @param {boolean} hasAttributes
* @param {boolean} isLeafNode
* @param {boolean} escapeEntities
*/
function parseTextData(val, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) {
if (val !== undefined) {
if (this.options.trimValues && !dontTrim) {
val = val.trim();
}
if(val.length > 0){
if(!escapeEntities) val = this.replaceEntitiesValue(val);
const newval = this.options.tagValueProcessor(tagName, val, jPath, hasAttributes, isLeafNode);
if(newval === null || newval === undefined){
//don't parse
return val;
}else if(typeof newval !== typeof val || newval !== val){
//overwrite
return newval;
}else if(this.options.trimValues){
return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions);
}else{
const trimmedVal = val.trim();
if(trimmedVal === val){
return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions);
}else{
return val;
}
}
}
}
}
function resolveNameSpace(tagname) {
if (this.options.removeNSPrefix) {
const tags = tagname.split(':');
const prefix = tagname.charAt(0) === '/' ? '/' : '';
if (tags[0] === 'xmlns') {
return '';
}
if (tags.length === 2) {
tagname = prefix + tags[1];
}
}
return tagname;
}
//TODO: change regex to capture NS
//const attrsRegx = new RegExp("([\\w\\-\\.\\:]+)\\s*=\\s*(['\"])((.|\n)*?)\\2","gm");
const attrsRegx = new RegExp('([^\\s=]+)\\s*(=\\s*([\'"])([\\s\\S]*?)\\3)?', 'gm');
function buildAttributesMap(attrStr, jPath, tagName) {
if (!this.options.ignoreAttributes && typeof attrStr === 'string') {
// attrStr = attrStr.replace(/\r?\n/g, ' ');
//attrStr = attrStr || attrStr.trim();
const matches = util.getAllMatches(attrStr, attrsRegx);
const len = matches.length; //don't make it inline
const attrs = {};
for (let i = 0; i < len; i++) {
const attrName = this.resolveNameSpace(matches[i][1]);
let oldVal = matches[i][4];
let aName = this.options.attributeNamePrefix + attrName;
if (attrName.length) {
if (this.options.transformAttributeName) {
aName = this.options.transformAttributeName(aName);
}
if(aName === "__proto__") aName = "#__proto__";
if (oldVal !== undefined) {
if (this.options.trimValues) {
oldVal = oldVal.trim();
}
oldVal = this.replaceEntitiesValue(oldVal);
const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath);
if(newVal === null || newVal === undefined){
//don't parse
attrs[aName] = oldVal;
}else if(typeof newVal !== typeof oldVal || newVal !== oldVal){
//overwrite
attrs[aName] = newVal;
}else{
//parse
attrs[aName] = parseValue(
oldVal,
this.options.parseAttributeValue,
this.options.numberParseOptions
);
}
} else if (this.options.allowBooleanAttributes) {
attrs[aName] = true;
}
}
}
if (!Object.keys(attrs).length) {
return;
}
if (this.options.attributesGroupName) {
const attrCollection = {};
attrCollection[this.options.attributesGroupName] = attrs;
return attrCollection;
}
return attrs
}
}
const parseXml = function(xmlData) {
xmlData = xmlData.replace(/\r\n?/g, "\n"); //TODO: remove this line
const xmlObj = new xmlNode('!xml');
let currentNode = xmlObj;
let textData = "";
let jPath = "";
for(let i=0; i< xmlData.length; i++){//for each char in XML data
const ch = xmlData[i];
if(ch === '<'){
// const nextIndex = i+1;
// const _2ndChar = xmlData[nextIndex];
if( xmlData[i+1] === '/') {//Closing Tag
const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed.")
let tagName = xmlData.substring(i+2,closeIndex).trim();
if(this.options.removeNSPrefix){
const colonIndex = tagName.indexOf(":");
if(colonIndex !== -1){
tagName = tagName.substr(colonIndex+1);
}
}
if(this.options.transformTagName) {
tagName = this.options.transformTagName(tagName);
}
if(currentNode){
textData = this.saveTextToParentTag(textData, currentNode, jPath);
}
//check if last tag of nested tag was unpaired tag
const lastTagName = jPath.substring(jPath.lastIndexOf(".")+1);
if(tagName && this.options.unpairedTags.indexOf(tagName) !== -1 ){
throw new Error(`Unpaired tag can not be used as closing tag: </${tagName}>`);
}
let propIndex = 0
if(lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1 ){
propIndex = jPath.lastIndexOf('.', jPath.lastIndexOf('.')-1)
this.tagsNodeStack.pop();
}else{
propIndex = jPath.lastIndexOf(".");
}
jPath = jPath.substring(0, propIndex);
currentNode = this.tagsNodeStack.pop();//avoid recursion, set the parent tag scope
textData = "";
i = closeIndex;
} else if( xmlData[i+1] === '?') {
let tagData = readTagExp(xmlData,i, false, "?>");
if(!tagData) throw new Error("Pi Tag is not closed.");
textData = this.saveTextToParentTag(textData, currentNode, jPath);
if( (this.options.ignoreDeclaration && tagData.tagName === "?xml") || this.options.ignorePiTags){
}else{
const childNode = new xmlNode(tagData.tagName);
childNode.add(this.options.textNodeName, "");
if(tagData.tagName !== tagData.tagExp && tagData.attrExpPresent){
childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName);
}
this.addChild(currentNode, childNode, jPath)
}
i = tagData.closeIndex + 1;
} else if(xmlData.substr(i + 1, 3) === '!--') {
const endIndex = findClosingIndex(xmlData, "-->", i+4, "Comment is not closed.")
if(this.options.commentPropName){
const comment = xmlData.substring(i + 4, endIndex - 2);
textData = this.saveTextToParentTag(textData, currentNode, jPath);
currentNode.add(this.options.commentPropName, [ { [this.options.textNodeName] : comment } ]);
}
i = endIndex;
} else if( xmlData.substr(i + 1, 2) === '!D') {
const result = readDocType(xmlData, i);
this.docTypeEntities = result.entities;
i = result.i;
}else if(xmlData.substr(i + 1, 2) === '![') {
const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2;
const tagExp = xmlData.substring(i + 9,closeIndex);
textData = this.saveTextToParentTag(textData, currentNode, jPath);
//cdata should be set even if it is 0 length string
if(this.options.cdataPropName){
// let val = this.parseTextData(tagExp, this.options.cdataPropName, jPath + "." + this.options.cdataPropName, true, false, true);
// if(!val) val = "";
currentNode.add(this.options.cdataPropName, [ { [this.options.textNodeName] : tagExp } ]);
}else{
let val = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true);
if(val == undefined) val = "";
currentNode.add(this.options.textNodeName, val);
}
i = closeIndex + 2;
}else {//Opening tag
let result = readTagExp(xmlData,i, this.options.removeNSPrefix);
let tagName= result.tagName;
let tagExp = result.tagExp;
let attrExpPresent = result.attrExpPresent;
let closeIndex = result.closeIndex;
if (this.options.transformTagName) {
tagName = this.options.transformTagName(tagName);
}
//save text as child node
if (currentNode && textData) {
if(currentNode.tagname !== '!xml'){
//when nested tag is found
textData = this.saveTextToParentTag(textData, currentNode, jPath, false);
}
}
//check if last tag was unpaired tag
const lastTag = currentNode;
if(lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1 ){
currentNode = this.tagsNodeStack.pop();
jPath = jPath.substring(0, jPath.lastIndexOf("."));
}
if(tagName !== xmlObj.tagname){
jPath += jPath ? "." + tagName : tagName;
}
if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { //TODO: namespace
let tagContent = "";
//self-closing tag
if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){
i = result.closeIndex;
}
//unpaired tag
else if(this.options.unpairedTags.indexOf(tagName) !== -1){
i = result.closeIndex;
}
//normal tag
else{
//read until closing tag is found
const result = this.readStopNodeData(xmlData, tagName, closeIndex + 1);
if(!result) throw new Error(`Unexpected end of ${tagName}`);
i = result.i;
tagContent = result.tagContent;
}
const childNode = new xmlNode(tagName);
if(tagName !== tagExp && attrExpPresent){
childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName);
}
if(tagContent) {
tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true);
}
jPath = jPath.substr(0, jPath.lastIndexOf("."));
childNode.add(this.options.textNodeName, tagContent);
this.addChild(currentNode, childNode, jPath)
}else{
//selfClosing tag
if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){
if(tagName[tagName.length - 1] === "/"){ //remove trailing '/'
tagName = tagName.substr(0, tagName.length - 1);
tagExp = tagName;
}else{
tagExp = tagExp.substr(0, tagExp.length - 1);
}
if(this.options.transformTagName) {
tagName = this.options.transformTagName(tagName);
}
const childNode = new xmlNode(tagName);
if(tagName !== tagExp && attrExpPresent){
childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName);
}
this.addChild(currentNode, childNode, jPath)
jPath = jPath.substr(0, jPath.lastIndexOf("."));
}
//opening tag
else{
const childNode = new xmlNode( tagName);
this.tagsNodeStack.push(currentNode);
if(tagName !== tagExp && attrExpPresent){
childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName);
}
this.addChild(currentNode, childNode, jPath)
currentNode = childNode;
}
textData = "";
i = closeIndex;
}
}
}else{
textData += xmlData[i];
}
}
return xmlObj.child;
}
function addChild(currentNode, childNode, jPath){
const result = this.options.updateTag(childNode.tagname, jPath, childNode[":@"])
if(result === false){
}else if(typeof result === "string"){
childNode.tagname = result
currentNode.addChild(childNode);
}else{
currentNode.addChild(childNode);
}
}
const replaceEntitiesValue = function(val){
if(this.options.processEntities){
for(let entityName in this.docTypeEntities){
const entity = this.docTypeEntities[entityName];
val = val.replace( entity.regx, entity.val);
}
for(let entityName in this.lastEntities){
const entity = this.lastEntities[entityName];
val = val.replace( entity.regex, entity.val);
}
if(this.options.htmlEntities){
for(let entityName in this.htmlEntities){
const entity = this.htmlEntities[entityName];
val = val.replace( entity.regex, entity.val);
}
}
val = val.replace( this.ampEntity.regex, this.ampEntity.val);
}
return val;
}
function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) {
if (textData) { //store previously collected data as textNode
if(isLeafNode === undefined) isLeafNode = Object.keys(currentNode.child).length === 0
textData = this.parseTextData(textData,
currentNode.tagname,
jPath,
false,
currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false,
isLeafNode);
if (textData !== undefined && textData !== "")
