diff --git a/dist/cleanup/CredentialsClient.js b/dist/cleanup/CredentialsClient.js deleted file mode 100644 index 4ff4cc5..0000000 --- a/dist/cleanup/CredentialsClient.js +++ /dev/null @@ -1,114 +0,0 @@ -"use strict"; -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -var __generator = (this && this.__generator) || function (thisArg, body) { - var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; - return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; - function verb(n) { return function (v) { return step([n, v]); }; } - function step(op) { - if (f) throw new TypeError("Generator is already executing."); - while (_) try { - if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; - if (y = 0, t) op = [op[0] & 2, t.value]; - switch (op[0]) { - case 0: case 1: t = op; break; - case 4: _.label++; return { value: op[1], done: false }; - case 5: _.label++; y = op[1]; op = [0]; continue; - case 7: op = _.ops.pop(); _.trys.pop(); continue; - default: - if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } - if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } - if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } - if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } - if (t[2]) _.ops.pop(); - _.trys.pop(); continue; - } - op = body.call(thisArg, _); - } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } - if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; - } -}; -exports.__esModule = true; -exports.CredentialsClient = void 0; -var core_1 = require("@actions/core"); -var client_sts_1 = require("@aws-sdk/client-sts"); -var node_http_handler_1 = require("@aws-sdk/node-http-handler"); -var https_proxy_agent_1 = require("https-proxy-agent"); -var helpers_1 = require("./helpers"); -var USER_AGENT = 'configure-aws-credentials-for-github-actions'; -var CredentialsClient = /** @class */ (function () { - function CredentialsClient(props) { - if (props.region) { - this.region = props.region; - } - else { - (0, core_1.info)('No region provided, using global STS endpoint'); - } - if (props.proxyServer) { - (0, core_1.info)('Configurint proxy handler for STS client'); - var handler = new https_proxy_agent_1.HttpsProxyAgent(props.proxyServer); - this.requestHandler = new node_http_handler_1.NodeHttpHandler({ - httpAgent: handler, - httpsAgent: handler - }); - } - } - CredentialsClient.prototype.getStsClient = function () { - if (!this.stsClient) { - this.stsClient = new client_sts_1.STSClient({ - region: this.region ? this.region : undefined, - customUserAgent: USER_AGENT, - requestHandler: this.requestHandler ? this.requestHandler : undefined, - useGlobalEndpoint: this.region ? false : true - }); - } - return this.stsClient; - }; - CredentialsClient.prototype.validateCredentials = function (expectedAccessKeyId) { - return __awaiter(this, void 0, void 0, function () { - var credentials, error_1, actualAccessKeyId; - return __generator(this, function (_a) { - switch (_a.label) { - case 0: - _a.trys.push([0, 2, , 3]); - return [4 /*yield*/, this.loadCredentials()]; - case 1: - credentials = _a.sent(); - if (!credentials.accessKeyId) { - throw new Error('Access key ID empty after loading credentials'); - } - return [3 /*break*/, 3]; - case 2: - error_1 = _a.sent(); - throw new Error("Credentials could not be loaded, please check your action inputs: ".concat((0, helpers_1.errorMessage)(error_1))); - case 3: - actualAccessKeyId = credentials.accessKeyId; - if (expectedAccessKeyId && expectedAccessKeyId !== actualAccessKeyId) { - throw new Error('Unexpected failure: Credentials loaded by the SDK do not match the access key ID configured by the action'); - } - return [2 /*return*/]; - } - }); - }); - }; - CredentialsClient.prototype.loadCredentials = function () { - return __awaiter(this, void 0, void 0, function () { - var client; - return __generator(this, function (_a) { - client = new client_sts_1.STSClient({ - requestHandler: this.requestHandler ? this.requestHandler : undefined - }); - return [2 /*return*/, client.config.credentials()]; - }); - }); - }; - return CredentialsClient; -}()); -exports.CredentialsClient = CredentialsClient; diff --git a/dist/cleanup/cleanup/index.js b/dist/cleanup/cleanup/index.js deleted file mode 100644 index 266f504..0000000 --- a/dist/cleanup/cleanup/index.js +++ /dev/null @@ -1,41 +0,0 @@ -"use strict"; -exports.__esModule = true; -exports.cleanup = void 0; -var core = require("@actions/core"); -var helpers_1 = require("../helpers"); -/** - * When the GitHub Actions job is done, clean up any environment variables that - * may have been set by the configure-aws-credentials steps in the job. - * - * Environment variables are not intended to be shared across different jobs in - * the same GitHub Actions workflow: GitHub Actions documentation states that - * each job runs in a fresh instance. However, doing our own cleanup will - * give us additional assurance that these environment variables are not shared - * with any other jobs. - */ -function cleanup() { - try { - // The GitHub Actions toolkit does not have an option to completely unset - // environment variables, so we overwrite the current value with an empty - // string. The AWS CLI and AWS SDKs will behave correctly: they treat an - // empty string value as if the environment variable does not exist. - core.exportVariable('AWS_ACCESS_KEY_ID', ''); - core.exportVariable('AWS_SECRET_ACCESS_KEY', ''); - core.exportVariable('AWS_SESSION_TOKEN', ''); - core.exportVariable('AWS_DEFAULT_REGION', ''); - core.exportVariable('AWS_REGION', ''); - } - catch (error) { - core.setFailed((0, helpers_1.errorMessage)(error)); - } -} -exports.cleanup = cleanup; -/* c8 ignore start */ -if (require.main === module) { - try { - cleanup(); - } - catch (error) { - core.setFailed((0, helpers_1.errorMessage)(error)); - } -} diff --git a/dist/cleanup/helpers.js b/dist/cleanup/helpers.js deleted file mode 100644 index 874414a..0000000 --- a/dist/cleanup/helpers.js +++ /dev/null @@ -1,165 +0,0 @@ -"use strict"; -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -var __generator = (this && this.__generator) || function (thisArg, body) { - var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; - return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; - function verb(n) { return function (v) { return step([n, v]); }; } - function step(op) { - if (f) throw new TypeError("Generator is already executing."); - while (_) try { - if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; - if (y = 0, t) op = [op[0] & 2, t.value]; - switch (op[0]) { - case 0: case 1: t = op; break; - case 4: _.label++; return { value: op[1], done: false }; - case 5: _.label++; y = op[1]; op = [0]; continue; - case 7: op = _.ops.pop(); _.trys.pop(); continue; - default: - if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } - if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } - if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } - if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } - if (t[2]) _.ops.pop(); - _.trys.pop(); continue; - } - op = body.call(thisArg, _); - } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } - if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; - } -}; -exports.__esModule = true; -exports.isDefined = exports.errorMessage = exports.retryAndBackoff = exports.reset = exports.withsleep = exports.defaultSleep = exports.sanitizeGitHubVariables = exports.exportAccountId = exports.exportRegion = exports.exportCredentials = void 0; -var core = require("@actions/core"); -var client_sts_1 = require("@aws-sdk/client-sts"); -var MAX_TAG_VALUE_LENGTH = 256; -var SANITIZATION_CHARACTER = '_'; -// Configure the AWS CLI and AWS SDKs using environment variables and set them as secrets. -// Setting the credentials as secrets masks them in Github Actions logs -function exportCredentials(creds) { - if (creds === null || creds === void 0 ? void 0 : creds.AccessKeyId) { - core.setSecret(creds.AccessKeyId); - core.exportVariable('AWS_ACCESS_KEY_ID', creds.AccessKeyId); - } - if (creds === null || creds === void 0 ? void 0 : creds.SecretAccessKey) { - core.setSecret(creds.SecretAccessKey); - core.exportVariable('AWS_SECRET_ACCESS_KEY', creds.SecretAccessKey); - } - if (creds === null || creds === void 0 ? void 0 : creds.SessionToken) { - core.setSecret(creds.SessionToken); - core.exportVariable('AWS_SESSION_TOKEN', creds.SessionToken); - } - else if (process.env['AWS_SESSION_TOKEN']) { - // clear session token from previous credentials action - core.exportVariable('AWS_SESSION_TOKEN', ''); - } -} -exports.exportCredentials = exportCredentials; -function exportRegion(region) { - core.exportVariable('AWS_DEFAULT_REGION', region); - core.exportVariable('AWS_REGION', region); -} -exports.exportRegion = exportRegion; -// Obtains account ID from STS Client and sets it as output -function exportAccountId(credentialsClient, maskAccountId) { - return __awaiter(this, void 0, void 0, function () { - var client, identity, accountId; - return __generator(this, function (_a) { - switch (_a.label) { - case 0: - client = credentialsClient.getStsClient(); - return [4 /*yield*/, client.send(new client_sts_1.GetCallerIdentityCommand({}))]; - case 1: - identity = _a.sent(); - accountId = identity.Account; - if (!accountId) { - throw new Error('Could not get Account ID from STS. Did you set credentials?'); - } - if (maskAccountId) { - core.setSecret(accountId); - } - core.setOutput('aws-account-id', accountId); - return [2 /*return*/, accountId]; - } - }); - }); -} -exports.exportAccountId = exportAccountId; -// Tags have a more restrictive set of acceptable characters than GitHub environment variables can. -// This replaces anything not conforming to the tag restrictions by inverting the regular expression. -// See the AWS documentation for constraint specifics https://docs.aws.amazon.com/STS/latest/APIReference/API_Tag.html. -function sanitizeGitHubVariables(name) { - var nameWithoutSpecialCharacters = name.replace(/[^\p{L}\p{Z}\p{N}_.:/=+\-@]/gu, SANITIZATION_CHARACTER); - var nameTruncated = nameWithoutSpecialCharacters.slice(0, MAX_TAG_VALUE_LENGTH); - return nameTruncated; -} -exports.sanitizeGitHubVariables = sanitizeGitHubVariables; -function defaultSleep(ms) { - return __awaiter(this, void 0, void 0, function () { - return __generator(this, function (_a) { - return [2 /*return*/, new Promise(function (resolve) { return setTimeout(resolve, ms); })]; - }); - }); -} -exports.defaultSleep = defaultSleep; -var sleep = defaultSleep; -function withsleep(s) { - sleep = s; -} -exports.withsleep = withsleep; -function reset() { - sleep = defaultSleep; -} -exports.reset = reset; -// Retries the promise with exponential backoff if the error isRetryable up to maxRetries time. -function retryAndBackoff(fn, isRetryable, retries, maxRetries, base) { - if (retries === void 0) { retries = 0; } - if (maxRetries === void 0) { maxRetries = 12; } - if (base === void 0) { base = 50; } - return __awaiter(this, void 0, void 0, function () { - var err_1; - return __generator(this, function (_a) { - switch (_a.label) { - case 0: - _a.trys.push([0, 2, , 5]); - return [4 /*yield*/, fn()]; - case 1: return [2 /*return*/, _a.sent()]; - case 2: - err_1 = _a.sent(); - if (!isRetryable) { - throw err_1; - } - // It's retryable, so sleep and retry. - return [4 /*yield*/, sleep(Math.random() * (Math.pow(2, retries) * base))]; - case 3: - // It's retryable, so sleep and retry. - _a.sent(); - retries += 1; - if (retries === maxRetries) { - throw err_1; - } - return [4 /*yield*/, retryAndBackoff(fn, isRetryable, retries, maxRetries, base)]; - case 4: return [2 /*return*/, _a.sent()]; - case 5: return [2 /*return*/]; - } - }); - }); -} -exports.retryAndBackoff = retryAndBackoff; -/* c8 ignore start */ -function errorMessage(error) { - return error instanceof Error ? error.message : String(error); -} -exports.errorMessage = errorMessage; -function isDefined(i) { - return i !== undefined && i !== null; -} -exports.isDefined = isDefined; -/* c8 ignore stop */ diff --git a/dist/cleanup/index.js b/dist/cleanup/index.js new file mode 100644 index 0000000..9071e50 --- /dev/null +++ b/dist/cleanup/index.js @@ -0,0 +1,17901 @@ +/******/ (() => { // webpackBootstrap +/******/ var __webpack_modules__ = ({ + +/***/ 7351: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.issue = exports.issueCommand = void 0; +const os = __importStar(__nccwpck_require__(2037)); +const utils_1 = __nccwpck_require__(5278); +/** + * Commands + * + * Command Format: + * ::name key=value,key=value::message + * + * Examples: + * ::warning::This is the message + * ::set-env name=MY_VAR::some value + */ +function issueCommand(command, properties, message) { + const cmd = new Command(command, properties, message); + process.stdout.write(cmd.toString() + os.EOL); +} +exports.issueCommand = issueCommand; +function issue(name, message = '') { + issueCommand(name, {}, message); +} +exports.issue = issue; +const CMD_STRING = '::'; +class Command { + constructor(command, properties, message) { + if (!command) { + command = 'missing.command'; + } + this.command = command; + this.properties = properties; + this.message = message; + } + toString() { + let cmdStr = CMD_STRING + this.command; + if (this.properties && Object.keys(this.properties).length > 0) { + cmdStr += ' '; + let first = true; + for (const key in this.properties) { + if (this.properties.hasOwnProperty(key)) { + const val = this.properties[key]; + if (val) { + if (first) { + first = false; + } + else { + cmdStr += ','; + } + cmdStr += `${key}=${escapeProperty(val)}`; + } + } + } + } + cmdStr += `${CMD_STRING}${escapeData(this.message)}`; + return cmdStr; + } +} +function escapeData(s) { + return utils_1.toCommandValue(s) + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A'); +} +function escapeProperty(s) { + return utils_1.toCommandValue(s) + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A') + .replace(/:/g, '%3A') + .replace(/,/g, '%2C'); +} +//# sourceMappingURL=command.js.map + +/***/ }), + +/***/ 2186: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getIDToken = exports.getState = exports.saveState = exports.group = exports.endGroup = exports.startGroup = exports.info = exports.notice = exports.warning = exports.error = exports.debug = exports.isDebug = exports.setFailed = exports.setCommandEcho = exports.setOutput = exports.getBooleanInput = exports.getMultilineInput = exports.getInput = exports.addPath = exports.setSecret = exports.exportVariable = exports.ExitCode = void 0; +const command_1 = __nccwpck_require__(7351); +const file_command_1 = __nccwpck_require__(717); +const utils_1 = __nccwpck_require__(5278); +const os = __importStar(__nccwpck_require__(2037)); +const path = __importStar(__nccwpck_require__(1017)); +const oidc_utils_1 = __nccwpck_require__(8041); +/** + * The code to exit an action + */ +var ExitCode; +(function (ExitCode) { + /** + * A code indicating that the action was successful + */ + ExitCode[ExitCode["Success"] = 0] = "Success"; + /** + * A code indicating that the action was a failure + */ + ExitCode[ExitCode["Failure"] = 1] = "Failure"; +})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); +//----------------------------------------------------------------------- +// Variables +//----------------------------------------------------------------------- +/** + * Sets env variable for this action and future actions in the job + * @param name the name of the variable to set + * @param val the value of the variable. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function exportVariable(name, val) { + const convertedVal = utils_1.toCommandValue(val); + process.env[name] = convertedVal; + const filePath = process.env['GITHUB_ENV'] || ''; + if (filePath) { + return file_command_1.issueFileCommand('ENV', file_command_1.prepareKeyValueMessage(name, val)); + } + command_1.issueCommand('set-env', { name }, convertedVal); +} +exports.exportVariable = exportVariable; +/** + * Registers a secret which will get masked from logs + * @param secret value of the secret + */ +function setSecret(secret) { + command_1.issueCommand('add-mask', {}, secret); +} +exports.setSecret = setSecret; +/** + * Prepends inputPath to the PATH (for this action and future actions) + * @param inputPath + */ +function addPath(inputPath) { + const filePath = process.env['GITHUB_PATH'] || ''; + if (filePath) { + file_command_1.issueFileCommand('PATH', inputPath); + } + else { + command_1.issueCommand('add-path', {}, inputPath); + } + process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; +} +exports.addPath = addPath; +/** + * Gets the value of an input. + * Unless trimWhitespace is set to false in InputOptions, the value is also trimmed. + * Returns an empty string if the value is not defined. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string + */ +function getInput(name, options) { + const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; + if (options && options.required && !val) { + throw new Error(`Input required and not supplied: ${name}`); + } + if (options && options.trimWhitespace === false) { + return val; + } + return val.trim(); +} +exports.getInput = getInput; +/** + * Gets the values of an multiline input. Each value is also trimmed. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string[] + * + */ +function getMultilineInput(name, options) { + const inputs = getInput(name, options) + .split('\n') + .filter(x => x !== ''); + if (options && options.trimWhitespace === false) { + return inputs; + } + return inputs.map(input => input.trim()); +} +exports.getMultilineInput = getMultilineInput; +/** + * Gets the input value of the boolean type in the YAML 1.2 "core schema" specification. + * Support boolean input list: `true | True | TRUE | false | False | FALSE` . + * The return value is also in boolean type. + * ref: https://yaml.org/spec/1.2/spec.html#id2804923 + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns boolean + */ +function getBooleanInput(name, options) { + const trueValue = ['true', 'True', 'TRUE']; + const falseValue = ['false', 'False', 'FALSE']; + const val = getInput(name, options); + if (trueValue.includes(val)) + return true; + if (falseValue.includes(val)) + return false; + throw new TypeError(`Input does not meet YAML 1.2 "Core Schema" specification: ${name}\n` + + `Support boolean input list: \`true | True | TRUE | false | False | FALSE\``); +} +exports.getBooleanInput = getBooleanInput; +/** + * Sets the value of an output. + * + * @param name name of the output to set + * @param value value to store. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function setOutput(name, value) { + const filePath = process.env['GITHUB_OUTPUT'] || ''; + if (filePath) { + return file_command_1.issueFileCommand('OUTPUT', file_command_1.prepareKeyValueMessage(name, value)); + } + process.stdout.write(os.EOL); + command_1.issueCommand('set-output', { name }, utils_1.toCommandValue(value)); +} +exports.setOutput = setOutput; +/** + * Enables or disables the echoing of commands into stdout for the rest of the step. + * Echoing is disabled by default if ACTIONS_STEP_DEBUG is not set. + * + */ +function setCommandEcho(enabled) { + command_1.issue('echo', enabled ? 'on' : 'off'); +} +exports.setCommandEcho = setCommandEcho; +//----------------------------------------------------------------------- +// Results +//----------------------------------------------------------------------- +/** + * Sets the action status to failed. + * When the action exits it will be with an exit code of 1 + * @param message add error issue message + */ +function setFailed(message) { + process.exitCode = ExitCode.Failure; + error(message); +} +exports.setFailed = setFailed; +//----------------------------------------------------------------------- +// Logging Commands +//----------------------------------------------------------------------- +/** + * Gets whether Actions Step Debug is on or not + */ +function isDebug() { + return process.env['RUNNER_DEBUG'] === '1'; +} +exports.isDebug = isDebug; +/** + * Writes debug message to user log + * @param message debug message + */ +function debug(message) { + command_1.issueCommand('debug', {}, message); +} +exports.debug = debug; +/** + * Adds an error issue + * @param message error issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. + */ +function error(message, properties = {}) { + command_1.issueCommand('error', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); +} +exports.error = error; +/** + * Adds a warning issue + * @param message warning issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. + */ +function warning(message, properties = {}) { + command_1.issueCommand('warning', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); +} +exports.warning = warning; +/** + * Adds a notice issue + * @param message notice issue message. Errors will be converted to string via toString() + * @param properties optional properties to add to the annotation. + */ +function notice(message, properties = {}) { + command_1.issueCommand('notice', utils_1.toCommandProperties(properties), message instanceof Error ? message.toString() : message); +} +exports.notice = notice; +/** + * Writes info to log with console.log. + * @param message info message + */ +function info(message) { + process.stdout.write(message + os.EOL); +} +exports.info = info; +/** + * Begin an output group. + * + * Output until the next `groupEnd` will be foldable in this group + * + * @param name The name of the output group + */ +function startGroup(name) { + command_1.issue('group', name); +} +exports.startGroup = startGroup; +/** + * End an output group. + */ +function endGroup() { + command_1.issue('endgroup'); +} +exports.endGroup = endGroup; +/** + * Wrap an asynchronous function call in a group. + * + * Returns the same type as the function itself. + * + * @param name The name of the group + * @param fn The function to wrap in the group + */ +function group(name, fn) { + return __awaiter(this, void 0, void 0, function* () { + startGroup(name); + let result; + try { + result = yield fn(); + } + finally { + endGroup(); + } + return result; + }); +} +exports.group = group; +//----------------------------------------------------------------------- +// Wrapper action state +//----------------------------------------------------------------------- +/** + * Saves state for current action, the state can only be retrieved by this action's post job execution. + * + * @param name name of the state to store + * @param value value to store. Non-string values will be converted to a string via JSON.stringify + */ +// eslint-disable-next-line @typescript-eslint/no-explicit-any +function saveState(name, value) { + const filePath = process.env['GITHUB_STATE'] || ''; + if (filePath) { + return file_command_1.issueFileCommand('STATE', file_command_1.prepareKeyValueMessage(name, value)); + } + command_1.issueCommand('save-state', { name }, utils_1.toCommandValue(value)); +} +exports.saveState = saveState; +/** + * Gets the value of an state set by this action's main execution. + * + * @param name name of the state to get + * @returns string + */ +function getState(name) { + return process.env[`STATE_${name}`] || ''; +} +exports.getState = getState; +function getIDToken(aud) { + return __awaiter(this, void 0, void 0, function* () { + return yield oidc_utils_1.OidcClient.getIDToken(aud); + }); +} +exports.getIDToken = getIDToken; +/** + * Summary exports + */ +var summary_1 = __nccwpck_require__(1327); +Object.defineProperty(exports, "summary", ({ enumerable: true, get: function () { return summary_1.summary; } })); +/** + * @deprecated use core.summary + */ +var summary_2 = __nccwpck_require__(1327); +Object.defineProperty(exports, "markdownSummary", ({ enumerable: true, get: function () { return summary_2.markdownSummary; } })); +/** + * Path exports + */ +var path_utils_1 = __nccwpck_require__(2981); +Object.defineProperty(exports, "toPosixPath", ({ enumerable: true, get: function () { return path_utils_1.toPosixPath; } })); +Object.defineProperty(exports, "toWin32Path", ({ enumerable: true, get: function () { return path_utils_1.toWin32Path; } })); +Object.defineProperty(exports, "toPlatformPath", ({ enumerable: true, get: function () { return path_utils_1.toPlatformPath; } })); +//# sourceMappingURL=core.js.map + +/***/ }), + +/***/ 717: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +// For internal use, subject to change. +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.prepareKeyValueMessage = exports.issueFileCommand = void 0; +// We use any as a valid input type +/* eslint-disable @typescript-eslint/no-explicit-any */ +const fs = __importStar(__nccwpck_require__(7147)); +const os = __importStar(__nccwpck_require__(2037)); +const uuid_1 = __nccwpck_require__(5840); +const utils_1 = __nccwpck_require__(5278); +function issueFileCommand(command, message) { + const filePath = process.env[`GITHUB_${command}`]; + if (!filePath) { + throw new Error(`Unable to find environment variable for file command ${command}`); + } + if (!fs.existsSync(filePath)) { + throw new Error(`Missing file at path: ${filePath}`); + } + fs.appendFileSync(filePath, `${utils_1.toCommandValue(message)}${os.EOL}`, { + encoding: 'utf8' + }); +} +exports.issueFileCommand = issueFileCommand; +function prepareKeyValueMessage(key, value) { + const delimiter = `ghadelimiter_${uuid_1.v4()}`; + const convertedValue = utils_1.toCommandValue(value); + // These should realistically never happen, but just in case someone finds a + // way to exploit uuid generation let's not allow keys or values that contain + // the delimiter. + if (key.includes(delimiter)) { + throw new Error(`Unexpected input: name should not contain the delimiter "${delimiter}"`); + } + if (convertedValue.includes(delimiter)) { + throw new Error(`Unexpected input: value should not contain the delimiter "${delimiter}"`); + } + return `${key}<<${delimiter}${os.EOL}${convertedValue}${os.EOL}${delimiter}`; +} +exports.prepareKeyValueMessage = prepareKeyValueMessage; +//# sourceMappingURL=file-command.js.map + +/***/ }), + +/***/ 8041: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.OidcClient = void 0; +const http_client_1 = __nccwpck_require__(6255); +const auth_1 = __nccwpck_require__(5526); +const core_1 = __nccwpck_require__(2186); +class OidcClient { + static createHttpClient(allowRetry = true, maxRetry = 10) { + const requestOptions = { + allowRetries: allowRetry, + maxRetries: maxRetry + }; + return new http_client_1.HttpClient('actions/oidc-client', [new auth_1.BearerCredentialHandler(OidcClient.getRequestToken())], requestOptions); + } + static getRequestToken() { + const token = process.env['ACTIONS_ID_TOKEN_REQUEST_TOKEN']; + if (!token) { + throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_TOKEN env variable'); + } + return token; + } + static getIDTokenUrl() { + const runtimeUrl = process.env['ACTIONS_ID_TOKEN_REQUEST_URL']; + if (!runtimeUrl) { + throw new Error('Unable to get ACTIONS_ID_TOKEN_REQUEST_URL env variable'); + } + return runtimeUrl; + } + static getCall(id_token_url) { + var _a; + return __awaiter(this, void 0, void 0, function* () { + const httpclient = OidcClient.createHttpClient(); + const res = yield httpclient + .getJson(id_token_url) + .catch(error => { + throw new Error(`Failed to get ID Token. \n + Error Code : ${error.statusCode}\n + Error Message: ${error.result.message}`); + }); + const id_token = (_a = res.result) === null || _a === void 0 ? void 0 : _a.value; + if (!id_token) { + throw new Error('Response json body do not have ID Token field'); + } + return id_token; + }); + } + static getIDToken(audience) { + return __awaiter(this, void 0, void 0, function* () { + try { + // New ID Token is requested from action service + let id_token_url = OidcClient.getIDTokenUrl(); + if (audience) { + const encodedAudience = encodeURIComponent(audience); + id_token_url = `${id_token_url}&audience=${encodedAudience}`; + } + core_1.debug(`ID token url is ${id_token_url}`); + const id_token = yield OidcClient.getCall(id_token_url); + core_1.setSecret(id_token); + return id_token; + } + catch (error) { + throw new Error(`Error message: ${error.message}`); + } + }); + } +} +exports.OidcClient = OidcClient; +//# sourceMappingURL=oidc-utils.js.map + +/***/ }), + +/***/ 2981: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toPlatformPath = exports.toWin32Path = exports.toPosixPath = void 0; +const path = __importStar(__nccwpck_require__(1017)); +/** + * toPosixPath converts the given path to the posix form. On Windows, \\ will be + * replaced with /. + * + * @param pth. Path to transform. + * @return string Posix path. + */ +function toPosixPath(pth) { + return pth.replace(/[\\]/g, '/'); +} +exports.toPosixPath = toPosixPath; +/** + * toWin32Path converts the given path to the win32 form. On Linux, / will be + * replaced with \\. + * + * @param pth. Path to transform. + * @return string Win32 path. + */ +function toWin32Path(pth) { + return pth.replace(/[/]/g, '\\'); +} +exports.toWin32Path = toWin32Path; +/** + * toPlatformPath converts the given path to a platform-specific path. It does + * this by replacing instances of / and \ with the platform-specific path + * separator. + * + * @param pth The path to platformize. + * @return string The platform-specific path. + */ +function toPlatformPath(pth) { + return pth.replace(/[/\\]/g, path.sep); +} +exports.toPlatformPath = toPlatformPath; +//# sourceMappingURL=path-utils.js.map + +/***/ }), + +/***/ 1327: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.summary = exports.markdownSummary = exports.SUMMARY_DOCS_URL = exports.SUMMARY_ENV_VAR = void 0; +const os_1 = __nccwpck_require__(2037); +const fs_1 = __nccwpck_require__(7147); +const { access, appendFile, writeFile } = fs_1.promises; +exports.SUMMARY_ENV_VAR = 'GITHUB_STEP_SUMMARY'; +exports.SUMMARY_DOCS_URL = 'https://docs.github.com/actions/using-workflows/workflow-commands-for-github-actions#adding-a-job-summary'; +class Summary { + constructor() { + this._buffer = ''; + } + /** + * Finds the summary file path from the environment, rejects if env var is not found or file does not exist + * Also checks r/w permissions. + * + * @returns step summary file path + */ + filePath() { + return __awaiter(this, void 0, void 0, function* () { + if (this._filePath) { + return this._filePath; + } + const pathFromEnv = process.env[exports.SUMMARY_ENV_VAR]; + if (!pathFromEnv) { + throw new Error(`Unable to find environment variable for $${exports.SUMMARY_ENV_VAR}. Check if your runtime environment supports job summaries.`); + } + try { + yield access(pathFromEnv, fs_1.constants.R_OK | fs_1.constants.W_OK); + } + catch (_a) { + throw new Error(`Unable to access summary file: '${pathFromEnv}'. Check if the file has correct read/write permissions.`); + } + this._filePath = pathFromEnv; + return this._filePath; + }); + } + /** + * Wraps content in an HTML tag, adding any HTML attributes + * + * @param {string} tag HTML tag to wrap + * @param {string | null} content content within the tag + * @param {[attribute: string]: string} attrs key-value list of HTML attributes to add + * + * @returns {string} content wrapped in HTML element + */ + wrap(tag, content, attrs = {}) { + const htmlAttrs = Object.entries(attrs) + .map(([key, value]) => ` ${key}="${value}"`) + .join(''); + if (!content) { + return `<${tag}${htmlAttrs}>`; + } + return `<${tag}${htmlAttrs}>${content}`; + } + /** + * Writes text in the buffer to the summary buffer file and empties buffer. Will append by default. + * + * @param {SummaryWriteOptions} [options] (optional) options for write operation + * + * @returns {Promise} summary instance + */ + write(options) { + return __awaiter(this, void 0, void 0, function* () { + const overwrite = !!(options === null || options === void 0 ? void 0 : options.overwrite); + const filePath = yield this.filePath(); + const writeFunc = overwrite ? writeFile : appendFile; + yield writeFunc(filePath, this._buffer, { encoding: 'utf8' }); + return this.emptyBuffer(); + }); + } + /** + * Clears the summary buffer and wipes the summary file + * + * @returns {Summary} summary instance + */ + clear() { + return __awaiter(this, void 0, void 0, function* () { + return this.emptyBuffer().write({ overwrite: true }); + }); + } + /** + * Returns the current summary buffer as a string + * + * @returns {string} string of summary buffer + */ + stringify() { + return this._buffer; + } + /** + * If the summary buffer is empty + * + * @returns {boolen} true if the buffer is empty + */ + isEmptyBuffer() { + return this._buffer.length === 0; + } + /** + * Resets the summary buffer without writing to summary file + * + * @returns {Summary} summary instance + */ + emptyBuffer() { + this._buffer = ''; + return this; + } + /** + * Adds raw text to the summary buffer + * + * @param {string} text content to add + * @param {boolean} [addEOL=false] (optional) append an EOL to the raw text (default: false) + * + * @returns {Summary} summary instance + */ + addRaw(text, addEOL = false) { + this._buffer += text; + return addEOL ? this.addEOL() : this; + } + /** + * Adds the operating system-specific end-of-line marker to the buffer + * + * @returns {Summary} summary instance + */ + addEOL() { + return this.addRaw(os_1.EOL); + } + /** + * Adds an HTML codeblock to the summary buffer + * + * @param {string} code content to render within fenced code block + * @param {string} lang (optional) language to syntax highlight code + * + * @returns {Summary} summary instance + */ + addCodeBlock(code, lang) { + const attrs = Object.assign({}, (lang && { lang })); + const element = this.wrap('pre', this.wrap('code', code), attrs); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML list to the summary buffer + * + * @param {string[]} items list of items to render + * @param {boolean} [ordered=false] (optional) if the rendered list should be ordered or not (default: false) + * + * @returns {Summary} summary instance + */ + addList(items, ordered = false) { + const tag = ordered ? 'ol' : 'ul'; + const listItems = items.map(item => this.wrap('li', item)).join(''); + const element = this.wrap(tag, listItems); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML table to the summary buffer + * + * @param {SummaryTableCell[]} rows table rows + * + * @returns {Summary} summary instance + */ + addTable(rows) { + const tableBody = rows + .map(row => { + const cells = row + .map(cell => { + if (typeof cell === 'string') { + return this.wrap('td', cell); + } + const { header, data, colspan, rowspan } = cell; + const tag = header ? 'th' : 'td'; + const attrs = Object.assign(Object.assign({}, (colspan && { colspan })), (rowspan && { rowspan })); + return this.wrap(tag, data, attrs); + }) + .join(''); + return this.wrap('tr', cells); + }) + .join(''); + const element = this.wrap('table', tableBody); + return this.addRaw(element).addEOL(); + } + /** + * Adds a collapsable HTML details element to the summary buffer + * + * @param {string} label text for the closed state + * @param {string} content collapsable content + * + * @returns {Summary} summary instance + */ + addDetails(label, content) { + const element = this.wrap('details', this.wrap('summary', label) + content); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML image tag to the summary buffer + * + * @param {string} src path to the image you to embed + * @param {string} alt text description of the image + * @param {SummaryImageOptions} options (optional) addition image attributes + * + * @returns {Summary} summary instance + */ + addImage(src, alt, options) { + const { width, height } = options || {}; + const attrs = Object.assign(Object.assign({}, (width && { width })), (height && { height })); + const element = this.wrap('img', null, Object.assign({ src, alt }, attrs)); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML section heading element + * + * @param {string} text heading text + * @param {number | string} [level=1] (optional) the heading level, default: 1 + * + * @returns {Summary} summary instance + */ + addHeading(text, level) { + const tag = `h${level}`; + const allowedTag = ['h1', 'h2', 'h3', 'h4', 'h5', 'h6'].includes(tag) + ? tag + : 'h1'; + const element = this.wrap(allowedTag, text); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML thematic break (
) to the summary buffer + * + * @returns {Summary} summary instance + */ + addSeparator() { + const element = this.wrap('hr', null); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML line break (
) to the summary buffer + * + * @returns {Summary} summary instance + */ + addBreak() { + const element = this.wrap('br', null); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML blockquote to the summary buffer + * + * @param {string} text quote text + * @param {string} cite (optional) citation url + * + * @returns {Summary} summary instance + */ + addQuote(text, cite) { + const attrs = Object.assign({}, (cite && { cite })); + const element = this.wrap('blockquote', text, attrs); + return this.addRaw(element).addEOL(); + } + /** + * Adds an HTML anchor tag to the summary buffer + * + * @param {string} text link text/content + * @param {string} href hyperlink + * + * @returns {Summary} summary instance + */ + addLink(text, href) { + const element = this.wrap('a', text, { href }); + return this.addRaw(element).addEOL(); + } +} +const _summary = new Summary(); +/** + * @deprecated use `core.summary` + */ +exports.markdownSummary = _summary; +exports.summary = _summary; +//# sourceMappingURL=summary.js.map + +/***/ }), + +/***/ 5278: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +// We use any as a valid input type +/* eslint-disable @typescript-eslint/no-explicit-any */ +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toCommandProperties = exports.toCommandValue = void 0; +/** + * Sanitizes an input into a string so it can be passed into issueCommand safely + * @param input input to sanitize into a string + */ +function toCommandValue(input) { + if (input === null || input === undefined) { + return ''; + } + else if (typeof input === 'string' || input instanceof String) { + return input; + } + return JSON.stringify(input); +} +exports.toCommandValue = toCommandValue; +/** + * + * @param annotationProperties + * @returns The command properties to send with the actual annotation command + * See IssueCommandProperties: https://github.com/actions/runner/blob/main/src/Runner.Worker/ActionCommandManager.cs#L646 + */ +function toCommandProperties(annotationProperties) { + if (!Object.keys(annotationProperties).length) { + return {}; + } + return { + title: annotationProperties.title, + file: annotationProperties.file, + line: annotationProperties.startLine, + endLine: annotationProperties.endLine, + col: annotationProperties.startColumn, + endColumn: annotationProperties.endColumn + }; +} +exports.toCommandProperties = toCommandProperties; +//# sourceMappingURL=utils.js.map + +/***/ }), + +/***/ 5526: +/***/ (function(__unused_webpack_module, exports) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PersonalAccessTokenCredentialHandler = exports.BearerCredentialHandler = exports.BasicCredentialHandler = void 0; +class BasicCredentialHandler { + constructor(username, password) { + this.username = username; + this.password = password; + } + prepareRequest(options) { + if (!options.headers) { + throw Error('The request has no headers'); + } + options.headers['Authorization'] = `Basic ${Buffer.from(`${this.username}:${this.password}`).toString('base64')}`; + } + // This handler cannot handle 401 + canHandleAuthentication() { + return false; + } + handleAuthentication() { + return __awaiter(this, void 0, void 0, function* () { + throw new Error('not implemented'); + }); + } +} +exports.BasicCredentialHandler = BasicCredentialHandler; +class BearerCredentialHandler { + constructor(token) { + this.token = token; + } + // currently implements pre-authorization + // TODO: support preAuth = false where it hooks on 401 + prepareRequest(options) { + if (!options.headers) { + throw Error('The request has no headers'); + } + options.headers['Authorization'] = `Bearer ${this.token}`; + } + // This handler cannot handle 401 + canHandleAuthentication() { + return false; + } + handleAuthentication() { + return __awaiter(this, void 0, void 0, function* () { + throw new Error('not implemented'); + }); + } +} +exports.BearerCredentialHandler = BearerCredentialHandler; +class PersonalAccessTokenCredentialHandler { + constructor(token) { + this.token = token; + } + // currently implements pre-authorization + // TODO: support preAuth = false where it hooks on 401 + prepareRequest(options) { + if (!options.headers) { + throw Error('The request has no headers'); + } + options.headers['Authorization'] = `Basic ${Buffer.from(`PAT:${this.token}`).toString('base64')}`; + } + // This handler cannot handle 401 + canHandleAuthentication() { + return false; + } + handleAuthentication() { + return __awaiter(this, void 0, void 0, function* () { + throw new Error('not implemented'); + }); + } +} +exports.PersonalAccessTokenCredentialHandler = PersonalAccessTokenCredentialHandler; +//# sourceMappingURL=auth.js.map + +/***/ }), + +/***/ 6255: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +/* eslint-disable @typescript-eslint/no-explicit-any */ +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } }); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpClient = exports.isHttps = exports.HttpClientResponse = exports.HttpClientError = exports.getProxyUrl = exports.MediaTypes = exports.Headers = exports.HttpCodes = void 0; +const http = __importStar(__nccwpck_require__(3685)); +const https = __importStar(__nccwpck_require__(5687)); +const pm = __importStar(__nccwpck_require__(9835)); +const tunnel = __importStar(__nccwpck_require__(4294)); +var HttpCodes; +(function (HttpCodes) { + HttpCodes[HttpCodes["OK"] = 200] = "OK"; + HttpCodes[HttpCodes["MultipleChoices"] = 300] = "MultipleChoices"; + HttpCodes[HttpCodes["MovedPermanently"] = 301] = "MovedPermanently"; + HttpCodes[HttpCodes["ResourceMoved"] = 302] = "ResourceMoved"; + HttpCodes[HttpCodes["SeeOther"] = 303] = "SeeOther"; + HttpCodes[HttpCodes["NotModified"] = 304] = "NotModified"; + HttpCodes[HttpCodes["UseProxy"] = 305] = "UseProxy"; + HttpCodes[HttpCodes["SwitchProxy"] = 306] = "SwitchProxy"; + HttpCodes[HttpCodes["TemporaryRedirect"] = 307] = "TemporaryRedirect"; + HttpCodes[HttpCodes["PermanentRedirect"] = 308] = "PermanentRedirect"; + HttpCodes[HttpCodes["BadRequest"] = 400] = "BadRequest"; + HttpCodes[HttpCodes["Unauthorized"] = 401] = "Unauthorized"; + HttpCodes[HttpCodes["PaymentRequired"] = 402] = "PaymentRequired"; + HttpCodes[HttpCodes["Forbidden"] = 403] = "Forbidden"; + HttpCodes[HttpCodes["NotFound"] = 404] = "NotFound"; + HttpCodes[HttpCodes["MethodNotAllowed"] = 405] = "MethodNotAllowed"; + HttpCodes[HttpCodes["NotAcceptable"] = 406] = "NotAcceptable"; + HttpCodes[HttpCodes["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired"; + HttpCodes[HttpCodes["RequestTimeout"] = 408] = "RequestTimeout"; + HttpCodes[HttpCodes["Conflict"] = 409] = "Conflict"; + HttpCodes[HttpCodes["Gone"] = 410] = "Gone"; + HttpCodes[HttpCodes["TooManyRequests"] = 429] = "TooManyRequests"; + HttpCodes[HttpCodes["InternalServerError"] = 500] = "InternalServerError"; + HttpCodes[HttpCodes["NotImplemented"] = 501] = "NotImplemented"; + HttpCodes[HttpCodes["BadGateway"] = 502] = "BadGateway"; + HttpCodes[HttpCodes["ServiceUnavailable"] = 503] = "ServiceUnavailable"; + HttpCodes[HttpCodes["GatewayTimeout"] = 504] = "GatewayTimeout"; +})(HttpCodes = exports.HttpCodes || (exports.HttpCodes = {})); +var Headers; +(function (Headers) { + Headers["Accept"] = "accept"; + Headers["ContentType"] = "content-type"; +})(Headers = exports.Headers || (exports.Headers = {})); +var MediaTypes; +(function (MediaTypes) { + MediaTypes["ApplicationJson"] = "application/json"; +})(MediaTypes = exports.MediaTypes || (exports.MediaTypes = {})); +/** + * Returns the proxy URL, depending upon the supplied url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ +function getProxyUrl(serverUrl) { + const proxyUrl = pm.getProxyUrl(new URL(serverUrl)); + return proxyUrl ? proxyUrl.href : ''; +} +exports.getProxyUrl = getProxyUrl; +const HttpRedirectCodes = [ + HttpCodes.MovedPermanently, + HttpCodes.ResourceMoved, + HttpCodes.SeeOther, + HttpCodes.TemporaryRedirect, + HttpCodes.PermanentRedirect +]; +const HttpResponseRetryCodes = [ + HttpCodes.BadGateway, + HttpCodes.ServiceUnavailable, + HttpCodes.GatewayTimeout +]; +const RetryableHttpVerbs = ['OPTIONS', 'GET', 'DELETE', 'HEAD']; +const ExponentialBackoffCeiling = 10; +const ExponentialBackoffTimeSlice = 5; +class HttpClientError extends Error { + constructor(message, statusCode) { + super(message); + this.name = 'HttpClientError'; + this.statusCode = statusCode; + Object.setPrototypeOf(this, HttpClientError.prototype); + } +} +exports.HttpClientError = HttpClientError; +class HttpClientResponse { + constructor(message) { + this.message = message; + } + readBody() { + return __awaiter(this, void 0, void 0, function* () { + return new Promise((resolve) => __awaiter(this, void 0, void 0, function* () { + let output = Buffer.alloc(0); + this.message.on('data', (chunk) => { + output = Buffer.concat([output, chunk]); + }); + this.message.on('end', () => { + resolve(output.toString()); + }); + })); + }); + } +} +exports.HttpClientResponse = HttpClientResponse; +function isHttps(requestUrl) { + const parsedUrl = new URL(requestUrl); + return parsedUrl.protocol === 'https:'; +} +exports.isHttps = isHttps; +class HttpClient { + constructor(userAgent, handlers, requestOptions) { + this._ignoreSslError = false; + this._allowRedirects = true; + this._allowRedirectDowngrade = false; + this._maxRedirects = 50; + this._allowRetries = false; + this._maxRetries = 1; + this._keepAlive = false; + this._disposed = false; + this.userAgent = userAgent; + this.handlers = handlers || []; + this.requestOptions = requestOptions; + if (requestOptions) { + if (requestOptions.ignoreSslError != null) { + this._ignoreSslError = requestOptions.ignoreSslError; + } + this._socketTimeout = requestOptions.socketTimeout; + if (requestOptions.allowRedirects != null) { + this._allowRedirects = requestOptions.allowRedirects; + } + if (requestOptions.allowRedirectDowngrade != null) { + this._allowRedirectDowngrade = requestOptions.allowRedirectDowngrade; + } + if (requestOptions.maxRedirects != null) { + this._maxRedirects = Math.max(requestOptions.maxRedirects, 0); + } + if (requestOptions.keepAlive != null) { + this._keepAlive = requestOptions.keepAlive; + } + if (requestOptions.allowRetries != null) { + this._allowRetries = requestOptions.allowRetries; + } + if (requestOptions.maxRetries != null) { + this._maxRetries = requestOptions.maxRetries; + } + } + } + options(requestUrl, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('OPTIONS', requestUrl, null, additionalHeaders || {}); + }); + } + get(requestUrl, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('GET', requestUrl, null, additionalHeaders || {}); + }); + } + del(requestUrl, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('DELETE', requestUrl, null, additionalHeaders || {}); + }); + } + post(requestUrl, data, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('POST', requestUrl, data, additionalHeaders || {}); + }); + } + patch(requestUrl, data, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('PATCH', requestUrl, data, additionalHeaders || {}); + }); + } + put(requestUrl, data, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('PUT', requestUrl, data, additionalHeaders || {}); + }); + } + head(requestUrl, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request('HEAD', requestUrl, null, additionalHeaders || {}); + }); + } + sendStream(verb, requestUrl, stream, additionalHeaders) { + return __awaiter(this, void 0, void 0, function* () { + return this.request(verb, requestUrl, stream, additionalHeaders); + }); + } + /** + * Gets a typed object from an endpoint + * Be aware that not found returns a null. Other errors (4xx, 5xx) reject the promise + */ + getJson(requestUrl, additionalHeaders = {}) { + return __awaiter(this, void 0, void 0, function* () { + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + const res = yield this.get(requestUrl, additionalHeaders); + return this._processResponse(res, this.requestOptions); + }); + } + postJson(requestUrl, obj, additionalHeaders = {}) { + return __awaiter(this, void 0, void 0, function* () { + const data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + const res = yield this.post(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + }); + } + putJson(requestUrl, obj, additionalHeaders = {}) { + return __awaiter(this, void 0, void 0, function* () { + const data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + const res = yield this.put(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + }); + } + patchJson(requestUrl, obj, additionalHeaders = {}) { + return __awaiter(this, void 0, void 0, function* () { + const data = JSON.stringify(obj, null, 2); + additionalHeaders[Headers.Accept] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.Accept, MediaTypes.ApplicationJson); + additionalHeaders[Headers.ContentType] = this._getExistingOrDefaultHeader(additionalHeaders, Headers.ContentType, MediaTypes.ApplicationJson); + const res = yield this.patch(requestUrl, data, additionalHeaders); + return this._processResponse(res, this.requestOptions); + }); + } + /** + * Makes a raw http request. + * All other methods such as get, post, patch, and request ultimately call this. + * Prefer get, del, post and patch + */ + request(verb, requestUrl, data, headers) { + return __awaiter(this, void 0, void 0, function* () { + if (this._disposed) { + throw new Error('Client has already been disposed.'); + } + const parsedUrl = new URL(requestUrl); + let info = this._prepareRequest(verb, parsedUrl, headers); + // Only perform retries on reads since writes may not be idempotent. + const maxTries = this._allowRetries && RetryableHttpVerbs.includes(verb) + ? this._maxRetries + 1 + : 1; + let numTries = 0; + let response; + do { + response = yield this.requestRaw(info, data); + // Check if it's an authentication challenge + if (response && + response.message && + response.message.statusCode === HttpCodes.Unauthorized) { + let authenticationHandler; + for (const handler of this.handlers) { + if (handler.canHandleAuthentication(response)) { + authenticationHandler = handler; + break; + } + } + if (authenticationHandler) { + return authenticationHandler.handleAuthentication(this, info, data); + } + else { + // We have received an unauthorized response but have no handlers to handle it. + // Let the response return to the caller. + return response; + } + } + let redirectsRemaining = this._maxRedirects; + while (response.message.statusCode && + HttpRedirectCodes.includes(response.message.statusCode) && + this._allowRedirects && + redirectsRemaining > 0) { + const redirectUrl = response.message.headers['location']; + if (!redirectUrl) { + // if there's no location to redirect to, we won't + break; + } + const parsedRedirectUrl = new URL(redirectUrl); + if (parsedUrl.protocol === 'https:' && + parsedUrl.protocol !== parsedRedirectUrl.protocol && + !this._allowRedirectDowngrade) { + throw new Error('Redirect from HTTPS to HTTP protocol. This downgrade is not allowed for security reasons. If you want to allow this behavior, set the allowRedirectDowngrade option to true.'); + } + // we need to finish reading the response before reassigning response + // which will leak the open socket. + yield response.readBody(); + // strip authorization header if redirected to a different hostname + if (parsedRedirectUrl.hostname !== parsedUrl.hostname) { + for (const header in headers) { + // header names are case insensitive + if (header.toLowerCase() === 'authorization') { + delete headers[header]; + } + } + } + // let's make the request with the new redirectUrl + info = this._prepareRequest(verb, parsedRedirectUrl, headers); + response = yield this.requestRaw(info, data); + redirectsRemaining--; + } + if (!response.message.statusCode || + !HttpResponseRetryCodes.includes(response.message.statusCode)) { + // If not a retry code, return immediately instead of retrying + return response; + } + numTries += 1; + if (numTries < maxTries) { + yield response.readBody(); + yield this._performExponentialBackoff(numTries); + } + } while (numTries < maxTries); + return response; + }); + } + /** + * Needs to be called if keepAlive is set to true in request options. + */ + dispose() { + if (this._agent) { + this._agent.destroy(); + } + this._disposed = true; + } + /** + * Raw request. + * @param info + * @param data + */ + requestRaw(info, data) { + return __awaiter(this, void 0, void 0, function* () { + return new Promise((resolve, reject) => { + function callbackForResult(err, res) { + if (err) { + reject(err); + } + else if (!res) { + // If `err` is not passed, then `res` must be passed. + reject(new Error('Unknown error')); + } + else { + resolve(res); + } + } + this.requestRawWithCallback(info, data, callbackForResult); + }); + }); + } + /** + * Raw request with callback. + * @param info + * @param data + * @param onResult + */ + requestRawWithCallback(info, data, onResult) { + if (typeof data === 'string') { + if (!info.options.headers) { + info.options.headers = {}; + } + info.options.headers['Content-Length'] = Buffer.byteLength(data, 'utf8'); + } + let callbackCalled = false; + function handleResult(err, res) { + if (!callbackCalled) { + callbackCalled = true; + onResult(err, res); + } + } + const req = info.httpModule.request(info.options, (msg) => { + const res = new HttpClientResponse(msg); + handleResult(undefined, res); + }); + let socket; + req.on('socket', sock => { + socket = sock; + }); + // If we ever get disconnected, we want the socket to timeout eventually + req.setTimeout(this._socketTimeout || 3 * 60000, () => { + if (socket) { + socket.end(); + } + handleResult(new Error(`Request timeout: ${info.options.path}`)); + }); + req.on('error', function (err) { + // err has statusCode property + // res should have headers + handleResult(err); + }); + if (data && typeof data === 'string') { + req.write(data, 'utf8'); + } + if (data && typeof data !== 'string') { + data.on('close', function () { + req.end(); + }); + data.pipe(req); + } + else { + req.end(); + } + } + /** + * Gets an http agent. This function is useful when you need an http agent that handles + * routing through a proxy server - depending upon the url and proxy environment variables. + * @param serverUrl The server URL where the request will be sent. For example, https://api.github.com + */ + getAgent(serverUrl) { + const parsedUrl = new URL(serverUrl); + return this._getAgent(parsedUrl); + } + _prepareRequest(method, requestUrl, headers) { + const info = {}; + info.parsedUrl = requestUrl; + const usingSsl = info.parsedUrl.protocol === 'https:'; + info.httpModule = usingSsl ? https : http; + const defaultPort = usingSsl ? 443 : 80; + info.options = {}; + info.options.host = info.parsedUrl.hostname; + info.options.port = info.parsedUrl.port + ? parseInt(info.parsedUrl.port) + : defaultPort; + info.options.path = + (info.parsedUrl.pathname || '') + (info.parsedUrl.search || ''); + info.options.method = method; + info.options.headers = this._mergeHeaders(headers); + if (this.userAgent != null) { + info.options.headers['user-agent'] = this.userAgent; + } + info.options.agent = this._getAgent(info.parsedUrl); + // gives handlers an opportunity to participate + if (this.handlers) { + for (const handler of this.handlers) { + handler.prepareRequest(info.options); + } + } + return info; + } + _mergeHeaders(headers) { + if (this.requestOptions && this.requestOptions.headers) { + return Object.assign({}, lowercaseKeys(this.requestOptions.headers), lowercaseKeys(headers || {})); + } + return lowercaseKeys(headers || {}); + } + _getExistingOrDefaultHeader(additionalHeaders, header, _default) { + let clientHeader; + if (this.requestOptions && this.requestOptions.headers) { + clientHeader = lowercaseKeys(this.requestOptions.headers)[header]; + } + return additionalHeaders[header] || clientHeader || _default; + } + _getAgent(parsedUrl) { + let agent; + const proxyUrl = pm.getProxyUrl(parsedUrl); + const useProxy = proxyUrl && proxyUrl.hostname; + if (this._keepAlive && useProxy) { + agent = this._proxyAgent; + } + if (this._keepAlive && !useProxy) { + agent = this._agent; + } + // if agent is already assigned use that agent. + if (agent) { + return agent; + } + const usingSsl = parsedUrl.protocol === 'https:'; + let maxSockets = 100; + if (this.requestOptions) { + maxSockets = this.requestOptions.maxSockets || http.globalAgent.maxSockets; + } + // This is `useProxy` again, but we need to check `proxyURl` directly for TypeScripts's flow analysis. + if (proxyUrl && proxyUrl.hostname) { + const agentOptions = { + maxSockets, + keepAlive: this._keepAlive, + proxy: Object.assign(Object.assign({}, ((proxyUrl.username || proxyUrl.password) && { + proxyAuth: `${proxyUrl.username}:${proxyUrl.password}` + })), { host: proxyUrl.hostname, port: proxyUrl.port }) + }; + let tunnelAgent; + const overHttps = proxyUrl.protocol === 'https:'; + if (usingSsl) { + tunnelAgent = overHttps ? tunnel.httpsOverHttps : tunnel.httpsOverHttp; + } + else { + tunnelAgent = overHttps ? tunnel.httpOverHttps : tunnel.httpOverHttp; + } + agent = tunnelAgent(agentOptions); + this._proxyAgent = agent; + } + // if reusing agent across request and tunneling agent isn't assigned create a new agent + if (this._keepAlive && !agent) { + const options = { keepAlive: this._keepAlive, maxSockets }; + agent = usingSsl ? new https.Agent(options) : new http.Agent(options); + this._agent = agent; + } + // if not using private agent and tunnel agent isn't setup then use global agent + if (!agent) { + agent = usingSsl ? https.globalAgent : http.globalAgent; + } + if (usingSsl && this._ignoreSslError) { + // we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process + // http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options + // we have to cast it to any and change it directly + agent.options = Object.assign(agent.options || {}, { + rejectUnauthorized: false + }); + } + return agent; + } + _performExponentialBackoff(retryNumber) { + return __awaiter(this, void 0, void 0, function* () { + retryNumber = Math.min(ExponentialBackoffCeiling, retryNumber); + const ms = ExponentialBackoffTimeSlice * Math.pow(2, retryNumber); + return new Promise(resolve => setTimeout(() => resolve(), ms)); + }); + } + _processResponse(res, options) { + return __awaiter(this, void 0, void 0, function* () { + return new Promise((resolve, reject) => __awaiter(this, void 0, void 0, function* () { + const statusCode = res.message.statusCode || 0; + const response = { + statusCode, + result: null, + headers: {} + }; + // not found leads to null obj returned + if (statusCode === HttpCodes.NotFound) { + resolve(response); + } + // get the result from the body + function dateTimeDeserializer(key, value) { + if (typeof value === 'string') { + const a = new Date(value); + if (!isNaN(a.valueOf())) { + return a; + } + } + return value; + } + let obj; + let contents; + try { + contents = yield res.readBody(); + if (contents && contents.length > 0) { + if (options && options.deserializeDates) { + obj = JSON.parse(contents, dateTimeDeserializer); + } + else { + obj = JSON.parse(contents); + } + response.result = obj; + } + response.headers = res.message.headers; + } + catch (err) { + // Invalid resource (contents not json); leaving result obj null + } + // note that 3xx redirects are handled by the http layer. + if (statusCode > 299) { + let msg; + // if exception/error in body, attempt to get better error + if (obj && obj.message) { + msg = obj.message; + } + else if (contents && contents.length > 0) { + // it may be the case that the exception is in the body message as string + msg = contents; + } + else { + msg = `Failed request: (${statusCode})`; + } + const err = new HttpClientError(msg, statusCode); + err.result = response.result; + reject(err); + } + else { + resolve(response); + } + })); + }); + } +} +exports.HttpClient = HttpClient; +const lowercaseKeys = (obj) => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCase()] = obj[k]), c), {}); +//# sourceMappingURL=index.js.map + +/***/ }), + +/***/ 9835: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.checkBypass = exports.getProxyUrl = void 0; +function getProxyUrl(reqUrl) { + const usingSsl = reqUrl.protocol === 'https:'; + if (checkBypass(reqUrl)) { + return undefined; + } + const proxyVar = (() => { + if (usingSsl) { + return process.env['https_proxy'] || process.env['HTTPS_PROXY']; + } + else { + return process.env['http_proxy'] || process.env['HTTP_PROXY']; + } + })(); + if (proxyVar) { + return new URL(proxyVar); + } + else { + return undefined; + } +} +exports.getProxyUrl = getProxyUrl; +function checkBypass(reqUrl) { + if (!reqUrl.hostname) { + return false; + } + const noProxy = process.env['no_proxy'] || process.env['NO_PROXY'] || ''; + if (!noProxy) { + return false; + } + // Determine the request port + let reqPort; + if (reqUrl.port) { + reqPort = Number(reqUrl.port); + } + else if (reqUrl.protocol === 'http:') { + reqPort = 80; + } + else if (reqUrl.protocol === 'https:') { + reqPort = 443; + } + // Format the request hostname and hostname with port + const upperReqHosts = [reqUrl.hostname.toUpperCase()]; + if (typeof reqPort === 'number') { + upperReqHosts.push(`${upperReqHosts[0]}:${reqPort}`); + } + // Compare request host against noproxy + for (const upperNoProxyItem of noProxy + .split(',') + .map(x => x.trim().toUpperCase()) + .filter(x => x)) { + if (upperReqHosts.some(x => x === upperNoProxyItem)) { + return true; + } + } + return false; +} +exports.checkBypass = checkBypass; +//# sourceMappingURL=proxy.js.map + +/***/ }), + +/***/ 9838: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSO = void 0; +const GetRoleCredentialsCommand_1 = __nccwpck_require__(8972); +const ListAccountRolesCommand_1 = __nccwpck_require__(1513); +const ListAccountsCommand_1 = __nccwpck_require__(4296); +const LogoutCommand_1 = __nccwpck_require__(2586); +const SSOClient_1 = __nccwpck_require__(1057); +class SSO extends SSOClient_1.SSOClient { + getRoleCredentials(args, optionsOrCb, cb) { + const command = new GetRoleCredentialsCommand_1.GetRoleCredentialsCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + listAccountRoles(args, optionsOrCb, cb) { + const command = new ListAccountRolesCommand_1.ListAccountRolesCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + listAccounts(args, optionsOrCb, cb) { + const command = new ListAccountsCommand_1.ListAccountsCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + logout(args, optionsOrCb, cb) { + const command = new LogoutCommand_1.LogoutCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } +} +exports.SSO = SSO; + + +/***/ }), + +/***/ 1057: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOClient = void 0; +const config_resolver_1 = __nccwpck_require__(6153); +const middleware_content_length_1 = __nccwpck_require__(2245); +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_host_header_1 = __nccwpck_require__(2545); +const middleware_logger_1 = __nccwpck_require__(14); +const middleware_recursion_detection_1 = __nccwpck_require__(5525); +const middleware_retry_1 = __nccwpck_require__(6064); +const middleware_user_agent_1 = __nccwpck_require__(4688); +const smithy_client_1 = __nccwpck_require__(4963); +const EndpointParameters_1 = __nccwpck_require__(4214); +const runtimeConfig_1 = __nccwpck_require__(9756); +class SSOClient extends smithy_client_1.Client { + constructor(configuration) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); + super(_config_6); + this.config = _config_6; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +} +exports.SSOClient = SSOClient; + + +/***/ }), + +/***/ 8972: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetRoleCredentialsCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(6390); +const Aws_restJson1_1 = __nccwpck_require__(8507); +class GetRoleCredentialsCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetRoleCredentialsCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "GetRoleCredentialsCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetRoleCredentialsRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetRoleCredentialsResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.serializeAws_restJson1GetRoleCredentialsCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.deserializeAws_restJson1GetRoleCredentialsCommand)(output, context); + } +} +exports.GetRoleCredentialsCommand = GetRoleCredentialsCommand; + + +/***/ }), + +/***/ 1513: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListAccountRolesCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(6390); +const Aws_restJson1_1 = __nccwpck_require__(8507); +class ListAccountRolesCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountRolesCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "ListAccountRolesCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.ListAccountRolesRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.ListAccountRolesResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.serializeAws_restJson1ListAccountRolesCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.deserializeAws_restJson1ListAccountRolesCommand)(output, context); + } +} +exports.ListAccountRolesCommand = ListAccountRolesCommand; + + +/***/ }), + +/***/ 4296: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ListAccountsCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(6390); +const Aws_restJson1_1 = __nccwpck_require__(8507); +class ListAccountsCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, ListAccountsCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "ListAccountsCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.ListAccountsRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.ListAccountsResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.serializeAws_restJson1ListAccountsCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.deserializeAws_restJson1ListAccountsCommand)(output, context); + } +} +exports.ListAccountsCommand = ListAccountsCommand; + + +/***/ }), + +/***/ 2586: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.LogoutCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(6390); +const Aws_restJson1_1 = __nccwpck_require__(8507); +class LogoutCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, LogoutCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "SSOClient"; + const commandName = "LogoutCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.LogoutRequestFilterSensitiveLog, + outputFilterSensitiveLog: (output) => output, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_restJson1_1.serializeAws_restJson1LogoutCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_restJson1_1.deserializeAws_restJson1LogoutCommand)(output, context); + } +} +exports.LogoutCommand = LogoutCommand; + + +/***/ }), + +/***/ 5706: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8972), exports); +tslib_1.__exportStar(__nccwpck_require__(1513), exports); +tslib_1.__exportStar(__nccwpck_require__(4296), exports); +tslib_1.__exportStar(__nccwpck_require__(2586), exports); + + +/***/ }), + +/***/ 4214: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + var _a, _b; + return { + ...options, + useDualstackEndpoint: (_a = options.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false, + useFipsEndpoint: (_b = options.useFipsEndpoint) !== null && _b !== void 0 ? _b : false, + defaultSigningName: "awsssoportal", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; + + +/***/ }), + +/***/ 898: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(3350); +const ruleset_1 = __nccwpck_require__(3341); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; + + +/***/ }), + +/***/ 3341: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +exports.ruleSet = { + version: "1.0", + parameters: { + Region: { + builtIn: "AWS::Region", + required: false, + documentation: "The AWS region used to dispatch the request.", + type: "String", + }, + UseDualStack: { + builtIn: "AWS::UseDualStack", + required: true, + default: false, + documentation: "When true, use the dual-stack endpoint. If the configured endpoint does not support dual-stack, dispatching the request MAY return an error.", + type: "Boolean", + }, + UseFIPS: { + builtIn: "AWS::UseFIPS", + required: true, + default: false, + documentation: "When true, send this request to the FIPS-compliant regional endpoint. If the configured endpoint does not have a FIPS compliant endpoint, dispatching the request will return an error.", + type: "Boolean", + }, + Endpoint: { + builtIn: "SDK::Endpoint", + required: false, + documentation: "Override the endpoint used to send this request", + type: "String", + }, + }, + rules: [ + { + conditions: [ + { + fn: "aws.partition", + argv: [ + { + ref: "Region", + }, + ], + assign: "PartitionResult", + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "isSet", + argv: [ + { + ref: "Endpoint", + }, + ], + }, + { + fn: "parseURL", + argv: [ + { + ref: "Endpoint", + }, + ], + assign: "url", + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + ], + error: "Invalid Configuration: FIPS and custom endpoint are not supported", + type: "error", + }, + { + conditions: [], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + error: "Invalid Configuration: Dualstack and custom endpoint are not supported", + type: "error", + }, + { + conditions: [], + endpoint: { + url: { + ref: "Endpoint", + }, + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsFIPS", + ], + }, + ], + }, + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsDualStack", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + endpoint: { + url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + { + conditions: [], + error: "FIPS and DualStack are enabled, but this partition does not support one or both", + type: "error", + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsFIPS", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + type: "tree", + rules: [ + { + conditions: [], + endpoint: { + url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], + }, + { + conditions: [], + error: "FIPS is enabled but this partition does not support FIPS", + type: "error", + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsDualStack", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + endpoint: { + url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + { + conditions: [], + error: "DualStack is enabled but this partition does not support DualStack", + type: "error", + }, + ], + }, + { + conditions: [], + endpoint: { + url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], +}; + + +/***/ }), + +/***/ 2666: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOServiceException = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9838), exports); +tslib_1.__exportStar(__nccwpck_require__(1057), exports); +tslib_1.__exportStar(__nccwpck_require__(5706), exports); +tslib_1.__exportStar(__nccwpck_require__(4952), exports); +tslib_1.__exportStar(__nccwpck_require__(6773), exports); +var SSOServiceException_1 = __nccwpck_require__(1517); +Object.defineProperty(exports, "SSOServiceException", ({ enumerable: true, get: function () { return SSOServiceException_1.SSOServiceException; } })); + + +/***/ }), + +/***/ 1517: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SSOServiceException = void 0; +const smithy_client_1 = __nccwpck_require__(4963); +class SSOServiceException extends smithy_client_1.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, SSOServiceException.prototype); + } +} +exports.SSOServiceException = SSOServiceException; + + +/***/ }), + +/***/ 4952: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6390), exports); + + +/***/ }), + +/***/ 6390: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.LogoutRequestFilterSensitiveLog = exports.ListAccountsResponseFilterSensitiveLog = exports.ListAccountsRequestFilterSensitiveLog = exports.ListAccountRolesResponseFilterSensitiveLog = exports.RoleInfoFilterSensitiveLog = exports.ListAccountRolesRequestFilterSensitiveLog = exports.GetRoleCredentialsResponseFilterSensitiveLog = exports.RoleCredentialsFilterSensitiveLog = exports.GetRoleCredentialsRequestFilterSensitiveLog = exports.AccountInfoFilterSensitiveLog = exports.UnauthorizedException = exports.TooManyRequestsException = exports.ResourceNotFoundException = exports.InvalidRequestException = void 0; +const smithy_client_1 = __nccwpck_require__(4963); +const SSOServiceException_1 = __nccwpck_require__(1517); +class InvalidRequestException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts, + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidRequestException.prototype); + } +} +exports.InvalidRequestException = InvalidRequestException; +class ResourceNotFoundException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts, + }); + this.name = "ResourceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ResourceNotFoundException.prototype); + } +} +exports.ResourceNotFoundException = ResourceNotFoundException; +class TooManyRequestsException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "TooManyRequestsException", + $fault: "client", + ...opts, + }); + this.name = "TooManyRequestsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, TooManyRequestsException.prototype); + } +} +exports.TooManyRequestsException = TooManyRequestsException; +class UnauthorizedException extends SSOServiceException_1.SSOServiceException { + constructor(opts) { + super({ + name: "UnauthorizedException", + $fault: "client", + ...opts, + }); + this.name = "UnauthorizedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, UnauthorizedException.prototype); + } +} +exports.UnauthorizedException = UnauthorizedException; +const AccountInfoFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AccountInfoFilterSensitiveLog = AccountInfoFilterSensitiveLog; +const GetRoleCredentialsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.GetRoleCredentialsRequestFilterSensitiveLog = GetRoleCredentialsRequestFilterSensitiveLog; +const RoleCredentialsFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.secretAccessKey && { secretAccessKey: smithy_client_1.SENSITIVE_STRING }), + ...(obj.sessionToken && { sessionToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.RoleCredentialsFilterSensitiveLog = RoleCredentialsFilterSensitiveLog; +const GetRoleCredentialsResponseFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.roleCredentials && { roleCredentials: (0, exports.RoleCredentialsFilterSensitiveLog)(obj.roleCredentials) }), +}); +exports.GetRoleCredentialsResponseFilterSensitiveLog = GetRoleCredentialsResponseFilterSensitiveLog; +const ListAccountRolesRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.ListAccountRolesRequestFilterSensitiveLog = ListAccountRolesRequestFilterSensitiveLog; +const RoleInfoFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.RoleInfoFilterSensitiveLog = RoleInfoFilterSensitiveLog; +const ListAccountRolesResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.ListAccountRolesResponseFilterSensitiveLog = ListAccountRolesResponseFilterSensitiveLog; +const ListAccountsRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.ListAccountsRequestFilterSensitiveLog = ListAccountsRequestFilterSensitiveLog; +const ListAccountsResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.ListAccountsResponseFilterSensitiveLog = ListAccountsResponseFilterSensitiveLog; +const LogoutRequestFilterSensitiveLog = (obj) => ({ + ...obj, + ...(obj.accessToken && { accessToken: smithy_client_1.SENSITIVE_STRING }), +}); +exports.LogoutRequestFilterSensitiveLog = LogoutRequestFilterSensitiveLog; + + +/***/ }), + +/***/ 849: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8460: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateListAccountRoles = void 0; +const ListAccountRolesCommand_1 = __nccwpck_require__(1513); +const SSO_1 = __nccwpck_require__(9838); +const SSOClient_1 = __nccwpck_require__(1057); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new ListAccountRolesCommand_1.ListAccountRolesCommand(input), ...args); +}; +const makePagedRequest = async (client, input, ...args) => { + return await client.listAccountRoles(input, ...args); +}; +async function* paginateListAccountRoles(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof SSO_1.SSO) { + page = await makePagedRequest(config.client, input, ...additionalArguments); + } + else if (config.client instanceof SSOClient_1.SSOClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected SSO | SSOClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateListAccountRoles = paginateListAccountRoles; + + +/***/ }), + +/***/ 938: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.paginateListAccounts = void 0; +const ListAccountsCommand_1 = __nccwpck_require__(4296); +const SSO_1 = __nccwpck_require__(9838); +const SSOClient_1 = __nccwpck_require__(1057); +const makePagedClientRequest = async (client, input, ...args) => { + return await client.send(new ListAccountsCommand_1.ListAccountsCommand(input), ...args); +}; +const makePagedRequest = async (client, input, ...args) => { + return await client.listAccounts(input, ...args); +}; +async function* paginateListAccounts(config, input, ...additionalArguments) { + let token = config.startingToken || undefined; + let hasNext = true; + let page; + while (hasNext) { + input.nextToken = token; + input["maxResults"] = config.pageSize; + if (config.client instanceof SSO_1.SSO) { + page = await makePagedRequest(config.client, input, ...additionalArguments); + } + else if (config.client instanceof SSOClient_1.SSOClient) { + page = await makePagedClientRequest(config.client, input, ...additionalArguments); + } + else { + throw new Error("Invalid client, expected SSO | SSOClient"); + } + yield page; + const prevToken = token; + token = page.nextToken; + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return undefined; +} +exports.paginateListAccounts = paginateListAccounts; + + +/***/ }), + +/***/ 6773: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(849), exports); +tslib_1.__exportStar(__nccwpck_require__(8460), exports); +tslib_1.__exportStar(__nccwpck_require__(938), exports); + + +/***/ }), + +/***/ 8507: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.deserializeAws_restJson1LogoutCommand = exports.deserializeAws_restJson1ListAccountsCommand = exports.deserializeAws_restJson1ListAccountRolesCommand = exports.deserializeAws_restJson1GetRoleCredentialsCommand = exports.serializeAws_restJson1LogoutCommand = exports.serializeAws_restJson1ListAccountsCommand = exports.serializeAws_restJson1ListAccountRolesCommand = exports.serializeAws_restJson1GetRoleCredentialsCommand = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(6390); +const SSOServiceException_1 = __nccwpck_require__(1517); +const serializeAws_restJson1GetRoleCredentialsCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = map({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}` + "/federation/credentials"; + const query = map({ + role_name: [, input.roleName], + account_id: [, input.accountId], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.serializeAws_restJson1GetRoleCredentialsCommand = serializeAws_restJson1GetRoleCredentialsCommand; +const serializeAws_restJson1ListAccountRolesCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = map({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/roles"; + const query = map({ + next_token: [, input.nextToken], + max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], + account_id: [, input.accountId], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.serializeAws_restJson1ListAccountRolesCommand = serializeAws_restJson1ListAccountRolesCommand; +const serializeAws_restJson1ListAccountsCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = map({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}` + "/assignment/accounts"; + const query = map({ + next_token: [, input.nextToken], + max_result: [() => input.maxResults !== void 0, () => input.maxResults.toString()], + }); + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "GET", + headers, + path: resolvedPath, + query, + body, + }); +}; +exports.serializeAws_restJson1ListAccountsCommand = serializeAws_restJson1ListAccountsCommand; +const serializeAws_restJson1LogoutCommand = async (input, context) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const headers = map({}, isSerializableHeaderValue, { + "x-amz-sso_bearer_token": input.accessToken, + }); + const resolvedPath = `${(basePath === null || basePath === void 0 ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}` + "/logout"; + let body; + return new protocol_http_1.HttpRequest({ + protocol, + hostname, + port, + method: "POST", + headers, + path: resolvedPath, + body, + }); +}; +exports.serializeAws_restJson1LogoutCommand = serializeAws_restJson1LogoutCommand; +const deserializeAws_restJson1GetRoleCredentialsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return deserializeAws_restJson1GetRoleCredentialsCommandError(output, context); + } + const contents = map({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + if (data.roleCredentials != null) { + contents.roleCredentials = deserializeAws_restJson1RoleCredentials(data.roleCredentials, context); + } + return contents; +}; +exports.deserializeAws_restJson1GetRoleCredentialsCommand = deserializeAws_restJson1GetRoleCredentialsCommand; +const deserializeAws_restJson1GetRoleCredentialsCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await deserializeAws_restJson1InvalidRequestExceptionResponse(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await deserializeAws_restJson1ResourceNotFoundExceptionResponse(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await deserializeAws_restJson1TooManyRequestsExceptionResponse(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await deserializeAws_restJson1UnauthorizedExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody, + exceptionCtor: SSOServiceException_1.SSOServiceException, + errorCode, + }); + } +}; +const deserializeAws_restJson1ListAccountRolesCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return deserializeAws_restJson1ListAccountRolesCommandError(output, context); + } + const contents = map({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + if (data.nextToken != null) { + contents.nextToken = (0, smithy_client_1.expectString)(data.nextToken); + } + if (data.roleList != null) { + contents.roleList = deserializeAws_restJson1RoleListType(data.roleList, context); + } + return contents; +}; +exports.deserializeAws_restJson1ListAccountRolesCommand = deserializeAws_restJson1ListAccountRolesCommand; +const deserializeAws_restJson1ListAccountRolesCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await deserializeAws_restJson1InvalidRequestExceptionResponse(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await deserializeAws_restJson1ResourceNotFoundExceptionResponse(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await deserializeAws_restJson1TooManyRequestsExceptionResponse(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await deserializeAws_restJson1UnauthorizedExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody, + exceptionCtor: SSOServiceException_1.SSOServiceException, + errorCode, + }); + } +}; +const deserializeAws_restJson1ListAccountsCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return deserializeAws_restJson1ListAccountsCommandError(output, context); + } + const contents = map({ + $metadata: deserializeMetadata(output), + }); + const data = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.expectObject)(await parseBody(output.body, context)), "body"); + if (data.accountList != null) { + contents.accountList = deserializeAws_restJson1AccountListType(data.accountList, context); + } + if (data.nextToken != null) { + contents.nextToken = (0, smithy_client_1.expectString)(data.nextToken); + } + return contents; +}; +exports.deserializeAws_restJson1ListAccountsCommand = deserializeAws_restJson1ListAccountsCommand; +const deserializeAws_restJson1ListAccountsCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await deserializeAws_restJson1InvalidRequestExceptionResponse(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await deserializeAws_restJson1ResourceNotFoundExceptionResponse(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await deserializeAws_restJson1TooManyRequestsExceptionResponse(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await deserializeAws_restJson1UnauthorizedExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody, + exceptionCtor: SSOServiceException_1.SSOServiceException, + errorCode, + }); + } +}; +const deserializeAws_restJson1LogoutCommand = async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return deserializeAws_restJson1LogoutCommandError(output, context); + } + const contents = map({ + $metadata: deserializeMetadata(output), + }); + await collectBody(output.body, context); + return contents; +}; +exports.deserializeAws_restJson1LogoutCommand = deserializeAws_restJson1LogoutCommand; +const deserializeAws_restJson1LogoutCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadRestJsonErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await deserializeAws_restJson1InvalidRequestExceptionResponse(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await deserializeAws_restJson1TooManyRequestsExceptionResponse(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await deserializeAws_restJson1UnauthorizedExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody, + exceptionCtor: SSOServiceException_1.SSOServiceException, + errorCode, + }); + } +}; +const map = smithy_client_1.map; +const deserializeAws_restJson1InvalidRequestExceptionResponse = async (parsedOutput, context) => { + const contents = map({}); + const data = parsedOutput.body; + if (data.message != null) { + contents.message = (0, smithy_client_1.expectString)(data.message); + } + const exception = new models_0_1.InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const deserializeAws_restJson1ResourceNotFoundExceptionResponse = async (parsedOutput, context) => { + const contents = map({}); + const data = parsedOutput.body; + if (data.message != null) { + contents.message = (0, smithy_client_1.expectString)(data.message); + } + const exception = new models_0_1.ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const deserializeAws_restJson1TooManyRequestsExceptionResponse = async (parsedOutput, context) => { + const contents = map({}); + const data = parsedOutput.body; + if (data.message != null) { + contents.message = (0, smithy_client_1.expectString)(data.message); + } + const exception = new models_0_1.TooManyRequestsException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const deserializeAws_restJson1UnauthorizedExceptionResponse = async (parsedOutput, context) => { + const contents = map({}); + const data = parsedOutput.body; + if (data.message != null) { + contents.message = (0, smithy_client_1.expectString)(data.message); + } + const exception = new models_0_1.UnauthorizedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents, + }); + return (0, smithy_client_1.decorateServiceException)(exception, parsedOutput.body); +}; +const deserializeAws_restJson1AccountInfo = (output, context) => { + return { + accountId: (0, smithy_client_1.expectString)(output.accountId), + accountName: (0, smithy_client_1.expectString)(output.accountName), + emailAddress: (0, smithy_client_1.expectString)(output.emailAddress), + }; +}; +const deserializeAws_restJson1AccountListType = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + if (entry === null) { + return null; + } + return deserializeAws_restJson1AccountInfo(entry, context); + }); + return retVal; +}; +const deserializeAws_restJson1RoleCredentials = (output, context) => { + return { + accessKeyId: (0, smithy_client_1.expectString)(output.accessKeyId), + expiration: (0, smithy_client_1.expectLong)(output.expiration), + secretAccessKey: (0, smithy_client_1.expectString)(output.secretAccessKey), + sessionToken: (0, smithy_client_1.expectString)(output.sessionToken), + }; +}; +const deserializeAws_restJson1RoleInfo = (output, context) => { + return { + accountId: (0, smithy_client_1.expectString)(output.accountId), + roleName: (0, smithy_client_1.expectString)(output.roleName), + }; +}; +const deserializeAws_restJson1RoleListType = (output, context) => { + const retVal = (output || []) + .filter((e) => e != null) + .map((entry) => { + if (entry === null) { + return null; + } + return deserializeAws_restJson1RoleInfo(entry, context); + }); + return retVal; +}; +const deserializeMetadata = (output) => { + var _a, _b; + return ({ + httpStatusCode: output.statusCode, + requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], + }); +}; +const collectBody = (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return Promise.resolve(streamBody); + } + return context.streamCollector(streamBody) || Promise.resolve(new Uint8Array()); +}; +const collectBodyString = (streamBody, context) => collectBody(streamBody, context).then((body) => context.utf8Encoder(body)); +const isSerializableHeaderValue = (value) => value !== undefined && + value !== null && + value !== "" && + (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && + (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0); +const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + return JSON.parse(encoded); + } + return {}; +}); +const parseErrorBody = async (errorBody, context) => { + var _a; + const value = await parseBody(errorBody, context); + value.message = (_a = value.message) !== null && _a !== void 0 ? _a : value.Message; + return value; +}; +const loadRestJsonErrorCode = (output, data) => { + const findKey = (object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()); + const sanitizeErrorCode = (rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }; + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== undefined) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data.code !== undefined) { + return sanitizeErrorCode(data.code); + } + if (data["__type"] !== undefined) { + return sanitizeErrorCode(data["__type"]); + } +}; + + +/***/ }), + +/***/ 9756: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(1092)); +const config_resolver_1 = __nccwpck_require__(6153); +const hash_node_1 = __nccwpck_require__(7442); +const middleware_retry_1 = __nccwpck_require__(6064); +const node_config_provider_1 = __nccwpck_require__(7684); +const node_http_handler_1 = __nccwpck_require__(8805); +const util_base64_node_1 = __nccwpck_require__(8588); +const util_body_length_node_1 = __nccwpck_require__(4147); +const util_user_agent_node_1 = __nccwpck_require__(8095); +const util_utf8_node_1 = __nccwpck_require__(6278); +const runtimeConfig_shared_1 = __nccwpck_require__(4355); +const smithy_client_1 = __nccwpck_require__(4963); +const util_defaults_mode_node_1 = __nccwpck_require__(4243); +const smithy_client_2 = __nccwpck_require__(4963); +const getRuntimeConfig = (config) => { + var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k, _l, _m, _o, _p; + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + base64Decoder: (_a = config === null || config === void 0 ? void 0 : config.base64Decoder) !== null && _a !== void 0 ? _a : util_base64_node_1.fromBase64, + base64Encoder: (_b = config === null || config === void 0 ? void 0 : config.base64Encoder) !== null && _b !== void 0 ? _b : util_base64_node_1.toBase64, + bodyLengthChecker: (_c = config === null || config === void 0 ? void 0 : config.bodyLengthChecker) !== null && _c !== void 0 ? _c : util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: (_d = config === null || config === void 0 ? void 0 : config.defaultUserAgentProvider) !== null && _d !== void 0 ? _d : (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: (_e = config === null || config === void 0 ? void 0 : config.maxAttempts) !== null && _e !== void 0 ? _e : (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: (_f = config === null || config === void 0 ? void 0 : config.region) !== null && _f !== void 0 ? _f : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: (_g = config === null || config === void 0 ? void 0 : config.requestHandler) !== null && _g !== void 0 ? _g : new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: (_h = config === null || config === void 0 ? void 0 : config.retryMode) !== null && _h !== void 0 ? _h : (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || middleware_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: (_j = config === null || config === void 0 ? void 0 : config.sha256) !== null && _j !== void 0 ? _j : hash_node_1.Hash.bind(null, "sha256"), + streamCollector: (_k = config === null || config === void 0 ? void 0 : config.streamCollector) !== null && _k !== void 0 ? _k : node_http_handler_1.streamCollector, + useDualstackEndpoint: (_l = config === null || config === void 0 ? void 0 : config.useDualstackEndpoint) !== null && _l !== void 0 ? _l : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: (_m = config === null || config === void 0 ? void 0 : config.useFipsEndpoint) !== null && _m !== void 0 ? _m : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + utf8Decoder: (_o = config === null || config === void 0 ? void 0 : config.utf8Decoder) !== null && _o !== void 0 ? _o : util_utf8_node_1.fromUtf8, + utf8Encoder: (_p = config === null || config === void 0 ? void 0 : config.utf8Encoder) !== null && _p !== void 0 ? _p : util_utf8_node_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 4355: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const url_parser_1 = __nccwpck_require__(2992); +const endpointResolver_1 = __nccwpck_require__(898); +const getRuntimeConfig = (config) => { + var _a, _b, _c, _d, _e; + return ({ + apiVersion: "2019-06-10", + disableHostPrefix: (_a = config === null || config === void 0 ? void 0 : config.disableHostPrefix) !== null && _a !== void 0 ? _a : false, + endpointProvider: (_b = config === null || config === void 0 ? void 0 : config.endpointProvider) !== null && _b !== void 0 ? _b : endpointResolver_1.defaultEndpointResolver, + logger: (_c = config === null || config === void 0 ? void 0 : config.logger) !== null && _c !== void 0 ? _c : {}, + serviceId: (_d = config === null || config === void 0 ? void 0 : config.serviceId) !== null && _d !== void 0 ? _d : "SSO", + urlParser: (_e = config === null || config === void 0 ? void 0 : config.urlParser) !== null && _e !== void 0 ? _e : url_parser_1.parseUrl, + }); +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 2605: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STS = void 0; +const AssumeRoleCommand_1 = __nccwpck_require__(9802); +const AssumeRoleWithSAMLCommand_1 = __nccwpck_require__(2865); +const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(7451); +const DecodeAuthorizationMessageCommand_1 = __nccwpck_require__(4150); +const GetAccessKeyInfoCommand_1 = __nccwpck_require__(9804); +const GetCallerIdentityCommand_1 = __nccwpck_require__(4278); +const GetFederationTokenCommand_1 = __nccwpck_require__(7552); +const GetSessionTokenCommand_1 = __nccwpck_require__(3285); +const STSClient_1 = __nccwpck_require__(4195); +class STS extends STSClient_1.STSClient { + assumeRole(args, optionsOrCb, cb) { + const command = new AssumeRoleCommand_1.AssumeRoleCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + assumeRoleWithSAML(args, optionsOrCb, cb) { + const command = new AssumeRoleWithSAMLCommand_1.AssumeRoleWithSAMLCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + assumeRoleWithWebIdentity(args, optionsOrCb, cb) { + const command = new AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + decodeAuthorizationMessage(args, optionsOrCb, cb) { + const command = new DecodeAuthorizationMessageCommand_1.DecodeAuthorizationMessageCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + getAccessKeyInfo(args, optionsOrCb, cb) { + const command = new GetAccessKeyInfoCommand_1.GetAccessKeyInfoCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + getCallerIdentity(args, optionsOrCb, cb) { + const command = new GetCallerIdentityCommand_1.GetCallerIdentityCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + getFederationToken(args, optionsOrCb, cb) { + const command = new GetFederationTokenCommand_1.GetFederationTokenCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } + getSessionToken(args, optionsOrCb, cb) { + const command = new GetSessionTokenCommand_1.GetSessionTokenCommand(args); + if (typeof optionsOrCb === "function") { + this.send(command, optionsOrCb); + } + else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expect http options but get ${typeof optionsOrCb}`); + this.send(command, optionsOrCb || {}, cb); + } + else { + return this.send(command, optionsOrCb); + } + } +} +exports.STS = STS; + + +/***/ }), + +/***/ 4195: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSClient = void 0; +const config_resolver_1 = __nccwpck_require__(6153); +const middleware_content_length_1 = __nccwpck_require__(2245); +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_host_header_1 = __nccwpck_require__(2545); +const middleware_logger_1 = __nccwpck_require__(14); +const middleware_recursion_detection_1 = __nccwpck_require__(5525); +const middleware_retry_1 = __nccwpck_require__(6064); +const middleware_sdk_sts_1 = __nccwpck_require__(5959); +const middleware_user_agent_1 = __nccwpck_require__(4688); +const smithy_client_1 = __nccwpck_require__(4963); +const EndpointParameters_1 = __nccwpck_require__(510); +const runtimeConfig_1 = __nccwpck_require__(3405); +class STSClient extends smithy_client_1.Client { + constructor(configuration) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_sdk_sts_1.resolveStsAuthConfig)(_config_5, { stsClientCtor: STSClient }); + const _config_7 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_6); + super(_config_7); + this.config = _config_7; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + } + destroy() { + super.destroy(); + } +} +exports.STSClient = STSClient; + + +/***/ }), + +/***/ 9802: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class AssumeRoleCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.AssumeRoleRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.AssumeRoleResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryAssumeRoleCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryAssumeRoleCommand)(output, context); + } +} +exports.AssumeRoleCommand = AssumeRoleCommand; + + +/***/ }), + +/***/ 2865: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleWithSAMLCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class AssumeRoleWithSAMLCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithSAMLCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleWithSAMLCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.AssumeRoleWithSAMLResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryAssumeRoleWithSAMLCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryAssumeRoleWithSAMLCommand)(output, context); + } +} +exports.AssumeRoleWithSAMLCommand = AssumeRoleWithSAMLCommand; + + +/***/ }), + +/***/ 7451: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AssumeRoleWithWebIdentityCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class AssumeRoleWithWebIdentityCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, AssumeRoleWithWebIdentityCommand.getEndpointParameterInstructions())); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "AssumeRoleWithWebIdentityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.AssumeRoleWithWebIdentityResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryAssumeRoleWithWebIdentityCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryAssumeRoleWithWebIdentityCommand)(output, context); + } +} +exports.AssumeRoleWithWebIdentityCommand = AssumeRoleWithWebIdentityCommand; + + +/***/ }), + +/***/ 4150: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DecodeAuthorizationMessageCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class DecodeAuthorizationMessageCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, DecodeAuthorizationMessageCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "DecodeAuthorizationMessageCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.DecodeAuthorizationMessageRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.DecodeAuthorizationMessageResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryDecodeAuthorizationMessageCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryDecodeAuthorizationMessageCommand)(output, context); + } +} +exports.DecodeAuthorizationMessageCommand = DecodeAuthorizationMessageCommand; + + +/***/ }), + +/***/ 9804: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetAccessKeyInfoCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class GetAccessKeyInfoCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetAccessKeyInfoCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetAccessKeyInfoCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetAccessKeyInfoRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetAccessKeyInfoResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryGetAccessKeyInfoCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryGetAccessKeyInfoCommand)(output, context); + } +} +exports.GetAccessKeyInfoCommand = GetAccessKeyInfoCommand; + + +/***/ }), + +/***/ 4278: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetCallerIdentityCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class GetCallerIdentityCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetCallerIdentityCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetCallerIdentityCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetCallerIdentityRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetCallerIdentityResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryGetCallerIdentityCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryGetCallerIdentityCommand)(output, context); + } +} +exports.GetCallerIdentityCommand = GetCallerIdentityCommand; + + +/***/ }), + +/***/ 7552: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetFederationTokenCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class GetFederationTokenCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetFederationTokenCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetFederationTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetFederationTokenRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetFederationTokenResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryGetFederationTokenCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryGetFederationTokenCommand)(output, context); + } +} +exports.GetFederationTokenCommand = GetFederationTokenCommand; + + +/***/ }), + +/***/ 3285: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetSessionTokenCommand = void 0; +const middleware_endpoint_1 = __nccwpck_require__(5497); +const middleware_serde_1 = __nccwpck_require__(3631); +const middleware_signing_1 = __nccwpck_require__(4935); +const smithy_client_1 = __nccwpck_require__(4963); +const models_0_1 = __nccwpck_require__(1780); +const Aws_query_1 = __nccwpck_require__(740); +class GetSessionTokenCommand extends smithy_client_1.Command { + constructor(input) { + super(); + this.input = input; + } + static getEndpointParameterInstructions() { + return { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, + }; + } + resolveMiddleware(clientStack, configuration, options) { + this.middlewareStack.use((0, middleware_serde_1.getSerdePlugin)(configuration, this.serialize, this.deserialize)); + this.middlewareStack.use((0, middleware_endpoint_1.getEndpointPlugin)(configuration, GetSessionTokenCommand.getEndpointParameterInstructions())); + this.middlewareStack.use((0, middleware_signing_1.getAwsAuthPlugin)(configuration)); + const stack = clientStack.concat(this.middlewareStack); + const { logger } = configuration; + const clientName = "STSClient"; + const commandName = "GetSessionTokenCommand"; + const handlerExecutionContext = { + logger, + clientName, + commandName, + inputFilterSensitiveLog: models_0_1.GetSessionTokenRequestFilterSensitiveLog, + outputFilterSensitiveLog: models_0_1.GetSessionTokenResponseFilterSensitiveLog, + }; + const { requestHandler } = configuration; + return stack.resolve((request) => requestHandler.handle(request.request, options || {}), handlerExecutionContext); + } + serialize(input, context) { + return (0, Aws_query_1.serializeAws_queryGetSessionTokenCommand)(input, context); + } + deserialize(output, context) { + return (0, Aws_query_1.deserializeAws_queryGetSessionTokenCommand)(output, context); + } +} +exports.GetSessionTokenCommand = GetSessionTokenCommand; + + +/***/ }), + +/***/ 5716: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9802), exports); +tslib_1.__exportStar(__nccwpck_require__(2865), exports); +tslib_1.__exportStar(__nccwpck_require__(7451), exports); +tslib_1.__exportStar(__nccwpck_require__(4150), exports); +tslib_1.__exportStar(__nccwpck_require__(9804), exports); +tslib_1.__exportStar(__nccwpck_require__(4278), exports); +tslib_1.__exportStar(__nccwpck_require__(7552), exports); +tslib_1.__exportStar(__nccwpck_require__(3285), exports); + + +/***/ }), + +/***/ 8028: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; +const defaultStsRoleAssumers_1 = __nccwpck_require__(48); +const STSClient_1 = __nccwpck_require__(4195); +const getCustomizableStsClientCtor = (baseCtor, customizations) => { + if (!customizations) + return baseCtor; + else + return class CustomizableSTSClient extends baseCtor { + constructor(config) { + super(config); + for (const customization of customizations) { + this.middlewareStack.use(customization); + } + } + }; +}; +const getDefaultRoleAssumer = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumer)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); +exports.getDefaultRoleAssumer = getDefaultRoleAssumer; +const getDefaultRoleAssumerWithWebIdentity = (stsOptions = {}, stsPlugins) => (0, defaultStsRoleAssumers_1.getDefaultRoleAssumerWithWebIdentity)(stsOptions, getCustomizableStsClientCtor(STSClient_1.STSClient, stsPlugins)); +exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; +const decorateDefaultCredentialProvider = (provider) => (input) => provider({ + roleAssumer: (0, exports.getDefaultRoleAssumer)(input), + roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input), + ...input, +}); +exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; + + +/***/ }), + +/***/ 48: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.decorateDefaultCredentialProvider = exports.getDefaultRoleAssumerWithWebIdentity = exports.getDefaultRoleAssumer = void 0; +const AssumeRoleCommand_1 = __nccwpck_require__(9802); +const AssumeRoleWithWebIdentityCommand_1 = __nccwpck_require__(7451); +const ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; +const decorateDefaultRegion = (region) => { + if (typeof region !== "function") { + return region === undefined ? ASSUME_ROLE_DEFAULT_REGION : region; + } + return async () => { + try { + return await region(); + } + catch (e) { + return ASSUME_ROLE_DEFAULT_REGION; + } + }; +}; +const getDefaultRoleAssumer = (stsOptions, stsClientCtor) => { + let stsClient; + let closureSourceCreds; + return async (sourceCreds, params) => { + closureSourceCreds = sourceCreds; + if (!stsClient) { + const { logger, region, requestHandler } = stsOptions; + stsClient = new stsClientCtor({ + logger, + credentialDefaultProvider: () => async () => closureSourceCreds, + region: decorateDefaultRegion(region || stsOptions.region), + ...(requestHandler ? { requestHandler } : {}), + }); + } + const { Credentials } = await stsClient.send(new AssumeRoleCommand_1.AssumeRoleCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + }; + }; +}; +exports.getDefaultRoleAssumer = getDefaultRoleAssumer; +const getDefaultRoleAssumerWithWebIdentity = (stsOptions, stsClientCtor) => { + let stsClient; + return async (params) => { + if (!stsClient) { + const { logger, region, requestHandler } = stsOptions; + stsClient = new stsClientCtor({ + logger, + region: decorateDefaultRegion(region || stsOptions.region), + ...(requestHandler ? { requestHandler } : {}), + }); + } + const { Credentials } = await stsClient.send(new AssumeRoleWithWebIdentityCommand_1.AssumeRoleWithWebIdentityCommand(params)); + if (!Credentials || !Credentials.AccessKeyId || !Credentials.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials.AccessKeyId, + secretAccessKey: Credentials.SecretAccessKey, + sessionToken: Credentials.SessionToken, + expiration: Credentials.Expiration, + }; + }; +}; +exports.getDefaultRoleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity; +const decorateDefaultCredentialProvider = (provider) => (input) => provider({ + roleAssumer: (0, exports.getDefaultRoleAssumer)(input, input.stsClientCtor), + roleAssumerWithWebIdentity: (0, exports.getDefaultRoleAssumerWithWebIdentity)(input, input.stsClientCtor), + ...input, +}); +exports.decorateDefaultCredentialProvider = decorateDefaultCredentialProvider; + + +/***/ }), + +/***/ 510: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + var _a, _b, _c; + return { + ...options, + useDualstackEndpoint: (_a = options.useDualstackEndpoint) !== null && _a !== void 0 ? _a : false, + useFipsEndpoint: (_b = options.useFipsEndpoint) !== null && _b !== void 0 ? _b : false, + useGlobalEndpoint: (_c = options.useGlobalEndpoint) !== null && _c !== void 0 ? _c : false, + defaultSigningName: "sts", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; + + +/***/ }), + +/***/ 1203: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(3350); +const ruleset_1 = __nccwpck_require__(6882); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_1.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; + + +/***/ }), + +/***/ 6882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +exports.ruleSet = { + version: "1.0", + parameters: { + Region: { + builtIn: "AWS::Region", + required: false, + documentation: "The AWS region used to dispatch the request.", + type: "String", + }, + UseDualStack: { + builtIn: "AWS::UseDualStack", + required: true, + default: false, + documentation: "When true, use the dual-stack endpoint. If the configured endpoint does not support dual-stack, dispatching the request MAY return an error.", + type: "Boolean", + }, + UseFIPS: { + builtIn: "AWS::UseFIPS", + required: true, + default: false, + documentation: "When true, send this request to the FIPS-compliant regional endpoint. If the configured endpoint does not have a FIPS compliant endpoint, dispatching the request will return an error.", + type: "Boolean", + }, + Endpoint: { + builtIn: "SDK::Endpoint", + required: false, + documentation: "Override the endpoint used to send this request", + type: "String", + }, + UseGlobalEndpoint: { + builtIn: "AWS::STS::UseGlobalEndpoint", + required: true, + default: false, + documentation: "Whether the global endpoint should be used, rather then the regional endpoint for us-east-1.", + type: "Boolean", + }, + }, + rules: [ + { + conditions: [ + { + fn: "aws.partition", + argv: [ + { + ref: "Region", + }, + ], + assign: "PartitionResult", + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseGlobalEndpoint", + }, + true, + ], + }, + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + false, + ], + }, + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + false, + ], + }, + { + fn: "not", + argv: [ + { + fn: "isSet", + argv: [ + { + ref: "Endpoint", + }, + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "ap-northeast-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "ap-south-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "ap-southeast-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "ap-southeast-2", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "aws-global", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "ca-central-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "eu-central-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "eu-north-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "eu-west-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "eu-west-2", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "eu-west-3", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "sa-east-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "us-east-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "us-east-2", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "us-west-1", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "us-west-2", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [], + endpoint: { + url: "https://sts.{Region}.{PartitionResult#dnsSuffix}", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "{Region}", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + { + conditions: [ + { + fn: "isSet", + argv: [ + { + ref: "Endpoint", + }, + ], + }, + { + fn: "parseURL", + argv: [ + { + ref: "Endpoint", + }, + ], + assign: "url", + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + ], + error: "Invalid Configuration: FIPS and custom endpoint are not supported", + type: "error", + }, + { + conditions: [], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + error: "Invalid Configuration: Dualstack and custom endpoint are not supported", + type: "error", + }, + { + conditions: [], + endpoint: { + url: { + ref: "Endpoint", + }, + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsFIPS", + ], + }, + ], + }, + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsDualStack", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + endpoint: { + url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + { + conditions: [], + error: "FIPS and DualStack are enabled, but this partition does not support one or both", + type: "error", + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseFIPS", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsFIPS", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "stringEquals", + argv: [ + "aws-us-gov", + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "name", + ], + }, + ], + }, + ], + endpoint: { + url: "https://sts.{Region}.{PartitionResult#dnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [], + endpoint: { + url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], + }, + { + conditions: [], + error: "FIPS is enabled but this partition does not support FIPS", + type: "error", + }, + ], + }, + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + { + ref: "UseDualStack", + }, + true, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "booleanEquals", + argv: [ + true, + { + fn: "getAttr", + argv: [ + { + ref: "PartitionResult", + }, + "supportsDualStack", + ], + }, + ], + }, + ], + type: "tree", + rules: [ + { + conditions: [], + endpoint: { + url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + { + conditions: [], + error: "DualStack is enabled but this partition does not support DualStack", + type: "error", + }, + ], + }, + { + conditions: [], + type: "tree", + rules: [ + { + conditions: [ + { + fn: "stringEquals", + argv: [ + { + ref: "Region", + }, + "aws-global", + ], + }, + ], + endpoint: { + url: "https://sts.amazonaws.com", + properties: { + authSchemes: [ + { + name: "sigv4", + signingName: "sts", + signingRegion: "us-east-1", + }, + ], + }, + headers: {}, + }, + type: "endpoint", + }, + { + conditions: [], + endpoint: { + url: "https://sts.{Region}.{PartitionResult#dnsSuffix}", + properties: {}, + headers: {}, + }, + type: "endpoint", + }, + ], + }, + ], + }, + ], +}; + + +/***/ }), + +/***/ 2209: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSServiceException = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2605), exports); +tslib_1.__exportStar(__nccwpck_require__(4195), exports); +tslib_1.__exportStar(__nccwpck_require__(5716), exports); +tslib_1.__exportStar(__nccwpck_require__(8028), exports); +tslib_1.__exportStar(__nccwpck_require__(106), exports); +var STSServiceException_1 = __nccwpck_require__(6450); +Object.defineProperty(exports, "STSServiceException", ({ enumerable: true, get: function () { return STSServiceException_1.STSServiceException; } })); + + +/***/ }), + +/***/ 6450: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSServiceException = void 0; +const smithy_client_1 = __nccwpck_require__(4963); +class STSServiceException extends smithy_client_1.ServiceException { + constructor(options) { + super(options); + Object.setPrototypeOf(this, STSServiceException.prototype); + } +} +exports.STSServiceException = STSServiceException; + + +/***/ }), + +/***/ 106: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(1780), exports); + + +/***/ }), + +/***/ 1780: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.GetSessionTokenResponseFilterSensitiveLog = exports.GetSessionTokenRequestFilterSensitiveLog = exports.GetFederationTokenResponseFilterSensitiveLog = exports.FederatedUserFilterSensitiveLog = exports.GetFederationTokenRequestFilterSensitiveLog = exports.GetCallerIdentityResponseFilterSensitiveLog = exports.GetCallerIdentityRequestFilterSensitiveLog = exports.GetAccessKeyInfoResponseFilterSensitiveLog = exports.GetAccessKeyInfoRequestFilterSensitiveLog = exports.DecodeAuthorizationMessageResponseFilterSensitiveLog = exports.DecodeAuthorizationMessageRequestFilterSensitiveLog = exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = exports.AssumeRoleResponseFilterSensitiveLog = exports.CredentialsFilterSensitiveLog = exports.AssumeRoleRequestFilterSensitiveLog = exports.TagFilterSensitiveLog = exports.PolicyDescriptorTypeFilterSensitiveLog = exports.AssumedRoleUserFilterSensitiveLog = exports.InvalidAuthorizationMessageException = exports.IDPCommunicationErrorException = exports.InvalidIdentityTokenException = exports.IDPRejectedClaimException = exports.RegionDisabledException = exports.PackedPolicyTooLargeException = exports.MalformedPolicyDocumentException = exports.ExpiredTokenException = void 0; +const STSServiceException_1 = __nccwpck_require__(6450); +class ExpiredTokenException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts, + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, ExpiredTokenException.prototype); + } +} +exports.ExpiredTokenException = ExpiredTokenException; +class MalformedPolicyDocumentException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts, + }); + this.name = "MalformedPolicyDocumentException"; + this.$fault = "client"; + Object.setPrototypeOf(this, MalformedPolicyDocumentException.prototype); + } +} +exports.MalformedPolicyDocumentException = MalformedPolicyDocumentException; +class PackedPolicyTooLargeException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "PackedPolicyTooLargeException", + $fault: "client", + ...opts, + }); + this.name = "PackedPolicyTooLargeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, PackedPolicyTooLargeException.prototype); + } +} +exports.PackedPolicyTooLargeException = PackedPolicyTooLargeException; +class RegionDisabledException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "RegionDisabledException", + $fault: "client", + ...opts, + }); + this.name = "RegionDisabledException"; + this.$fault = "client"; + Object.setPrototypeOf(this, RegionDisabledException.prototype); + } +} +exports.RegionDisabledException = RegionDisabledException; +class IDPRejectedClaimException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "IDPRejectedClaimException", + $fault: "client", + ...opts, + }); + this.name = "IDPRejectedClaimException"; + this.$fault = "client"; + Object.setPrototypeOf(this, IDPRejectedClaimException.prototype); + } +} +exports.IDPRejectedClaimException = IDPRejectedClaimException; +class InvalidIdentityTokenException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "InvalidIdentityTokenException", + $fault: "client", + ...opts, + }); + this.name = "InvalidIdentityTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidIdentityTokenException.prototype); + } +} +exports.InvalidIdentityTokenException = InvalidIdentityTokenException; +class IDPCommunicationErrorException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "IDPCommunicationErrorException", + $fault: "client", + ...opts, + }); + this.name = "IDPCommunicationErrorException"; + this.$fault = "client"; + Object.setPrototypeOf(this, IDPCommunicationErrorException.prototype); + } +} +exports.IDPCommunicationErrorException = IDPCommunicationErrorException; +class InvalidAuthorizationMessageException extends STSServiceException_1.STSServiceException { + constructor(opts) { + super({ + name: "InvalidAuthorizationMessageException", + $fault: "client", + ...opts, + }); + this.name = "InvalidAuthorizationMessageException"; + this.$fault = "client"; + Object.setPrototypeOf(this, InvalidAuthorizationMessageException.prototype); + } +} +exports.InvalidAuthorizationMessageException = InvalidAuthorizationMessageException; +const AssumedRoleUserFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumedRoleUserFilterSensitiveLog = AssumedRoleUserFilterSensitiveLog; +const PolicyDescriptorTypeFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.PolicyDescriptorTypeFilterSensitiveLog = PolicyDescriptorTypeFilterSensitiveLog; +const TagFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.TagFilterSensitiveLog = TagFilterSensitiveLog; +const AssumeRoleRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleRequestFilterSensitiveLog = AssumeRoleRequestFilterSensitiveLog; +const CredentialsFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.CredentialsFilterSensitiveLog = CredentialsFilterSensitiveLog; +const AssumeRoleResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleResponseFilterSensitiveLog = AssumeRoleResponseFilterSensitiveLog; +const AssumeRoleWithSAMLRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleWithSAMLRequestFilterSensitiveLog = AssumeRoleWithSAMLRequestFilterSensitiveLog; +const AssumeRoleWithSAMLResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleWithSAMLResponseFilterSensitiveLog = AssumeRoleWithSAMLResponseFilterSensitiveLog; +const AssumeRoleWithWebIdentityRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleWithWebIdentityRequestFilterSensitiveLog = AssumeRoleWithWebIdentityRequestFilterSensitiveLog; +const AssumeRoleWithWebIdentityResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.AssumeRoleWithWebIdentityResponseFilterSensitiveLog = AssumeRoleWithWebIdentityResponseFilterSensitiveLog; +const DecodeAuthorizationMessageRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.DecodeAuthorizationMessageRequestFilterSensitiveLog = DecodeAuthorizationMessageRequestFilterSensitiveLog; +const DecodeAuthorizationMessageResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.DecodeAuthorizationMessageResponseFilterSensitiveLog = DecodeAuthorizationMessageResponseFilterSensitiveLog; +const GetAccessKeyInfoRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetAccessKeyInfoRequestFilterSensitiveLog = GetAccessKeyInfoRequestFilterSensitiveLog; +const GetAccessKeyInfoResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetAccessKeyInfoResponseFilterSensitiveLog = GetAccessKeyInfoResponseFilterSensitiveLog; +const GetCallerIdentityRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetCallerIdentityRequestFilterSensitiveLog = GetCallerIdentityRequestFilterSensitiveLog; +const GetCallerIdentityResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetCallerIdentityResponseFilterSensitiveLog = GetCallerIdentityResponseFilterSensitiveLog; +const GetFederationTokenRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetFederationTokenRequestFilterSensitiveLog = GetFederationTokenRequestFilterSensitiveLog; +const FederatedUserFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.FederatedUserFilterSensitiveLog = FederatedUserFilterSensitiveLog; +const GetFederationTokenResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetFederationTokenResponseFilterSensitiveLog = GetFederationTokenResponseFilterSensitiveLog; +const GetSessionTokenRequestFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetSessionTokenRequestFilterSensitiveLog = GetSessionTokenRequestFilterSensitiveLog; +const GetSessionTokenResponseFilterSensitiveLog = (obj) => ({ + ...obj, +}); +exports.GetSessionTokenResponseFilterSensitiveLog = GetSessionTokenResponseFilterSensitiveLog; + + +/***/ }), + +/***/ 740: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.deserializeAws_queryGetSessionTokenCommand = exports.deserializeAws_queryGetFederationTokenCommand = exports.deserializeAws_queryGetCallerIdentityCommand = exports.deserializeAws_queryGetAccessKeyInfoCommand = exports.deserializeAws_queryDecodeAuthorizationMessageCommand = exports.deserializeAws_queryAssumeRoleWithWebIdentityCommand = exports.deserializeAws_queryAssumeRoleWithSAMLCommand = exports.deserializeAws_queryAssumeRoleCommand = exports.serializeAws_queryGetSessionTokenCommand = exports.serializeAws_queryGetFederationTokenCommand = exports.serializeAws_queryGetCallerIdentityCommand = exports.serializeAws_queryGetAccessKeyInfoCommand = exports.serializeAws_queryDecodeAuthorizationMessageCommand = exports.serializeAws_queryAssumeRoleWithWebIdentityCommand = exports.serializeAws_queryAssumeRoleWithSAMLCommand = exports.serializeAws_queryAssumeRoleCommand = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const smithy_client_1 = __nccwpck_require__(4963); +const fast_xml_parser_1 = __nccwpck_require__(2603); +const models_0_1 = __nccwpck_require__(1780); +const STSServiceException_1 = __nccwpck_require__(6450); +const serializeAws_queryAssumeRoleCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryAssumeRoleRequest(input, context), + Action: "AssumeRole", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryAssumeRoleCommand = serializeAws_queryAssumeRoleCommand; +const serializeAws_queryAssumeRoleWithSAMLCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryAssumeRoleWithSAMLRequest(input, context), + Action: "AssumeRoleWithSAML", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryAssumeRoleWithSAMLCommand = serializeAws_queryAssumeRoleWithSAMLCommand; +const serializeAws_queryAssumeRoleWithWebIdentityCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryAssumeRoleWithWebIdentityRequest(input, context), + Action: "AssumeRoleWithWebIdentity", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryAssumeRoleWithWebIdentityCommand = serializeAws_queryAssumeRoleWithWebIdentityCommand; +const serializeAws_queryDecodeAuthorizationMessageCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryDecodeAuthorizationMessageRequest(input, context), + Action: "DecodeAuthorizationMessage", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryDecodeAuthorizationMessageCommand = serializeAws_queryDecodeAuthorizationMessageCommand; +const serializeAws_queryGetAccessKeyInfoCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryGetAccessKeyInfoRequest(input, context), + Action: "GetAccessKeyInfo", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryGetAccessKeyInfoCommand = serializeAws_queryGetAccessKeyInfoCommand; +const serializeAws_queryGetCallerIdentityCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryGetCallerIdentityRequest(input, context), + Action: "GetCallerIdentity", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryGetCallerIdentityCommand = serializeAws_queryGetCallerIdentityCommand; +const serializeAws_queryGetFederationTokenCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryGetFederationTokenRequest(input, context), + Action: "GetFederationToken", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryGetFederationTokenCommand = serializeAws_queryGetFederationTokenCommand; +const serializeAws_queryGetSessionTokenCommand = async (input, context) => { + const headers = { + "content-type": "application/x-www-form-urlencoded", + }; + let body; + body = buildFormUrlencodedString({ + ...serializeAws_queryGetSessionTokenRequest(input, context), + Action: "GetSessionToken", + Version: "2011-06-15", + }); + return buildHttpRpcRequest(context, headers, "/", undefined, body); +}; +exports.serializeAws_queryGetSessionTokenCommand = serializeAws_queryGetSessionTokenCommand; +const