currentNode.add(this.options.textNodeName, textData);
textData = "";
}
return textData;
}
//TODO: use jPath to simplify the logic
/**
*
* @param {string[]} stopNodes
* @param {string} jPath
* @param {string} currentTagName
*/
function isItStopNode(stopNodes, jPath, currentTagName){
const allNodesExp = "*." + currentTagName;
for (const stopNodePath in stopNodes) {
const stopNodeExp = stopNodes[stopNodePath];
if( allNodesExp === stopNodeExp || jPath === stopNodeExp ) return true;
}
return false;
}
/**
* Returns the tag Expression and where it is ending handling single-double quotes situation
* @param {string} xmlData
* @param {number} i starting index
* @returns
*/
function tagExpWithClosingIndex(xmlData, i, closingChar = ">"){
let attrBoundary;
let tagExp = "";
for (let index = i; index < xmlData.length; index++) {
let ch = xmlData[index];
if (attrBoundary) {
if (ch === attrBoundary) attrBoundary = "";//reset
} else if (ch === '"' || ch === "'") {
attrBoundary = ch;
} else if (ch === closingChar[0]) {
if(closingChar[1]){
if(xmlData[index + 1] === closingChar[1]){
return {
data: tagExp,
index: index
}
}
}else{
return {
data: tagExp,
index: index
}
}
} else if (ch === '\t') {
ch = " "
}
tagExp += ch;
}
}
function findClosingIndex(xmlData, str, i, errMsg){
const closingIndex = xmlData.indexOf(str, i);
if(closingIndex === -1){
throw new Error(errMsg)
}else{
return closingIndex + str.length - 1;
}
}
function readTagExp(xmlData,i, removeNSPrefix, closingChar = ">"){
const result = tagExpWithClosingIndex(xmlData, i+1, closingChar);
if(!result) return;
let tagExp = result.data;
const closeIndex = result.index;
const separatorIndex = tagExp.search(/\s/);
let tagName = tagExp;
let attrExpPresent = true;
if(separatorIndex !== -1){//separate tag name and attributes expression
tagName = tagExp.substr(0, separatorIndex).replace(/\s\s*$/, '');
tagExp = tagExp.substr(separatorIndex + 1);
}
if(removeNSPrefix){
const colonIndex = tagName.indexOf(":");
if(colonIndex !== -1){
tagName = tagName.substr(colonIndex+1);
attrExpPresent = tagName !== result.data.substr(colonIndex + 1);
}
}
return {
tagName: tagName,
tagExp: tagExp,
closeIndex: closeIndex,
attrExpPresent: attrExpPresent,
}
}
/**
* find paired tag for a stop node
* @param {string} xmlData
* @param {string} tagName
* @param {number} i
*/
function readStopNodeData(xmlData, tagName, i){
const startIndex = i;
// Starting at 1 since we already have an open tag
let openTagCount = 1;
for (; i < xmlData.length; i++) {
if( xmlData[i] === "<"){
if (xmlData[i+1] === "/") {//close tag
const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`);
let closeTagName = xmlData.substring(i+2,closeIndex).trim();
if(closeTagName === tagName){
openTagCount--;
if (openTagCount === 0) {
return {
tagContent: xmlData.substring(startIndex, i),
i : closeIndex
}
}
}
i=closeIndex;
} else if(xmlData[i+1] === '?') {
const closeIndex = findClosingIndex(xmlData, "?>", i+1, "StopNode is not closed.")
i=closeIndex;
} else if(xmlData.substr(i + 1, 3) === '!--') {
const closeIndex = findClosingIndex(xmlData, "-->", i+3, "StopNode is not closed.")
i=closeIndex;
} else if(xmlData.substr(i + 1, 2) === '![') {
const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2;
i=closeIndex;
} else {
const tagData = readTagExp(xmlData, i, '>')
if (tagData) {
const openTagName = tagData && tagData.tagName;
if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length-1] !== "/") {
openTagCount++;
}
i=tagData.closeIndex;
}
}
}
}//end for loop
}
function parseValue(val, shouldParse, options) {
if (shouldParse && typeof val === 'string') {
//console.log(options)
const newval = val.trim();
if(newval === 'true' ) return true;
else if(newval === 'false' ) return false;
else return toNumber(val, options);
} else {
if (util.isExist(val)) {
return val;
} else {
return '';
}
}
}
module.exports = OrderedObjParser;
/***/ }),
/***/ 42380:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
const { buildOptions} = __nccwpck_require__(86993);
const OrderedObjParser = __nccwpck_require__(25832);
const { prettify} = __nccwpck_require__(42882);
const validator = __nccwpck_require__(61739);
class XMLParser{
constructor(options){
this.externalEntities = {};
this.options = buildOptions(options);
}
/**
* Parse XML dats to JS object
* @param {string|Buffer} xmlData
* @param {boolean|Object} validationOption
*/
parse(xmlData,validationOption){
if(typeof xmlData === "string"){
}else if( xmlData.toString){
xmlData = xmlData.toString();
}else{
throw new Error("XML data is accepted in String or Bytes[] form.")
}
if( validationOption){
if(validationOption === true) validationOption = {}; //validate with default options
const result = validator.validate(xmlData, validationOption);
if (result !== true) {
throw Error( `${result.err.msg}:${result.err.line}:${result.err.col}` )
}
}
const orderedObjParser = new OrderedObjParser(this.options);
orderedObjParser.addExternalEntities(this.externalEntities);
const orderedResult = orderedObjParser.parseXml(xmlData);
if(this.options.preserveOrder || orderedResult === undefined) return orderedResult;
else return prettify(orderedResult, this.options);
}
/**
* Add Entity which is not by default supported by this library
* @param {string} key
* @param {string} value
*/
addEntity(key, value){
if(value.indexOf("&") !== -1){
throw new Error("Entity value can't have '&'")
}else if(key.indexOf("&") !== -1 || key.indexOf(";") !== -1){
throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for '&#xD;'")
}else if(value === "&"){
throw new Error("An entity with value '&' is not permitted");
}else{
this.externalEntities[key] = value;
}
}
}
module.exports = XMLParser;
/***/ }),
/***/ 42882:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
/**
*
* @param {array} node
* @param {any} options
* @returns
*/
function prettify(node, options){
return compress( node, options);
}
/**
*
* @param {array} arr
* @param {object} options
* @param {string} jPath
* @returns object
*/
function compress(arr, options, jPath){
let text;
const compressedObj = {};
for (let i = 0; i < arr.length; i++) {
const tagObj = arr[i];
const property = propName(tagObj);
let newJpath = "";
if(jPath === undefined) newJpath = property;
else newJpath = jPath + "." + property;
if(property === options.textNodeName){
if(text === undefined) text = tagObj[property];
else text += "" + tagObj[property];
}else if(property === undefined){
continue;
}else if(tagObj[property]){
let val = compress(tagObj[property], options, newJpath);
const isLeaf = isLeafTag(val, options);
if(tagObj[":@"]){
assignAttributes( val, tagObj[":@"], newJpath, options);
}else if(Object.keys(val).length === 1 && val[options.textNodeName] !== undefined && !options.alwaysCreateTextNode){
val = val[options.textNodeName];
}else if(Object.keys(val).length === 0){
if(options.alwaysCreateTextNode) val[options.textNodeName] = "";
else val = "";
}
if(compressedObj[property] !== undefined && compressedObj.hasOwnProperty(property)) {
if(!Array.isArray(compressedObj[property])) {
compressedObj[property] = [ compressedObj[property] ];
}
compressedObj[property].push(val);
}else{
//TODO: if a node is not an array, then check if it should be an array
//also determine if it is a leaf node
if (options.isArray(property, newJpath, isLeaf )) {
compressedObj[property] = [val];
}else{
compressedObj[property] = val;
}
}
}
}
// if(text && text.length > 0) compressedObj[options.textNodeName] = text;
if(typeof text === "string"){
if(text.length > 0) compressedObj[options.textNodeName] = text;
}else if(text !== undefined) compressedObj[options.textNodeName] = text;
return compressedObj;
}
function propName(obj){
const keys = Object.keys(obj);
for (let i = 0; i < keys.length; i++) {
const key = keys[i];
if(key !== ":@") return key;
}
}
function assignAttributes(obj, attrMap, jpath, options){
if (attrMap) {
const keys = Object.keys(attrMap);
const len = keys.length; //don't make it inline
for (let i = 0; i < len; i++) {
const atrrName = keys[i];
if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) {
obj[atrrName] = [ attrMap[atrrName] ];
} else {
obj[atrrName] = attrMap[atrrName];
}
}
}
}
function isLeafTag(obj, options){
const { textNodeName } = options;
const propCount = Object.keys(obj).length;
if (propCount === 0) {
return true;
}
if (
propCount === 1 &&
(obj[textNodeName] || typeof obj[textNodeName] === "boolean" || obj[textNodeName] === 0)
) {
return true;
}
return false;
}
exports.prettify = prettify;
/***/ }),
/***/ 7462:
/***/ ((module) => {
"use strict";
class XmlNode{
constructor(tagname) {
this.tagname = tagname;
this.child = []; //nested tags, text, cdata, comments in order
this[":@"] = {}; //attributes map
}
add(key,val){
// this.child.push( {name : key, val: val, isCdata: isCdata });
if(key === "__proto__") key = "#__proto__";
this.child.push( {[key]: val });
}
addChild(node) {
if(node.tagname === "__proto__") node.tagname = "#__proto__";
if(node[":@"] && Object.keys(node[":@"]).length > 0){
this.child.push( { [node.tagname]: node.child, [":@"]: node[":@"] });
}else{
this.child.push( { [node.tagname]: node.child });
}
};
};
module.exports = XmlNode;
/***/ }),
/***/ 31621:
/***/ ((module) => {
"use strict";
module.exports = (flag, argv = process.argv) => {
const prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--');
const position = argv.indexOf(prefix + flag);
const terminatorPosition = argv.indexOf('--');
return position !== -1 && (terminatorPosition === -1 || position < terminatorPosition);
};
/***/ }),
/***/ 15098:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
const net_1 = __importDefault(__nccwpck_require__(41808));
const tls_1 = __importDefault(__nccwpck_require__(24404));
const url_1 = __importDefault(__nccwpck_require__(57310));
const assert_1 = __importDefault(__nccwpck_require__(39491));
const debug_1 = __importDefault(__nccwpck_require__(38237));
const agent_base_1 = __nccwpck_require__(49690);
const parse_proxy_response_1 = __importDefault(__nccwpck_require__(595));
const debug = debug_1.default('https-proxy-agent:agent');
/**
* The `HttpsProxyAgent` implements an HTTP Agent subclass that connects to
* the specified "HTTP(s) proxy server" in order to proxy HTTPS requests.