deserializeAws_queryAssumeRoleCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryAssumeRoleCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryAssumeRoleResponse(data.AssumeRoleResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryAssumeRoleCommand = deserializeAws_queryAssumeRoleCommand; +const deserializeAws_queryAssumeRoleCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await deserializeAws_queryExpiredTokenExceptionResponse(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await deserializeAws_queryMalformedPolicyDocumentExceptionResponse(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await deserializeAws_queryPackedPolicyTooLargeExceptionResponse(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await deserializeAws_queryRegionDisabledExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryAssumeRoleWithSAMLCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryAssumeRoleWithSAMLCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryAssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryAssumeRoleWithSAMLCommand = deserializeAws_queryAssumeRoleWithSAMLCommand; +const deserializeAws_queryAssumeRoleWithSAMLCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await deserializeAws_queryExpiredTokenExceptionResponse(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await deserializeAws_queryIDPRejectedClaimExceptionResponse(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await deserializeAws_queryInvalidIdentityTokenExceptionResponse(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await deserializeAws_queryMalformedPolicyDocumentExceptionResponse(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await deserializeAws_queryPackedPolicyTooLargeExceptionResponse(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await deserializeAws_queryRegionDisabledExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryAssumeRoleWithWebIdentityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryAssumeRoleWithWebIdentityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryAssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryAssumeRoleWithWebIdentityCommand = deserializeAws_queryAssumeRoleWithWebIdentityCommand; +const deserializeAws_queryAssumeRoleWithWebIdentityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await deserializeAws_queryExpiredTokenExceptionResponse(parsedOutput, context); + case "IDPCommunicationError": + case "com.amazonaws.sts#IDPCommunicationErrorException": + throw await deserializeAws_queryIDPCommunicationErrorExceptionResponse(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await deserializeAws_queryIDPRejectedClaimExceptionResponse(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await deserializeAws_queryInvalidIdentityTokenExceptionResponse(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await deserializeAws_queryMalformedPolicyDocumentExceptionResponse(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await deserializeAws_queryPackedPolicyTooLargeExceptionResponse(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await deserializeAws_queryRegionDisabledExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryDecodeAuthorizationMessageCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryDecodeAuthorizationMessageCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryDecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryDecodeAuthorizationMessageCommand = deserializeAws_queryDecodeAuthorizationMessageCommand; +const deserializeAws_queryDecodeAuthorizationMessageCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "InvalidAuthorizationMessageException": + case "com.amazonaws.sts#InvalidAuthorizationMessageException": + throw await deserializeAws_queryInvalidAuthorizationMessageExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryGetAccessKeyInfoCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryGetAccessKeyInfoCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryGetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryGetAccessKeyInfoCommand = deserializeAws_queryGetAccessKeyInfoCommand; +const deserializeAws_queryGetAccessKeyInfoCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); +}; +const deserializeAws_queryGetCallerIdentityCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryGetCallerIdentityCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryGetCallerIdentityResponse(data.GetCallerIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryGetCallerIdentityCommand = deserializeAws_queryGetCallerIdentityCommand; +const deserializeAws_queryGetCallerIdentityCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); +}; +const deserializeAws_queryGetFederationTokenCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryGetFederationTokenCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryGetFederationTokenResponse(data.GetFederationTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryGetFederationTokenCommand = deserializeAws_queryGetFederationTokenCommand; +const deserializeAws_queryGetFederationTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await deserializeAws_queryMalformedPolicyDocumentExceptionResponse(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await deserializeAws_queryPackedPolicyTooLargeExceptionResponse(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await deserializeAws_queryRegionDisabledExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryGetSessionTokenCommand = async (output, context) => { + if (output.statusCode >= 300) { + return deserializeAws_queryGetSessionTokenCommandError(output, context); + } + const data = await parseBody(output.body, context); + let contents = {}; + contents = deserializeAws_queryGetSessionTokenResponse(data.GetSessionTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents, + }; + return Promise.resolve(response); +}; +exports.deserializeAws_queryGetSessionTokenCommand = deserializeAws_queryGetSessionTokenCommand; +const deserializeAws_queryGetSessionTokenCommandError = async (output, context) => { + const parsedOutput = { + ...output, + body: await parseErrorBody(output.body, context), + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await deserializeAws_queryRegionDisabledExceptionResponse(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + (0, smithy_client_1.throwDefaultError)({ + output, + parsedBody: parsedBody.Error, + exceptionCtor: STSServiceException_1.STSServiceException, + errorCode, + }); + } +}; +const deserializeAws_queryExpiredTokenExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryExpiredTokenException(body.Error, context); + const exception = new models_0_1.ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryIDPCommunicationErrorExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryIDPCommunicationErrorException(body.Error, context); + const exception = new models_0_1.IDPCommunicationErrorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryIDPRejectedClaimExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryIDPRejectedClaimException(body.Error, context); + const exception = new models_0_1.IDPRejectedClaimException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryInvalidAuthorizationMessageExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryInvalidAuthorizationMessageException(body.Error, context); + const exception = new models_0_1.InvalidAuthorizationMessageException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryInvalidIdentityTokenExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryInvalidIdentityTokenException(body.Error, context); + const exception = new models_0_1.InvalidIdentityTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryMalformedPolicyDocumentExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryMalformedPolicyDocumentException(body.Error, context); + const exception = new models_0_1.MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryPackedPolicyTooLargeExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryPackedPolicyTooLargeException(body.Error, context); + const exception = new models_0_1.PackedPolicyTooLargeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const deserializeAws_queryRegionDisabledExceptionResponse = async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = deserializeAws_queryRegionDisabledException(body.Error, context); + const exception = new models_0_1.RegionDisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized, + }); + return (0, smithy_client_1.decorateServiceException)(exception, body); +}; +const serializeAws_queryAssumeRoleRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.RoleSessionName != null) { + entries["RoleSessionName"] = input.RoleSessionName; + } + if (input.PolicyArns != null) { + const memberEntries = serializeAws_querypolicyDescriptorListType(input.PolicyArns, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.Tags != null) { + const memberEntries = serializeAws_querytagListType(input.Tags, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + if (input.TransitiveTagKeys != null) { + const memberEntries = serializeAws_querytagKeyListType(input.TransitiveTagKeys, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `TransitiveTagKeys.${key}`; + entries[loc] = value; + }); + } + if (input.ExternalId != null) { + entries["ExternalId"] = input.ExternalId; + } + if (input.SerialNumber != null) { + entries["SerialNumber"] = input.SerialNumber; + } + if (input.TokenCode != null) { + entries["TokenCode"] = input.TokenCode; + } + if (input.SourceIdentity != null) { + entries["SourceIdentity"] = input.SourceIdentity; + } + return entries; +}; +const serializeAws_queryAssumeRoleWithSAMLRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.PrincipalArn != null) { + entries["PrincipalArn"] = input.PrincipalArn; + } + if (input.SAMLAssertion != null) { + entries["SAMLAssertion"] = input.SAMLAssertion; + } + if (input.PolicyArns != null) { + const memberEntries = serializeAws_querypolicyDescriptorListType(input.PolicyArns, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + return entries; +}; +const serializeAws_queryAssumeRoleWithWebIdentityRequest = (input, context) => { + const entries = {}; + if (input.RoleArn != null) { + entries["RoleArn"] = input.RoleArn; + } + if (input.RoleSessionName != null) { + entries["RoleSessionName"] = input.RoleSessionName; + } + if (input.WebIdentityToken != null) { + entries["WebIdentityToken"] = input.WebIdentityToken; + } + if (input.ProviderId != null) { + entries["ProviderId"] = input.ProviderId; + } + if (input.PolicyArns != null) { + const memberEntries = serializeAws_querypolicyDescriptorListType(input.PolicyArns, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + return entries; +}; +const serializeAws_queryDecodeAuthorizationMessageRequest = (input, context) => { + const entries = {}; + if (input.EncodedMessage != null) { + entries["EncodedMessage"] = input.EncodedMessage; + } + return entries; +}; +const serializeAws_queryGetAccessKeyInfoRequest = (input, context) => { + const entries = {}; + if (input.AccessKeyId != null) { + entries["AccessKeyId"] = input.AccessKeyId; + } + return entries; +}; +const serializeAws_queryGetCallerIdentityRequest = (input, context) => { + const entries = {}; + return entries; +}; +const serializeAws_queryGetFederationTokenRequest = (input, context) => { + const entries = {}; + if (input.Name != null) { + entries["Name"] = input.Name; + } + if (input.Policy != null) { + entries["Policy"] = input.Policy; + } + if (input.PolicyArns != null) { + const memberEntries = serializeAws_querypolicyDescriptorListType(input.PolicyArns, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.Tags != null) { + const memberEntries = serializeAws_querytagListType(input.Tags, context); + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + return entries; +}; +const serializeAws_queryGetSessionTokenRequest = (input, context) => { + const entries = {}; + if (input.DurationSeconds != null) { + entries["DurationSeconds"] = input.DurationSeconds; + } + if (input.SerialNumber != null) { + entries["SerialNumber"] = input.SerialNumber; + } + if (input.TokenCode != null) { + entries["TokenCode"] = input.TokenCode; + } + return entries; +}; +const serializeAws_querypolicyDescriptorListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = serializeAws_queryPolicyDescriptorType(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const serializeAws_queryPolicyDescriptorType = (input, context) => { + const entries = {}; + if (input.arn != null) { + entries["arn"] = input.arn; + } + return entries; +}; +const serializeAws_queryTag = (input, context) => { + const entries = {}; + if (input.Key != null) { + entries["Key"] = input.Key; + } + if (input.Value != null) { + entries["Value"] = input.Value; + } + return entries; +}; +const serializeAws_querytagKeyListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + entries[`member.${counter}`] = entry; + counter++; + } + return entries; +}; +const serializeAws_querytagListType = (input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = serializeAws_queryTag(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}; +const deserializeAws_queryAssumedRoleUser = (output, context) => { + const contents = { + AssumedRoleId: undefined, + Arn: undefined, + }; + if (output["AssumedRoleId"] !== undefined) { + contents.AssumedRoleId = (0, smithy_client_1.expectString)(output["AssumedRoleId"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const deserializeAws_queryAssumeRoleResponse = (output, context) => { + const contents = { + Credentials: undefined, + AssumedRoleUser: undefined, + PackedPolicySize: undefined, + SourceIdentity: undefined, + }; + if (output["Credentials"] !== undefined) { + contents.Credentials = deserializeAws_queryCredentials(output["Credentials"], context); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = deserializeAws_queryAssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const deserializeAws_queryAssumeRoleWithSAMLResponse = (output, context) => { + const contents = { + Credentials: undefined, + AssumedRoleUser: undefined, + PackedPolicySize: undefined, + Subject: undefined, + SubjectType: undefined, + Issuer: undefined, + Audience: undefined, + NameQualifier: undefined, + SourceIdentity: undefined, + }; + if (output["Credentials"] !== undefined) { + contents.Credentials = deserializeAws_queryCredentials(output["Credentials"], context); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = deserializeAws_queryAssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["Subject"] !== undefined) { + contents.Subject = (0, smithy_client_1.expectString)(output["Subject"]); + } + if (output["SubjectType"] !== undefined) { + contents.SubjectType = (0, smithy_client_1.expectString)(output["SubjectType"]); + } + if (output["Issuer"] !== undefined) { + contents.Issuer = (0, smithy_client_1.expectString)(output["Issuer"]); + } + if (output["Audience"] !== undefined) { + contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); + } + if (output["NameQualifier"] !== undefined) { + contents.NameQualifier = (0, smithy_client_1.expectString)(output["NameQualifier"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const deserializeAws_queryAssumeRoleWithWebIdentityResponse = (output, context) => { + const contents = { + Credentials: undefined, + SubjectFromWebIdentityToken: undefined, + AssumedRoleUser: undefined, + PackedPolicySize: undefined, + Provider: undefined, + Audience: undefined, + SourceIdentity: undefined, + }; + if (output["Credentials"] !== undefined) { + contents.Credentials = deserializeAws_queryCredentials(output["Credentials"], context); + } + if (output["SubjectFromWebIdentityToken"] !== undefined) { + contents.SubjectFromWebIdentityToken = (0, smithy_client_1.expectString)(output["SubjectFromWebIdentityToken"]); + } + if (output["AssumedRoleUser"] !== undefined) { + contents.AssumedRoleUser = deserializeAws_queryAssumedRoleUser(output["AssumedRoleUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + if (output["Provider"] !== undefined) { + contents.Provider = (0, smithy_client_1.expectString)(output["Provider"]); + } + if (output["Audience"] !== undefined) { + contents.Audience = (0, smithy_client_1.expectString)(output["Audience"]); + } + if (output["SourceIdentity"] !== undefined) { + contents.SourceIdentity = (0, smithy_client_1.expectString)(output["SourceIdentity"]); + } + return contents; +}; +const deserializeAws_queryCredentials = (output, context) => { + const contents = { + AccessKeyId: undefined, + SecretAccessKey: undefined, + SessionToken: undefined, + Expiration: undefined, + }; + if (output["AccessKeyId"] !== undefined) { + contents.AccessKeyId = (0, smithy_client_1.expectString)(output["AccessKeyId"]); + } + if (output["SecretAccessKey"] !== undefined) { + contents.SecretAccessKey = (0, smithy_client_1.expectString)(output["SecretAccessKey"]); + } + if (output["SessionToken"] !== undefined) { + contents.SessionToken = (0, smithy_client_1.expectString)(output["SessionToken"]); + } + if (output["Expiration"] !== undefined) { + contents.Expiration = (0, smithy_client_1.expectNonNull)((0, smithy_client_1.parseRfc3339DateTime)(output["Expiration"])); + } + return contents; +}; +const deserializeAws_queryDecodeAuthorizationMessageResponse = (output, context) => { + const contents = { + DecodedMessage: undefined, + }; + if (output["DecodedMessage"] !== undefined) { + contents.DecodedMessage = (0, smithy_client_1.expectString)(output["DecodedMessage"]); + } + return contents; +}; +const deserializeAws_queryExpiredTokenException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryFederatedUser = (output, context) => { + const contents = { + FederatedUserId: undefined, + Arn: undefined, + }; + if (output["FederatedUserId"] !== undefined) { + contents.FederatedUserId = (0, smithy_client_1.expectString)(output["FederatedUserId"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const deserializeAws_queryGetAccessKeyInfoResponse = (output, context) => { + const contents = { + Account: undefined, + }; + if (output["Account"] !== undefined) { + contents.Account = (0, smithy_client_1.expectString)(output["Account"]); + } + return contents; +}; +const deserializeAws_queryGetCallerIdentityResponse = (output, context) => { + const contents = { + UserId: undefined, + Account: undefined, + Arn: undefined, + }; + if (output["UserId"] !== undefined) { + contents.UserId = (0, smithy_client_1.expectString)(output["UserId"]); + } + if (output["Account"] !== undefined) { + contents.Account = (0, smithy_client_1.expectString)(output["Account"]); + } + if (output["Arn"] !== undefined) { + contents.Arn = (0, smithy_client_1.expectString)(output["Arn"]); + } + return contents; +}; +const deserializeAws_queryGetFederationTokenResponse = (output, context) => { + const contents = { + Credentials: undefined, + FederatedUser: undefined, + PackedPolicySize: undefined, + }; + if (output["Credentials"] !== undefined) { + contents.Credentials = deserializeAws_queryCredentials(output["Credentials"], context); + } + if (output["FederatedUser"] !== undefined) { + contents.FederatedUser = deserializeAws_queryFederatedUser(output["FederatedUser"], context); + } + if (output["PackedPolicySize"] !== undefined) { + contents.PackedPolicySize = (0, smithy_client_1.strictParseInt32)(output["PackedPolicySize"]); + } + return contents; +}; +const deserializeAws_queryGetSessionTokenResponse = (output, context) => { + const contents = { + Credentials: undefined, + }; + if (output["Credentials"] !== undefined) { + contents.Credentials = deserializeAws_queryCredentials(output["Credentials"], context); + } + return contents; +}; +const deserializeAws_queryIDPCommunicationErrorException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryIDPRejectedClaimException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryInvalidAuthorizationMessageException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryInvalidIdentityTokenException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryMalformedPolicyDocumentException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryPackedPolicyTooLargeException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeAws_queryRegionDisabledException = (output, context) => { + const contents = { + message: undefined, + }; + if (output["message"] !== undefined) { + contents.message = (0, smithy_client_1.expectString)(output["message"]); + } + return contents; +}; +const deserializeMetadata = (output) => { + var _a, _b; + return ({ + httpStatusCode: output.statusCode, + requestId: (_b = (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"]) !== null && _b !== void 0 ? _b : output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], + }); +}; +const collectBody = (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return Promise.resolve(streamBody); + } + return context.streamCollector(streamBody) || Promise.resolve(new Uint8Array()); +}; +const collectBodyString = (streamBody, context) => collectBody(streamBody, context).then((body) => context.utf8Encoder(body)); +const buildHttpRpcRequest = async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers, + }; + if (resolvedHostname !== undefined) { + contents.hostname = resolvedHostname; + } + if (body !== undefined) { + contents.body = body; + } + return new protocol_http_1.HttpRequest(contents); +}; +const parseBody = (streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + const parser = new fast_xml_parser_1.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val) => (val.trim() === "" && val.includes("\n") ? "" : undefined), + }); + parser.addEntity("#xD", "\r"); + parser.addEntity("#10", "\n"); + const parsedObj = parser.parse(encoded); + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return (0, smithy_client_1.getValueFromTextNode)(parsedObjToReturn); + } + return {}; +}); +const parseErrorBody = async (errorBody, context) => { + var _a; + const value = await parseBody(errorBody, context); + if (value.Error) { + value.Error.message = (_a = value.Error.message) !== null && _a !== void 0 ? _a : value.Error.Message; + } + return value; +}; +const buildFormUrlencodedString = (formEntries) => Object.entries(formEntries) + .map(([key, value]) => (0, smithy_client_1.extendedEncodeURIComponent)(key) + "=" + (0, smithy_client_1.extendedEncodeURIComponent)(value)) + .join("&"); +const loadQueryErrorCode = (output, data) => { + if (data.Error.Code !== undefined) { + return data.Error.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}; + + +/***/ }), + +/***/ 3405: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(7947)); +const defaultStsRoleAssumers_1 = __nccwpck_require__(48); +const config_resolver_1 = __nccwpck_require__(6153); +const credential_provider_node_1 = __nccwpck_require__(5531); +const hash_node_1 = __nccwpck_require__(7442); +const middleware_retry_1 = __nccwpck_require__(6064); +const node_config_provider_1 = __nccwpck_require__(7684); +const node_http_handler_1 = __nccwpck_require__(8805); +const util_base64_node_1 = __nccwpck_require__(8588); +const util_body_length_node_1 = __nccwpck_require__(4147); +const util_user_agent_node_1 = __nccwpck_require__(8095); +const util_utf8_node_1 = __nccwpck_require__(6278); +const runtimeConfig_shared_1 = __nccwpck_require__(2642); +const smithy_client_1 = __nccwpck_require__(4963); +const util_defaults_mode_node_1 = __nccwpck_require__(4243); +const smithy_client_2 = __nccwpck_require__(4963); +const getRuntimeConfig = (config) => { + var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k, _l, _m, _o, _p, _q; + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + base64Decoder: (_a = config === null || config === void 0 ? void 0 : config.base64Decoder) !== null && _a !== void 0 ? _a : util_base64_node_1.fromBase64, + base64Encoder: (_b = config === null || config === void 0 ? void 0 : config.base64Encoder) !== null && _b !== void 0 ? _b : util_base64_node_1.toBase64, + bodyLengthChecker: (_c = config === null || config === void 0 ? void 0 : config.bodyLengthChecker) !== null && _c !== void 0 ? _c : util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: (_d = config === null || config === void 0 ? void 0 : config.credentialDefaultProvider) !== null && _d !== void 0 ? _d : (0, defaultStsRoleAssumers_1.decorateDefaultCredentialProvider)(credential_provider_node_1.defaultProvider), + defaultUserAgentProvider: (_e = config === null || config === void 0 ? void 0 : config.defaultUserAgentProvider) !== null && _e !== void 0 ? _e : (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: (_f = config === null || config === void 0 ? void 0 : config.maxAttempts) !== null && _f !== void 0 ? _f : (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: (_g = config === null || config === void 0 ? void 0 : config.region) !== null && _g !== void 0 ? _g : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: (_h = config === null || config === void 0 ? void 0 : config.requestHandler) !== null && _h !== void 0 ? _h : new node_http_handler_1.NodeHttpHandler(defaultConfigProvider), + retryMode: (_j = config === null || config === void 0 ? void 0 : config.retryMode) !== null && _j !== void 0 ? _j : (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || middleware_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: (_k = config === null || config === void 0 ? void 0 : config.sha256) !== null && _k !== void 0 ? _k : hash_node_1.Hash.bind(null, "sha256"), + streamCollector: (_l = config === null || config === void 0 ? void 0 : config.streamCollector) !== null && _l !== void 0 ? _l : node_http_handler_1.streamCollector, + useDualstackEndpoint: (_m = config === null || config === void 0 ? void 0 : config.useDualstackEndpoint) !== null && _m !== void 0 ? _m : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: (_o = config === null || config === void 0 ? void 0 : config.useFipsEndpoint) !== null && _o !== void 0 ? _o : (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + utf8Decoder: (_p = config === null || config === void 0 ? void 0 : config.utf8Decoder) !== null && _p !== void 0 ? _p : util_utf8_node_1.fromUtf8, + utf8Encoder: (_q = config === null || config === void 0 ? void 0 : config.utf8Encoder) !== null && _q !== void 0 ? _q : util_utf8_node_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 2642: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const url_parser_1 = __nccwpck_require__(2992); +const endpointResolver_1 = __nccwpck_require__(1203); +const getRuntimeConfig = (config) => { + var _a, _b, _c, _d, _e; + return ({ + apiVersion: "2011-06-15", + disableHostPrefix: (_a = config === null || config === void 0 ? void 0 : config.disableHostPrefix) !== null && _a !== void 0 ? _a : false, + endpointProvider: (_b = config === null || config === void 0 ? void 0 : config.endpointProvider) !== null && _b !== void 0 ? _b : endpointResolver_1.defaultEndpointResolver, + logger: (_c = config === null || config === void 0 ? void 0 : config.logger) !== null && _c !== void 0 ? _c : {}, + serviceId: (_d = config === null || config === void 0 ? void 0 : config.serviceId) !== null && _d !== void 0 ? _d : "STS", + urlParser: (_e = config === null || config === void 0 ? void 0 : config.urlParser) !== null && _e !== void 0 ? _e : url_parser_1.parseUrl, + }); +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 4723: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_DUALSTACK_ENDPOINT = exports.CONFIG_USE_DUALSTACK_ENDPOINT = exports.ENV_USE_DUALSTACK_ENDPOINT = void 0; +const util_config_provider_1 = __nccwpck_require__(6168); +exports.ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; +exports.CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; +exports.DEFAULT_USE_DUALSTACK_ENDPOINT = false; +exports.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.ENV), + configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_DUALSTACK_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), + default: false, +}; + + +/***/ }), + +/***/ 2478: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = exports.DEFAULT_USE_FIPS_ENDPOINT = exports.CONFIG_USE_FIPS_ENDPOINT = exports.ENV_USE_FIPS_ENDPOINT = void 0; +const util_config_provider_1 = __nccwpck_require__(6168); +exports.ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; +exports.CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; +exports.DEFAULT_USE_FIPS_ENDPOINT = false; +exports.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, util_config_provider_1.booleanSelector)(env, exports.ENV_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.ENV), + configFileSelector: (profile) => (0, util_config_provider_1.booleanSelector)(profile, exports.CONFIG_USE_FIPS_ENDPOINT, util_config_provider_1.SelectorType.CONFIG), + default: false, +}; + + +/***/ }), + +/***/ 7392: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(4723), exports); +tslib_1.__exportStar(__nccwpck_require__(2478), exports); +tslib_1.__exportStar(__nccwpck_require__(2108), exports); +tslib_1.__exportStar(__nccwpck_require__(2327), exports); + + +/***/ }), + +/***/ 2108: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveCustomEndpointsConfig = void 0; +const util_middleware_1 = __nccwpck_require__(236); +const resolveCustomEndpointsConfig = (input) => { + var _a; + const { endpoint, urlParser } = input; + return { + ...input, + tls: (_a = input.tls) !== null && _a !== void 0 ? _a : true, + endpoint: (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), + isCustomEndpoint: true, + useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)(input.useDualstackEndpoint), + }; +}; +exports.resolveCustomEndpointsConfig = resolveCustomEndpointsConfig; + + +/***/ }), + +/***/ 2327: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveEndpointsConfig = void 0; +const util_middleware_1 = __nccwpck_require__(236); +const getEndpointFromRegion_1 = __nccwpck_require__(4159); +const resolveEndpointsConfig = (input) => { + var _a; + const useDualstackEndpoint = (0, util_middleware_1.normalizeProvider)(input.useDualstackEndpoint); + const { endpoint, useFipsEndpoint, urlParser } = input; + return { + ...input, + tls: (_a = input.tls) !== null && _a !== void 0 ? _a : true, + endpoint: endpoint + ? (0, util_middleware_1.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) + : () => (0, getEndpointFromRegion_1.getEndpointFromRegion)({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint, + useDualstackEndpoint, + }; +}; +exports.resolveEndpointsConfig = resolveEndpointsConfig; + + +/***/ }), + +/***/ 4159: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointFromRegion = void 0; +const getEndpointFromRegion = async (input) => { + var _a; + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); + } + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = (_a = (await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }))) !== null && _a !== void 0 ? _a : {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); + } + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); +}; +exports.getEndpointFromRegion = getEndpointFromRegion; + + +/***/ }), + +/***/ 6153: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7392), exports); +tslib_1.__exportStar(__nccwpck_require__(5441), exports); +tslib_1.__exportStar(__nccwpck_require__(6258), exports); + + +/***/ }), + +/***/ 422: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_REGION_CONFIG_FILE_OPTIONS = exports.NODE_REGION_CONFIG_OPTIONS = exports.REGION_INI_NAME = exports.REGION_ENV_NAME = void 0; +exports.REGION_ENV_NAME = "AWS_REGION"; +exports.REGION_INI_NAME = "region"; +exports.NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.REGION_ENV_NAME], + configFileSelector: (profile) => profile[exports.REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + }, +}; +exports.NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials", +}; + + +/***/ }), + +/***/ 2844: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRealRegion = void 0; +const isFipsRegion_1 = __nccwpck_require__(2440); +const getRealRegion = (region) => (0, isFipsRegion_1.isFipsRegion)(region) + ? ["fips-aws-global", "aws-fips"].includes(region) + ? "us-east-1" + : region.replace(/fips-(dkr-|prod-)?|-fips/, "") + : region; +exports.getRealRegion = getRealRegion; + + +/***/ }), + +/***/ 5441: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(422), exports); +tslib_1.__exportStar(__nccwpck_require__(174), exports); + + +/***/ }), + +/***/ 2440: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isFipsRegion = void 0; +const isFipsRegion = (region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")); +exports.isFipsRegion = isFipsRegion; + + +/***/ }), + +/***/ 174: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRegionConfig = void 0; +const getRealRegion_1 = __nccwpck_require__(2844); +const isFipsRegion_1 = __nccwpck_require__(2440); +const resolveRegionConfig = (input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return { + ...input, + region: async () => { + if (typeof region === "string") { + return (0, getRealRegion_1.getRealRegion)(region); + } + const providedRegion = await region(); + return (0, getRealRegion_1.getRealRegion)(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if ((0, isFipsRegion_1.isFipsRegion)(providedRegion)) { + return true; + } + return typeof useFipsEndpoint === "boolean" ? Promise.resolve(useFipsEndpoint) : useFipsEndpoint(); + }, + }; +}; +exports.resolveRegionConfig = resolveRegionConfig; + + +/***/ }), + +/***/ 3566: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6057: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5280: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHostnameFromVariants = void 0; +const getHostnameFromVariants = (variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { + var _a; + return (_a = variants.find(({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack"))) === null || _a === void 0 ? void 0 : _a.hostname; +}; +exports.getHostnameFromVariants = getHostnameFromVariants; + + +/***/ }), + +/***/ 6167: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRegionInfo = void 0; +const getHostnameFromVariants_1 = __nccwpck_require__(5280); +const getResolvedHostname_1 = __nccwpck_require__(3877); +const getResolvedPartition_1 = __nccwpck_require__(7642); +const getResolvedSigningRegion_1 = __nccwpck_require__(3517); +const getRegionInfo = (region, { useFipsEndpoint = false, useDualstackEndpoint = false, signingService, regionHash, partitionHash, }) => { + var _a, _b, _c, _d, _e, _f; + const partition = (0, getResolvedPartition_1.getResolvedPartition)(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : (_b = (_a = partitionHash[partition]) === null || _a === void 0 ? void 0 : _a.endpoint) !== null && _b !== void 0 ? _b : region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_c = regionHash[resolvedRegion]) === null || _c === void 0 ? void 0 : _c.variants, hostnameOptions); + const partitionHostname = (0, getHostnameFromVariants_1.getHostnameFromVariants)((_d = partitionHash[partition]) === null || _d === void 0 ? void 0 : _d.variants, hostnameOptions); + const hostname = (0, getResolvedHostname_1.getResolvedHostname)(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === undefined) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + } + const signingRegion = (0, getResolvedSigningRegion_1.getResolvedSigningRegion)(hostname, { + signingRegion: (_e = regionHash[resolvedRegion]) === null || _e === void 0 ? void 0 : _e.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint, + }); + return { + partition, + signingService, + hostname, + ...(signingRegion && { signingRegion }), + ...(((_f = regionHash[resolvedRegion]) === null || _f === void 0 ? void 0 : _f.signingService) && { + signingService: regionHash[resolvedRegion].signingService, + }), + }; +}; +exports.getRegionInfo = getRegionInfo; + + +/***/ }), + +/***/ 3877: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedHostname = void 0; +const getResolvedHostname = (resolvedRegion, { regionHostname, partitionHostname }) => regionHostname + ? regionHostname + : partitionHostname + ? partitionHostname.replace("{region}", resolvedRegion) + : undefined; +exports.getResolvedHostname = getResolvedHostname; + + +/***/ }), + +/***/ 7642: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedPartition = void 0; +const getResolvedPartition = (region, { partitionHash }) => { var _a; return (_a = Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region))) !== null && _a !== void 0 ? _a : "aws"; }; +exports.getResolvedPartition = getResolvedPartition; + + +/***/ }), + +/***/ 3517: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getResolvedSigningRegion = void 0; +const getResolvedSigningRegion = (hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; + } + else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); + } + } +}; +exports.getResolvedSigningRegion = getResolvedSigningRegion; + + +/***/ }), + +/***/ 6258: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(3566), exports); +tslib_1.__exportStar(__nccwpck_require__(6057), exports); +tslib_1.__exportStar(__nccwpck_require__(6167), exports); + + +/***/ }), + +/***/ 255: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromEnv = exports.ENV_EXPIRATION = exports.ENV_SESSION = exports.ENV_SECRET = exports.ENV_KEY = void 0; +const property_provider_1 = __nccwpck_require__(4462); +exports.ENV_KEY = "AWS_ACCESS_KEY_ID"; +exports.ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; +exports.ENV_SESSION = "AWS_SESSION_TOKEN"; +exports.ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; +const fromEnv = () => async () => { + const accessKeyId = process.env[exports.ENV_KEY]; + const secretAccessKey = process.env[exports.ENV_SECRET]; + const sessionToken = process.env[exports.ENV_SESSION]; + const expiry = process.env[exports.ENV_EXPIRATION]; + if (accessKeyId && secretAccessKey) { + return { + accessKeyId, + secretAccessKey, + ...(sessionToken && { sessionToken }), + ...(expiry && { expiration: new Date(expiry) }), + }; + } + throw new property_provider_1.CredentialsProviderError("Unable to find environment variable credentials."); +}; +exports.fromEnv = fromEnv; + + +/***/ }), + +/***/ 5972: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(255), exports); + + +/***/ }), + +/***/ 3736: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Endpoint = void 0; +var Endpoint; +(function (Endpoint) { + Endpoint["IPv4"] = "http://169.254.169.254"; + Endpoint["IPv6"] = "http://[fd00:ec2::254]"; +})(Endpoint = exports.Endpoint || (exports.Endpoint = {})); + + +/***/ }), + +/***/ 8438: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ENDPOINT_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_NAME = exports.ENV_ENDPOINT_NAME = void 0; +exports.ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; +exports.CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; +exports.ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_NAME], + default: undefined, +}; + + +/***/ }), + +/***/ 1695: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointMode = void 0; +var EndpointMode; +(function (EndpointMode) { + EndpointMode["IPv4"] = "IPv4"; + EndpointMode["IPv6"] = "IPv6"; +})(EndpointMode = exports.EndpointMode || (exports.EndpointMode = {})); + + +/***/ }), + +/***/ 7824: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ENDPOINT_MODE_CONFIG_OPTIONS = exports.CONFIG_ENDPOINT_MODE_NAME = exports.ENV_ENDPOINT_MODE_NAME = void 0; +const EndpointMode_1 = __nccwpck_require__(1695); +exports.ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; +exports.CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; +exports.ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[exports.CONFIG_ENDPOINT_MODE_NAME], + default: EndpointMode_1.EndpointMode.IPv4, +}; + + +/***/ }), + +/***/ 5232: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromContainerMetadata = exports.ENV_CMDS_AUTH_TOKEN = exports.ENV_CMDS_RELATIVE_URI = exports.ENV_CMDS_FULL_URI = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const url_1 = __nccwpck_require__(7310); +const httpRequest_1 = __nccwpck_require__(1303); +const ImdsCredentials_1 = __nccwpck_require__(1467); +const RemoteProviderInit_1 = __nccwpck_require__(2314); +const retry_1 = __nccwpck_require__(9912); +exports.ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +exports.ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +exports.ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +const fromContainerMetadata = (init = {}) => { + const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); + return () => (0, retry_1.retry)(async () => { + const requestOptions = await getCmdsUri(); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { + throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); + } + return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); + }, maxRetries); +}; +exports.fromContainerMetadata = fromContainerMetadata; +const requestFromEcsImds = async (timeout, options) => { + if (process.env[exports.ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[exports.ENV_CMDS_AUTH_TOKEN], + }; + } + const buffer = await (0, httpRequest_1.httpRequest)({ + ...options, + timeout, + }); + return buffer.toString(); +}; +const CMDS_IP = "169.254.170.2"; +const GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true, +}; +const GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true, +}; +const getCmdsUri = async () => { + if (process.env[exports.ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[exports.ENV_CMDS_RELATIVE_URI], + }; + } + if (process.env[exports.ENV_CMDS_FULL_URI]) { + const parsed = (0, url_1.parse)(process.env[exports.ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new property_provider_1.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, false); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new property_provider_1.