*
* Outgoing HTTP requests are first tunneled through the proxy server using the
* `CONNECT` HTTP request method to establish a connection to the proxy server,
* and then the proxy server connects to the destination target and issues the
* HTTP request from the proxy server.
*
* `https:` requests have their socket connection upgraded to TLS once
* the connection to the proxy server has been established.
*
* @api public
*/
class HttpsProxyAgent extends agent_base_1.Agent {
constructor(_opts) {
let opts;
if (typeof _opts === 'string') {
opts = url_1.default.parse(_opts);
}
else {
opts = _opts;
}
if (!opts) {
throw new Error('an HTTP(S) proxy server `host` and `port` must be specified!');
}
debug('creating new HttpsProxyAgent instance: %o', opts);
super(opts);
const proxy = Object.assign({}, opts);
// If `true`, then connect to the proxy server over TLS.
// Defaults to `false`.
this.secureProxy = opts.secureProxy || isHTTPS(proxy.protocol);
// Prefer `hostname` over `host`, and set the `port` if needed.
proxy.host = proxy.hostname || proxy.host;
if (typeof proxy.port === 'string') {
proxy.port = parseInt(proxy.port, 10);
}
if (!proxy.port && proxy.host) {
proxy.port = this.secureProxy ? 443 : 80;
}
// ALPN is supported by Node.js >= v5.
// attempt to negotiate http/1.1 for proxy servers that support http/2
if (this.secureProxy && !('ALPNProtocols' in proxy)) {
proxy.ALPNProtocols = ['http 1.1'];
}
if (proxy.host && proxy.path) {
// If both a `host` and `path` are specified then it's most likely
// the result of a `url.parse()` call... we need to remove the
// `path` portion so that `net.connect()` doesn't attempt to open
// that as a Unix socket file.
delete proxy.path;
delete proxy.pathname;
}
this.proxy = proxy;
}
/**
* Called when the node-core HTTP client library is creating a
* new HTTP request.
*
* @api protected
*/
callback(req, opts) {
return __awaiter(this, void 0, void 0, function* () {
const { proxy, secureProxy } = this;
// Create a socket connection to the proxy server.
let socket;
if (secureProxy) {
debug('Creating `tls.Socket`: %o', proxy);
socket = tls_1.default.connect(proxy);
}
else {
debug('Creating `net.Socket`: %o', proxy);
socket = net_1.default.connect(proxy);
}
const headers = Object.assign({}, proxy.headers);
const hostname = `${opts.host}:${opts.port}`;
let payload = `CONNECT ${hostname} HTTP/1.1\r\n`;
// Inject the `Proxy-Authorization` header if necessary.
if (proxy.auth) {
headers['Proxy-Authorization'] = `Basic ${Buffer.from(proxy.auth).toString('base64')}`;
}
// The `Host` header should only include the port
// number when it is not the default port.
let { host, port, secureEndpoint } = opts;
if (!isDefaultPort(port, secureEndpoint)) {
host += `:${port}`;
}
headers.Host = host;
headers.Connection = 'close';
for (const name of Object.keys(headers)) {
payload += `${name}: ${headers[name]}\r\n`;
}
const proxyResponsePromise = parse_proxy_response_1.default(socket);
socket.write(`${payload}\r\n`);
const { statusCode, buffered } = yield proxyResponsePromise;
if (statusCode === 200) {
req.once('socket', resume);
if (opts.secureEndpoint) {
// The proxy is connecting to a TLS server, so upgrade
// this socket connection to a TLS connection.
debug('Upgrading socket connection to TLS');
const servername = opts.servername || opts.host;
return tls_1.default.connect(Object.assign(Object.assign({}, omit(opts, 'host', 'hostname', 'path', 'port')), { socket,
servername }));
}
return socket;
}
// Some other status code that's not 200... need to re-play the HTTP
// header "data" events onto the socket once the HTTP machinery is
// attached so that the node core `http` can parse and handle the
// error status code.
// Close the original socket, and a new "fake" socket is returned
// instead, so that the proxy doesn't get the HTTP request
// written to it (which may contain `Authorization` headers or other
// sensitive data).
//
// See: https://hackerone.com/reports/541502
socket.destroy();
const fakeSocket = new net_1.default.Socket({ writable: false });
fakeSocket.readable = true;
// Need to wait for the "socket" event to re-play the "data" events.
req.once('socket', (s) => {
debug('replaying proxy buffer for failed request');
assert_1.default(s.listenerCount('data') > 0);
// Replay the "buffered" Buffer onto the fake `socket`, since at
// this point the HTTP module machinery has been hooked up for
// the user.
s.push(buffered);
s.push(null);
});
return fakeSocket;
});
}
}
exports["default"] = HttpsProxyAgent;
function resume(socket) {
socket.resume();
}
function isDefaultPort(port, secure) {
return Boolean((!secure && port === 80) || (secure && port === 443));
}
function isHTTPS(protocol) {
return typeof protocol === 'string' ? /^https:?$/i.test(protocol) : false;
}
function omit(obj, ...keys) {
const ret = {};
let key;
for (key in obj) {
if (!keys.includes(key)) {
ret[key] = obj[key];
}
}
return ret;
}
//# sourceMappingURL=agent.js.map
/***/ }),
/***/ 77219:
/***/ (function(module, __unused_webpack_exports, __nccwpck_require__) {
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
const agent_1 = __importDefault(__nccwpck_require__(15098));
function createHttpsProxyAgent(opts) {
return new agent_1.default(opts);
}
(function (createHttpsProxyAgent) {
createHttpsProxyAgent.HttpsProxyAgent = agent_1.default;
createHttpsProxyAgent.prototype = agent_1.default.prototype;
})(createHttpsProxyAgent || (createHttpsProxyAgent = {}));
module.exports = createHttpsProxyAgent;
//# sourceMappingURL=index.js.map
/***/ }),
/***/ 595:
/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) {
"use strict";
var __importDefault = (this && this.__importDefault) || function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
Object.defineProperty(exports, "__esModule", ({ value: true }));
const debug_1 = __importDefault(__nccwpck_require__(38237));
const debug = debug_1.default('https-proxy-agent:parse-proxy-response');
function parseProxyResponse(socket) {
return new Promise((resolve, reject) => {
// we need to buffer any HTTP traffic that happens with the proxy before we get
// the CONNECT response, so that if the response is anything other than an "200"
// response code, then we can re-play the "data" events on the socket once the
// HTTP parser is hooked up...
let buffersLength = 0;
const buffers = [];
function read() {
const b = socket.read();
if (b)
ondata(b);
else
socket.once('readable', read);
}
function cleanup() {
socket.removeListener('end', onend);
socket.removeListener('error', onerror);
socket.removeListener('close', onclose);
socket.removeListener('readable', read);
}
function onclose(err) {
debug('onclose had error %o', err);
}
function onend() {
debug('onend');
}
function onerror(err) {
cleanup();
debug('onerror %o', err);
reject(err);
}
function ondata(b) {
buffers.push(b);
buffersLength += b.length;
const buffered = Buffer.concat(buffers, buffersLength);
const endOfHeaders = buffered.indexOf('\r\n\r\n');
if (endOfHeaders === -1) {
// keep buffering
debug('have not received end of HTTP headers yet...');
read();
return;
}
const firstLine = buffered.toString('ascii', 0, buffered.indexOf('\r\n'));
const statusCode = +firstLine.split(' ')[1];
debug('got proxy server response: %o', firstLine);
resolve({
statusCode,
buffered
});
}
socket.on('error', onerror);
socket.on('close', onclose);
socket.on('end', onend);
read();
});
}
exports["default"] = parseProxyResponse;
//# sourceMappingURL=parse-proxy-response.js.map
/***/ }),
/***/ 80900:
/***/ ((module) => {
/**
* Helpers.
*/
var s = 1000;
var m = s * 60;
var h = m * 60;
var d = h * 24;
var w = d * 7;
var y = d * 365.25;
/**
* Parse or format the given `val`.
*
* Options:
*
* - `long` verbose formatting [false]
*
* @param {String|Number} val
* @param {Object} [options]
* @throws {Error} throw an error if val is not a non-empty string or a number
* @return {String|Number}
* @api public
*/
module.exports = function(val, options) {
options = options || {};
var type = typeof val;
if (type === 'string' && val.length > 0) {
return parse(val);
} else if (type === 'number' && isFinite(val)) {
return options.long ? fmtLong(val) : fmtShort(val);
}
throw new Error(
'val is not a non-empty string or a valid number. val=' +
JSON.stringify(val)
);
};
/**
* Parse the given `str` and return milliseconds.
*
* @param {String} str
* @return {Number}
* @api private
*/
function parse(str) {
str = String(str);
if (str.length > 100) {
return;
}
var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
str
);
if (!match) {
return;
}
var n = parseFloat(match[1]);
var type = (match[2] || 'ms').toLowerCase();
switch (type) {
case 'years':
case 'year':
case 'yrs':
case 'yr':
case 'y':
return n * y;
case 'weeks':
case 'week':
case 'w':
return n * w;
case 'days':
case 'day':
case 'd':
return n * d;
case 'hours':
case 'hour':
case 'hrs':
case 'hr':
case 'h':
return n * h;
case 'minutes':
case 'minute':
case 'mins':
case 'min':
case 'm':
return n * m;
case 'seconds':
case 'second':
case 'secs':
case 'sec':
case 's':
return n * s;
case 'milliseconds':
case 'millisecond':
case 'msecs':
case 'msec':
case 'ms':
return n;
default:
return undefined;
}
}
/**
* Short format for `ms`.
*
* @param {Number} ms
* @return {String}
* @api private
*/
function fmtShort(ms) {
var msAbs = Math.abs(ms);
if (msAbs >= d) {
return Math.round(ms / d) + 'd';
}
if (msAbs >= h) {
return Math.round(ms / h) + 'h';
}
if (msAbs >= m) {
return Math.round(ms / m) + 'm';
}
if (msAbs >= s) {
return Math.round(ms / s) + 's';
}
return ms + 'ms';
}
/**
* Long format for `ms`.
*
* @param {Number} ms
* @return {String}
* @api private
*/
function fmtLong(ms) {
var msAbs = Math.abs(ms);
if (msAbs >= d) {
return plural(ms, msAbs, d, 'day');
}
if (msAbs >= h) {
return plural(ms, msAbs, h, 'hour');
}
if (msAbs >= m) {
return plural(ms, msAbs, m, 'minute');
}
if (msAbs >= s) {
return plural(ms, msAbs, s, 'second');
}
return ms + ' ms';
}
/**
* Pluralization helper.
*/
function plural(ms, msAbs, n, name) {
var isPlural = msAbs >= n * 1.5;
return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
}
/***/ }),
/***/ 14526:
/***/ ((module) => {
const hexRegex = /^[-+]?0x[a-fA-F0-9]+$/;
const numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/;
// const octRegex = /0x[a-z0-9]+/;
// const binRegex = /0x[a-z0-9]+/;
//polyfill
if (!Number.parseInt && window.parseInt) {
Number.parseInt = window.parseInt;
}
if (!Number.parseFloat && window.parseFloat) {
Number.parseFloat = window.parseFloat;
}
const consider = {
hex : true,
leadingZeros: true,
decimalPoint: "\.",
eNotation: true
//skipLike: /regex/
};
function toNumber(str, options = {}){
// const options = Object.assign({}, consider);
// if(opt.leadingZeros === false){
// options.leadingZeros = false;
// }else if(opt.hex === false){
// options.hex = false;
// }
options = Object.assign({}, consider, options );
if(!str || typeof str !== "string" ) return str;
let trimmedStr = str.trim();
// if(trimmedStr === "0.0") return 0;
// else if(trimmedStr === "+0.0") return 0;
// else if(trimmedStr === "-0.0") return -0;
if(options.skipLike !== undefined && options.skipLike.test(trimmedStr)) return str;
else if (options.hex && hexRegex.test(trimmedStr)) {
return Number.parseInt(trimmedStr, 16);
// } else if (options.parseOct && octRegex.test(str)) {
// return Number.parseInt(val, 8);
// }else if (options.parseBin && binRegex.test(str)) {
// return Number.parseInt(val, 2);
}else{
//separate negative sign, leading zeros, and rest number
const match = numRegex.exec(trimmedStr);
if(match){
const sign = match[1];
const leadingZeros = match[2];
let numTrimmedByZeros = trimZeros(match[3]); //complete num without leading zeros
//trim ending zeros for floating number
const eNotation = match[4] || match[6];
if(!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; //-0123
else if(!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; //0123
else{//no leading zeros or leading zeros are allowed
const num = Number(trimmedStr);
const numStr = "" + num;
if(numStr.search(/[eE]/) !== -1){ //given number is long and parsed to eNotation
if(options.eNotation) return num;
else return str;
}else if(eNotation){ //given number has enotation
if(options.eNotation) return num;
else return str;
}else if(trimmedStr.indexOf(".") !== -1){ //floating number
// const decimalPart = match[5].substr(1);
// const intPart = trimmedStr.substr(0,trimmedStr.indexOf("."));
// const p = numStr.indexOf(".");
// const givenIntPart = numStr.substr(0,p);
// const givenDecPart = numStr.substr(p+1);
if(numStr === "0" && (numTrimmedByZeros === "") ) return num; //0.0
else if(numStr === numTrimmedByZeros) return num; //0.456. 0.79000
else if( sign && numStr === "-"+numTrimmedByZeros) return num;
else return str;
}
if(leadingZeros){
// if(numTrimmedByZeros === numStr){
// if(options.leadingZeros) return num;
// else return str;
// }else return str;
if(numTrimmedByZeros === numStr) return num;
else if(sign+numTrimmedByZeros === numStr) return num;
else return str;
}
if(trimmedStr === numStr) return num;
else if(trimmedStr === sign+numStr) return num;
// else{
// //number with +/- sign
// trimmedStr.test(/[-+][0-9]);
// }
return str;
}
// else if(!eNotation && trimmedStr && trimmedStr !== Number(trimmedStr) ) return str;
}else{ //non-numeric string
return str;
}
}
}
/**
*
* @param {string} numStr without leading zeros
* @returns
*/
function trimZeros(numStr){
if(numStr && numStr.indexOf(".") !== -1){//float
numStr = numStr.replace(/0+$/, ""); //remove ending zeros
if(numStr === ".") numStr = "0";
else if(numStr[0] === ".") numStr = "0"+numStr;
else if(numStr[numStr.length-1] === ".") numStr = numStr.substr(0,numStr.length-1);
return numStr;
}
return numStr;
}
module.exports = toNumber
/***/ }),
/***/ 59318:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
"use strict";
const os = __nccwpck_require__(22037);
const tty = __nccwpck_require__(76224);
const hasFlag = __nccwpck_require__(31621);
const {env} = process;
let forceColor;
if (hasFlag('no-color') ||
hasFlag('no-colors') ||
hasFlag('color=false') ||
hasFlag('color=never')) {
forceColor = 0;
} else if (hasFlag('color') ||
hasFlag('colors') ||
hasFlag('color=true') ||
hasFlag('color=always')) {
forceColor = 1;
}
if ('FORCE_COLOR' in env) {
if (env.FORCE_COLOR === 'true') {
forceColor = 1;
} else if (env.FORCE_COLOR === 'false') {
forceColor = 0;
} else {
forceColor = env.FORCE_COLOR.length === 0 ? 1 : Math.min(parseInt(env.FORCE_COLOR, 10), 3);
}
}
function translateLevel(level) {
if (level === 0) {
return false;
}
return {
level,
hasBasic: true,
has256: level >= 2,
has16m: level >= 3
};
}
function supportsColor(haveStream, streamIsTTY) {
if (forceColor === 0) {
return 0;
}
if (hasFlag('color=16m') ||
hasFlag('color=full') ||
hasFlag('color=truecolor')) {
return 3;
}
if (hasFlag('color=256')) {
return 2;
}
if (haveStream && !streamIsTTY && forceColor === undefined) {
return 0;
}
const min = forceColor || 0;
if (env.TERM === 'dumb') {
return min;
}
if (process.platform === 'win32') {
// Windows 10 build 10586 is the first Windows release that supports 256 colors.
// Windows 10 build 14931 is the first release that supports 16m/TrueColor.
const osRelease = os.release().split('.');
if (
Number(osRelease[0]) >= 10 &&
Number(osRelease[2]) >= 10586
) {
return Number(osRelease[2]) >= 14931 ? 3 : 2;
}
return 1;
}
if ('CI' in env) {
if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI', 'GITHUB_ACTIONS', 'BUILDKITE'].some(sign => sign in env) || env.CI_NAME === 'codeship') {
return 1;
}
return min;
}
if ('TEAMCITY_VERSION' in env) {
return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0;
}
if (env.COLORTERM === 'truecolor') {
return 3;
}
if ('TERM_PROGRAM' in env) {
const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10);
switch (env.TERM_PROGRAM) {
case 'iTerm.app':
return version >= 3 ? 3 : 2;
case 'Apple_Terminal':
return 2;
// No default
}
}
if (/-256(color)?$/i.test(env.TERM)) {
return 2;
}
if (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) {
return 1;
}
if ('COLORTERM' in env) {
return 1;
}
return min;
}
function getSupportLevel(stream) {
const level = supportsColor(stream, stream && stream.isTTY);
return translateLevel(level);
}
module.exports = {
supportsColor: getSupportLevel,
stdout: translateLevel(supportsColor(true, tty.isatty(1))),
stderr: translateLevel(supportsColor(true, tty.isatty(2)))
};
/***/ }),
/***/ 4351:
/***/ ((module) => {
/******************************************************************************
Copyright (c) Microsoft Corporation.
Permission to use, copy, modify, and/or distribute this software for any
purpose with or without fee is hereby granted.
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
PERFORMANCE OF THIS SOFTWARE.