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, false); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : undefined, + }; + } + throw new property_provider_1.CredentialsProviderError("The container metadata credential provider cannot be used unless" + + ` the ${exports.ENV_CMDS_RELATIVE_URI} or ${exports.ENV_CMDS_FULL_URI} environment` + + " variable is set", false); +}; + + +/***/ }), + +/***/ 5813: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromInstanceMetadata = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const httpRequest_1 = __nccwpck_require__(1303); +const ImdsCredentials_1 = __nccwpck_require__(1467); +const RemoteProviderInit_1 = __nccwpck_require__(2314); +const retry_1 = __nccwpck_require__(9912); +const getInstanceMetadataEndpoint_1 = __nccwpck_require__(1206); +const staticStabilityProvider_1 = __nccwpck_require__(4620); +const IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; +const IMDS_TOKEN_PATH = "/latest/api/token"; +const fromInstanceMetadata = (init = {}) => (0, staticStabilityProvider_1.staticStabilityProvider)(getInstanceImdsProvider(init), { logger: init.logger }); +exports.fromInstanceMetadata = fromInstanceMetadata; +const getInstanceImdsProvider = (init) => { + let disableFetchToken = false; + const { timeout, maxRetries } = (0, RemoteProviderInit_1.providerConfigFromInit)(init); + const getCredentials = async (maxRetries, options) => { + const profile = (await (0, retry_1.retry)(async () => { + let profile; + try { + profile = await getProfile(options); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile; + }, maxRetries)).trim(); + return (0, retry_1.retry)(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(profile, options); + } + catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return creds; + }, maxRetries); + }; + return async () => { + const endpoint = await (0, getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint)(); + if (disableFetchToken) { + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } + catch (error) { + if ((error === null || error === void 0 ? void 0 : error.statusCode) === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error", + }); + } + else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; + } + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + "x-aws-ec2-metadata-token": token, + }, + timeout, + }); + } + }; +}; +const getMetadataToken = async (options) => (0, httpRequest_1.httpRequest)({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600", + }, +}); +const getProfile = async (options) => (await (0, httpRequest_1.httpRequest)({ ...options, path: IMDS_PATH })).toString(); +const getCredentialsFromProfile = async (profile, options) => { + const credsResponse = JSON.parse((await (0, httpRequest_1.httpRequest)({ + ...options, + path: IMDS_PATH + profile, + })).toString()); + if (!(0, ImdsCredentials_1.isImdsCredentials)(credsResponse)) { + throw new property_provider_1.CredentialsProviderError("Invalid response received from instance metadata service."); + } + return (0, ImdsCredentials_1.fromImdsCredentials)(credsResponse); +}; + + +/***/ }), + +/***/ 5898: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getInstanceMetadataEndpoint = exports.httpRequest = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5232), exports); +tslib_1.__exportStar(__nccwpck_require__(5813), exports); +tslib_1.__exportStar(__nccwpck_require__(2314), exports); +tslib_1.__exportStar(__nccwpck_require__(1178), exports); +var httpRequest_1 = __nccwpck_require__(1303); +Object.defineProperty(exports, "httpRequest", ({ enumerable: true, get: function () { return httpRequest_1.httpRequest; } })); +var getInstanceMetadataEndpoint_1 = __nccwpck_require__(1206); +Object.defineProperty(exports, "getInstanceMetadataEndpoint", ({ enumerable: true, get: function () { return getInstanceMetadataEndpoint_1.getInstanceMetadataEndpoint; } })); + + +/***/ }), + +/***/ 1467: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromImdsCredentials = exports.isImdsCredentials = void 0; +const isImdsCredentials = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.AccessKeyId === "string" && + typeof arg.SecretAccessKey === "string" && + typeof arg.Token === "string" && + typeof arg.Expiration === "string"; +exports.isImdsCredentials = isImdsCredentials; +const fromImdsCredentials = (creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration), +}); +exports.fromImdsCredentials = fromImdsCredentials; + + +/***/ }), + +/***/ 2314: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.providerConfigFromInit = exports.DEFAULT_MAX_RETRIES = exports.DEFAULT_TIMEOUT = void 0; +exports.DEFAULT_TIMEOUT = 1000; +exports.DEFAULT_MAX_RETRIES = 0; +const providerConfigFromInit = ({ maxRetries = exports.DEFAULT_MAX_RETRIES, timeout = exports.DEFAULT_TIMEOUT, }) => ({ maxRetries, timeout }); +exports.providerConfigFromInit = providerConfigFromInit; + + +/***/ }), + +/***/ 1303: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.httpRequest = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const buffer_1 = __nccwpck_require__(4300); +const http_1 = __nccwpck_require__(3685); +function httpRequest(options) { + return new Promise((resolve, reject) => { + var _a; + const req = (0, http_1.request)({ + method: "GET", + ...options, + hostname: (_a = options.hostname) === null || _a === void 0 ? void 0 : _a.replace(/^\[(.+)\]$/, "$1"), + }); + req.on("error", (err) => { + reject(Object.assign(new property_provider_1.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new property_provider_1.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject(Object.assign(new property_provider_1.ProviderError("Error response received from instance metadata service"), { statusCode })); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(buffer_1.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); + }); +} +exports.httpRequest = httpRequest; + + +/***/ }), + +/***/ 9912: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.retry = void 0; +const retry = (toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; +}; +exports.retry = retry; + + +/***/ }), + +/***/ 1178: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8473: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getExtendedInstanceMetadataCredentials = void 0; +const STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; +const STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; +const STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; +const getExtendedInstanceMetadataCredentials = (credentials, logger) => { + var _a; + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1000); + logger.warn("Attempting credential expiration extension due to a credential service availability issue. A refresh of these " + + "credentials will be attempted after ${new Date(newExpiration)}.\nFor more information, please visit: " + + STATIC_STABILITY_DOC_URL); + const originalExpiration = (_a = credentials.originalExpiration) !== null && _a !== void 0 ? _a : credentials.expiration; + return { + ...credentials, + ...(originalExpiration ? { originalExpiration } : {}), + expiration: newExpiration, + }; +}; +exports.getExtendedInstanceMetadataCredentials = getExtendedInstanceMetadataCredentials; + + +/***/ }), + +/***/ 1206: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getInstanceMetadataEndpoint = void 0; +const node_config_provider_1 = __nccwpck_require__(7684); +const url_parser_1 = __nccwpck_require__(2992); +const Endpoint_1 = __nccwpck_require__(3736); +const EndpointConfigOptions_1 = __nccwpck_require__(8438); +const EndpointMode_1 = __nccwpck_require__(1695); +const EndpointModeConfigOptions_1 = __nccwpck_require__(7824); +const getInstanceMetadataEndpoint = async () => (0, url_parser_1.parseUrl)((await getFromEndpointConfig()) || (await getFromEndpointModeConfig())); +exports.getInstanceMetadataEndpoint = getInstanceMetadataEndpoint; +const getFromEndpointConfig = async () => (0, node_config_provider_1.loadConfig)(EndpointConfigOptions_1.ENDPOINT_CONFIG_OPTIONS)(); +const getFromEndpointModeConfig = async () => { + const endpointMode = await (0, node_config_provider_1.loadConfig)(EndpointModeConfigOptions_1.ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case EndpointMode_1.EndpointMode.IPv4: + return Endpoint_1.Endpoint.IPv4; + case EndpointMode_1.EndpointMode.IPv6: + return Endpoint_1.Endpoint.IPv6; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}.` + ` Select from ${Object.values(EndpointMode_1.EndpointMode)}`); + } +}; + + +/***/ }), + +/***/ 4620: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.staticStabilityProvider = void 0; +const getExtendedInstanceMetadataCredentials_1 = __nccwpck_require__(8473); +const staticStabilityProvider = (provider, options = {}) => { + const logger = (options === null || options === void 0 ? void 0 : options.logger) || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(credentials, logger); + } + } + catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = (0, getExtendedInstanceMetadataCredentials_1.getExtendedInstanceMetadataCredentials)(pastCredentials, logger); + } + else { + throw e; + } + } + pastCredentials = credentials; + return credentials; + }; +}; +exports.staticStabilityProvider = staticStabilityProvider; + + +/***/ }), + +/***/ 5442: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromIni = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const resolveProfileData_1 = __nccwpck_require__(5653); +const fromIni = (init = {}) => async () => { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + return (0, resolveProfileData_1.resolveProfileData)((0, shared_ini_file_loader_1.getProfileName)(init), profiles, init); +}; +exports.fromIni = fromIni; + + +/***/ }), + +/***/ 4203: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5442), exports); + + +/***/ }), + +/***/ 853: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveAssumeRoleCredentials = exports.isAssumeRoleProfile = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const resolveCredentialSource_1 = __nccwpck_require__(2458); +const resolveProfileData_1 = __nccwpck_require__(5653); +const isAssumeRoleProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && + ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && + ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && + (isAssumeRoleWithSourceProfile(arg) || isAssumeRoleWithProviderProfile(arg)); +exports.isAssumeRoleProfile = isAssumeRoleProfile; +const isAssumeRoleWithSourceProfile = (arg) => typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; +const isAssumeRoleWithProviderProfile = (arg) => typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; +const resolveAssumeRoleCredentials = async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (!options.roleAssumer) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires a role to be assumed, but no role assumption callback was provided.`, false); + } + const { source_profile } = data; + if (source_profile && source_profile in visitedProfiles) { + throw new property_provider_1.CredentialsProviderError(`Detected a cycle attempting to resolve credentials for profile` + + ` ${(0, shared_ini_file_loader_1.getProfileName)(options)}. Profiles visited: ` + + Object.keys(visitedProfiles).join(", "), false); + } + const sourceCredsProvider = source_profile + ? (0, resolveProfileData_1.resolveProfileData)(source_profile, profiles, options, { + ...visitedProfiles, + [source_profile]: true, + }) + : (0, resolveCredentialSource_1.resolveCredentialSource)(data.credential_source, profileName)(); + const params = { + RoleArn: data.role_arn, + RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`, + ExternalId: data.external_id, + }; + const { mfa_serial } = data; + if (mfa_serial) { + if (!options.mfaCodeProvider) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, false); + } + params.SerialNumber = mfa_serial; + params.TokenCode = await options.mfaCodeProvider(mfa_serial); + } + const sourceCreds = await sourceCredsProvider; + return options.roleAssumer(sourceCreds, params); +}; +exports.resolveAssumeRoleCredentials = resolveAssumeRoleCredentials; + + +/***/ }), + +/***/ 2458: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveCredentialSource = void 0; +const credential_provider_env_1 = __nccwpck_require__(5972); +const credential_provider_imds_1 = __nccwpck_require__(5898); +const property_provider_1 = __nccwpck_require__(4462); +const resolveCredentialSource = (credentialSource, profileName) => { + const sourceProvidersMap = { + EcsContainer: credential_provider_imds_1.fromContainerMetadata, + Ec2InstanceMetadata: credential_provider_imds_1.fromInstanceMetadata, + Environment: credential_provider_env_1.fromEnv, + }; + if (credentialSource in sourceProvidersMap) { + return sourceProvidersMap[credentialSource](); + } + else { + throw new property_provider_1.CredentialsProviderError(`Unsupported credential source in profile ${profileName}. Got ${credentialSource}, ` + + `expected EcsContainer or Ec2InstanceMetadata or Environment.`); + } +}; +exports.resolveCredentialSource = resolveCredentialSource; + + +/***/ }), + +/***/ 5653: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveProfileData = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const resolveAssumeRoleCredentials_1 = __nccwpck_require__(853); +const resolveSsoCredentials_1 = __nccwpck_require__(9867); +const resolveStaticCredentials_1 = __nccwpck_require__(3071); +const resolveWebIdentityCredentials_1 = __nccwpck_require__(8342); +const resolveProfileData = async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (Object.keys(visitedProfiles).length > 0 && (0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { + return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); + } + if ((0, resolveAssumeRoleCredentials_1.isAssumeRoleProfile)(data)) { + return (0, resolveAssumeRoleCredentials_1.resolveAssumeRoleCredentials)(profileName, profiles, options, visitedProfiles); + } + if ((0, resolveStaticCredentials_1.isStaticCredsProfile)(data)) { + return (0, resolveStaticCredentials_1.resolveStaticCredentials)(data); + } + if ((0, resolveWebIdentityCredentials_1.isWebIdentityProfile)(data)) { + return (0, resolveWebIdentityCredentials_1.resolveWebIdentityCredentials)(data, options); + } + if ((0, resolveSsoCredentials_1.isSsoProfile)(data)) { + return (0, resolveSsoCredentials_1.resolveSsoCredentials)(data); + } + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found or parsed in shared credentials file.`); +}; +exports.resolveProfileData = resolveProfileData; + + +/***/ }), + +/***/ 9867: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSsoCredentials = exports.isSsoProfile = void 0; +const credential_provider_sso_1 = __nccwpck_require__(6414); +var credential_provider_sso_2 = __nccwpck_require__(6414); +Object.defineProperty(exports, "isSsoProfile", ({ enumerable: true, get: function () { return credential_provider_sso_2.isSsoProfile; } })); +const resolveSsoCredentials = (data) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = (0, credential_provider_sso_1.validateSsoProfile)(data); + return (0, credential_provider_sso_1.fromSSO)({ + ssoStartUrl: sso_start_url, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + })(); +}; +exports.resolveSsoCredentials = resolveSsoCredentials; + + +/***/ }), + +/***/ 3071: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveStaticCredentials = exports.isStaticCredsProfile = void 0; +const isStaticCredsProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.aws_access_key_id === "string" && + typeof arg.aws_secret_access_key === "string" && + ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1; +exports.isStaticCredsProfile = isStaticCredsProfile; +const resolveStaticCredentials = (profile) => Promise.resolve({ + accessKeyId: profile.aws_access_key_id, + secretAccessKey: profile.aws_secret_access_key, + sessionToken: profile.aws_session_token, +}); +exports.resolveStaticCredentials = resolveStaticCredentials; + + +/***/ }), + +/***/ 8342: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveWebIdentityCredentials = exports.isWebIdentityProfile = void 0; +const credential_provider_web_identity_1 = __nccwpck_require__(5646); +const isWebIdentityProfile = (arg) => Boolean(arg) && + typeof arg === "object" && + typeof arg.web_identity_token_file === "string" && + typeof arg.role_arn === "string" && + ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1; +exports.isWebIdentityProfile = isWebIdentityProfile; +const resolveWebIdentityCredentials = async (profile, options) => (0, credential_provider_web_identity_1.fromTokenFile)({ + webIdentityTokenFile: profile.web_identity_token_file, + roleArn: profile.role_arn, + roleSessionName: profile.role_session_name, + roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, +})(); +exports.resolveWebIdentityCredentials = resolveWebIdentityCredentials; + + +/***/ }), + +/***/ 5560: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultProvider = void 0; +const credential_provider_env_1 = __nccwpck_require__(5972); +const credential_provider_ini_1 = __nccwpck_require__(4203); +const credential_provider_process_1 = __nccwpck_require__(9969); +const credential_provider_sso_1 = __nccwpck_require__(6414); +const credential_provider_web_identity_1 = __nccwpck_require__(5646); +const property_provider_1 = __nccwpck_require__(4462); +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const remoteProvider_1 = __nccwpck_require__(626); +const defaultProvider = (init = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)(...(init.profile || process.env[shared_ini_file_loader_1.ENV_PROFILE] ? [] : [(0, credential_provider_env_1.fromEnv)()]), (0, credential_provider_sso_1.fromSSO)(init), (0, credential_provider_ini_1.fromIni)(init), (0, credential_provider_process_1.fromProcess)(init), (0, credential_provider_web_identity_1.fromTokenFile)(init), (0, remoteProvider_1.remoteProvider)(init), async () => { + throw new property_provider_1.CredentialsProviderError("Could not load credentials from any providers", false); +}), (credentials) => credentials.expiration !== undefined && credentials.expiration.getTime() - Date.now() < 300000, (credentials) => credentials.expiration !== undefined); +exports.defaultProvider = defaultProvider; + + +/***/ }), + +/***/ 5531: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5560), exports); + + +/***/ }), + +/***/ 626: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.remoteProvider = exports.ENV_IMDS_DISABLED = void 0; +const credential_provider_imds_1 = __nccwpck_require__(5898); +const property_provider_1 = __nccwpck_require__(4462); +exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +const remoteProvider = (init) => { + if (process.env[credential_provider_imds_1.ENV_CMDS_RELATIVE_URI] || process.env[credential_provider_imds_1.ENV_CMDS_FULL_URI]) { + return (0, credential_provider_imds_1.fromContainerMetadata)(init); + } + if (process.env[exports.ENV_IMDS_DISABLED]) { + return async () => { + throw new property_provider_1.CredentialsProviderError("EC2 Instance Metadata Service access disabled"); + }; + } + return (0, credential_provider_imds_1.fromInstanceMetadata)(init); +}; +exports.remoteProvider = remoteProvider; + + +/***/ }), + +/***/ 2650: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromProcess = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const resolveProcessCredentials_1 = __nccwpck_require__(4926); +const fromProcess = (init = {}) => async () => { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + return (0, resolveProcessCredentials_1.resolveProcessCredentials)((0, shared_ini_file_loader_1.getProfileName)(init), profiles); +}; +exports.fromProcess = fromProcess; + + +/***/ }), + +/***/ 1104: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getValidatedProcessCredentials = void 0; +const getValidatedProcessCredentials = (profileName, data) => { + if (data.Version !== 1) { + throw Error(`Profile ${profileName} credential_process did not return Version 1.`); + } + if (data.AccessKeyId === undefined || data.SecretAccessKey === undefined) { + throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); + } + if (data.Expiration) { + const currentTime = new Date(); + const expireTime = new Date(data.Expiration); + if (expireTime < currentTime) { + throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + } + } + return { + accessKeyId: data.AccessKeyId, + secretAccessKey: data.SecretAccessKey, + ...(data.SessionToken && { sessionToken: data.SessionToken }), + ...(data.Expiration && { expiration: new Date(data.Expiration) }), + }; +}; +exports.getValidatedProcessCredentials = getValidatedProcessCredentials; + + +/***/ }), + +/***/ 9969: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2650), exports); + + +/***/ }), + +/***/ 4926: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveProcessCredentials = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const child_process_1 = __nccwpck_require__(2081); +const util_1 = __nccwpck_require__(3837); +const getValidatedProcessCredentials_1 = __nccwpck_require__(1104); +const resolveProcessCredentials = async (profileName, profiles) => { + const profile = profiles[profileName]; + if (profiles[profileName]) { + const credentialProcess = profile["credential_process"]; + if (credentialProcess !== undefined) { + const execPromise = (0, util_1.promisify)(child_process_1.exec); + try { + const { stdout } = await execPromise(credentialProcess); + let data; + try { + data = JSON.parse(stdout.trim()); + } + catch (_a) { + throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); + } + return (0, getValidatedProcessCredentials_1.getValidatedProcessCredentials)(profileName, data); + } + catch (error) { + throw new property_provider_1.CredentialsProviderError(error.message); + } + } + else { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`); + } + } + else { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`); + } +}; +exports.resolveProcessCredentials = resolveProcessCredentials; + + +/***/ }), + +/***/ 5184: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromSSO = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const isSsoProfile_1 = __nccwpck_require__(2572); +const resolveSSOCredentials_1 = __nccwpck_require__(4729); +const validateSsoProfile_1 = __nccwpck_require__(8098); +const fromSSO = (init = {}) => async () => { + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient } = init; + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName) { + const profiles = await (0, shared_ini_file_loader_1.parseKnownFiles)(init); + const profileName = (0, shared_ini_file_loader_1.getProfileName)(init); + const profile = profiles[profileName]; + if (!(0, isSsoProfile_1.isSsoProfile)(profile)) { + throw new property_provider_1.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`); + } + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = (0, validateSsoProfile_1.validateSsoProfile)(profile); + return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ + ssoStartUrl: sso_start_url, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + ssoClient: ssoClient, + }); + } + else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { + throw new property_provider_1.CredentialsProviderError('Incomplete configuration. The fromSSO() argument hash must include "ssoStartUrl",' + + ' "ssoAccountId", "ssoRegion", "ssoRoleName"'); + } + else { + return (0, resolveSSOCredentials_1.resolveSSOCredentials)({ ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient }); + } +}; +exports.fromSSO = fromSSO; + + +/***/ }), + +/***/ 6414: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5184), exports); +tslib_1.__exportStar(__nccwpck_require__(2572), exports); +tslib_1.__exportStar(__nccwpck_require__(6623), exports); +tslib_1.__exportStar(__nccwpck_require__(8098), exports); + + +/***/ }), + +/***/ 2572: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isSsoProfile = void 0; +const isSsoProfile = (arg) => arg && + (typeof arg.sso_start_url === "string" || + typeof arg.sso_account_id === "string" || + typeof arg.sso_region === "string" || + typeof arg.sso_role_name === "string"); +exports.isSsoProfile = isSsoProfile; + + +/***/ }), + +/***/ 4729: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSSOCredentials = void 0; +const client_sso_1 = __nccwpck_require__(2666); +const property_provider_1 = __nccwpck_require__(4462); +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const EXPIRE_WINDOW_MS = 15 * 60 * 1000; +const SHOULD_FAIL_CREDENTIAL_CHAIN = false; +const resolveSSOCredentials = async ({ ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoClient, }) => { + let token; + const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; + try { + token = await (0, shared_ini_file_loader_1.getSSOTokenFromFile)(ssoStartUrl); + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + if (new Date(token.expiresAt).getTime() - Date.now() <= EXPIRE_WINDOW_MS) { + throw new property_provider_1.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + const { accessToken } = token; + const sso = ssoClient || new client_sso_1.SSOClient({ region: ssoRegion }); + let ssoResp; + try { + ssoResp = await sso.send(new client_sso_1.GetRoleCredentialsCommand({ + accountId: ssoAccountId, + roleName: ssoRoleName, + accessToken, + })); + } + catch (e) { + throw property_provider_1.CredentialsProviderError.from(e, SHOULD_FAIL_CREDENTIAL_CHAIN); + } + const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration } = {} } = ssoResp; + if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { + throw new property_provider_1.CredentialsProviderError("SSO returns an invalid temporary credential.", SHOULD_FAIL_CREDENTIAL_CHAIN); + } + return { accessKeyId, secretAccessKey, sessionToken, expiration: new Date(expiration) }; +}; +exports.resolveSSOCredentials = resolveSSOCredentials; + + +/***/ }), + +/***/ 6623: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8098: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.validateSsoProfile = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const validateSsoProfile = (profile) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; + if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { + throw new property_provider_1.CredentialsProviderError(`Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", ` + + `"sso_role_name", "sso_start_url". Got ${Object.keys(profile).join(", ")}\nReference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, false); + } + return profile; +}; +exports.validateSsoProfile = validateSsoProfile; + + +/***/ }), + +/***/ 5614: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromTokenFile = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const fs_1 = __nccwpck_require__(7147); +const fromWebToken_1 = __nccwpck_require__(7905); +const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; +const ENV_ROLE_ARN = "AWS_ROLE_ARN"; +const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; +const fromTokenFile = (init = {}) => async () => { + return resolveTokenFile(init); +}; +exports.fromTokenFile = fromTokenFile; +const resolveTokenFile = (init) => { + var _a, _b, _c; + const webIdentityTokenFile = (_a = init === null || init === void 0 ? void 0 : init.webIdentityTokenFile) !== null && _a !== void 0 ? _a : process.env[ENV_TOKEN_FILE]; + const roleArn = (_b = init === null || init === void 0 ? void 0 : init.roleArn) !== null && _b !== void 0 ? _b : process.env[ENV_ROLE_ARN]; + const roleSessionName = (_c = init === null || init === void 0 ? void 0 : init.roleSessionName) !== null && _c !== void 0 ? _c : process.env[ENV_ROLE_SESSION_NAME]; + if (!webIdentityTokenFile || !roleArn) { + throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified"); + } + return (0, fromWebToken_1.fromWebToken)({ + ...init, + webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), + roleArn, + roleSessionName, + })(); +}; + + +/***/ }), + +/***/ 7905: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromWebToken = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const fromWebToken = (init) => () => { + const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds, roleAssumerWithWebIdentity, } = init; + if (!roleAssumerWithWebIdentity) { + throw new property_provider_1.CredentialsProviderError(`Role Arn '${roleArn}' needs to be assumed with web identity,` + + ` but no role assumption callback was provided.`, false); + } + return roleAssumerWithWebIdentity({ + RoleArn: roleArn, + RoleSessionName: roleSessionName !== null && roleSessionName !== void 0 ? roleSessionName : `aws-sdk-js-session-${Date.now()}`, + WebIdentityToken: webIdentityToken, + ProviderId: providerId, + PolicyArns: policyArns, + Policy: policy, + DurationSeconds: durationSeconds, + }); +}; +exports.fromWebToken = fromWebToken; + + +/***/ }), + +/***/ 5646: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5614), exports); +tslib_1.__exportStar(__nccwpck_require__(7905), exports); + + +/***/ }), + +/***/ 7442: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Hash = void 0; +const util_buffer_from_1 = __nccwpck_require__(6010); +const buffer_1 = __nccwpck_require__(4300); +const crypto_1 = __nccwpck_require__(6113); +class Hash { + constructor(algorithmIdentifier, secret) { + this.hash = secret ? (0, crypto_1.createHmac)(algorithmIdentifier, castSourceData(secret)) : (0, crypto_1.createHash)(algorithmIdentifier); + } + update(toHash, encoding) { + this.hash.update(castSourceData(toHash, encoding)); + } + digest() { + return Promise.resolve(this.hash.digest()); + } +} +exports.Hash = Hash; +function castSourceData(toCast, encoding) { + if (buffer_1.Buffer.isBuffer(toCast)) { + return toCast; + } + if (typeof toCast === "string") { + return (0, util_buffer_from_1.fromString)(toCast, encoding); + } + if (ArrayBuffer.isView(toCast)) { + return (0, util_buffer_from_1.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return (0, util_buffer_from_1.fromArrayBuffer)(toCast); +} + + +/***/ }), + +/***/ 9126: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isArrayBuffer = void 0; +const isArrayBuffer = (arg) => (typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer) || + Object.prototype.toString.call(arg) === "[object ArrayBuffer]"; +exports.isArrayBuffer = isArrayBuffer; + + +/***/ }), + +/***/ 2245: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getContentLengthPlugin = exports.contentLengthMiddlewareOptions = exports.contentLengthMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const CONTENT_LENGTH_HEADER = "content-length"; +function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request = args.request; + if (protocol_http_1.HttpRequest.isInstance(request)) { + const { body, headers } = request; + if (body && + Object.keys(headers) + .map((str) => str.toLowerCase()) + .indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request.headers = { + ...request.headers, + [CONTENT_LENGTH_HEADER]: String(length), + }; + } + catch (error) { + } + } + } + return next({ + ...args, + request, + }); + }; +} +exports.contentLengthMiddleware = contentLengthMiddleware; +exports.contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true, +}; +const getContentLengthPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), exports.contentLengthMiddlewareOptions); + }, +}); +exports.getContentLengthPlugin = getContentLengthPlugin; + + +/***/ }), + +/***/ 3504: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.createConfigValueProvider = void 0; +const createConfigValueProvider = (configKey, canonicalEndpointParamKey, config) => { + const configProvider = async () => { + var _a; + const configValue = (_a = config[configKey]) !== null && _a !== void 0 ? _a : config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); + } + return configValue; + }; + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; + } + return configProvider; +}; +exports.createConfigValueProvider = createConfigValueProvider; + + +/***/ }), + +/***/ 2419: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveParams = exports.getEndpointFromInstructions = void 0; +const service_customizations_1 = __nccwpck_require__(3589); +const createConfigValueProvider_1 = __nccwpck_require__(3504); +const getEndpointFromInstructions = async (commandInput, instructionsSupplier, clientConfig, context) => { + const endpointParams = await (0, exports.resolveParams)(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}; +exports.getEndpointFromInstructions = getEndpointFromInstructions; +const resolveParams = async (commandInput, instructionsSupplier, clientConfig) => { + var _a; + const endpointParams = {}; + const instructions = ((_a = instructionsSupplier === null || instructionsSupplier === void 0 ? void 0 : instructionsSupplier.getEndpointParameterInstructions) === null || _a === void 0 ? void 0 : _a.call(instructionsSupplier)) || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await (0, createConfigValueProvider_1.createConfigValueProvider)(instruction.name, name, clientConfig)(); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); + } + } + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); + } + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await (0, service_customizations_1.resolveParamsForS3)(endpointParams); + } + return endpointParams; +}; +exports.resolveParams = resolveParams; + + +/***/ }), + +/***/ 197: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2419), exports); +tslib_1.__exportStar(__nccwpck_require__(8289), exports); + + +/***/ }), + +/***/ 8289: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toEndpointV1 = void 0; +const url_parser_1 = __nccwpck_require__(2992); +const toEndpointV1 = (endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, url_parser_1.parseUrl)(endpoint.url); + } + return endpoint; + } + return (0, url_parser_1.parseUrl)(endpoint); +}; +exports.toEndpointV1 = toEndpointV1; + + +/***/ }), + +/***/ 2639: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.endpointMiddleware = void 0; +const getEndpointFromInstructions_1 = __nccwpck_require__(2419); +const endpointMiddleware = ({ config, instructions, }) => { + return (next, context) => async (args) => { + var _a, _b; + const endpoint = await (0, getEndpointFromInstructions_1.getEndpointFromInstructions)(args.input, { + getEndpointParameterInstructions() { + return instructions; + }, + }, { ...config }, context); + context.endpointV2 = endpoint; + context.authSchemes = (_a = endpoint.properties) === null || _a === void 0 ? void 0 : _a.authSchemes; + const authScheme = (_b = context.authSchemes) === null || _b === void 0 ? void 0 : _b[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + } + return next({ + ...args, + }); + }; +}; +exports.endpointMiddleware = endpointMiddleware; + + +/***/ }), + +/***/ 7981: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointPlugin = exports.endpointMiddlewareOptions = void 0; +const middleware_serde_1 = __nccwpck_require__(3631); +const endpointMiddleware_1 = __nccwpck_require__(2639); +exports.endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: middleware_serde_1.serializerMiddlewareOption.name, +}; +const getEndpointPlugin = (config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, endpointMiddleware_1.endpointMiddleware)({ + config, + instructions, + }), exports.endpointMiddlewareOptions); + }, +}); +exports.getEndpointPlugin = getEndpointPlugin; + + +/***/ }), + +/***/ 5497: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(197), exports); +tslib_1.__exportStar(__nccwpck_require__(2639), exports); +tslib_1.__exportStar(__nccwpck_require__(7981), exports); +tslib_1.__exportStar(__nccwpck_require__(3157), exports); +tslib_1.__exportStar(__nccwpck_require__(2521), exports); + + +/***/ }), + +/***/ 3157: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveEndpointConfig = void 0; +const util_middleware_1 = __nccwpck_require__(236); +const toEndpointV1_1 = __nccwpck_require__(8289); +const resolveEndpointConfig = (input) => { + var _a, _b, _c; + const tls = (_a = input.tls) !== null && _a !== void 0 ? _a : true; + const { endpoint } = input; + const customEndpointProvider = endpoint != null ? async () => (0, toEndpointV1_1.toEndpointV1)(await (0, util_middleware_1.normalizeProvider)(endpoint)()) : undefined; + const isCustomEndpoint = !!endpoint; + return { + ...input, + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, util_middleware_1.normalizeProvider)((_b = input.useDualstackEndpoint) !== null && _b !== void 0 ? _b : false), + useFipsEndpoint: (0, util_middleware_1.normalizeProvider)((_c = input.useFipsEndpoint) !== null && _c !== void 0 ? _c : false), + }; +}; +exports.resolveEndpointConfig = resolveEndpointConfig; + + +/***/ }), + +/***/ 3589: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8648), exports); + + +/***/ }), + +/***/ 8648: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isArnBucketName = exports.isDnsCompatibleBucketName = exports.S3_HOSTNAME_PATTERN = exports.DOT_PATTERN = exports.resolveParamsForS3 = void 0; +const resolveParamsForS3 = async (endpointParams) => { + const bucket = (endpointParams === null || endpointParams === void 0 ? void 0 : endpointParams.Bucket) || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); + } + if ((0, exports.isArnBucketName)(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); + } + } + else if (!(0, exports.isDnsCompatibleBucketName)(bucket) || + (bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:")) || + bucket.toLowerCase() !== bucket || + bucket.length < 3) { + endpointParams.ForcePathStyle = true; + } + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; + } + return endpointParams; +}; +exports.resolveParamsForS3 = resolveParamsForS3; +const DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +const IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +const DOTS_PATTERN = /\.\./; +exports.DOT_PATTERN = /\./; +exports.S3_HOSTNAME_PATTERN = /^(.+\.)?s3(-fips)?(\.dualstack)?[.-]([a-z0-9-]+)\./; +const isDnsCompatibleBucketName = (bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName); +exports.isDnsCompatibleBucketName = isDnsCompatibleBucketName; +const isArnBucketName = (bucketName) => { + const [arn, partition, service, region, account, typeOrId] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = [arn, partition, service, account, typeOrId].filter(Boolean).length === 5; + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + } + return arn === "arn" && !!partition && !!service && !!account && !!typeOrId; +}; +exports.isArnBucketName = isArnBucketName; + + +/***/ }), + +/***/ 2521: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2545: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHostHeaderPlugin = exports.hostHeaderMiddlewareOptions = exports.hostHeaderMiddleware = exports.resolveHostHeaderConfig = void 0; +const protocol_http_1 = __nccwpck_require__(223); +function resolveHostHeaderConfig(input) { + return input; +} +exports.resolveHostHeaderConfig = resolveHostHeaderConfig; +const hostHeaderMiddleware = (options) => (next) => async (args) => { + if (!protocol_http_1.HttpRequest.isInstance(args.request)) + return next(args); + const { request } = args; + const { handlerProtocol = "" } = options.requestHandler.metadata || {}; + if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { + delete request.headers["host"]; + request.headers[":authority"] = ""; + } + else if (!request.headers["host"]) { + request.headers["host"] = request.hostname; + } + return next(args); +}; +exports.hostHeaderMiddleware = hostHeaderMiddleware; +exports.hostHeaderMiddlewareOptions = { + name: "hostHeaderMiddleware", + step: "build", + priority: "low", + tags: ["HOST"], + override: true, +}; +const getHostHeaderPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.hostHeaderMiddleware)(options), exports.hostHeaderMiddlewareOptions); + }, +}); +exports.getHostHeaderPlugin = getHostHeaderPlugin; + + +/***/ }), + +/***/ 14: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9754), exports); + + +/***/ }), + +/***/ 9754: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getLoggerPlugin = exports.loggerMiddlewareOptions = exports.loggerMiddleware = void 0; +const loggerMiddleware = () => (next, context) => async (args) => { + const { clientName, commandName, inputFilterSensitiveLog, logger, outputFilterSensitiveLog } = context; + const response = await next(args); + if (!logger) { + return response; + } + if (typeof logger.info === "function") { + const { $metadata, ...outputWithoutMetadata } = response.output; + logger.info({ + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + output: outputFilterSensitiveLog(outputWithoutMetadata), + metadata: $metadata, + }); + } + return response; +}; +exports.loggerMiddleware = loggerMiddleware; +exports.loggerMiddlewareOptions = { + name: "loggerMiddleware", + tags: ["LOGGER"], + step: "initialize", + override: true, +}; +const getLoggerPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.loggerMiddleware)(), exports.loggerMiddlewareOptions); + }, +}); +exports.getLoggerPlugin = getLoggerPlugin; + + +/***/ }), + +/***/ 5525: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRecursionDetectionPlugin = exports.addRecursionDetectionMiddlewareOptions = exports.recursionDetectionMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; +const ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; +const ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; +const recursionDetectionMiddleware = (options) => (next) => async (args) => { + const { request } = args; + if (!protocol_http_1.HttpRequest.isInstance(request) || + options.runtime !== "node" || + request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) { + return next(args); + } + const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; + const traceId = process.env[ENV_TRACE_ID]; + const nonEmptyString = (str) => typeof str === "string" && str.length > 0; + if (nonEmptyString(functionName) && nonEmptyString(traceId)) { + request.headers[TRACE_ID_HEADER_NAME] = traceId; + } + return next({ + ...args, + request, + }); +}; +exports.recursionDetectionMiddleware = recursionDetectionMiddleware; +exports.addRecursionDetectionMiddlewareOptions = { + step: "build", + tags: ["RECURSION_DETECTION"], + name: "recursionDetectionMiddleware", + override: true, + priority: "low", +}; +const getRecursionDetectionPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.recursionDetectionMiddleware)(options), exports.addRecursionDetectionMiddlewareOptions); + }, +}); +exports.getRecursionDetectionPlugin = getRecursionDetectionPlugin; + + +/***/ }), + +/***/ 7328: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AdaptiveRetryStrategy = void 0; +const config_1 = __nccwpck_require__(5192); +const DefaultRateLimiter_1 = __nccwpck_require__(6402); +const StandardRetryStrategy_1 = __nccwpck_require__(533); +class AdaptiveRetryStrategy extends StandardRetryStrategy_1.StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options !== null && options !== void 0 ? options : {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter !== null && rateLimiter !== void 0 ? rateLimiter : new DefaultRateLimiter_1.DefaultRateLimiter(); + this.mode = config_1.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + }, + }); + } +} +exports.AdaptiveRetryStrategy = AdaptiveRetryStrategy; + + +/***/ }), + +/***/ 6402: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DefaultRateLimiter = void 0; +const service_error_classification_1 = __nccwpck_require__(1921); +class DefaultRateLimiter { + constructor(options) { + var _a, _b, _c, _d, _e; + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = (_a = options === null || options === void 0 ? void 0 : options.beta) !== null && _a !== void 0 ? _a : 0.7; + this.minCapacity = (_b = options === null || options === void 0 ? void 0 : options.minCapacity) !== null && _b !== void 0 ? _b : 1; + this.minFillRate = (_c = options === null || options === void 0 ? void 0 : options.minFillRate) !== null && _c !