***************************************************************************** */
/* global global, define, Symbol, Reflect, Promise, SuppressedError */
var __extends;
var __assign;
var __rest;
var __decorate;
var __param;
var __esDecorate;
var __runInitializers;
var __propKey;
var __setFunctionName;
var __metadata;
var __awaiter;
var __generator;
var __exportStar;
var __values;
var __read;
var __spread;
var __spreadArrays;
var __spreadArray;
var __await;
var __asyncGenerator;
var __asyncDelegator;
var __asyncValues;
var __makeTemplateObject;
var __importStar;
var __importDefault;
var __classPrivateFieldGet;
var __classPrivateFieldSet;
var __classPrivateFieldIn;
var __createBinding;
var __addDisposableResource;
var __disposeResources;
(function (factory) {
var root = typeof global === "object" ? global : typeof self === "object" ? self : typeof this === "object" ? this : {};
if (typeof define === "function" && define.amd) {
define("tslib", ["exports"], function (exports) { factory(createExporter(root, createExporter(exports))); });
}
else if ( true && typeof module.exports === "object") {
factory(createExporter(root, createExporter(module.exports)));
}
else {
factory(createExporter(root));
}
function createExporter(exports, previous) {
if (exports !== root) {
if (typeof Object.create === "function") {
Object.defineProperty(exports, "__esModule", { value: true });
}
else {
exports.__esModule = true;
}
}
return function (id, v) { return exports[id] = previous ? previous(id, v) : v; };
}
})
(function (exporter) {
var extendStatics = Object.setPrototypeOf ||
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
__extends = function (d, b) {
if (typeof b !== "function" && b !== null)
throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
extendStatics(d, b);
function __() { this.constructor = d; }
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
};
__assign = Object.assign || function (t) {
for (var s, i = 1, n = arguments.length; i < n; i++) {
s = arguments[i];
for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
}
return t;
};
__rest = function (s, e) {
var t = {};
for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
t[p] = s[p];
if (s != null && typeof Object.getOwnPropertySymbols === "function")
for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
t[p[i]] = s[p[i]];
}
return t;
};
__decorate = function (decorators, target, key, desc) {
var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
return c > 3 && r && Object.defineProperty(target, key, r), r;
};
__param = function (paramIndex, decorator) {
return function (target, key) { decorator(target, key, paramIndex); }
};
__esDecorate = function (ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) {
function accept(f) { if (f !== void 0 && typeof f !== "function") throw new TypeError("Function expected"); return f; }
var kind = contextIn.kind, key = kind === "getter" ? "get" : kind === "setter" ? "set" : "value";
var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null;
var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {});
var _, done = false;
for (var i = decorators.length - 1; i >= 0; i--) {
var context = {};
for (var p in contextIn) context[p] = p === "access" ? {} : contextIn[p];
for (var p in contextIn.access) context.access[p] = contextIn.access[p];
context.addInitializer = function (f) { if (done) throw new TypeError("Cannot add initializers after decoration has completed"); extraInitializers.push(accept(f || null)); };
var result = (0, decorators[i])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context);
if (kind === "accessor") {
if (result === void 0) continue;
if (result === null || typeof result !== "object") throw new TypeError("Object expected");
if (_ = accept(result.get)) descriptor.get = _;
if (_ = accept(result.set)) descriptor.set = _;
if (_ = accept(result.init)) initializers.unshift(_);
}
else if (_ = accept(result)) {
if (kind === "field") initializers.unshift(_);
else descriptor[key] = _;
}
}
if (target) Object.defineProperty(target, contextIn.name, descriptor);
done = true;
};
__runInitializers = function (thisArg, initializers, value) {
var useValue = arguments.length > 2;
for (var i = 0; i < initializers.length; i++) {
value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg);
}
return useValue ? value : void 0;
};
__propKey = function (x) {
return typeof x === "symbol" ? x : "".concat(x);
};
__setFunctionName = function (f, name, prefix) {
if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : "";
return Object.defineProperty(f, "name", { configurable: true, value: prefix ? "".concat(prefix, " ", name) : name });
};
__metadata = function (metadataKey, metadataValue) {
if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
};
__awaiter = function (thisArg, _arguments, P, generator) {
function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
return new (P || (P = Promise))(function (resolve, reject) {
function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
step((generator = generator.apply(thisArg, _arguments || [])).next());
});
};
__generator = function (thisArg, body) {
var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
function verb(n) { return function (v) { return step([n, v]); }; }
function step(op) {
if (f) throw new TypeError("Generator is already executing.");
while (g && (g = 0, op[0] && (_ = 0)), _) try {
if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
if (y = 0, t) op = [op[0] & 2, t.value];
switch (op[0]) {
case 0: case 1: t = op; break;
case 4: _.label++; return { value: op[1], done: false };
case 5: _.label++; y = op[1]; op = [0]; continue;
case 7: op = _.ops.pop(); _.trys.pop(); continue;
default:
if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
if (t[2]) _.ops.pop();
_.trys.pop(); continue;
}
op = body.call(thisArg, _);
} catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
}
};
__exportStar = function(m, o) {
for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);
};
__createBinding = Object.create ? (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
var desc = Object.getOwnPropertyDescriptor(m, k);
if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) {
desc = { enumerable: true, get: function() { return m[k]; } };
}
Object.defineProperty(o, k2, desc);
}) : (function(o, m, k, k2) {
if (k2 === undefined) k2 = k;
o[k2] = m[k];
});
__values = function (o) {
var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0;
if (m) return m.call(o);
if (o && typeof o.length === "number") return {
next: function () {
if (o && i >= o.length) o = void 0;
return { value: o && o[i++], done: !o };
}
};
throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined.");
};
__read = function (o, n) {
var m = typeof Symbol === "function" && o[Symbol.iterator];
if (!m) return o;
var i = m.call(o), r, ar = [], e;
try {
while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
}
catch (error) { e = { error: error }; }
finally {
try {
if (r && !r.done && (m = i["return"])) m.call(i);
}
finally { if (e) throw e.error; }
}
return ar;
};
/** @deprecated */
__spread = function () {
for (var ar = [], i = 0; i < arguments.length; i++)
ar = ar.concat(__read(arguments[i]));
return ar;
};
/** @deprecated */
__spreadArrays = function () {
for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;
for (var r = Array(s), k = 0, i = 0; i < il; i++)
for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
r[k] = a[j];
return r;
};
__spreadArray = function (to, from, pack) {
if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {
if (ar || !(i in from)) {
if (!ar) ar = Array.prototype.slice.call(from, 0, i);
ar[i] = from[i];
}
}
return to.concat(ar || Array.prototype.slice.call(from));
};
__await = function (v) {
return this instanceof __await ? (this.v = v, this) : new __await(v);
};
__asyncGenerator = function (thisArg, _arguments, generator) {
if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
var g = generator.apply(thisArg, _arguments || []), i, q = [];
return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
function fulfill(value) { resume("next", value); }
function reject(value) { resume("throw", value); }
function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
};
__asyncDelegator = function (o) {
var i, p;
return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; } : f; }
};
__asyncValues = function (o) {
if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
var m = o[Symbol.asyncIterator], i;
return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
};
__makeTemplateObject = function (cooked, raw) {
if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
return cooked;
};
var __setModuleDefault = Object.create ? (function(o, v) {
Object.defineProperty(o, "default", { enumerable: true, value: v });
}) : function(o, v) {
o["default"] = v;
};
__importStar = function (mod) {
if (mod && mod.__esModule) return mod;
var result = {};
if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
__setModuleDefault(result, mod);
return result;
};
__importDefault = function (mod) {
return (mod && mod.__esModule) ? mod : { "default": mod };
};
__classPrivateFieldGet = function (receiver, state, kind, f) {
if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter");
if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it");
return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver);
};
__classPrivateFieldSet = function (receiver, state, value, kind, f) {
if (kind === "m") throw new TypeError("Private method is not writable");
if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter");
if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it");
return (kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;
};
__classPrivateFieldIn = function (state, receiver) {
if (receiver === null || (typeof receiver !== "object" && typeof receiver !== "function")) throw new TypeError("Cannot use 'in' operator on non-object");
return typeof state === "function" ? receiver === state : state.has(receiver);
};
__addDisposableResource = function (env, value, async) {
if (value !== null && value !== void 0) {
if (typeof value !== "object" && typeof value !== "function") throw new TypeError("Object expected.");
var dispose;
if (async) {
if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined.");
dispose = value[Symbol.asyncDispose];
}
if (dispose === void 0) {
if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined.");
dispose = value[Symbol.dispose];
}
if (typeof dispose !== "function") throw new TypeError("Object not disposable.");
env.stack.push({ value: value, dispose: dispose, async: async });
}
else if (async) {
env.stack.push({ async: true });
}
return value;
};
var _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function (error, suppressed, message) {
var e = new Error(message);
return e.name = "SuppressedError", e.error = error, e.suppressed = suppressed, e;
};
__disposeResources = function (env) {
function fail(e) {
env.error = env.hasError ? new _SuppressedError(e, env.error, "An error was suppressed during disposal.") : e;
env.hasError = true;
}
function next() {
while (env.stack.length) {
var rec = env.stack.pop();
try {
var result = rec.dispose && rec.dispose.call(rec.value);
if (rec.async) return Promise.resolve(result).then(next, function(e) { fail(e); return next(); });
}
catch (e) {
fail(e);
}
}
if (env.hasError) throw env.error;
}
return next();
};
exporter("__extends", __extends);
exporter("__assign", __assign);
exporter("__rest", __rest);
exporter("__decorate", __decorate);
exporter("__param", __param);
exporter("__esDecorate", __esDecorate);
exporter("__runInitializers", __runInitializers);
exporter("__propKey", __propKey);
exporter("__setFunctionName", __setFunctionName);
exporter("__metadata", __metadata);
exporter("__awaiter", __awaiter);
exporter("__generator", __generator);
exporter("__exportStar", __exportStar);
exporter("__createBinding", __createBinding);
exporter("__values", __values);
exporter("__read", __read);
exporter("__spread", __spread);
exporter("__spreadArrays", __spreadArrays);
exporter("__spreadArray", __spreadArray);
exporter("__await", __await);
exporter("__asyncGenerator", __asyncGenerator);
exporter("__asyncDelegator", __asyncDelegator);
exporter("__asyncValues", __asyncValues);
exporter("__makeTemplateObject", __makeTemplateObject);
exporter("__importStar", __importStar);
exporter("__importDefault", __importDefault);
exporter("__classPrivateFieldGet", __classPrivateFieldGet);
exporter("__classPrivateFieldSet", __classPrivateFieldSet);
exporter("__classPrivateFieldIn", __classPrivateFieldIn);
exporter("__addDisposableResource", __addDisposableResource);
exporter("__disposeResources", __disposeResources);
});
/***/ }),
/***/ 74294:
/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => {
module.exports = __nccwpck_require__(54219);
/***/ }),
/***/ 54219:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
var net = __nccwpck_require__(41808);
var tls = __nccwpck_require__(24404);
var http = __nccwpck_require__(13685);
var https = __nccwpck_require__(95687);
var events = __nccwpck_require__(82361);
var assert = __nccwpck_require__(39491);
var util = __nccwpck_require__(73837);
exports.httpOverHttp = httpOverHttp;
exports.httpsOverHttp = httpsOverHttp;
exports.httpOverHttps = httpOverHttps;
exports.httpsOverHttps = httpsOverHttps;
function httpOverHttp(options) {
var agent = new TunnelingAgent(options);
agent.request = http.request;
return agent;
}
function httpsOverHttp(options) {
var agent = new TunnelingAgent(options);
agent.request = http.request;
agent.createSocket = createSecureSocket;
agent.defaultPort = 443;
return agent;
}
function httpOverHttps(options) {
var agent = new TunnelingAgent(options);
agent.request = https.request;
return agent;
}
function httpsOverHttps(options) {
var agent = new TunnelingAgent(options);
agent.request = https.request;
agent.createSocket = createSecureSocket;
agent.defaultPort = 443;
return agent;
}
function TunnelingAgent(options) {
var self = this;
self.options = options || {};
self.proxyOptions = self.options.proxy || {};
self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets;
self.requests = [];
self.sockets = [];
self.on('free', function onFree(socket, host, port, localAddress) {
var options = toOptions(host, port, localAddress);
for (var i = 0, len = self.requests.length; i < len; ++i) {
var pending = self.requests[i];
if (pending.host === options.host && pending.port === options.port) {
// Detect the request to connect same origin server,
// reuse the connection.