== void 0 ? _c : 0.5; + this.scaleConstant = (_d = options === null || options === void 0 ? void 0 : options.scaleConstant) !== null && _d !== void 0 ? _d : 0.4; + this.smooth = (_e = options === null || options === void 0 ? void 0 : options.smooth) !== null && _e !== void 0 ? _e : 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; + } + getCurrentTimeInSeconds() { + return Date.now() / 1000; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; + } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = ((amount - this.currentCapacity) / this.fillRate) * 1000; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + this.currentCapacity = this.currentCapacity - amount; + } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; + } + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; + } + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, service_error_classification_1.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); + } + else { + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); + } + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow((this.lastMaxRate * (1 - this.beta)) / this.scaleConstant, 1 / 3)); + } + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); + } + cubicSuccess(timestamp) { + return this.getPrecise(this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate); + } + enableTokenBucket() { + this.enabled = true; + } + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); + } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } +} +exports.DefaultRateLimiter = DefaultRateLimiter; + + +/***/ }), + +/***/ 533: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.StandardRetryStrategy = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const service_error_classification_1 = __nccwpck_require__(1921); +const uuid_1 = __nccwpck_require__(5840); +const config_1 = __nccwpck_require__(5192); +const constants_1 = __nccwpck_require__(41); +const defaultRetryQuota_1 = __nccwpck_require__(2568); +const delayDecider_1 = __nccwpck_require__(5940); +const retryDecider_1 = __nccwpck_require__(9572); +class StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + var _a, _b, _c; + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = config_1.RETRY_MODES.STANDARD; + this.retryDecider = (_a = options === null || options === void 0 ? void 0 : options.retryDecider) !== null && _a !== void 0 ? _a : retryDecider_1.defaultRetryDecider; + this.delayDecider = (_b = options === null || options === void 0 ? void 0 : options.delayDecider) !== null && _b !== void 0 ? _b : delayDecider_1.defaultDelayDecider; + this.retryQuota = (_c = options === null || options === void 0 ? void 0 : options.retryQuota) !== null && _c !== void 0 ? _c : (0, defaultRetryQuota_1.getDefaultRetryQuota)(constants_1.INITIAL_RETRY_TOKENS); + } + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + } + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } + catch (error) { + maxAttempts = config_1.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; + } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request } = args; + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[constants_1.INVOCATION_ID_HEADER] = (0, uuid_1.v4)(); + } + while (true) { + try { + if (protocol_http_1.HttpRequest.isInstance(request)) { + request.headers[constants_1.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options === null || options === void 0 ? void 0 : options.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options === null || options === void 0 ? void 0 : options.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } + catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider((0, service_error_classification_1.isThrottlingError)(err) ? constants_1.THROTTLING_RETRY_DELAY_BASE : constants_1.DEFAULT_RETRY_DELAY_BASE, attempts); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } + } +} +exports.StandardRetryStrategy = StandardRetryStrategy; +const getDelayFromRetryAfterHeader = (response) => { + if (!protocol_http_1.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1000; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); +}; +const asSdkError = (error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); +}; + + +/***/ }), + +/***/ 5192: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DEFAULT_RETRY_MODE = exports.DEFAULT_MAX_ATTEMPTS = exports.RETRY_MODES = void 0; +var RETRY_MODES; +(function (RETRY_MODES) { + RETRY_MODES["STANDARD"] = "standard"; + RETRY_MODES["ADAPTIVE"] = "adaptive"; +})(RETRY_MODES = exports.RETRY_MODES || (exports.RETRY_MODES = {})); +exports.DEFAULT_MAX_ATTEMPTS = 3; +exports.DEFAULT_RETRY_MODE = RETRY_MODES.STANDARD; + + +/***/ }), + +/***/ 6160: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_RETRY_MODE_CONFIG_OPTIONS = exports.CONFIG_RETRY_MODE = exports.ENV_RETRY_MODE = exports.resolveRetryConfig = exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = exports.CONFIG_MAX_ATTEMPTS = exports.ENV_MAX_ATTEMPTS = void 0; +const util_middleware_1 = __nccwpck_require__(236); +const AdaptiveRetryStrategy_1 = __nccwpck_require__(7328); +const config_1 = __nccwpck_require__(5192); +const StandardRetryStrategy_1 = __nccwpck_require__(533); +exports.ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; +exports.CONFIG_MAX_ATTEMPTS = "max_attempts"; +exports.NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[exports.ENV_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${exports.ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[exports.CONFIG_MAX_ATTEMPTS]; + if (!value) + return undefined; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${exports.CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: config_1.DEFAULT_MAX_ATTEMPTS, +}; +const resolveRetryConfig = (input) => { + var _a; + const maxAttempts = (0, util_middleware_1.normalizeProvider)((_a = input.maxAttempts) !== null && _a !== void 0 ? _a : config_1.DEFAULT_MAX_ATTEMPTS); + return { + ...input, + maxAttempts, + retryStrategy: async () => { + if (input.retryStrategy) { + return input.retryStrategy; + } + const retryMode = await (0, util_middleware_1.normalizeProvider)(input.retryMode)(); + if (retryMode === config_1.RETRY_MODES.ADAPTIVE) { + return new AdaptiveRetryStrategy_1.AdaptiveRetryStrategy(maxAttempts); + } + return new StandardRetryStrategy_1.StandardRetryStrategy(maxAttempts); + }, + }; +}; +exports.resolveRetryConfig = resolveRetryConfig; +exports.ENV_RETRY_MODE = "AWS_RETRY_MODE"; +exports.CONFIG_RETRY_MODE = "retry_mode"; +exports.NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[exports.ENV_RETRY_MODE], + configFileSelector: (profile) => profile[exports.CONFIG_RETRY_MODE], + default: config_1.DEFAULT_RETRY_MODE, +}; + + +/***/ }), + +/***/ 41: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.REQUEST_HEADER = exports.INVOCATION_ID_HEADER = exports.NO_RETRY_INCREMENT = exports.TIMEOUT_RETRY_COST = exports.RETRY_COST = exports.INITIAL_RETRY_TOKENS = exports.THROTTLING_RETRY_DELAY_BASE = exports.MAXIMUM_RETRY_DELAY = exports.DEFAULT_RETRY_DELAY_BASE = void 0; +exports.DEFAULT_RETRY_DELAY_BASE = 100; +exports.MAXIMUM_RETRY_DELAY = 20 * 1000; +exports.THROTTLING_RETRY_DELAY_BASE = 500; +exports.INITIAL_RETRY_TOKENS = 500; +exports.RETRY_COST = 5; +exports.TIMEOUT_RETRY_COST = 10; +exports.NO_RETRY_INCREMENT = 1; +exports.INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; +exports.REQUEST_HEADER = "amz-sdk-request"; + + +/***/ }), + +/***/ 2568: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getDefaultRetryQuota = void 0; +const constants_1 = __nccwpck_require__(41); +const getDefaultRetryQuota = (initialRetryTokens, options) => { + var _a, _b, _c; + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = (_a = options === null || options === void 0 ? void 0 : options.noRetryIncrement) !== null && _a !== void 0 ? _a : constants_1.NO_RETRY_INCREMENT; + const retryCost = (_b = options === null || options === void 0 ? void 0 : options.retryCost) !== null && _b !== void 0 ? _b : constants_1.RETRY_COST; + const timeoutRetryCost = (_c = options === null || options === void 0 ? void 0 : options.timeoutRetryCost) !== null && _c !== void 0 ? _c : constants_1.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = (error) => (error.name === "TimeoutError" ? timeoutRetryCost : retryCost); + const hasRetryTokens = (error) => getCapacityAmount(error) <= availableCapacity; + const retrieveRetryTokens = (error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }; + const releaseRetryTokens = (capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount !== null && capacityReleaseAmount !== void 0 ? capacityReleaseAmount : noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }; + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens, + }); +}; +exports.getDefaultRetryQuota = getDefaultRetryQuota; + + +/***/ }), + +/***/ 5940: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultDelayDecider = void 0; +const constants_1 = __nccwpck_require__(41); +const defaultDelayDecider = (delayBase, attempts) => Math.floor(Math.min(constants_1.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); +exports.defaultDelayDecider = defaultDelayDecider; + + +/***/ }), + +/***/ 6064: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7328), exports); +tslib_1.__exportStar(__nccwpck_require__(6402), exports); +tslib_1.__exportStar(__nccwpck_require__(533), exports); +tslib_1.__exportStar(__nccwpck_require__(5192), exports); +tslib_1.__exportStar(__nccwpck_require__(6160), exports); +tslib_1.__exportStar(__nccwpck_require__(5940), exports); +tslib_1.__exportStar(__nccwpck_require__(3521), exports); +tslib_1.__exportStar(__nccwpck_require__(9572), exports); +tslib_1.__exportStar(__nccwpck_require__(1806), exports); +tslib_1.__exportStar(__nccwpck_require__(8580), exports); + + +/***/ }), + +/***/ 3521: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getOmitRetryHeadersPlugin = exports.omitRetryHeadersMiddlewareOptions = exports.omitRetryHeadersMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const constants_1 = __nccwpck_require__(41); +const omitRetryHeadersMiddleware = () => (next) => async (args) => { + const { request } = args; + if (protocol_http_1.HttpRequest.isInstance(request)) { + delete request.headers[constants_1.INVOCATION_ID_HEADER]; + delete request.headers[constants_1.REQUEST_HEADER]; + } + return next(args); +}; +exports.omitRetryHeadersMiddleware = omitRetryHeadersMiddleware; +exports.omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true, +}; +const getOmitRetryHeadersPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, exports.omitRetryHeadersMiddleware)(), exports.omitRetryHeadersMiddlewareOptions); + }, +}); +exports.getOmitRetryHeadersPlugin = getOmitRetryHeadersPlugin; + + +/***/ }), + +/***/ 9572: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultRetryDecider = void 0; +const service_error_classification_1 = __nccwpck_require__(1921); +const defaultRetryDecider = (error) => { + if (!error) { + return false; + } + return (0, service_error_classification_1.isRetryableByTrait)(error) || (0, service_error_classification_1.isClockSkewError)(error) || (0, service_error_classification_1.isThrottlingError)(error) || (0, service_error_classification_1.isTransientError)(error); +}; +exports.defaultRetryDecider = defaultRetryDecider; + + +/***/ }), + +/***/ 1806: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRetryPlugin = exports.retryMiddlewareOptions = exports.retryMiddleware = void 0; +const retryMiddleware = (options) => (next, context) => async (args) => { + const retryStrategy = await options.retryStrategy(); + if (retryStrategy === null || retryStrategy === void 0 ? void 0 : retryStrategy.mode) + context.userAgent = [...(context.userAgent || []), ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); +}; +exports.retryMiddleware = retryMiddleware; +exports.retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true, +}; +const getRetryPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.retryMiddleware)(options), exports.retryMiddlewareOptions); + }, +}); +exports.getRetryPlugin = getRetryPlugin; + + +/***/ }), + +/***/ 8580: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5959: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveStsAuthConfig = void 0; +const middleware_signing_1 = __nccwpck_require__(4935); +const resolveStsAuthConfig = (input, { stsClientCtor }) => (0, middleware_signing_1.resolveAwsAuthConfig)({ + ...input, + stsClientCtor, +}); +exports.resolveStsAuthConfig = resolveStsAuthConfig; + + +/***/ }), + +/***/ 5648: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.deserializerMiddleware = void 0; +const deserializerMiddleware = (options, deserializer) => (next, context) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed, + }; + } + catch (error) { + Object.defineProperty(error, "$response", { + value: response, + }); + throw error; + } +}; +exports.deserializerMiddleware = deserializerMiddleware; + + +/***/ }), + +/***/ 3631: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5648), exports); +tslib_1.__exportStar(__nccwpck_require__(9328), exports); +tslib_1.__exportStar(__nccwpck_require__(9511), exports); + + +/***/ }), + +/***/ 9328: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSerdePlugin = exports.serializerMiddlewareOption = exports.deserializerMiddlewareOption = void 0; +const deserializerMiddleware_1 = __nccwpck_require__(5648); +const serializerMiddleware_1 = __nccwpck_require__(9511); +exports.deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true, +}; +exports.serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true, +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add((0, deserializerMiddleware_1.deserializerMiddleware)(config, deserializer), exports.deserializerMiddlewareOption); + commandStack.add((0, serializerMiddleware_1.serializerMiddleware)(config, serializer), exports.serializerMiddlewareOption); + }, + }; +} +exports.getSerdePlugin = getSerdePlugin; + + +/***/ }), + +/***/ 9511: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.serializerMiddleware = void 0; +const serializerMiddleware = (options, serializer) => (next, context) => async (args) => { + var _a; + const endpoint = ((_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.url) && options.urlParser + ? async () => options.urlParser(context.endpointV2.url) + : options.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); + } + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request, + }); +}; +exports.serializerMiddleware = serializerMiddleware; + + +/***/ }), + +/***/ 3061: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveSigV4AuthConfig = exports.resolveAwsAuthConfig = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const signature_v4_1 = __nccwpck_require__(4275); +const util_middleware_1 = __nccwpck_require__(236); +const CREDENTIAL_EXPIRE_WINDOW = 300000; +const resolveAwsAuthConfig = (input) => { + const normalizedCreds = input.credentials + ? normalizeCredentialProvider(input.credentials) + : input.credentialDefaultProvider(input); + const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; + let signer; + if (input.signer) { + signer = (0, util_middleware_1.normalizeProvider)(input.signer); + } + else if (input.regionInfoProvider) { + signer = () => (0, util_middleware_1.normalizeProvider)(input.region)() + .then(async (region) => [ + (await input.regionInfoProvider(region, { + useFipsEndpoint: await input.useFipsEndpoint(), + useDualstackEndpoint: await input.useDualstackEndpoint(), + })) || {}, + region, + ]) + .then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + input.signingRegion = input.signingRegion || signingRegion || region; + input.signingName = input.signingName || signingService || input.serviceId; + const params = { + ...input, + credentials: normalizedCreds, + region: input.signingRegion, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; + return new SignerCtor(params); + }); + } + else { + signer = async (authScheme) => { + authScheme = Object.assign({}, { + name: "sigv4", + signingName: input.signingName || input.defaultSigningName, + signingRegion: await (0, util_middleware_1.normalizeProvider)(input.region)(), + properties: {}, + }, authScheme); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + input.signingRegion = input.signingRegion || signingRegion; + input.signingName = input.signingName || signingService || input.serviceId; + const params = { + ...input, + credentials: normalizedCreds, + region: input.signingRegion, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + }; + const SignerCtor = input.signerConstructor || signature_v4_1.SignatureV4; + return new SignerCtor(params); + }; + } + return { + ...input, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer, + }; +}; +exports.resolveAwsAuthConfig = resolveAwsAuthConfig; +const resolveSigV4AuthConfig = (input) => { + const normalizedCreds = input.credentials + ? normalizeCredentialProvider(input.credentials) + : input.credentialDefaultProvider(input); + const { signingEscapePath = true, systemClockOffset = input.systemClockOffset || 0, sha256 } = input; + let signer; + if (input.signer) { + signer = (0, util_middleware_1.normalizeProvider)(input.signer); + } + else { + signer = (0, util_middleware_1.normalizeProvider)(new signature_v4_1.SignatureV4({ + credentials: normalizedCreds, + region: input.region, + service: input.signingName, + sha256, + uriEscapePath: signingEscapePath, + })); + } + return { + ...input, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer, + }; +}; +exports.resolveSigV4AuthConfig = resolveSigV4AuthConfig; +const normalizeCredentialProvider = (credentials) => { + if (typeof credentials === "function") { + return (0, property_provider_1.memoize)(credentials, (credentials) => credentials.expiration !== undefined && + credentials.expiration.getTime() - Date.now() < CREDENTIAL_EXPIRE_WINDOW, (credentials) => credentials.expiration !== undefined); + } + return (0, util_middleware_1.normalizeProvider)(credentials); +}; + + +/***/ }), + +/***/ 4935: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(3061), exports); +tslib_1.__exportStar(__nccwpck_require__(2509), exports); + + +/***/ }), + +/***/ 2509: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin = exports.awsAuthMiddlewareOptions = exports.awsAuthMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const getSkewCorrectedDate_1 = __nccwpck_require__(8253); +const getUpdatedSystemClockOffset_1 = __nccwpck_require__(5863); +const awsAuthMiddleware = (options) => (next, context) => async function (args) { + var _a, _b, _c, _d; + if (!protocol_http_1.HttpRequest.isInstance(args.request)) + return next(args); + const authScheme = (_c = (_b = (_a = context.endpointV2) === null || _a === void 0 ? void 0 : _a.properties) === null || _b === void 0 ? void 0 : _b.authSchemes) === null || _c === void 0 ? void 0 : _c[0]; + const multiRegionOverride = (authScheme === null || authScheme === void 0 ? void 0 : authScheme.name) === "sigv4a" ? (_d = authScheme === null || authScheme === void 0 ? void 0 : authScheme.signingRegionSet) === null || _d === void 0 ? void 0 : _d.join(",") : undefined; + const signer = await options.signer(authScheme); + const output = await next({ + ...args, + request: await signer.sign(args.request, { + signingDate: (0, getSkewCorrectedDate_1.getSkewCorrectedDate)(options.systemClockOffset), + signingRegion: multiRegionOverride || context["signing_region"], + signingService: context["signing_service"], + }), + }).catch((error) => { + var _a; + const serverTime = (_a = error.ServerTime) !== null && _a !== void 0 ? _a : getDateHeader(error.$response); + if (serverTime) { + options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(serverTime, options.systemClockOffset); + } + throw error; + }); + const dateHeader = getDateHeader(output.response); + if (dateHeader) { + options.systemClockOffset = (0, getUpdatedSystemClockOffset_1.getUpdatedSystemClockOffset)(dateHeader, options.systemClockOffset); + } + return output; +}; +exports.awsAuthMiddleware = awsAuthMiddleware; +const getDateHeader = (response) => { var _a, _b, _c; return protocol_http_1.HttpResponse.isInstance(response) ? (_b = (_a = response.headers) === null || _a === void 0 ? void 0 : _a.date) !== null && _b !== void 0 ? _b : (_c = response.headers) === null || _c === void 0 ? void 0 : _c.Date : undefined; }; +exports.awsAuthMiddlewareOptions = { + name: "awsAuthMiddleware", + tags: ["SIGNATURE", "AWSAUTH"], + relation: "after", + toMiddleware: "retryMiddleware", + override: true, +}; +const getAwsAuthPlugin = (options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo((0, exports.awsAuthMiddleware)(options), exports.awsAuthMiddlewareOptions); + }, +}); +exports.getAwsAuthPlugin = getAwsAuthPlugin; +exports.getSigV4AuthPlugin = exports.getAwsAuthPlugin; + + +/***/ }), + +/***/ 8253: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSkewCorrectedDate = void 0; +const getSkewCorrectedDate = (systemClockOffset) => new Date(Date.now() + systemClockOffset); +exports.getSkewCorrectedDate = getSkewCorrectedDate; + + +/***/ }), + +/***/ 5863: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getUpdatedSystemClockOffset = void 0; +const isClockSkewed_1 = __nccwpck_require__(5301); +const getUpdatedSystemClockOffset = (clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if ((0, isClockSkewed_1.isClockSkewed)(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; +}; +exports.getUpdatedSystemClockOffset = getUpdatedSystemClockOffset; + + +/***/ }), + +/***/ 5301: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isClockSkewed = void 0; +const getSkewCorrectedDate_1 = __nccwpck_require__(8253); +const isClockSkewed = (clockTime, systemClockOffset) => Math.abs((0, getSkewCorrectedDate_1.getSkewCorrectedDate)(systemClockOffset).getTime() - clockTime) >= 300000; +exports.isClockSkewed = isClockSkewed; + + +/***/ }), + +/***/ 8399: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.constructStack = void 0; +const constructStack = () => { + let absoluteEntries = []; + let relativeEntries = []; + const entriesNameSet = new Set(); + const sort = (entries) => entries.sort((a, b) => stepWeights[b.step] - stepWeights[a.step] || + priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"]); + const removeByName = (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + if (entry.name && entry.name === toRemove) { + isRemoved = true; + entriesNameSet.delete(toRemove); + return false; + } + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }; + const removeByReference = (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + if (entry.name) + entriesNameSet.delete(entry.name); + return false; + } + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }; + const cloneTo = (toStack) => { + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); + }); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); + }); + return toStack; + }; + const expandRelativeMiddlewareList = (from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } + else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } + else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + return expandedMiddlewareList; + }; + const getMiddlewareList = (debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [], + }; + if (normalizedEntry.name) + normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [], + }; + if (normalizedEntry.name) + normalizedEntriesNameMap[normalizedEntry.name] = normalizedEntry; + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === undefined) { + if (debug) { + return; + } + throw new Error(`${entry.toMiddleware} is not found when adding ${entry.name || "anonymous"} middleware ${entry.relation} ${entry.toMiddleware}`); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); + } + } + }); + const mainChain = sort(normalizedAbsoluteEntries) + .map(expandRelativeMiddlewareList) + .reduce((wholeList, expendedMiddlewareList) => { + wholeList.push(...expendedMiddlewareList); + return wholeList; + }, []); + return mainChain; + }; + const stack = { + add: (middleware, options = {}) => { + const { name, override } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options, + }; + if (name) { + if (entriesNameSet.has(name)) { + if (!override) + throw new Error(`Duplicate middleware name '${name}'`); + const toOverrideIndex = absoluteEntries.findIndex((entry) => entry.name === name); + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || toOverride.priority !== entry.priority) { + throw new Error(`"${name}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be ` + + `overridden by same-name middleware with ${entry.priority} priority in ${entry.step} step.`); + } + absoluteEntries.splice(toOverrideIndex, 1); + } + entriesNameSet.add(name); + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override } = options; + const entry = { + middleware, + ...options, + }; + if (name) { + if (entriesNameSet.has(name)) { + if (!override) + throw new Error(`Duplicate middleware name '${name}'`); + const toOverrideIndex = relativeEntries.findIndex((entry) => entry.name === name); + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error(`"${name}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden ` + + `by same-name middleware ${entry.relation} "${entry.toMiddleware}" middleware.`); + } + relativeEntries.splice(toOverrideIndex, 1); + } + entriesNameSet.add(name); + } + relativeEntries.push(entry); + }, + clone: () => cloneTo((0, exports.constructStack)()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = (entry) => { + const { tags, name } = entry; + if (tags && tags.includes(toRemove)) { + if (name) + entriesNameSet.delete(name); + isRemoved = true; + return false; + } + return true; + }; + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + const cloned = cloneTo((0, exports.constructStack)()); + cloned.use(from); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + return mw.name + ": " + (mw.tags || []).join(","); + }); + }, + resolve: (handler, context) => { + for (const middleware of getMiddlewareList() + .map((entry) => entry.middleware) + .reverse()) { + handler = middleware(handler, context); + } + return handler; + }, + }; + return stack; +}; +exports.constructStack = constructStack; +const stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1, +}; +const priorityWeights = { + high: 3, + normal: 2, + low: 1, +}; + + +/***/ }), + +/***/ 1461: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8399), exports); + + +/***/ }), + +/***/ 6546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveUserAgentConfig = void 0; +function resolveUserAgentConfig(input) { + return { + ...input, + customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent, + }; +} +exports.resolveUserAgentConfig = resolveUserAgentConfig; + + +/***/ }), + +/***/ 8025: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UA_ESCAPE_REGEX = exports.SPACE = exports.X_AMZ_USER_AGENT = exports.USER_AGENT = void 0; +exports.USER_AGENT = "user-agent"; +exports.X_AMZ_USER_AGENT = "x-amz-user-agent"; +exports.SPACE = " "; +exports.UA_ESCAPE_REGEX = /[^\!\#\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; + + +/***/ }), + +/***/ 4688: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6546), exports); +tslib_1.__exportStar(__nccwpck_require__(6236), exports); + + +/***/ }), + +/***/ 6236: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getUserAgentPlugin = exports.getUserAgentMiddlewareOptions = exports.userAgentMiddleware = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const constants_1 = __nccwpck_require__(8025); +const userAgentMiddleware = (options) => (next, context) => async (args) => { + var _a, _b; + const { request } = args; + if (!protocol_http_1.HttpRequest.isInstance(request)) + return next(args); + const { headers } = request; + const userAgent = ((_a = context === null || context === void 0 ? void 0 : context.userAgent) === null || _a === void 0 ? void 0 : _a.map(escapeUserAgent)) || []; + const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); + const customUserAgent = ((_b = options === null || options === void 0 ? void 0 : options.customUserAgent) === null || _b === void 0 ? void 0 : _b.map(escapeUserAgent)) || []; + const sdkUserAgentValue = [...defaultUserAgent, ...userAgent, ...customUserAgent].join(constants_1.SPACE); + const normalUAValue = [ + ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), + ...customUserAgent, + ].join(constants_1.SPACE); + if (options.runtime !== "browser") { + if (normalUAValue) { + headers[constants_1.X_AMZ_USER_AGENT] = headers[constants_1.X_AMZ_USER_AGENT] + ? `${headers[constants_1.USER_AGENT]} ${normalUAValue}` + : normalUAValue; + } + headers[constants_1.USER_AGENT] = sdkUserAgentValue; + } + else { + headers[constants_1.X_AMZ_USER_AGENT] = sdkUserAgentValue; + } + return next({ + ...args, + request, + }); +}; +exports.userAgentMiddleware = userAgentMiddleware; +const escapeUserAgent = ([name, version]) => { + const prefixSeparatorIndex = name.indexOf("/"); + const prefix = name.substring(0, prefixSeparatorIndex); + let uaName = name.substring(prefixSeparatorIndex + 1); + if (prefix === "api") { + uaName = uaName.toLowerCase(); + } + return [prefix, uaName, version] + .filter((item) => item && item.length > 0) + .map((item) => item === null || item === void 0 ? void 0 : item.replace(constants_1.UA_ESCAPE_REGEX, "_")) + .join("/"); +}; +exports.getUserAgentMiddlewareOptions = { + name: "getUserAgentMiddleware", + step: "build", + priority: "low", + tags: ["SET_USER_AGENT", "USER_AGENT"], + override: true, +}; +const getUserAgentPlugin = (config) => ({ + applyToStack: (clientStack) => { + clientStack.add((0, exports.userAgentMiddleware)(config), exports.getUserAgentMiddlewareOptions); + }, +}); +exports.getUserAgentPlugin = getUserAgentPlugin; + + +/***/ }), + +/***/ 2175: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.loadConfig = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const fromEnv_1 = __nccwpck_require__(6161); +const fromSharedConfigFiles_1 = __nccwpck_require__(3905); +const fromStatic_1 = __nccwpck_require__(5881); +const loadConfig = ({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, property_provider_1.memoize)((0, property_provider_1.chain)((0, fromEnv_1.fromEnv)(environmentVariableSelector), (0, fromSharedConfigFiles_1.fromSharedConfigFiles)(configFileSelector, configuration), (0, fromStatic_1.fromStatic)(defaultValue))); +exports.loadConfig = loadConfig; + + +/***/ }), + +/***/ 6161: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromEnv = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const fromEnv = (envVarSelector) => async () => { + try { + const config = envVarSelector(process.env); + if (config === undefined) { + throw new Error(); + } + return config; + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(e.message || `Cannot load config from environment variables with getter: ${envVarSelector}`); + } +}; +exports.fromEnv = fromEnv; + + +/***/ }), + +/***/ 3905: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromSharedConfigFiles = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const shared_ini_file_loader_1 = __nccwpck_require__(7387); +const fromSharedConfigFiles = (configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, shared_ini_file_loader_1.getProfileName)(init); + const { configFile, credentialsFile } = await (0, shared_ini_file_loader_1.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" + ? { ...profileFromCredentials, ...profileFromConfig } + : { ...profileFromConfig, ...profileFromCredentials }; + try { + const configValue = configSelector(mergedProfile); + if (configValue === undefined) { + throw new Error(); + } + return configValue; + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(e.message || + `Cannot load config for profile ${profile} in SDK configuration files with getter: ${configSelector}`); + } +}; +exports.fromSharedConfigFiles = fromSharedConfigFiles; + + +/***/ }), + +/***/ 5881: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromStatic = void 0; +const property_provider_1 = __nccwpck_require__(4462); +const isFunction = (func) => typeof func === "function"; +const fromStatic = (defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, property_provider_1.fromStatic)(defaultValue); +exports.fromStatic = fromStatic; + + +/***/ }), + +/***/ 7684: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2175), exports); + + +/***/ }), + +/***/ 3647: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = void 0; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 6225: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getTransformedHeaders = void 0; +const getTransformedHeaders = (headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}; +exports.getTransformedHeaders = getTransformedHeaders; + + +/***/ }), + +/***/ 8805: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2298), exports); +tslib_1.__exportStar(__nccwpck_require__(2533), exports); +tslib_1.__exportStar(__nccwpck_require__(2198), exports); + + +/***/ }), + +/***/ 2298: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttpHandler = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const querystring_builder_1 = __nccwpck_require__(3402); +const http_1 = __nccwpck_require__(3685); +const https_1 = __nccwpck_require__(5687); +const constants_1 = __nccwpck_require__(3647); +const get_transformed_headers_1 = __nccwpck_require__(6225); +const set_connection_timeout_1 = __nccwpck_require__(3598); +const set_socket_timeout_1 = __nccwpck_require__(4751); +const write_request_body_1 = __nccwpck_require__(5248); +class NodeHttpHandler { + constructor(options) { + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }) + .catch(reject); + } + else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + resolveDefaultConfig(options) { + const { connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + socketTimeout, + httpAgent: httpAgent || new http_1.Agent({ keepAlive, maxSockets }), + httpsAgent: httpsAgent || new https_1.Agent({ keepAlive, maxSockets }), + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) === null || _a === void 0 ? void 0 : _a.httpAgent) === null || _b === void 0 ? void 0 : _b.destroy(); + (_d = (_c = this.config) === null || _c === void 0 ? void 0 : _c.httpsAgent) === null || _d === void 0 ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + return new Promise((resolve, reject) => { + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const queryString = (0, querystring_builder_1.buildQueryString)(request.query || {}); + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path: queryString ? `${request.path}?${queryString}` : request.path, + port: request.port, + agent: isSSL ? this.config.httpsAgent : this.config.httpAgent, + }; + const requestFunc = isSSL ? https_1.request : http_1.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: res.statusCode || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(res.headers), + body: res, + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } + else { + reject(err); + } + }); + (0, set_connection_timeout_1.setConnectionTimeout)(req, reject, this.config.connectionTimeout); + (0, set_socket_timeout_1.setSocketTimeout)(req, reject, this.config.socketTimeout); + if (abortSignal) { + abortSignal.onabort = () => { + req.abort(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + (0, write_request_body_1.writeRequestBody)(req, request); + }); + } +} +exports.NodeHttpHandler = NodeHttpHandler; + + +/***/ }), + +/***/ 2533: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NodeHttp2Handler = void 0; +const protocol_http_1 = __nccwpck_require__(223); +const querystring_builder_1 = __nccwpck_require__(3402); +const http2_1 = __nccwpck_require__(5158); +const get_transformed_headers_1 = __nccwpck_require__(6225); +const write_request_body_1 = __nccwpck_require__(5248); +class NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options() + .then((opts) => { + resolve(opts || {}); + }) + .catch(reject); + } + else { + resolve(options || {}); + } + }); + this.sessionCache = new Map(); + } + destroy() { + for (const sessions of this.sessionCache.values()) { + sessions.forEach((session) => this.destroySession(session)); + } + this.sessionCache.clear(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((resolve, rejectOriginal) => { + let fulfilled = false; + if (abortSignal === null || abortSignal === void 0 ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectOriginal(abortError); + return; + } + const { hostname, method, port, protocol, path, query } = request; + const authority = `${protocol}//${hostname}${port ? `:${port}` : ""}`; + const session = this.getSession(authority, disableConcurrentStreams || false); + const reject = (err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + rejectOriginal(err); + }; + const queryString = (0, querystring_builder_1.buildQueryString)(query || {}); + const req = session.request({ + ...request.headers, + [http2_1.constants.HTTP2_HEADER_PATH]: queryString ? `${path}?${queryString}` : path, + [http2_1.constants.HTTP2_HEADER_METHOD]: method, + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new protocol_http_1.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: (0, get_transformed_headers_1.getTransformedHeaders)(headers), + body: req, + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.deleteSessionFromCache(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }); + } + if (abortSignal) { + abortSignal.onabort = () => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }; + } + req.on("frameError", (type, code, id) => { + reject(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", reject); + req.on("aborted", () => { + reject(new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`)); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + reject(new Error("Unexpected error: http2 request did not get a response")); + } + }); + (0, write_request_body_1.writeRequestBody)(req, request); + }); + } + getSession(authority, disableConcurrentStreams) { + var _a; + const sessionCache = this.sessionCache; + const existingSessions = sessionCache.get(authority) || []; + if (existingSessions.length > 0 && !disableConcurrentStreams) + return existingSessions[0]; + const newSession = (0, http2_1.connect)(authority); + newSession.unref(); + const destroySessionCb = () => { + this.destroySession(newSession); + this.deleteSessionFromCache(authority, newSession); + }; + newSession.on("goaway", destroySessionCb); + newSession.on("error", destroySessionCb); + newSession.on("frameError", destroySessionCb); + newSession.on("close", () => this.deleteSessionFromCache(authority, newSession)); + if ((_a = this.config) === null || _a === void 0 ? void 0 : _a.sessionTimeout) { + newSession.setTimeout(this.config.sessionTimeout, destroySessionCb); + } + existingSessions.push(newSession); + sessionCache.set(authority, existingSessions); + return newSession; + } + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } + deleteSessionFromCache(authority, session) { + const existingSessions = this.sessionCache.get(authority) || []; + if (!existingSessions.includes(session)) { + return; + } + this.sessionCache.set(authority, existingSessions.filter((s) => s !== session)); + } +} +exports.NodeHttp2Handler = NodeHttp2Handler; + + +/***/ }), + +/***/ 3598: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setConnectionTimeout = void 0; +const setConnectionTimeout = (request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + request.on("socket", (socket) => { + if (socket.connecting) { + const timeoutId = setTimeout(() => { + request.destroy(); + reject(Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError", + })); + }, timeoutInMs); + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } + }); +}; +exports.setConnectionTimeout = setConnectionTimeout; + + +/***/ }), + +/***/ 4751: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.setSocketTimeout = void 0; +const setSocketTimeout = (request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}; +exports.setSocketTimeout = setSocketTimeout; + + +/***/ }), + +/***/ 4362: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Collector = void 0; +const stream_1 = __nccwpck_require__(2781); +class Collector extends stream_1.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +} +exports.Collector = Collector; + + +/***/ }), + +/***/ 2198: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.streamCollector = void 0; +const collector_1 = __nccwpck_require__(4362); +const streamCollector = (stream) => new Promise((resolve, reject) => { + const collector = new collector_1.Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function () { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); +}); +exports.streamCollector = streamCollector; + + +/***/ }), + +/***/ 5248: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.writeRequestBody = void 0; +const stream_1 = __nccwpck_require__(2781); +function writeRequestBody(httpRequest, request) { + const expect = request.headers["Expect"] || request.headers["expect"]; + if (expect === "100-continue") { + httpRequest.on("continue", () => { + writeBody(httpRequest, request.body); + }); + } + else { + writeBody(httpRequest, request.body); + } +} +exports.writeRequestBody = writeRequestBody; +function writeBody(httpRequest, body) { + if (body instanceof stream_1.Readable) { + body.pipe(httpRequest); + } + else if (body) { + httpRequest.end(Buffer.from(body)); + } + else { + httpRequest.end(); + } +} + + +/***/ }), + +/***/ 6875: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.CredentialsProviderError = void 0; +const ProviderError_1 = __nccwpck_require__(1786); +class CredentialsProviderError extends ProviderError_1.ProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, CredentialsProviderError.prototype); + } +} +exports.CredentialsProviderError = CredentialsProviderError; + + +/***/ }), + +/***/ 1786: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ProviderError = void 0; +class ProviderError extends Error { + constructor(message, tryNextLink = true) { + super(message); + this.tryNextLink = tryNextLink; + this.name = "ProviderError"; + Object.setPrototypeOf(this, ProviderError.prototype); + } + static from(error, tryNextLink = true) { + return Object.assign(new this(error.message, tryNextLink), error); + } +} +exports.ProviderError = ProviderError; + + +/***/ }), + +/***/ 2173: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.TokenProviderError = void 0; +const ProviderError_1 = __nccwpck_require__(1786); +class TokenProviderError extends ProviderError_1.ProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, TokenProviderError.prototype); + } +} +exports.TokenProviderError = TokenProviderError; + + +/***/ }), + +/***/ 1444: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.chain = void 0; +const ProviderError_1 = __nccwpck_require__(1786); +function chain(...providers) { + return () => { + let promise = Promise.reject(new ProviderError_1.ProviderError("No providers in chain")); + for (const provider of providers) { + promise = promise.catch((err) => { + if (err === null || err === void 0 ? void 0 : err.tryNextLink) { + return provider(); + } + throw err; + }); + } + return promise; + }; +} +exports.chain = chain; + + +/***/ }), + +/***/ 529: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromStatic = void 0; +const fromStatic = (staticValue) => () => Promise.resolve(staticValue); +exports.fromStatic = fromStatic; + + +/***/ }), + +/***/ 4462: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6875), exports); +tslib_1.__exportStar(__nccwpck_require__(1786), exports); +tslib_1.__exportStar(__nccwpck_require__(2173), exports); +tslib_1.__exportStar(__nccwpck_require__(1444), exports); +tslib_1.__exportStar(__nccwpck_require__(529), exports); +tslib_1.__exportStar(__nccwpck_require__(714), exports); + + +/***/ }), + +/***/ 714: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.memoize = void 0; +const memoize = (provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } + finally { + pending = undefined; + } + return resolved; + }; + if (isExpired === undefined) { + return async (options) => { + if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || (options === null || options === void 0 ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}; +exports.memoize = memoize; + + +/***/ }), + +/***/ 6779: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2872: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpRequest = void 0; +class HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol + ? options.protocol.slice(-1) !== ":" + ? `${options.protocol}:` + : options.protocol + : "https:"; + this.path = options.path ? (options.path.charAt(0) !== "/" ? `/${options.path}` : options.path) : "/"; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return ("method" in req && + "protocol" in req && + "hostname" in req && + "path" in req && + typeof req["query"] === "object" && + typeof req["headers"] === "object"); + } + clone() { + const cloned = new HttpRequest({ + ...this, + headers: { ...this.headers }, + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +} +exports.HttpRequest = HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; + }, {}); +} + + +/***/ }), + +/***/ 2348: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.HttpResponse = void 0; +class HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +} +exports.HttpResponse = HttpResponse; + + +/***/ }), + +/***/ 223: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6779), exports); +tslib_1.__exportStar(__nccwpck_require__(2872), exports); +tslib_1.__exportStar(__nccwpck_require__(2348), exports); +tslib_1.__exportStar(__nccwpck_require__(5694), exports); + + +/***/ }), + +/***/ 5694: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostname = void 0; +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +exports.isValidHostname = isValidHostname; + + +/***/ }), + +/***/ 3402: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.buildQueryString = void 0; +const util_uri_escape_1 = __nccwpck_require__(7952); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, util_uri_escape_1.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, util_uri_escape_1.escapeUri)(value[i])}`); + } + } + else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +exports.buildQueryString = buildQueryString; + + +/***/ }), + +/***/ 4392: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseQueryString = void 0; +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } + else if (Array.isArray(query[key])) { + query[key].push(value); + } + else { + query[key] = [query[key], value]; + } + } + } + return query; +} +exports.parseQueryString = parseQueryString; + + +/***/ }), + +/***/ 7352: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODEJS_TIMEOUT_ERROR_CODES = exports.TRANSIENT_ERROR_STATUS_CODES = exports.TRANSIENT_ERROR_CODES = exports.THROTTLING_ERROR_CODES = exports.CLOCK_SKEW_ERROR_CODES = void 0; +exports.CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch", +]; +exports.THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException", +]; +exports.TRANSIENT_ERROR_CODES = ["AbortError", "TimeoutError", "RequestTimeout", "RequestTimeoutException"]; +exports.TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; +exports.NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + + +/***/ }), + +/***/ 1921: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isTransientError = exports.isThrottlingError = exports.isClockSkewError = exports.isRetryableByTrait = void 0; +const constants_1 = __nccwpck_require__(7352); +const isRetryableByTrait = (error) => error.$retryable !== undefined; +exports.isRetryableByTrait = isRetryableByTrait; +const isClockSkewError = (error) => constants_1.CLOCK_SKEW_ERROR_CODES.includes(error.name); +exports.isClockSkewError = isClockSkewError; +const isThrottlingError = (error) => { + var _a, _b; + return ((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) === 429 || + constants_1.THROTTLING_ERROR_CODES.includes(error.name) || + ((_b = error.$retryable) === null || _b === void 0 ? void 0 : _b.throttling) == true; +}; +exports.isThrottlingError = isThrottlingError; +const isTransientError = (error) => { + var _a; + return constants_1.TRANSIENT_ERROR_CODES.includes(error.name) || + constants_1.NODEJS_TIMEOUT_ERROR_CODES.includes((error === null || error === void 0 ? void 0 : error.code) || "") || + constants_1.TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) === null || _a === void 0 ? void 0 : _a.httpStatusCode) || 0); +}; +exports.isTransientError = isTransientError; + + +/***/ }), + +/***/ 5216: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getConfigFilepath = exports.ENV_CONFIG_PATH = void 0; +const path_1 = __nccwpck_require__(1017); +const getHomeDir_1 = __nccwpck_require__(7363); +exports.ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +const getConfigFilepath = () => process.env[exports.ENV_CONFIG_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "config"); +exports.getConfigFilepath = getConfigFilepath; + + +/***/ }), + +/***/ 1569: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getCredentialsFilepath = exports.ENV_CREDENTIALS_PATH = void 0; +const path_1 = __nccwpck_require__(1017); +const getHomeDir_1 = __nccwpck_require__(7363); +exports.ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +const getCredentialsFilepath = () => process.env[exports.ENV_CREDENTIALS_PATH] || (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "credentials"); +exports.getCredentialsFilepath = getCredentialsFilepath; + + +/***/ }), + +/***/ 7363: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(2037); +const path_1 = __nccwpck_require__(1017); +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + return (0, os_1.homedir)(); +}; +exports.getHomeDir = getHomeDir; + + +/***/ }), + +/***/ 7498: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getProfileData = void 0; +const profileKeyRegex = /^profile\s(["'])?([^\1]+)\1$/; +const getProfileData = (data) => Object.entries(data) + .filter(([key]) => profileKeyRegex.test(key)) + .reduce((acc, [key, value]) => ({ ...acc, [profileKeyRegex.exec(key)[2]]: value }), { + ...(data.default && { default: data.default }), +}); +exports.getProfileData = getProfileData; + + +/***/ }), + +/***/ 6776: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getProfileName = exports.DEFAULT_PROFILE = exports.ENV_PROFILE = void 0; +exports.ENV_PROFILE = "AWS_PROFILE"; +exports.DEFAULT_PROFILE = "default"; +const getProfileName = (init) => init.profile || process.env[exports.ENV_PROFILE] || exports.DEFAULT_PROFILE; +exports.getProfileName = getProfileName; + + +/***/ }), + +/***/ 6147: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(6113); +const path_1 = __nccwpck_require__(1017); +const getHomeDir_1 = __nccwpck_require__(7363); +const getSSOTokenFilepath = (ssoStartUrl) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(ssoStartUrl).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +}; +exports.getSSOTokenFilepath = getSSOTokenFilepath; + + +/***/ }), + +/***/ 8553: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(7147); +const getSSOTokenFilepath_1 = __nccwpck_require__(6147); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (ssoStartUrl) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(ssoStartUrl); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; + + +/***/ }), + +/***/ 5175: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSsoSessionData = void 0; +const ssoSessionKeyRegex = /^sso-session\s(["'])?([^\1]+)\1$/; +const getSsoSessionData = (data) => Object.entries(data) + .filter(([key]) => ssoSessionKeyRegex.test(key)) + .reduce((acc, [key, value]) => ({ ...acc, [ssoSessionKeyRegex.exec(key)[2]]: value }), {}); +exports.getSsoSessionData = getSsoSessionData; + + +/***/ }), + +/***/ 7387: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7363), exports); +tslib_1.__exportStar(__nccwpck_require__(6776), exports); +tslib_1.__exportStar(__nccwpck_require__(6147), exports); +tslib_1.__exportStar(__nccwpck_require__(8553), exports); +tslib_1.__exportStar(__nccwpck_require__(7871), exports); +tslib_1.__exportStar(__nccwpck_require__(6179), exports); +tslib_1.__exportStar(__nccwpck_require__(6533), exports); +tslib_1.__exportStar(__nccwpck_require__(4105), exports); + + +/***/ }), + +/***/ 7871: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.loadSharedConfigFiles = void 0; +const getConfigFilepath_1 = __nccwpck_require__(5216); +const getCredentialsFilepath_1 = __nccwpck_require__(1569); +const getProfileData_1 = __nccwpck_require__(7498); +const parseIni_1 = __nccwpck_require__(2806); +const slurpFile_1 = __nccwpck_require__(9242); +const swallowError = () => ({}); +const loadSharedConfigFiles = async (init = {}) => { + const { filepath = (0, getCredentialsFilepath_1.getCredentialsFilepath)(), configFilepath = (0, getConfigFilepath_1.getConfigFilepath)() } = init; + const parsedFiles = await Promise.all([ + (0, slurpFile_1.slurpFile)(configFilepath).then(parseIni_1.parseIni).then(getProfileData_1.getProfileData).catch(swallowError), + (0, slurpFile_1.slurpFile)(filepath).then(parseIni_1.parseIni).catch(swallowError), + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1], + }; +}; +exports.loadSharedConfigFiles = loadSharedConfigFiles; + + +/***/ }), + +/***/ 6179: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.loadSsoSessionData = void 0; +const getConfigFilepath_1 = __nccwpck_require__(5216); +const getSsoSessionData_1 = __nccwpck_require__(5175); +const parseIni_1 = __nccwpck_require__(2806); +const slurpFile_1 = __nccwpck_require__(9242); +const swallowError = () => ({}); +const loadSsoSessionData = async (init = {}) => { + var _a; + return (0, slurpFile_1.slurpFile)((_a = init.configFilepath) !== null && _a !== void 0 ? _a : (0, getConfigFilepath_1.getConfigFilepath)()) + .then(parseIni_1.parseIni) + .then(getSsoSessionData_1.getSsoSessionData) + .catch(swallowError); +}; +exports.loadSsoSessionData = loadSsoSessionData; + + +/***/ }), + +/***/ 2806: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseIni = void 0; +const profileNameBlockList = ["__proto__", "profile __proto__"]; +const parseIni = (iniData) => { + const map = {}; + let currentSection; + for (let line of iniData.split(/\r?\n/)) { + line = line.split(/(^|\s)[;#]/)[0].trim(); + const isSection = line[0] === "[" && line[line.length - 1] === "]"; + if (isSection) { + currentSection = line.substring(1, line.length - 1); + if (profileNameBlockList.includes(currentSection)) { + throw new Error(`Found invalid profile name "${currentSection}"`); + } + } + else if (currentSection) { + const indexOfEqualsSign = line.indexOf("="); + const start = 0; + const end = line.length - 1; + const isAssignment = indexOfEqualsSign !== -1 && indexOfEqualsSign !== start && indexOfEqualsSign !== end; + if (isAssignment) { + const [name, value] = [ + line.substring(0, indexOfEqualsSign).trim(), + line.substring(indexOfEqualsSign + 1).trim(), + ]; + map[currentSection] = map[currentSection] || {}; + map[currentSection][name] = value; + } + } + } + return map; +}; +exports.parseIni = parseIni; + + +/***/ }), + +/***/ 6533: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseKnownFiles = void 0; +const loadSharedConfigFiles_1 = __nccwpck_require__(7871); +const parseKnownFiles = async (init) => { + const parsedFiles = await (0, loadSharedConfigFiles_1.loadSharedConfigFiles)(init); + return { + ...parsedFiles.configFile, + ...parsedFiles.credentialsFile, + }; +}; +exports.parseKnownFiles = parseKnownFiles; + + +/***/ }), + +/***/ 9242: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(7147); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path) => { + if (!filePromisesHash[path]) { + filePromisesHash[path] = readFile(path, "utf8"); + } + return filePromisesHash[path]; +}; +exports.slurpFile = slurpFile; + + +/***/ }), + +/***/ 4105: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5086: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SignatureV4 = void 0; +const util_hex_encoding_1 = __nccwpck_require__(1968); +const util_middleware_1 = __nccwpck_require__(236); +const constants_1 = __nccwpck_require__(342); +const credentialDerivation_1 = __nccwpck_require__(1424); +const getCanonicalHeaders_1 = __nccwpck_require__(3590); +const getCanonicalQuery_1 = __nccwpck_require__(2019); +const getPayloadHash_1 = __nccwpck_require__(7080); +const headerUtil_1 = __nccwpck_require__(4120); +const moveHeadersToQuery_1 = __nccwpck_require__(8201); +const prepareRequest_1 = __nccwpck_require__(5772); +const utilDate_1 = __nccwpck_require__(4799); +class SignatureV4 { + constructor({ applyChecksum, credentials, region, service, sha256, uriEscapePath = true, }) { + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, util_middleware_1.normalizeProvider)(region); + this.credentialProvider = (0, util_middleware_1.normalizeProvider)(credentials); + } + async presign(originalRequest, options = {}) { + const { signingDate = new Date(), expiresIn = 3600, unsignableHeaders, unhoistableHeaders, signableHeaders, signingRegion, signingService, } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { longDate, shortDate } = formatDate(signingDate); + if (expiresIn > constants_1.MAX_PRESIGNED_TTL) { + return Promise.reject("Signature version 4 presigned URLs" + " must have an expiration date less than one week in" + " the future"); + } + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + const request = (0, moveHeadersToQuery_1.moveHeadersToQuery)((0, prepareRequest_1.prepareRequest)(originalRequest), { unhoistableHeaders }); + if (credentials.sessionToken) { + request.query[constants_1.TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request.query[constants_1.ALGORITHM_QUERY_PARAM] = constants_1.ALGORITHM_IDENTIFIER; + request.query[constants_1.CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request.query[constants_1.AMZ_DATE_QUERY_PARAM] = longDate; + request.query[constants_1.EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); + request.query[constants_1.SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); + request.query[constants_1.SIGNATURE_QUERY_PARAM] = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, await (0, getPayloadHash_1.getPayloadHash)(originalRequest, this.sha256))); + return request; + } + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } + else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } + else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { shortDate, longDate } = formatDate(signingDate); + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + const hashedPayload = await (0, getPayloadHash_1.getPayloadHash)({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, util_hex_encoding_1.toHex)(await hash.digest()); + const stringToSign = [ + constants_1.EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload, + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signString(stringToSign, { signingDate = new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const { shortDate } = formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update(stringToSign); + return (0, util_hex_encoding_1.toHex)(await hash.digest()); + } + async signRequest(requestToSign, { signingDate = new Date(), signableHeaders, unsignableHeaders, signingRegion, signingService, } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion !== null && signingRegion !== void 0 ? signingRegion : (await this.regionProvider()); + const request = (0, prepareRequest_1.prepareRequest)(requestToSign); + const { longDate, shortDate } = formatDate(signingDate); + const scope = (0, credentialDerivation_1.createScope)(shortDate, region, signingService !== null && signingService !== void 0 ? signingService : this.service); + request.headers[constants_1.AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request.headers[constants_1.TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await (0, getPayloadHash_1.getPayloadHash)(request, this.sha256); + if (!(0, headerUtil_1.hasHeader)(constants_1.SHA256_HEADER, request.headers) && this.applyChecksum) { + request.headers[constants_1.SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = (0, getCanonicalHeaders_1.getCanonicalHeaders)(request, unsignableHeaders, signableHeaders); + const signature = await this.getSignature(longDate, scope, this.getSigningKey(credentials, region, shortDate, signingService), this.createCanonicalRequest(request, canonicalHeaders, payloadHash)); + request.headers[constants_1.AUTH_HEADER] = + `${constants_1.ALGORITHM_IDENTIFIER} ` + + `Credential=${credentials.accessKeyId}/${scope}, ` + + `SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, ` + + `Signature=${signature}`; + return request; + } + createCanonicalRequest(request, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request.method} +${this.getCanonicalPath(request)} +${(0, getCanonicalQuery_1.getCanonicalQuery)(request)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; + } + async createStringToSign(longDate, credentialScope, canonicalRequest) { + const hash = new this.sha256(); + hash.update(canonicalRequest); + const hashedRequest = await hash.digest(); + return `${constants_1.ALGORITHM_IDENTIFIER} +${longDate} +${credentialScope} +${(0, util_hex_encoding_1.toHex)(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if ((pathSegment === null || pathSegment === void 0 ? void 0 : pathSegment.length) === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } + else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${(path === null || path === void 0 ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path === null || path === void 0 ? void 0 : path.endsWith("/")) ? "/" : ""}`; + const doubleEncoded = encodeURIComponent(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); + } + return path; + } + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); + const hash = new this.sha256(await keyPromise); + hash.update(stringToSign); + return (0, util_hex_encoding_1.toHex)(await hash.digest()); + } + getSigningKey(credentials, region, shortDate, service) { + return (0, credentialDerivation_1.getSigningKey)(this.sha256, credentials, shortDate, region, service || this.service); + } + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || + typeof credentials.accessKeyId !== "string" || + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } + } +} +exports.SignatureV4 = SignatureV4; +const formatDate = (now) => { + const longDate = (0, utilDate_1.iso8601)(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8), + }; +}; +const getCanonicalHeaderList = (headers) => Object.keys(headers).sort().join(";"); + + +/***/ }), + +/***/ 3141: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.cloneQuery = exports.cloneRequest = void 0; +const cloneRequest = ({ headers, query, ...rest }) => ({ + ...rest, + headers: { ...headers }, + query: query ? (0, exports.cloneQuery)(query) : undefined, +}); +exports.cloneRequest = cloneRequest; +const cloneQuery = (query) => Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param, + }; +}, {}); +exports.cloneQuery = cloneQuery; + + +/***/ }), + +/***/ 342: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.MAX_PRESIGNED_TTL = exports.KEY_TYPE_IDENTIFIER = exports.MAX_CACHE_SIZE = exports.UNSIGNED_PAYLOAD = exports.EVENT_ALGORITHM_IDENTIFIER = exports.ALGORITHM_IDENTIFIER_V4A = exports.ALGORITHM_IDENTIFIER = exports.UNSIGNABLE_PATTERNS = exports.SEC_HEADER_PATTERN = exports.PROXY_HEADER_PATTERN = exports.ALWAYS_UNSIGNABLE_HEADERS = exports.HOST_HEADER = exports.TOKEN_HEADER = exports.SHA256_HEADER = exports.SIGNATURE_HEADER = exports.GENERATED_HEADERS = exports.DATE_HEADER = exports.AMZ_DATE_HEADER = exports.AUTH_HEADER = exports.REGION_SET_PARAM = exports.TOKEN_QUERY_PARAM = exports.SIGNATURE_QUERY_PARAM = exports.EXPIRES_QUERY_PARAM = exports.SIGNED_HEADERS_QUERY_PARAM = exports.AMZ_DATE_QUERY_PARAM = exports.CREDENTIAL_QUERY_PARAM = exports.ALGORITHM_QUERY_PARAM = void 0; +exports.ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; +exports.CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; +exports.AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; +exports.SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; +exports.EXPIRES_QUERY_PARAM = "X-Amz-Expires"; +exports.SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; +exports.TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; +exports.REGION_SET_PARAM = "X-Amz-Region-Set"; +exports.AUTH_HEADER = "authorization"; +exports.AMZ_DATE_HEADER = exports.AMZ_DATE_QUERY_PARAM.toLowerCase(); +exports.DATE_HEADER = "date"; +exports.GENERATED_HEADERS = [exports.AUTH_HEADER, exports.AMZ_DATE_HEADER, exports.DATE_HEADER]; +exports.SIGNATURE_HEADER = exports.SIGNATURE_QUERY_PARAM.toLowerCase(); +exports.SHA256_HEADER = "x-amz-content-sha256"; +exports.TOKEN_HEADER = exports.TOKEN_QUERY_PARAM.toLowerCase(); +exports.HOST_HEADER = "host"; +exports.ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true, +}; +exports.PROXY_HEADER_PATTERN = /^proxy-/; +exports.SEC_HEADER_PATTERN = /^sec-/; +exports.UNSIGNABLE_PATTERNS = [/^proxy-/i, /^sec-/i]; +exports.ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; +exports.ALGORITHM_IDENTIFIER_V4A = "AWS4-ECDSA-P256-SHA256"; +exports.EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; +exports.UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; +exports.MAX_CACHE_SIZE = 50; +exports.KEY_TYPE_IDENTIFIER = "aws4_request"; +exports.MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; + + +/***/ }), + +/***/ 1424: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.clearCredentialCache = exports.getSigningKey = exports.createScope = void 0; +const util_hex_encoding_1 = __nccwpck_require__(1968); +const constants_1 = __nccwpck_require__(342); +const signingKeyCache = {}; +const cacheQueue = []; +const createScope = (shortDate, region, service) => `${shortDate}/${region}/${service}/${constants_1.KEY_TYPE_IDENTIFIER}`; +exports.createScope = createScope; +const getSigningKey = async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, util_hex_encoding_1.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; + } + cacheQueue.push(cacheKey); + while (cacheQueue.length > constants_1.MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; + } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, constants_1.KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return (signingKeyCache[cacheKey] = key); +}; +exports.getSigningKey = getSigningKey; +const clearCredentialCache = () => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); +}; +exports.clearCredentialCache = clearCredentialCache; +const hmac = (ctor, secret, data) => { + const hash = new ctor(secret); + hash.update(data); + return hash.digest(); +}; + + +/***/ }), + +/***/ 3590: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getCanonicalHeaders = void 0; +const constants_1 = __nccwpck_require__(342); +const getCanonicalHeaders = ({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == undefined) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in constants_1.ALWAYS_UNSIGNABLE_HEADERS || + (unsignableHeaders === null || unsignableHeaders === void 0 ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || + constants_1.PROXY_HEADER_PATTERN.test(canonicalHeaderName) || + constants_1.SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || (signableHeaders && !signableHeaders.has(canonicalHeaderName))) { + continue; + } + } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); + } + return canonical; +}; +exports.getCanonicalHeaders = getCanonicalHeaders; + + +/***/ }), + +/***/ 2019: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getCanonicalQuery = void 0; +const util_uri_escape_1 = __nccwpck_require__(7952); +const constants_1 = __nccwpck_require__(342); +const getCanonicalQuery = ({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query).sort()) { + if (key.toLowerCase() === constants_1.SIGNATURE_HEADER) { + continue; + } + keys.push(key); + const value = query[key]; + if (typeof value === "string") { + serialized[key] = `${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`; + } + else if (Array.isArray(value)) { + serialized[key] = value + .slice(0) + .sort() + .reduce((encoded, value) => encoded.concat([`${(0, util_uri_escape_1.escapeUri)(key)}=${(0, util_uri_escape_1.escapeUri)(value)}`]), []) + .join("&"); + } + } + return keys + .map((key) => serialized[key]) + .filter((serialized) => serialized) + .join("&"); +}; +exports.getCanonicalQuery = getCanonicalQuery; + + +/***/ }), + +/***/ 7080: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getPayloadHash = void 0; +const is_array_buffer_1 = __nccwpck_require__(9126); +const util_hex_encoding_1 = __nccwpck_require__(1968); +const constants_1 = __nccwpck_require__(342); +const getPayloadHash = async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === constants_1.SHA256_HEADER) { + return headers[headerName]; + } + } + if (body == undefined) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } + else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, is_array_buffer_1.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update(body); + return (0, util_hex_encoding_1.toHex)(await hashCtor.digest()); + } + return constants_1.UNSIGNED_PAYLOAD; +}; +exports.getPayloadHash = getPayloadHash; + + +/***/ }), + +/***/ 4120: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.deleteHeader = exports.getHeaderValue = exports.hasHeader = void 0; +const hasHeader = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; + } + } + return false; +}; +exports.hasHeader = hasHeader; +const getHeaderValue = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return headers[headerName]; + } + } + return undefined; +}; +exports.getHeaderValue = getHeaderValue; +const deleteHeader = (soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + delete headers[headerName]; + } + } +}; +exports.deleteHeader = deleteHeader; + + +/***/ }), + +/***/ 4275: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.prepareRequest = exports.moveHeadersToQuery = exports.getPayloadHash = exports.getCanonicalQuery = exports.getCanonicalHeaders = void 0; +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(5086), exports); +var getCanonicalHeaders_1 = __nccwpck_require__(3590); +Object.defineProperty(exports, "getCanonicalHeaders", ({ enumerable: true, get: function () { return getCanonicalHeaders_1.getCanonicalHeaders; } })); +var getCanonicalQuery_1 = __nccwpck_require__(2019); +Object.defineProperty(exports, "getCanonicalQuery", ({ enumerable: true, get: function () { return getCanonicalQuery_1.getCanonicalQuery; } })); +var getPayloadHash_1 = __nccwpck_require__(7080); +Object.defineProperty(exports, "getPayloadHash", ({ enumerable: true, get: function () { return getPayloadHash_1.getPayloadHash; } })); +var moveHeadersToQuery_1 = __nccwpck_require__(8201); +Object.defineProperty(exports, "moveHeadersToQuery", ({ enumerable: true, get: function () { return moveHeadersToQuery_1.moveHeadersToQuery; } })); +var prepareRequest_1 = __nccwpck_require__(5772); +Object.defineProperty(exports, "prepareRequest", ({ enumerable: true, get: function () { return prepareRequest_1.prepareRequest; } })); +tslib_1.__exportStar(__nccwpck_require__(1424), exports); + + +/***/ }), + +/***/ 8201: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.moveHeadersToQuery = void 0; +const cloneRequest_1 = __nccwpck_require__(3141); +const moveHeadersToQuery = (request, options = {}) => { + var _a; + const { headers, query = {} } = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) === null || _a === void 0 ? void 0 : _a.has(lname))) { + query[name] = headers[name]; + delete headers[name]; + } + } + return { + ...request, + headers, + query, + }; +}; +exports.moveHeadersToQuery = moveHeadersToQuery; + + +/***/ }), + +/***/ 5772: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.prepareRequest = void 0; +const cloneRequest_1 = __nccwpck_require__(3141); +const constants_1 = __nccwpck_require__(342); +const prepareRequest = (request) => { + request = typeof request.clone === "function" ? request.clone() : (0, cloneRequest_1.cloneRequest)(request); + for (const headerName of Object.keys(request.headers)) { + if (constants_1.GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request.headers[headerName]; + } + } + return request; +}; +exports.prepareRequest = prepareRequest; + + +/***/ }), + +/***/ 4799: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toDate = exports.iso8601 = void 0; +const iso8601 = (time) => (0, exports.toDate)(time) + .toISOString() + .replace(/\.\d{3}Z$/, "Z"); +exports.iso8601 = iso8601; +const toDate = (time) => { + if (typeof time === "number") { + return new Date(time * 1000); + } + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1000); + } + return new Date(time); + } + return time; +}; +exports.toDate = toDate; + + +/***/ }), + +/***/ 6034: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Client = void 0; +const middleware_stack_1 = __nccwpck_require__(1461); +class Client { + constructor(config) { + this.middlewareStack = (0, middleware_stack_1.constructStack)(); + this.config = config; + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : undefined; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + if (callback) { + handler(command) + .then((result) => callback(null, result.output), (err) => callback(err)) + .catch(() => { }); + } + else { + return handler(command).then((result) => result.output); + } + } + destroy() { + if (this.config.requestHandler.destroy) + this.config.requestHandler.destroy(); + } +} +exports.Client = Client; + + +/***/ }), + +/***/ 4014: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Command = void 0; +const middleware_stack_1 = __nccwpck_require__(1461); +class Command { + constructor() { + this.middlewareStack = (0, middleware_stack_1.constructStack)(); + } +} +exports.Command = Command; + + +/***/ }), + +/***/ 8392: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SENSITIVE_STRING = void 0; +exports.SENSITIVE_STRING = "***SensitiveInformation***"; + + +/***/ }), + +/***/ 4695: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseEpochTimestamp = exports.parseRfc7231DateTime = exports.parseRfc3339DateTime = exports.dateToUtcString = void 0; +const parse_utils_1 = __nccwpck_require__(4809); +const DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +const MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +exports.dateToUtcString = dateToUtcString; +const RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +const parseRfc3339DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}; +exports.parseRfc3339DateTime = parseRfc3339DateTime; +const IMF_FIXDATE = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const RFC_850_DATE = new RegExp(/^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/); +const ASC_TIME = new RegExp(/^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/); +const parseRfc7231DateTime = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year(buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds, + })); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate((0, parse_utils_1.strictParseShort)(stripLeadingZeroes(yearStr)), parseMonthByShortName(monthStr), parseDateValue(dayStr.trimLeft(), "day", 1, 31), { hours, minutes, seconds, fractionalMilliseconds }); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}; +exports.parseRfc7231DateTime = parseRfc7231DateTime; +const parseEpochTimestamp = (value) => { + if (value === null || value === undefined) { + return undefined; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } + else if (typeof value === "string") { + valueAsDouble = (0, parse_utils_1.strictParseDouble)(value); + } + else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1000)); +}; +exports.parseEpochTimestamp = parseEpochTimestamp; +const buildDate = (year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date(Date.UTC(year, adjustedMonth, day, parseDateValue(time.hours, "hour", 0, 23), parseDateValue(time.minutes, "minute", 0, 59), parseDateValue(time.seconds, "seconds", 0, 60), parseMilliseconds(time.fractionalMilliseconds))); +}; +const parseTwoDigitYear = (value) => { + const thisYear = new Date().getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + (0, parse_utils_1.strictParseShort)(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; +}; +const FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1000; +const adjustRfc850Year = (input) => { + if (input.getTime() - new Date().getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date(Date.UTC(input.getUTCFullYear() - 100, input.getUTCMonth(), input.getUTCDate(), input.getUTCHours(), input.getUTCMinutes(), input.getUTCSeconds(), input.getUTCMilliseconds())); + } + return input; +}; +const parseMonthByShortName = (value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; +}; +const DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +const validateDayOfMonth = (year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } +}; +const isLeapYear = (year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}; +const parseDateValue = (value, type, lower, upper) => { + const dateVal = (0, parse_utils_1.strictParseByte)(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; +}; +const parseMilliseconds = (value) => { + if (value === null || value === undefined) { + return 0; + } + return (0, parse_utils_1.strictParseFloat32)("0." + value) * 1000; +}; +const stripLeadingZeroes = (value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); +}; + + +/***/ }), + +/***/ 7222: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.throwDefaultError = void 0; +const exceptions_1 = __nccwpck_require__(7778); +const throwDefaultError = ({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : undefined; + const response = new exceptionCtor({ + name: parsedBody.code || parsedBody.Code || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata, + }); + throw (0, exceptions_1.decorateServiceException)(response, parsedBody); +}; +exports.throwDefaultError = throwDefaultError; +const deserializeMetadata = (output) => { + var _a; + return ({ + httpStatusCode: output.statusCode, + requestId: (_a = output.headers["x-amzn-requestid"]) !== null && _a !== void 0 ? _a : output.headers["x-amzn-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"], + }); +}; + + +/***/ }), + +/***/ 3088: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.loadConfigsForDefaultMode = void 0; +const loadConfigsForDefaultMode = (mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100, + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100, + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100, + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 30000, + }; + default: + return {}; + } +}; +exports.loadConfigsForDefaultMode = loadConfigsForDefaultMode; + + +/***/ }), + +/***/ 2363: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.emitWarningIfUnsupportedVersion = void 0; +let warningEmitted = false; +const emitWarningIfUnsupportedVersion = (version) => { + if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 14) { + warningEmitted = true; + process.emitWarning(`The AWS SDK for JavaScript (v3) will\n` + + `no longer support Node.js ${version} on November 1, 2022.\n\n` + + `To continue receiving updates to AWS services, bug fixes, and security\n` + + `updates please upgrade to Node.js 14.x or later.\n\n` + + `For details, please refer our blog post: https://a.co/48dbdYz`, `NodeDeprecationWarning`); + } +}; +exports.emitWarningIfUnsupportedVersion = emitWarningIfUnsupportedVersion; + + +/***/ }), + +/***/ 7778: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.decorateServiceException = exports.ServiceException = void 0; +class ServiceException extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, ServiceException.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; + } +} +exports.ServiceException = ServiceException; +const decorateServiceException = (exception, additions = {}) => { + Object.entries(additions) + .filter(([, v]) => v !== undefined) + .forEach(([k, v]) => { + if (exception[k] == undefined || exception[k] === "") { + exception[k] = v; + } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; +}; +exports.decorateServiceException = decorateServiceException; + + +/***/ }), + +/***/ 1927: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.extendedEncodeURIComponent = void 0; +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function (c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} +exports.extendedEncodeURIComponent = extendedEncodeURIComponent; + + +/***/ }), + +/***/ 6457: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getArrayIfSingleItem = void 0; +const getArrayIfSingleItem = (mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray]; +exports.getArrayIfSingleItem = getArrayIfSingleItem; + + +/***/ }), + +/***/ 5830: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getValueFromTextNode = void 0; +const getValueFromTextNode = (obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== undefined) { + obj[key] = obj[key][textNodeName]; + } + else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = (0, exports.getValueFromTextNode)(obj[key]); + } + } + return obj; +}; +exports.getValueFromTextNode = getValueFromTextNode; + + +/***/ }), + +/***/ 4963: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(6034), exports); +tslib_1.__exportStar(__nccwpck_require__(4014), exports); +tslib_1.__exportStar(__nccwpck_require__(8392), exports); +tslib_1.__exportStar(__nccwpck_require__(4695), exports); +tslib_1.__exportStar(__nccwpck_require__(7222), exports); +tslib_1.__exportStar(__nccwpck_require__(3088), exports); +tslib_1.__exportStar(__nccwpck_require__(2363), exports); +tslib_1.__exportStar(__nccwpck_require__(7778), exports); +tslib_1.__exportStar(__nccwpck_require__(1927), exports); +tslib_1.__exportStar(__nccwpck_require__(6457), exports); +tslib_1.__exportStar(__nccwpck_require__(5830), exports); +tslib_1.__exportStar(__nccwpck_require__(3613), exports); +tslib_1.__exportStar(__nccwpck_require__(1599), exports); +tslib_1.__exportStar(__nccwpck_require__(4809), exports); +tslib_1.__exportStar(__nccwpck_require__(308), exports); +tslib_1.__exportStar(__nccwpck_require__(8000), exports); +tslib_1.__exportStar(__nccwpck_require__(8730), exports); + + +/***/ }), + +/***/ 3613: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.LazyJsonString = exports.StringWrapper = void 0; +const StringWrapper = function () { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; +}; +exports.StringWrapper = StringWrapper; +exports.StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: exports.StringWrapper, + enumerable: false, + writable: true, + configurable: true, + }, +}); +Object.setPrototypeOf(exports.StringWrapper, String); +class LazyJsonString extends exports.StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); + } + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof LazyJsonString) { + return object; + } + else if (object instanceof String || typeof object === "string") { + return new LazyJsonString(object); + } + return new LazyJsonString(JSON.stringify(object)); + } +} +exports.LazyJsonString = LazyJsonString; + + +/***/ }), + +/***/ 1599: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.convertMap = exports.map = void 0; +function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } + else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); + } + else { + instructions = arg1; + } + } + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; + continue; + } + let [filter, value] = instructions[key]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === undefined && (_value = value()) != null; + const customFilterPassed = (typeof filter === "function" && !!filter(void 0)) || (typeof filter !== "function" && !!filter); + if (defaultFilterPassed) { + target[key] = _value; + } + else if (customFilterPassed) { + target[key] = value(); + } + } + else { + const defaultFilterPassed = filter === undefined && value != null; + const customFilterPassed = (typeof filter === "function" && !!filter(value)) || (typeof filter !== "function" && !!filter); + if (defaultFilterPassed || customFilterPassed) { + target[key] = value; + } + } + } + return target; +} +exports.map = map; +const convertMap = (target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; + } + return output; +}; +exports.convertMap = convertMap; +const mapWithFilter = (target, filter, instructions) => { + return map(target, Object.entries(instructions).reduce((_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } + else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } + else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, {})); +}; + + +/***/ }), + +/***/ 4809: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.logger = exports.strictParseByte = exports.strictParseShort = exports.strictParseInt32 = exports.strictParseInt = exports.strictParseLong = exports.limitedParseFloat32 = exports.limitedParseFloat = exports.handleFloat = exports.limitedParseDouble = exports.strictParseFloat32 = exports.strictParseFloat = exports.strictParseDouble = exports.expectUnion = exports.expectString = exports.expectObject = exports.expectNonNull = exports.expectByte = exports.expectShort = exports.expectInt32 = exports.expectInt = exports.expectLong = exports.expectFloat32 = exports.expectNumber = exports.expectBoolean = exports.parseBoolean = void 0; +const parseBoolean = (value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } +}; +exports.parseBoolean = parseBoolean; +const expectBoolean = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; + } + } + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + exports.logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; + } + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}; +exports.expectBoolean = expectBoolean; +const expectNumber = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + exports.logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; + } + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}; +exports.expectNumber = expectNumber; +const MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +const expectFloat32 = (value) => { + const expected = (0, exports.expectNumber)(value); + if (expected !