self.requests.splice(i, 1);
pending.request.onSocket(socket);
return;
}
}
socket.destroy();
self.removeSocket(socket);
});
}
util.inherits(TunnelingAgent, events.EventEmitter);
TunnelingAgent.prototype.addRequest = function addRequest(req, host, port, localAddress) {
var self = this;
var options = mergeOptions({request: req}, self.options, toOptions(host, port, localAddress));
if (self.sockets.length >= this.maxSockets) {
// We are over limit so we'll add it to the queue.
self.requests.push(options);
return;
}
// If we are under maxSockets create a new one.
self.createSocket(options, function(socket) {
socket.on('free', onFree);
socket.on('close', onCloseOrRemove);
socket.on('agentRemove', onCloseOrRemove);
req.onSocket(socket);
function onFree() {
self.emit('free', socket, options);
}
function onCloseOrRemove(err) {
self.removeSocket(socket);
socket.removeListener('free', onFree);
socket.removeListener('close', onCloseOrRemove);
socket.removeListener('agentRemove', onCloseOrRemove);
}
});
};
TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
var self = this;
var placeholder = {};
self.sockets.push(placeholder);
var connectOptions = mergeOptions({}, self.proxyOptions, {
method: 'CONNECT',
path: options.host + ':' + options.port,
agent: false,
headers: {
host: options.host + ':' + options.port
}
});
if (options.localAddress) {
connectOptions.localAddress = options.localAddress;
}
if (connectOptions.proxyAuth) {
connectOptions.headers = connectOptions.headers || {};
connectOptions.headers['Proxy-Authorization'] = 'Basic ' +
new Buffer(connectOptions.proxyAuth).toString('base64');
}
debug('making CONNECT request');
var connectReq = self.request(connectOptions);
connectReq.useChunkedEncodingByDefault = false; // for v0.6
connectReq.once('response', onResponse); // for v0.6
connectReq.once('upgrade', onUpgrade); // for v0.6
connectReq.once('connect', onConnect); // for v0.7 or later
connectReq.once('error', onError);
connectReq.end();
function onResponse(res) {
// Very hacky. This is necessary to avoid http-parser leaks.
res.upgrade = true;
}
function onUpgrade(res, socket, head) {
// Hacky.
process.nextTick(function() {
onConnect(res, socket, head);
});
}
function onConnect(res, socket, head) {
connectReq.removeAllListeners();
socket.removeAllListeners();
if (res.statusCode !== 200) {
debug('tunneling socket could not be established, statusCode=%d',
res.statusCode);
socket.destroy();
var error = new Error('tunneling socket could not be established, ' +
'statusCode=' + res.statusCode);
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
return;
}
if (head.length > 0) {
debug('got illegal response body from proxy');
socket.destroy();
var error = new Error('got illegal response body from proxy');
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
return;
}
debug('tunneling connection has established');
self.sockets[self.sockets.indexOf(placeholder)] = socket;
return cb(socket);
}
function onError(cause) {
connectReq.removeAllListeners();
debug('tunneling socket could not be established, cause=%s\n',
cause.message, cause.stack);
var error = new Error('tunneling socket could not be established, ' +
'cause=' + cause.message);
error.code = 'ECONNRESET';
options.request.emit('error', error);
self.removeSocket(placeholder);
}
};
TunnelingAgent.prototype.removeSocket = function removeSocket(socket) {
var pos = this.sockets.indexOf(socket)
if (pos === -1) {
return;
}
this.sockets.splice(pos, 1);
var pending = this.requests.shift();
if (pending) {
// If we have pending requests and a socket gets closed a new one
// needs to be created to take over in the pool for the one that closed.
this.createSocket(pending, function(socket) {
pending.request.onSocket(socket);
});
}
};
function createSecureSocket(options, cb) {
var self = this;
TunnelingAgent.prototype.createSocket.call(self, options, function(socket) {
var hostHeader = options.request.getHeader('host');
var tlsOptions = mergeOptions({}, self.options, {
socket: socket,
servername: hostHeader ? hostHeader.replace(/:.*$/, '') : options.host
});
// 0 is dummy port for v0.6
var secureSocket = tls.connect(0, tlsOptions);
self.sockets[self.sockets.indexOf(socket)] = secureSocket;
cb(secureSocket);
});
}
function toOptions(host, port, localAddress) {
if (typeof host === 'string') { // since v0.10
return {
host: host,
port: port,
localAddress: localAddress
};
}
return host; // for v0.11 or later
}
function mergeOptions(target) {
for (var i = 1, len = arguments.length; i < len; ++i) {
var overrides = arguments[i];
if (typeof overrides === 'object') {
var keys = Object.keys(overrides);
for (var j = 0, keyLen = keys.length; j < keyLen; ++j) {
var k = keys[j];
if (overrides[k] !== undefined) {
target[k] = overrides[k];
}
}
}
}
return target;
}
var debug;
if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) {
debug = function() {
var args = Array.prototype.slice.call(arguments);
if (typeof args[0] === 'string') {
args[0] = 'TUNNEL: ' + args[0];
} else {
args.unshift('TUNNEL:');
}
console.error.apply(console, args);
}
} else {
debug = function() {};
}
exports.debug = debug; // for test
/***/ }),
/***/ 75840:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
Object.defineProperty(exports, "v1", ({
enumerable: true,
get: function () {
return _v.default;
}
}));
Object.defineProperty(exports, "v3", ({
enumerable: true,
get: function () {
return _v2.default;
}
}));
Object.defineProperty(exports, "v4", ({
enumerable: true,
get: function () {
return _v3.default;
}
}));
Object.defineProperty(exports, "v5", ({
enumerable: true,
get: function () {
return _v4.default;
}
}));
Object.defineProperty(exports, "NIL", ({
enumerable: true,
get: function () {
return _nil.default;
}
}));
Object.defineProperty(exports, "version", ({
enumerable: true,
get: function () {
return _version.default;
}
}));
Object.defineProperty(exports, "validate", ({
enumerable: true,
get: function () {
return _validate.default;
}
}));
Object.defineProperty(exports, "stringify", ({
enumerable: true,
get: function () {
return _stringify.default;
}
}));
Object.defineProperty(exports, "parse", ({
enumerable: true,
get: function () {
return _parse.default;
}
}));
var _v = _interopRequireDefault(__nccwpck_require__(78628));
var _v2 = _interopRequireDefault(__nccwpck_require__(86409));
var _v3 = _interopRequireDefault(__nccwpck_require__(85122));
var _v4 = _interopRequireDefault(__nccwpck_require__(79120));
var _nil = _interopRequireDefault(__nccwpck_require__(25332));
var _version = _interopRequireDefault(__nccwpck_require__(81595));
var _validate = _interopRequireDefault(__nccwpck_require__(66900));
var _stringify = _interopRequireDefault(__nccwpck_require__(18950));
var _parse = _interopRequireDefault(__nccwpck_require__(62746));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
/***/ }),
/***/ 4569:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _crypto = _interopRequireDefault(__nccwpck_require__(6113));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function md5(bytes) {
if (Array.isArray(bytes)) {
bytes = Buffer.from(bytes);
} else if (typeof bytes === 'string') {
bytes = Buffer.from(bytes, 'utf8');
}
return _crypto.default.createHash('md5').update(bytes).digest();
}
var _default = md5;
exports["default"] = _default;
/***/ }),
/***/ 25332:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _default = '00000000-0000-0000-0000-000000000000';
exports["default"] = _default;
/***/ }),
/***/ 62746:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _validate = _interopRequireDefault(__nccwpck_require__(66900));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function parse(uuid) {
if (!(0, _validate.default)(uuid)) {
throw TypeError('Invalid UUID');
}
let v;
const arr = new Uint8Array(16); // Parse ########-....-....-....-............
arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24;
arr[1] = v >>> 16 & 0xff;
arr[2] = v >>> 8 & 0xff;
arr[3] = v & 0xff; // Parse ........-####-....-....-............
arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8;
arr[5] = v & 0xff; // Parse ........-....-####-....-............
arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8;
arr[7] = v & 0xff; // Parse ........-....-....-####-............
arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8;
arr[9] = v & 0xff; // Parse ........-....-....-....-############
// (Use "/" to avoid 32-bit truncation when bit-shifting high-order bytes)
arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 0x10000000000 & 0xff;
arr[11] = v / 0x100000000 & 0xff;
arr[12] = v >>> 24 & 0xff;
arr[13] = v >>> 16 & 0xff;
arr[14] = v >>> 8 & 0xff;
arr[15] = v & 0xff;
return arr;
}
var _default = parse;
exports["default"] = _default;
/***/ }),
/***/ 40814:
/***/ ((__unused_webpack_module, exports) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i;
exports["default"] = _default;
/***/ }),
/***/ 50807:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = rng;
var _crypto = _interopRequireDefault(__nccwpck_require__(6113));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
const rnds8Pool = new Uint8Array(256); // # of random values to pre-allocate
let poolPtr = rnds8Pool.length;
function rng() {
if (poolPtr > rnds8Pool.length - 16) {
_crypto.default.randomFillSync(rnds8Pool);
poolPtr = 0;
}
return rnds8Pool.slice(poolPtr, poolPtr += 16);
}
/***/ }),
/***/ 85274:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _crypto = _interopRequireDefault(__nccwpck_require__(6113));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function sha1(bytes) {
if (Array.isArray(bytes)) {
bytes = Buffer.from(bytes);
} else if (typeof bytes === 'string') {
bytes = Buffer.from(bytes, 'utf8');
}
return _crypto.default.createHash('sha1').update(bytes).digest();
}
var _default = sha1;
exports["default"] = _default;
/***/ }),
/***/ 18950:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _validate = _interopRequireDefault(__nccwpck_require__(66900));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
/**
* Convert array of 16 byte values to UUID string format of the form:
* XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX
*/
const byteToHex = [];
for (let i = 0; i < 256; ++i) {
byteToHex.push((i + 0x100).toString(16).substr(1));
}
function stringify(arr, offset = 0) {
// Note: Be careful editing this code! It's been tuned for performance
// and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434
const uuid = (byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]).toLowerCase(); // Consistency check for valid UUID. If this throws, it's likely due to one
// of the following:
// - One or more input array values don't map to a hex octet (leading to
// "undefined" in the uuid)
// - Invalid input values for the RFC `version` or `variant` fields
if (!(0, _validate.default)(uuid)) {
throw TypeError('Stringified UUID is invalid');
}
return uuid;
}
var _default = stringify;
exports["default"] = _default;
/***/ }),
/***/ 78628:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _rng = _interopRequireDefault(__nccwpck_require__(50807));
var _stringify = _interopRequireDefault(__nccwpck_require__(18950));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
// **`v1()` - Generate time-based UUID**
//
// Inspired by https://github.com/LiosK/UUID.js
// and http://docs.python.org/library/uuid.html
let _nodeId;
let _clockseq; // Previous uuid creation time
let _lastMSecs = 0;
let _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details
function v1(options, buf, offset) {
let i = buf && offset || 0;
const b = buf || new Array(16);
options = options || {};
let node = options.node || _nodeId;
let clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not
// specified. We do this lazily to minimize issues related to insufficient
// system entropy. See #189
if (node == null || clockseq == null) {
const seedBytes = options.random || (options.rng || _rng.default)();
if (node == null) {
// Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1)
node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]];
}
if (clockseq == null) {
// Per 4.2.2, randomize (14 bit) clockseq
clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff;
}
} // UUID timestamps are 100 nano-second units since the Gregorian epoch,
// (1582-10-15 00:00). JSNumbers aren't precise enough for this, so
// time is handled internally as 'msecs' (integer milliseconds) and 'nsecs'
// (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00.
let msecs = options.msecs !== undefined ? options.msecs : Date.now(); // Per 4.2.1.2, use count of uuid's generated during the current clock
// cycle to simulate higher resolution clock
let nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs)
const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression
if (dt < 0 && options.clockseq === undefined) {
clockseq = clockseq + 1 & 0x3fff;
} // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new
// time interval
if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) {
nsecs = 0;
} // Per 4.2.1.2 Throw error if too many uuids are requested
if (nsecs >= 10000) {
throw new Error("uuid.v1(): Can't create more than 10M uuids/sec");
}
_lastMSecs = msecs;
_lastNSecs = nsecs;
_clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch
msecs += 12219292800000; // `time_low`
const tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000;
b[i++] = tl >>> 24 & 0xff;
b[i++] = tl >>> 16 & 0xff;
b[i++] = tl >>> 8 & 0xff;
b[i++] = tl & 0xff; // `time_mid`
const tmh = msecs / 0x100000000 * 10000 & 0xfffffff;
b[i++] = tmh >>> 8 & 0xff;
b[i++] = tmh & 0xff; // `time_high_and_version`
b[i++] = tmh >>> 24 & 0xf | 0x10; // include version
b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant)
b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low`
b[i++] = clockseq & 0xff; // `node`
for (let n = 0; n < 6; ++n) {
b[i + n] = node[n];
}
return buf || (0, _stringify.default)(b);
}
var _default = v1;
exports["default"] = _default;
/***/ }),
/***/ 86409:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _v = _interopRequireDefault(__nccwpck_require__(65998));
var _md = _interopRequireDefault(__nccwpck_require__(4569));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
const v3 = (0, _v.default)('v3', 0x30, _md.default);
var _default = v3;
exports["default"] = _default;
/***/ }),
/***/ 65998:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = _default;
exports.URL = exports.DNS = void 0;
var _stringify = _interopRequireDefault(__nccwpck_require__(18950));
var _parse = _interopRequireDefault(__nccwpck_require__(62746));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function stringToBytes(str) {
str = unescape(encodeURIComponent(str)); // UTF8 escape
const bytes = [];
for (let i = 0; i < str.length; ++i) {
bytes.push(str.charCodeAt(i));
}
return bytes;
}
const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8';
exports.DNS = DNS;
const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8';
exports.URL = URL;
function _default(name, version, hashfunc) {
function generateUUID(value, namespace, buf, offset) {
if (typeof value === 'string') {
value = stringToBytes(value);
}
if (typeof namespace === 'string') {
namespace = (0, _parse.default)(namespace);
}
if (namespace.length !== 16) {
throw TypeError('Namespace must be array-like (16 iterable integer values, 0-255)');
} // Compute hash of namespace and value, Per 4.3
// Future: Use spread syntax when supported on all platforms, e.g. `bytes =
// hashfunc([...namespace, ... value])`
let bytes = new Uint8Array(16 + value.length);
bytes.set(namespace);
bytes.set(value, namespace.length);
bytes = hashfunc(bytes);
bytes[6] = bytes[6] & 0x0f | version;
bytes[8] = bytes[8] & 0x3f | 0x80;
if (buf) {
offset = offset || 0;
for (let i = 0; i < 16; ++i) {
buf[offset + i] = bytes[i];
}
return buf;
}
return (0, _stringify.default)(bytes);
} // Function#name is not settable on some platforms (#270)
try {
generateUUID.name = name; // eslint-disable-next-line no-empty
} catch (err) {} // For CommonJS default export support
generateUUID.DNS = DNS;
generateUUID.URL = URL;
return generateUUID;
}
/***/ }),
/***/ 85122:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _rng = _interopRequireDefault(__nccwpck_require__(50807));
var _stringify = _interopRequireDefault(__nccwpck_require__(18950));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function v4(options, buf, offset) {
options = options || {};
const rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved`
rnds[6] = rnds[6] & 0x0f | 0x40;
rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided
if (buf) {
offset = offset || 0;
for (let i = 0; i < 16; ++i) {
buf[offset + i] = rnds[i];
}
return buf;
}
return (0, _stringify.default)(rnds);
}
var _default = v4;
exports["default"] = _default;
/***/ }),
/***/ 79120:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _v = _interopRequireDefault(__nccwpck_require__(65998));
var _sha = _interopRequireDefault(__nccwpck_require__(85274));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
const v5 = (0, _v.default)('v5', 0x50, _sha.default);
var _default = v5;
exports["default"] = _default;
/***/ }),
/***/ 66900:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _regex = _interopRequireDefault(__nccwpck_require__(40814));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function validate(uuid) {
return typeof uuid === 'string' && _regex.default.test(uuid);
}
var _default = validate;
exports["default"] = _default;
/***/ }),
/***/ 81595:
/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => {
"use strict";
Object.defineProperty(exports, "__esModule", ({
value: true
}));
exports["default"] = void 0;
var _validate = _interopRequireDefault(__nccwpck_require__(66900));
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
function version(uuid) {
if (!(0, _validate.default)(uuid)) {
throw TypeError('Invalid UUID');
}
return parseInt(uuid.substr(14, 1), 16);
}
var _default = version;
exports["default"] = _default;
/***/ }),
/***/ 39491:
/***/ ((module) => {
"use strict";
module.exports = require("assert");
/***/ }),
/***/ 14300:
/***/ ((module) => {
"use strict";
module.exports = require("buffer");
/***/ }),
/***/ 32081:
/***/ ((module) => {
"use strict";
module.exports = require("child_process");
/***/ }),
/***/ 6113:
/***/ ((module) => {
"use strict";
module.exports = require("crypto");
/***/ }),
/***/ 82361:
/***/ ((module) => {
"use strict";
module.exports = require("events");
/***/ }),
/***/ 57147:
/***/ ((module) => {
"use strict";
module.exports = require("fs");
/***/ }),
/***/ 13685:
/***/ ((module) => {
"use strict";
module.exports = require("http");
/***/ }),
/***/ 85158:
/***/ ((module) => {
"use strict";
module.exports = require("http2");
/***/ }),
/***/ 95687:
/***/ ((module) => {
"use strict";
module.exports = require("https");
/***/ }),
/***/ 41808:
/***/ ((module) => {
"use strict";
module.exports = require("net");
/***/ }),
/***/ 22037:
/***/ ((module) => {
"use strict";
module.exports = require("os");
/***/ }),
/***/ 71017:
/***/ ((module) => {
"use strict";
module.exports = require("path");
/***/ }),
/***/ 77282:
/***/ ((module) => {
"use strict";
module.exports = require("process");
/***/ }),
/***/ 12781:
/***/ ((module) => {
"use strict";
module.exports = require("stream");
/***/ }),
/***/ 24404:
/***/ ((module) => {
"use strict";
module.exports = require("tls");
/***/ }),
/***/ 76224:
/***/ ((module) => {
"use strict";
module.exports = require("tty");
/***/ }),
/***/ 57310:
/***/ ((module) => {
"use strict";
module.exports = require("url");
/***/ }),
/***/ 73837:
/***/ ((module) => {
"use strict";
module.exports = require("util");
/***/ }),
/***/ 91092:
/***/ ((module) => {
"use strict";
module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.465.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/core":"3.465.0","@aws-sdk/middleware-host-header":"3.465.0","@aws-sdk/middleware-logger":"3.465.0","@aws-sdk/middleware-recursion-detection":"3.465.0","@aws-sdk/middleware-user-agent":"3.465.0","@aws-sdk/region-config-resolver":"3.465.0","@aws-sdk/types":"3.465.0","@aws-sdk/util-endpoints":"3.465.0","@aws-sdk/util-user-agent-browser":"3.465.0","@aws-sdk/util-user-agent-node":"3.465.0","@smithy/config-resolver":"^2.0.18","@smithy/fetch-http-handler":"^2.2.6","@smithy/hash-node":"^2.0.15","@smithy/invalid-dependency":"^2.0.13","@smithy/middleware-content-length":"^2.0.15","@smithy/middleware-endpoint":"^2.2.0","@smithy/middleware-retry":"^2.0.20","@smithy/middleware-serde":"^2.0.13","@smithy/middleware-stack":"^2.0.7","@smithy/node-config-provider":"^2.1.5","@smithy/node-http-handler":"^2.1.9","@smithy/protocol-http":"^3.0.9","@smithy/smithy-client":"^2.1.15","@smithy/types":"^2.5.0","@smithy/url-parser":"^2.0.13","@smithy/util-base64":"^2.0.1","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.19","@smithy/util-defaults-mode-node":"^2.0.25","@smithy/util-endpoints":"^1.0.4","@smithy/util-retry":"^2.0.6","@smithy/util-utf8":"^2.0.2","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}');
/***/ }),
/***/ 7947:
/***/ ((module) => {
"use strict";
module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native","version":"3.465.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sts","test":"yarn test:unit","test:unit":"jest"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"3.0.0","@aws-crypto/sha256-js":"3.0.0","@aws-sdk/core":"3.465.0","@aws-sdk/credential-provider-node":"3.465.0","@aws-sdk/middleware-host-header":"3.465.0","@aws-sdk/middleware-logger":"3.465.0","@aws-sdk/middleware-recursion-detection":"3.465.0","@aws-sdk/middleware-sdk-sts":"3.465.0","@aws-sdk/middleware-signing":"3.465.0","@aws-sdk/middleware-user-agent":"3.465.0","@aws-sdk/region-config-resolver":"3.465.0","@aws-sdk/types":"3.465.0","@aws-sdk/util-endpoints":"3.465.0","@aws-sdk/util-user-agent-browser":"3.465.0","@aws-sdk/util-user-agent-node":"3.465.0","@smithy/config-resolver":"^2.0.18","@smithy/fetch-http-handler":"^2.2.6","@smithy/hash-node":"^2.0.15","@smithy/invalid-dependency":"^2.0.13","@smithy/middleware-content-length":"^2.0.15","@smithy/middleware-endpoint":"^2.2.0","@smithy/middleware-retry":"^2.0.20","@smithy/middleware-serde":"^2.0.13","@smithy/middleware-stack":"^2.0.7","@smithy/node-config-provider":"^2.1.5","@smithy/node-http-handler":"^2.1.9","@smithy/protocol-http":"^3.0.9","@smithy/smithy-client":"^2.1.15","@smithy/types":"^2.5.0","@smithy/url-parser":"^2.0.13","@smithy/util-base64":"^2.0.1","@smithy/util-body-length-browser":"^2.0.0","@smithy/util-body-length-node":"^2.1.0","@smithy/util-defaults-mode-browser":"^2.0.19","@smithy/util-defaults-mode-node":"^2.0.25","@smithy/util-endpoints":"^1.0.4","@smithy/util-retry":"^2.0.6","@smithy/util-utf8":"^2.0.2","fast-xml-parser":"4.2.5","tslib":"^2.5.0"},"devDependencies":{"@smithy/service-client-documentation-generator":"^2.0.0","@tsconfig/node14":"1.0.3","@types/node":"^14.14.31","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=14.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sts"}}');
/***/ }),
/***/ 95367:
/***/ ((module) => {
"use strict";
module.exports = JSON.parse('{"partitions":[{"id":"aws","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","implicitGlobalRegion":"us-east-1","name":"aws","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^(us|eu|ap|sa|ca|me|af|il)\\\\-\\\\w+\\\\-\\\\d+$","regions":{"af-south-1":{"description":"Africa (Cape Town)"},"ap-east-1":{"description":"Asia Pacific (Hong Kong)"},"ap-northeast-1":{"description":"Asia Pacific (Tokyo)"},"ap-northeast-2":{"description":"Asia Pacific (Seoul)"},"ap-northeast-3":{"description":"Asia Pacific (Osaka)"},"ap-south-1":{"description":"Asia Pacific (Mumbai)"},"ap-south-2":{"description":"Asia Pacific (Hyderabad)"},"ap-southeast-1":{"description":"Asia Pacific (Singapore)"},"ap-southeast-2":{"description":"Asia Pacific (Sydney)"},"ap-southeast-3":{"description":"Asia Pacific (Jakarta)"},"ap-southeast-4":{"description":"Asia Pacific (Melbourne)"},"aws-global":{"description":"AWS Standard global region"},"ca-central-1":{"description":"Canada (Central)"},"eu-central-1":{"description":"Europe (Frankfurt)"},"eu-central-2":{"description":"Europe (Zurich)"},"eu-north-1":{"description":"Europe (Stockholm)"},"eu-south-1":{"description":"Europe (Milan)"},"eu-south-2":{"description":"Europe (Spain)"},"eu-west-1":{"description":"Europe (Ireland)"},"eu-west-2":{"description":"Europe (London)"},"eu-west-3":{"description":"Europe (Paris)"},"il-central-1":{"description":"Israel (Tel Aviv)"},"me-central-1":{"description":"Middle East (UAE)"},"me-south-1":{"description":"Middle East (Bahrain)"},"sa-east-1":{"description":"South America (Sao Paulo)"},"us-east-1":{"description":"US East (N. Virginia)"},"us-east-2":{"description":"US East (Ohio)"},"us-west-1":{"description":"US West (N. California)"},"us-west-2":{"description":"US West (Oregon)"}}},{"id":"aws-cn","outputs":{"dnsSuffix":"amazonaws.com.cn","dualStackDnsSuffix":"api.amazonwebservices.com.cn","implicitGlobalRegion":"cn-northwest-1","name":"aws-cn","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^cn\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-cn-global":{"description":"AWS China global region"},"cn-north-1":{"description":"China (Beijing)"},"cn-northwest-1":{"description":"China (Ningxia)"}}},{"id":"aws-us-gov","outputs":{"dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","implicitGlobalRegion":"us-gov-west-1","name":"aws-us-gov","supportsDualStack":true,"supportsFIPS":true},"regionRegex":"^us\\\\-gov\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-us-gov-global":{"description":"AWS GovCloud (US) global region"},"us-gov-east-1":{"description":"AWS GovCloud (US-East)"},"us-gov-west-1":{"description":"AWS GovCloud (US-West)"}}},{"id":"aws-iso","outputs":{"dnsSuffix":"c2s.ic.gov","dualStackDnsSuffix":"c2s.ic.gov","implicitGlobalRegion":"us-iso-east-1","name":"aws-iso","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-iso\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-global":{"description":"AWS ISO (US) global region"},"us-iso-east-1":{"description":"US ISO East"},"us-iso-west-1":{"description":"US ISO WEST"}}},{"id":"aws-iso-b","outputs":{"dnsSuffix":"sc2s.sgov.gov","dualStackDnsSuffix":"sc2s.sgov.gov","implicitGlobalRegion":"us-isob-east-1","name":"aws-iso-b","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isob\\\\-\\\\w+\\\\-\\\\d+$","regions":{"aws-iso-b-global":{"description":"AWS ISOB (US) global region"},"us-isob-east-1":{"description":"US ISOB East (Ohio)"}}},{"id":"aws-iso-e","outputs":{"dnsSuffix":"cloud.adc-e.uk","dualStackDnsSuffix":"cloud.adc-e.uk","implicitGlobalRegion":"eu-isoe-west-1","name":"aws-iso-e","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^eu\\\\-isoe\\\\-\\\\w+\\\\-\\\\d+$","regions":{}},{"id":"aws-iso-f","outputs":{"dnsSuffix":"csp.hci.ic.gov","dualStackDnsSuffix":"csp.hci.ic.gov","implicitGlobalRegion":"us-isof-south-1","name":"aws-iso-f","supportsDualStack":false,"supportsFIPS":true},"regionRegex":"^us\\\\-isof\\\\-\\\\w+\\\\-\\\\d+$","regions":{}}],"version":"1.1"}');
/***/ })
/******/ });
/************************************************************************/
/******/ // The module cache
/******/ var __webpack_module_cache__ = {};
/******/
/******/ // The require function
/******/ function __nccwpck_require__(moduleId) {
/******/ // Check if module is in cache
/******/ var cachedModule = __webpack_module_cache__[moduleId];
/******/ if (cachedModule !== undefined) {
/******/ return cachedModule.exports;
/******/ }
/******/ // Create a new module (and put it into the cache)
/******/ var module = __webpack_module_cache__[moduleId] = {
/******/ // no module.id needed
/******/ // no module.loaded needed
/******/ exports: {}
/******/ };
/******/
/******/ // Execute the module function
/******/ var threw = true;
/******/ try {
/******/ __webpack_modules__[moduleId].call(module.exports, module, module.exports, __nccwpck_require__);
/******/ threw = false;
/******/ } finally {
/******/ if(threw) delete __webpack_module_cache__[moduleId];
/******/ }
/******/
/******/ // Return the exports of the module
/******/ return module.exports;
/******/ }
/******/
/************************************************************************/
/******/ /* webpack/runtime/compat */
/******/
/******/ if (typeof __nccwpck_require__ !== 'undefined') __nccwpck_require__.ab = __dirname + "/";
/******/
/************************************************************************/
/******/
/******/ // startup
/******/ // Load entry module and return exports
/******/ // This entry module is referenced by other modules so it can't be inlined
/******/ var __webpack_exports__ = __nccwpck_require__(71667);
/******/ module.exports = __webpack_exports__;
/******/
/******/ })()
;
Reference in New Issue View Git Blame Copy Permalink