== undefined && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } + } + return expected; +}; +exports.expectFloat32 = expectFloat32; +const expectLong = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}; +exports.expectLong = expectLong; +exports.expectInt = exports.expectLong; +const expectInt32 = (value) => expectSizedInt(value, 32); +exports.expectInt32 = expectInt32; +const expectShort = (value) => expectSizedInt(value, 16); +exports.expectShort = expectShort; +const expectByte = (value) => expectSizedInt(value, 8); +exports.expectByte = expectByte; +const expectSizedInt = (value, size) => { + const expected = (0, exports.expectLong)(value); + if (expected !== undefined && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}; +const castInt = (value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}; +const expectNonNull = (value, location) => { + if (value === null || value === undefined) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; +}; +exports.expectNonNull = expectNonNull; +const expectObject = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}; +exports.expectObject = expectObject; +const expectString = (value) => { + if (value === null || value === undefined) { + return undefined; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + exports.logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}; +exports.expectString = expectString; +const expectUnion = (value) => { + if (value === null || value === undefined) { + return undefined; + } + const asObject = (0, exports.expectObject)(value); + const setKeys = Object.entries(asObject) + .filter(([, v]) => v != null) + .map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}; +exports.expectUnion = expectUnion; +const strictParseDouble = (value) => { + if (typeof value == "string") { + return (0, exports.expectNumber)(parseNumber(value)); + } + return (0, exports.expectNumber)(value); +}; +exports.strictParseDouble = strictParseDouble; +exports.strictParseFloat = exports.strictParseDouble; +const strictParseFloat32 = (value) => { + if (typeof value == "string") { + return (0, exports.expectFloat32)(parseNumber(value)); + } + return (0, exports.expectFloat32)(value); +}; +exports.strictParseFloat32 = strictParseFloat32; +const NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +const parseNumber = (value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}; +const limitedParseDouble = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return (0, exports.expectNumber)(value); +}; +exports.limitedParseDouble = limitedParseDouble; +exports.handleFloat = exports.limitedParseDouble; +exports.limitedParseFloat = exports.limitedParseDouble; +const limitedParseFloat32 = (value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return (0, exports.expectFloat32)(value); +}; +exports.limitedParseFloat32 = limitedParseFloat32; +const parseFloatString = (value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}; +const strictParseLong = (value) => { + if (typeof value === "string") { + return (0, exports.expectLong)(parseNumber(value)); + } + return (0, exports.expectLong)(value); +}; +exports.strictParseLong = strictParseLong; +exports.strictParseInt = exports.strictParseLong; +const strictParseInt32 = (value) => { + if (typeof value === "string") { + return (0, exports.expectInt32)(parseNumber(value)); + } + return (0, exports.expectInt32)(value); +}; +exports.strictParseInt32 = strictParseInt32; +const strictParseShort = (value) => { + if (typeof value === "string") { + return (0, exports.expectShort)(parseNumber(value)); + } + return (0, exports.expectShort)(value); +}; +exports.strictParseShort = strictParseShort; +const strictParseByte = (value) => { + if (typeof value === "string") { + return (0, exports.expectByte)(parseNumber(value)); + } + return (0, exports.expectByte)(value); +}; +exports.strictParseByte = strictParseByte; +const stackTraceWarning = (message) => { + return String(new TypeError(message).stack || message) + .split("\n") + .slice(0, 5) + .filter((s) => !s.includes("stackTraceWarning")) + .join("\n"); +}; +exports.logger = { + warn: console.warn, +}; + + +/***/ }), + +/***/ 308: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolvedPath = void 0; +const extended_encode_uri_component_1 = __nccwpck_require__(1927); +const resolvedPath = (resolvedPath, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== undefined) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath = resolvedPath.replace(uriLabel, isGreedyLabel + ? labelValue + .split("/") + .map((segment) => (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(segment)) + .join("/") + : (0, extended_encode_uri_component_1.extendedEncodeURIComponent)(labelValue)); + } + else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); + } + return resolvedPath; +}; +exports.resolvedPath = resolvedPath; + + +/***/ }), + +/***/ 8000: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.serializeFloat = void 0; +const serializeFloat = (value) => { + if (value !== value) { + return "NaN"; + } + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; + default: + return value; + } +}; +exports.serializeFloat = serializeFloat; + + +/***/ }), + +/***/ 8730: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.splitEvery = void 0; +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } + else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } + } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; +} +exports.splitEvery = splitEvery; + + +/***/ }), + +/***/ 2562: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6913: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6527: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 8470: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7736: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3268: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9385: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointURLScheme = void 0; +var EndpointURLScheme; +(function (EndpointURLScheme) { + EndpointURLScheme["HTTP"] = "http"; + EndpointURLScheme["HTTPS"] = "https"; +})(EndpointURLScheme = exports.EndpointURLScheme || (exports.EndpointURLScheme = {})); + + +/***/ }), + +/***/ 7521: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1393: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9029: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2562), exports); +tslib_1.__exportStar(__nccwpck_require__(6913), exports); +tslib_1.__exportStar(__nccwpck_require__(6527), exports); +tslib_1.__exportStar(__nccwpck_require__(8470), exports); +tslib_1.__exportStar(__nccwpck_require__(7736), exports); +tslib_1.__exportStar(__nccwpck_require__(3268), exports); +tslib_1.__exportStar(__nccwpck_require__(9385), exports); +tslib_1.__exportStar(__nccwpck_require__(7521), exports); +tslib_1.__exportStar(__nccwpck_require__(1393), exports); +tslib_1.__exportStar(__nccwpck_require__(9910), exports); +tslib_1.__exportStar(__nccwpck_require__(6678), exports); +tslib_1.__exportStar(__nccwpck_require__(9931), exports); +tslib_1.__exportStar(__nccwpck_require__(2620), exports); +tslib_1.__exportStar(__nccwpck_require__(9546), exports); +tslib_1.__exportStar(__nccwpck_require__(7835), exports); +tslib_1.__exportStar(__nccwpck_require__(1678), exports); +tslib_1.__exportStar(__nccwpck_require__(3818), exports); +tslib_1.__exportStar(__nccwpck_require__(1991), exports); +tslib_1.__exportStar(__nccwpck_require__(7035), exports); +tslib_1.__exportStar(__nccwpck_require__(9416), exports); +tslib_1.__exportStar(__nccwpck_require__(134), exports); +tslib_1.__exportStar(__nccwpck_require__(4465), exports); + + +/***/ }), + +/***/ 9910: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9931: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2620: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9546: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7835: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1678: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 3818: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1991: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7035: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 9416: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 134: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 4465: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 2992: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseUrl = void 0; +const querystring_parser_1 = __nccwpck_require__(4392); +const parseUrl = (url) => { + if (typeof url === "string") { + return (0, exports.parseUrl)(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, querystring_parser_1.parseQueryString)(search); + } + return { + hostname, + port: port ? parseInt(port) : undefined, + protocol, + path: pathname, + query, + }; +}; +exports.parseUrl = parseUrl; + + +/***/ }), + +/***/ 8588: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toBase64 = exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(6010); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +function fromBase64(input) { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); +} +exports.fromBase64 = fromBase64; +function toBase64(input) { + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +} +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 9190: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.calculateBodyLength = void 0; +const fs_1 = __nccwpck_require__(7147); +const calculateBodyLength = (body) => { + if (!body) { + return 0; + } + if (typeof body === "string") { + return Buffer.from(body).length; + } + else if (typeof body.byteLength === "number") { + return body.byteLength; + } + else if (typeof body.size === "number") { + return body.size; + } + else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, fs_1.lstatSync)(body.path).size; + } + else if (typeof body.fd === "number") { + return (0, fs_1.fstatSync)(body.fd).size; + } + throw new Error(`Body Length computation failed for ${body}`); +}; +exports.calculateBodyLength = calculateBodyLength; + + +/***/ }), + +/***/ 4147: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9190), exports); + + +/***/ }), + +/***/ 6010: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromString = exports.fromArrayBuffer = void 0; +const is_array_buffer_1 = __nccwpck_require__(9126); +const buffer_1 = __nccwpck_require__(4300); +const fromArrayBuffer = (input, offset = 0, length = input.byteLength - offset) => { + if (!(0, is_array_buffer_1.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return buffer_1.Buffer.from(input, offset, length); +}; +exports.fromArrayBuffer = fromArrayBuffer; +const fromString = (input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? buffer_1.Buffer.from(input, encoding) : buffer_1.Buffer.from(input); +}; +exports.fromString = fromString; + + +/***/ }), + +/***/ 9509: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.booleanSelector = exports.SelectorType = void 0; +var SelectorType; +(function (SelectorType) { + SelectorType["ENV"] = "env"; + SelectorType["CONFIG"] = "shared config entry"; +})(SelectorType = exports.SelectorType || (exports.SelectorType = {})); +const booleanSelector = (obj, key, type) => { + if (!(key in obj)) + return undefined; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); +}; +exports.booleanSelector = booleanSelector; + + +/***/ }), + +/***/ 6168: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9509), exports); + + +/***/ }), + +/***/ 6488: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.IMDS_REGION_PATH = exports.DEFAULTS_MODE_OPTIONS = exports.ENV_IMDS_DISABLED = exports.AWS_DEFAULT_REGION_ENV = exports.AWS_REGION_ENV = exports.AWS_EXECUTION_ENV = void 0; +exports.AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; +exports.AWS_REGION_ENV = "AWS_REGION"; +exports.AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; +exports.ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +exports.DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; +exports.IMDS_REGION_PATH = "/latest/meta-data/placement/region"; + + +/***/ }), + +/***/ 8450: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = void 0; +const AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; +const AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; +exports.NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy", +}; + + +/***/ }), + +/***/ 4243: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8238), exports); + + +/***/ }), + +/***/ 8238: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveDefaultsModeConfig = void 0; +const config_resolver_1 = __nccwpck_require__(6153); +const credential_provider_imds_1 = __nccwpck_require__(5898); +const node_config_provider_1 = __nccwpck_require__(7684); +const property_provider_1 = __nccwpck_require__(4462); +const constants_1 = __nccwpck_require__(6488); +const defaultsModeConfig_1 = __nccwpck_require__(8450); +const resolveDefaultsModeConfig = ({ region = (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS), defaultsMode = (0, node_config_provider_1.loadConfig)(defaultsModeConfig_1.NODE_DEFAULTS_MODE_CONFIG_OPTIONS), } = {}) => (0, property_provider_1.memoize)(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode === null || mode === void 0 ? void 0 : mode.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode === null || mode === void 0 ? void 0 : mode.toLocaleLowerCase()); + case undefined: + return Promise.resolve("legacy"); + default: + throw new Error(`Invalid parameter for "defaultsMode", expect ${constants_1.DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}`); + } +}); +exports.resolveDefaultsModeConfig = resolveDefaultsModeConfig; +const resolveNodeDefaultsModeAuto = async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; + } + if (resolvedRegion === inferredRegion) { + return "in-region"; + } + else { + return "cross-region"; + } + } + return "standard"; +}; +const inferPhysicalRegion = async () => { + var _a; + if (process.env[constants_1.AWS_EXECUTION_ENV] && (process.env[constants_1.AWS_REGION_ENV] || process.env[constants_1.AWS_DEFAULT_REGION_ENV])) { + return (_a = process.env[constants_1.AWS_REGION_ENV]) !== null && _a !== void 0 ? _a : process.env[constants_1.AWS_DEFAULT_REGION_ENV]; + } + if (!process.env[constants_1.ENV_IMDS_DISABLED]) { + try { + const endpoint = await (0, credential_provider_imds_1.getInstanceMetadataEndpoint)(); + return (await (0, credential_provider_imds_1.httpRequest)({ ...endpoint, path: constants_1.IMDS_REGION_PATH })).toString(); + } + catch (e) { + } + } +}; + + +/***/ }), + +/***/ 1809: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.debugId = void 0; +exports.debugId = "endpoints"; + + +/***/ }), + +/***/ 7617: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(1809), exports); +tslib_1.__exportStar(__nccwpck_require__(6833), exports); + + +/***/ }), + +/***/ 6833: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toDebugString = void 0; +function toDebugString(input) { + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); +} +exports.toDebugString = toDebugString; + + +/***/ }), + +/***/ 3350: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7482), exports); +tslib_1.__exportStar(__nccwpck_require__(6563), exports); +tslib_1.__exportStar(__nccwpck_require__(7433), exports); + + +/***/ }), + +/***/ 6835: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(8079), exports); +tslib_1.__exportStar(__nccwpck_require__(4711), exports); +tslib_1.__exportStar(__nccwpck_require__(7482), exports); + + +/***/ }), + +/***/ 8079: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isVirtualHostableS3Bucket = void 0; +const isIpAddress_1 = __nccwpck_require__(3442); +const isValidHostLabel_1 = __nccwpck_require__(7373); +const isVirtualHostableS3Bucket = (value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!(0, exports.isVirtualHostableS3Bucket)(label)) { + return false; + } + } + return true; + } + if (!(0, isValidHostLabel_1.isValidHostLabel)(value)) { + return false; + } + if (value.length < 3 || value.length > 63) { + return false; + } + if (value !== value.toLowerCase()) { + return false; + } + if ((0, isIpAddress_1.isIpAddress)(value)) { + return false; + } + return true; +}; +exports.isVirtualHostableS3Bucket = isVirtualHostableS3Bucket; + + +/***/ }), + +/***/ 4711: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseArn = void 0; +const parseArn = (value) => { + const segments = value.split(":"); + if (segments.length < 6) + return null; + const [arn, partition, service, region, accountId, ...resourceId] = segments; + if (arn !== "arn" || partition === "" || service === "" || resourceId[0] === "") + return null; + return { + partition, + service, + region, + accountId, + resourceId: resourceId[0].includes("/") ? resourceId[0].split("/") : resourceId, + }; +}; +exports.parseArn = parseArn; + + +/***/ }), + +/***/ 7482: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.partition = void 0; +const tslib_1 = __nccwpck_require__(4351); +const partitions_json_1 = tslib_1.__importDefault(__nccwpck_require__(5367)); +const { partitions } = partitions_json_1.default; +const DEFAULT_PARTITION = partitions.find((partition) => partition.id === "aws"); +const partition = (value) => { + for (const partition of partitions) { + const { regions, outputs } = partition; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData, + }; + } + } + } + for (const partition of partitions) { + const { regionRegex, outputs } = partition; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs, + }; + } + } + if (!DEFAULT_PARTITION) { + throw new Error("Provided region was not found in the partition array or regex," + + " and default partition with id 'aws' doesn't exist."); + } + return { + ...DEFAULT_PARTITION.outputs, + }; +}; +exports.partition = partition; + + +/***/ }), + +/***/ 5370: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.booleanEquals = void 0; +const booleanEquals = (value1, value2) => value1 === value2; +exports.booleanEquals = booleanEquals; + + +/***/ }), + +/***/ 767: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getAttr = void 0; +const types_1 = __nccwpck_require__(7433); +const getAttrPathList_1 = __nccwpck_require__(1844); +const getAttr = (value, path) => (0, getAttrPathList_1.getAttrPathList)(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new types_1.EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } + else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; +}, value); +exports.getAttr = getAttr; + + +/***/ }), + +/***/ 1844: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getAttrPathList = void 0; +const types_1 = __nccwpck_require__(7433); +const getAttrPathList = (path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new types_1.EndpointError(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new types_1.EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } + else { + pathList.push(part); + } + } + return pathList; +}; +exports.getAttrPathList = getAttrPathList; + + +/***/ }), + +/***/ 3188: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.aws = void 0; +const tslib_1 = __nccwpck_require__(4351); +exports.aws = tslib_1.__importStar(__nccwpck_require__(6835)); +tslib_1.__exportStar(__nccwpck_require__(5370), exports); +tslib_1.__exportStar(__nccwpck_require__(767), exports); +tslib_1.__exportStar(__nccwpck_require__(8816), exports); +tslib_1.__exportStar(__nccwpck_require__(7373), exports); +tslib_1.__exportStar(__nccwpck_require__(9692), exports); +tslib_1.__exportStar(__nccwpck_require__(2780), exports); +tslib_1.__exportStar(__nccwpck_require__(5182), exports); +tslib_1.__exportStar(__nccwpck_require__(8305), exports); +tslib_1.__exportStar(__nccwpck_require__(6535), exports); + + +/***/ }), + +/***/ 3442: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isIpAddress = void 0; +const IP_V4_REGEX = new RegExp(`^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$`); +const isIpAddress = (value) => IP_V4_REGEX.test(value) || (value.startsWith("[") && value.endsWith("]")); +exports.isIpAddress = isIpAddress; + + +/***/ }), + +/***/ 8816: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isSet = void 0; +const isSet = (value) => value != null; +exports.isSet = isSet; + + +/***/ }), + +/***/ 7373: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isValidHostLabel = void 0; +const VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); +const isValidHostLabel = (value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); + } + const labels = value.split("."); + for (const label of labels) { + if (!(0, exports.isValidHostLabel)(label)) { + return false; + } + } + return true; +}; +exports.isValidHostLabel = isValidHostLabel; + + +/***/ }), + +/***/ 9692: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.not = void 0; +const not = (value) => !value; +exports.not = not; + + +/***/ }), + +/***/ 2780: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.parseURL = void 0; +const types_1 = __nccwpck_require__(9029); +const isIpAddress_1 = __nccwpck_require__(3442); +const DEFAULT_PORTS = { + [types_1.EndpointURLScheme.HTTP]: 80, + [types_1.EndpointURLScheme.HTTPS]: 443, +}; +const parseURL = (value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname, port, protocol = "", path = "", query = {} } = value; + const url = new URL(`${protocol}//${hostname}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query) + .map(([k, v]) => `${k}=${v}`) + .join("&"); + return url; + } + return new URL(value); + } + catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; + } + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(types_1.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = (0, isIpAddress_1.isIpAddress)(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || + (typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`)); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp, + }; +}; +exports.parseURL = parseURL; + + +/***/ }), + +/***/ 5182: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.stringEquals = void 0; +const stringEquals = (value1, value2) => value1 === value2; +exports.stringEquals = stringEquals; + + +/***/ }), + +/***/ 8305: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.substring = void 0; +const substring = (input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); +}; +exports.substring = substring; + + +/***/ }), + +/***/ 6535: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.uriEncode = void 0; +const uriEncode = (value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`); +exports.uriEncode = uriEncode; + + +/***/ }), + +/***/ 6563: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveEndpoint = void 0; +const debug_1 = __nccwpck_require__(7617); +const types_1 = __nccwpck_require__(7433); +const utils_1 = __nccwpck_require__(1114); +const resolveEndpoint = (ruleSetObject, options) => { + var _a, _b, _c, _d, _e, _f; + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `Initial EndpointParams: ${(0, debug_1.toDebugString)(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters) + .filter(([, v]) => v.default != null) + .map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = (_c = endpointParams[paramKey]) !== null && _c !== void 0 ? _c : paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters) + .filter(([, v]) => v.required) + .map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new types_1.EndpointError(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint = (0, utils_1.evaluateRules)(rules, { endpointParams, logger, referenceRecord: {} }); + if ((_d = options.endpointParams) === null || _d === void 0 ? void 0 : _d.Endpoint) { + try { + const givenEndpoint = new URL(options.endpointParams.Endpoint); + const { protocol, port } = givenEndpoint; + endpoint.url.protocol = protocol; + endpoint.url.port = port; + } + catch (e) { + } + } + (_f = (_e = options.logger) === null || _e === void 0 ? void 0 : _e.debug) === null || _f === void 0 ? void 0 : _f.call(_e, debug_1.debugId, `Resolved endpoint: ${(0, debug_1.toDebugString)(endpoint)}`); + return endpoint; +}; +exports.resolveEndpoint = resolveEndpoint; + + +/***/ }), + +/***/ 3033: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.EndpointError = void 0; +class EndpointError extends Error { + constructor(message) { + super(message); + this.name = "EndpointError"; + } +} +exports.EndpointError = EndpointError; + + +/***/ }), + +/***/ 1261: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 312: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 6083: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 1767: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 7433: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(3033), exports); +tslib_1.__exportStar(__nccwpck_require__(1261), exports); +tslib_1.__exportStar(__nccwpck_require__(312), exports); +tslib_1.__exportStar(__nccwpck_require__(6083), exports); +tslib_1.__exportStar(__nccwpck_require__(1767), exports); +tslib_1.__exportStar(__nccwpck_require__(1811), exports); + + +/***/ }), + +/***/ 1811: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 5075: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.callFunction = void 0; +const tslib_1 = __nccwpck_require__(4351); +const lib = tslib_1.__importStar(__nccwpck_require__(3188)); +const evaluateExpression_1 = __nccwpck_require__(2980); +const callFunction = ({ fn, argv }, options) => { + const evaluatedArgs = argv.map((arg) => ["boolean", "number"].includes(typeof arg) ? arg : (0, evaluateExpression_1.evaluateExpression)(arg, "arg", options)); + return fn.split(".").reduce((acc, key) => acc[key], lib)(...evaluatedArgs); +}; +exports.callFunction = callFunction; + + +/***/ }), + +/***/ 7851: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateCondition = void 0; +const debug_1 = __nccwpck_require__(7617); +const types_1 = __nccwpck_require__(7433); +const callFunction_1 = __nccwpck_require__(5075); +const evaluateCondition = ({ assign, ...fnArgs }, options) => { + var _a, _b; + if (assign && assign in options.referenceRecord) { + throw new types_1.EndpointError(`'${assign}' is already defined in Reference Record.`); + } + const value = (0, callFunction_1.callFunction)(fnArgs, options); + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `evaluateCondition: ${(0, debug_1.toDebugString)(fnArgs)} = ${(0, debug_1.toDebugString)(value)}`); + return { + result: value === "" ? true : !!value, + ...(assign != null && { toAssign: { name: assign, value } }), + }; +}; +exports.evaluateCondition = evaluateCondition; + + +/***/ }), + +/***/ 9169: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateConditions = void 0; +const debug_1 = __nccwpck_require__(7617); +const evaluateCondition_1 = __nccwpck_require__(7851); +const evaluateConditions = (conditions = [], options) => { + var _a, _b; + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = (0, evaluateCondition_1.evaluateCondition)(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord, + }, + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `assign: ${toAssign.name} := ${(0, debug_1.toDebugString)(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; +}; +exports.evaluateConditions = evaluateConditions; + + +/***/ }), + +/***/ 5324: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateEndpointRule = void 0; +const debug_1 = __nccwpck_require__(7617); +const evaluateConditions_1 = __nccwpck_require__(9169); +const getEndpointHeaders_1 = __nccwpck_require__(8268); +const getEndpointProperties_1 = __nccwpck_require__(4973); +const getEndpointUrl_1 = __nccwpck_require__(3602); +const evaluateEndpointRule = (endpointRule, options) => { + var _a, _b; + const { conditions, endpoint } = endpointRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }; + const { url, properties, headers } = endpoint; + (_b = (_a = options.logger) === null || _a === void 0 ? void 0 : _a.debug) === null || _b === void 0 ? void 0 : _b.call(_a, debug_1.debugId, `Resolving endpoint from template: ${(0, debug_1.toDebugString)(endpoint)}`); + return { + ...(headers != undefined && { + headers: (0, getEndpointHeaders_1.getEndpointHeaders)(headers, endpointRuleOptions), + }), + ...(properties != undefined && { + properties: (0, getEndpointProperties_1.getEndpointProperties)(properties, endpointRuleOptions), + }), + url: (0, getEndpointUrl_1.getEndpointUrl)(url, endpointRuleOptions), + }; +}; +exports.evaluateEndpointRule = evaluateEndpointRule; + + +/***/ }), + +/***/ 2110: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateErrorRule = void 0; +const types_1 = __nccwpck_require__(7433); +const evaluateConditions_1 = __nccwpck_require__(9169); +const evaluateExpression_1 = __nccwpck_require__(2980); +const evaluateErrorRule = (errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; + } + throw new types_1.EndpointError((0, evaluateExpression_1.evaluateExpression)(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + })); +}; +exports.evaluateErrorRule = evaluateErrorRule; + + +/***/ }), + +/***/ 2980: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateExpression = void 0; +const types_1 = __nccwpck_require__(7433); +const callFunction_1 = __nccwpck_require__(5075); +const evaluateTemplate_1 = __nccwpck_require__(7535); +const getReferenceValue_1 = __nccwpck_require__(8810); +const evaluateExpression = (obj, keyName, options) => { + if (typeof obj === "string") { + return (0, evaluateTemplate_1.evaluateTemplate)(obj, options); + } + else if (obj["fn"]) { + return (0, callFunction_1.callFunction)(obj, options); + } + else if (obj["ref"]) { + return (0, getReferenceValue_1.getReferenceValue)(obj, options); + } + throw new types_1.EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); +}; +exports.evaluateExpression = evaluateExpression; + + +/***/ }), + +/***/ 9738: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateRules = void 0; +const types_1 = __nccwpck_require__(7433); +const evaluateEndpointRule_1 = __nccwpck_require__(5324); +const evaluateErrorRule_1 = __nccwpck_require__(2110); +const evaluateTreeRule_1 = __nccwpck_require__(6587); +const evaluateRules = (rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = (0, evaluateEndpointRule_1.evaluateEndpointRule)(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } + else if (rule.type === "error") { + (0, evaluateErrorRule_1.evaluateErrorRule)(rule, options); + } + else if (rule.type === "tree") { + const endpointOrUndefined = (0, evaluateTreeRule_1.evaluateTreeRule)(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } + else { + throw new types_1.EndpointError(`Unknown endpoint rule: ${rule}`); + } + } + throw new types_1.EndpointError(`Rules evaluation failed`); +}; +exports.evaluateRules = evaluateRules; + + +/***/ }), + +/***/ 7535: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateTemplate = void 0; +const lib_1 = __nccwpck_require__(3188); +const ATTR_SHORTHAND_REGEX = new RegExp("\\${([\\w]+)#([\\w]+)}", "g"); +const evaluateTemplate = (template, options) => { + const templateToEvaluate = template + .replace(new RegExp(`\{([^{}]+)\}`, "g"), "${$1}") + .replace(new RegExp(`\{\\$\{([^{}]+)\}\}`, "g"), "{$1}"); + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord, + }; + const attrShortHandList = templateToEvaluate.match(ATTR_SHORTHAND_REGEX) || []; + const attrShortHandMap = attrShortHandList.reduce((acc, attrShortHand) => { + const indexOfHash = attrShortHand.indexOf("#"); + const refName = attrShortHand.substring(2, indexOfHash); + const attrName = attrShortHand.substring(indexOfHash + 1, attrShortHand.length - 1); + acc[attrShortHand] = (0, lib_1.getAttr)(templateContext[refName], attrName); + return acc; + }, {}); + const templateWithAttr = Object.entries(attrShortHandMap).reduce((acc, [shortHand, value]) => acc.replace(shortHand, value), templateToEvaluate); + const templateContextNames = Object.keys(templateContext); + const templateContextValues = Object.values(templateContext); + const templateWithTildeEscaped = templateWithAttr.replace(/\`/g, "\\`"); + return new Function(...templateContextNames, `return \`${templateWithTildeEscaped}\``)(...templateContextValues); +}; +exports.evaluateTemplate = evaluateTemplate; + + +/***/ }), + +/***/ 6587: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.evaluateTreeRule = void 0; +const evaluateConditions_1 = __nccwpck_require__(9169); +const evaluateRules_1 = __nccwpck_require__(9738); +const evaluateTreeRule = (treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = (0, evaluateConditions_1.evaluateConditions)(conditions, options); + if (!result) { + return; + } + return (0, evaluateRules_1.evaluateRules)(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord }, + }); +}; +exports.evaluateTreeRule = evaluateTreeRule; + + +/***/ }), + +/***/ 8268: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointHeaders = void 0; +const types_1 = __nccwpck_require__(7433); +const evaluateExpression_1 = __nccwpck_require__(2980); +const getEndpointHeaders = (headers, options) => Object.entries(headers).reduce((acc, [headerKey, headerVal]) => ({ + ...acc, + [headerKey]: headerVal.map((headerValEntry) => { + const processedExpr = (0, evaluateExpression_1.evaluateExpression)(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new types_1.EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }), +}), {}); +exports.getEndpointHeaders = getEndpointHeaders; + + +/***/ }), + +/***/ 4973: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointProperties = void 0; +const getEndpointProperty_1 = __nccwpck_require__(2978); +const getEndpointProperties = (properties, options) => Object.entries(properties).reduce((acc, [propertyKey, propertyVal]) => ({ + ...acc, + [propertyKey]: (0, getEndpointProperty_1.getEndpointProperty)(propertyVal, options), +}), {}); +exports.getEndpointProperties = getEndpointProperties; + + +/***/ }), + +/***/ 2978: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointProperty = void 0; +const types_1 = __nccwpck_require__(7433); +const evaluateTemplate_1 = __nccwpck_require__(7535); +const getEndpointProperties_1 = __nccwpck_require__(4973); +const getEndpointProperty = (property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => (0, exports.getEndpointProperty)(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return (0, evaluateTemplate_1.evaluateTemplate)(property, options); + case "object": + if (property === null) { + throw new types_1.EndpointError(`Unexpected endpoint property: ${property}`); + } + return (0, getEndpointProperties_1.getEndpointProperties)(property, options); + case "boolean": + return property; + default: + throw new types_1.EndpointError(`Unexpected endpoint property type: ${typeof property}`); + } +}; +exports.getEndpointProperty = getEndpointProperty; + + +/***/ }), + +/***/ 3602: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointUrl = void 0; +const types_1 = __nccwpck_require__(7433); +const evaluateExpression_1 = __nccwpck_require__(2980); +const getEndpointUrl = (endpointUrl, options) => { + const expression = (0, evaluateExpression_1.evaluateExpression)(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } + catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; + } + } + throw new types_1.EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); +}; +exports.getEndpointUrl = getEndpointUrl; + + +/***/ }), + +/***/ 8810: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getReferenceValue = void 0; +const getReferenceValue = ({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, + ...options.referenceRecord, + }; + return referenceRecord[ref]; +}; +exports.getReferenceValue = getReferenceValue; + + +/***/ }), + +/***/ 1114: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(9738), exports); + + +/***/ }), + +/***/ 1968: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toHex = exports.fromHex = void 0; +const SHORT_TO_HEX = {}; +const HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); + } + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } + else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } + } + return out; +} +exports.fromHex = fromHex; +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; +} +exports.toHex = toHex; + + +/***/ }), + +/***/ 236: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(7776), exports); + + +/***/ }), + +/***/ 7776: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.normalizeProvider = void 0; +const normalizeProvider = (input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}; +exports.normalizeProvider = normalizeProvider; + + +/***/ }), + +/***/ 5774: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUriPath = void 0; +const escape_uri_1 = __nccwpck_require__(4652); +const escapeUriPath = (uri) => uri.split("/").map(escape_uri_1.escapeUri).join("/"); +exports.escapeUriPath = escapeUriPath; + + +/***/ }), + +/***/ 4652: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.escapeUri = void 0; +const escapeUri = (uri) => encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode); +exports.escapeUri = escapeUri; +const hexEncode = (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`; + + +/***/ }), + +/***/ 7952: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(4652), exports); +tslib_1.__exportStar(__nccwpck_require__(5774), exports); + + +/***/ }), + +/***/ 8095: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultUserAgent = exports.UA_APP_ID_INI_NAME = exports.UA_APP_ID_ENV_NAME = void 0; +const node_config_provider_1 = __nccwpck_require__(7684); +const os_1 = __nccwpck_require__(2037); +const process_1 = __nccwpck_require__(7282); +const is_crt_available_1 = __nccwpck_require__(8390); +exports.UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; +exports.UA_APP_ID_INI_NAME = "sdk-ua-app-id"; +const defaultUserAgent = ({ serviceId, clientVersion }) => { + const sections = [ + ["aws-sdk-js", clientVersion], + [`os/${(0, os_1.platform)()}`, (0, os_1.release)()], + ["lang/js"], + ["md/nodejs", `${process_1.versions.node}`], + ]; + const crtAvailable = (0, is_crt_available_1.isCrtAvailable)(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (process_1.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${process_1.env.AWS_EXECUTION_ENV}`]); + } + const appIdPromise = (0, node_config_provider_1.loadConfig)({ + environmentVariableSelector: (env) => env[exports.UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[exports.UA_APP_ID_INI_NAME], + default: undefined, + })(); + let resolvedUserAgent = undefined; + return async () => { + if (!resolvedUserAgent) { + const appId = await appIdPromise; + resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; + } + return resolvedUserAgent; + }; +}; +exports.defaultUserAgent = defaultUserAgent; + + +/***/ }), + +/***/ 8390: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isCrtAvailable = void 0; +const isCrtAvailable = () => { + try { + if ( true && __nccwpck_require__(7578)) { + return ["md/crt-avail"]; + } + return null; + } + catch (e) { + return null; + } +}; +exports.isCrtAvailable = isCrtAvailable; + + +/***/ }), + +/***/ 6278: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toUtf8 = exports.fromUtf8 = void 0; +const util_buffer_from_1 = __nccwpck_require__(6010); +const fromUtf8 = (input) => { + const buf = (0, util_buffer_from_1.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}; +exports.fromUtf8 = fromUtf8; +const toUtf8 = (input) => (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +exports.toUtf8 = toUtf8; + + +/***/ }), + +/***/ 2603: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + + +const validator = __nccwpck_require__(1739); +const XMLParser = __nccwpck_require__(2380); +const XMLBuilder = __nccwpck_require__(660); + +module.exports = { + XMLParser: XMLParser, + XMLValidator: validator, + XMLBuilder: XMLBuilder +} + +/***/ }), + +/***/ 8280: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +const nameStartChar = ':A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD'; +const nameChar = nameStartChar + '\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040'; +const nameRegexp = '[' + nameStartChar + '][' + nameChar + ']*' +const regexName = new RegExp('^' + nameRegexp + '$'); + +const getAllMatches = function(string, regex) { + const matches = []; + let match = regex.exec(string); + while (match) { + const allmatches = []; + allmatches.startIndex = regex.lastIndex - match[0].length; + const len = match.length; + for (let index = 0; index < len; index++) { + allmatches.push(match[index]); + } + matches.push(allmatches); + match = regex.exec(string); + } + return matches; +}; + +const isName = function(string) { + const match = regexName.exec(string); + return !(match === null || typeof match === 'undefined'); +}; + +exports.isExist = function(v) { + return typeof v !== 'undefined'; +}; + +exports.isEmptyObject = function(obj) { + return Object.keys(obj).length === 0; +}; + +/** + * Copy all the properties of a into b. + * @param {*} target + * @param {*} a + */ +exports.merge = function(target, a, arrayMode) { + if (a) { + const keys = Object.keys(a); // will return an array of own properties + const len = keys.length; //don't make it inline + for (let i = 0; i < len; i++) { + if (arrayMode === 'strict') { + target[keys[i]] = [ a[keys[i]] ]; + } else { + target[keys[i]] = a[keys[i]]; + } + } + } +}; +/* exports.merge =function (b,a){ + return Object.assign(b,a); +} */ + +exports.getValue = function(v) { + if (exports.isExist(v)) { + return v; + } else { + return ''; + } +}; + +// const fakeCall = function(a) {return a;}; +// const fakeCallNoReturn = function() {}; + +exports.isName = isName; +exports.getAllMatches = getAllMatches; +exports.nameRegexp = nameRegexp; + + +/***/ }), + +/***/ 1739: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +const util = __nccwpck_require__(8280); + +const defaultOptions = { + allowBooleanAttributes: false, //A tag can have attributes without any value + unpairedTags: [] +}; + +//const tagsPattern = new RegExp("<\\/?([\\w:\\-_\.]+)\\s*\/?>","g"); +exports.validate = function (xmlData, options) { + options = Object.assign({}, defaultOptions, options); + + //xmlData = xmlData.replace(/(\r\n|\n|\r)/gm,"");//make it single line + //xmlData = xmlData.replace(/(^\s*<\?xml.*?\?>)/g,"");//Remove XML starting tag + //xmlData = xmlData.replace(/()/g,"");//Remove DOCTYPE + const tags = []; + let tagFound = false; + + //indicates that the root tag has been closed (aka. depth 0 has been reached) + let reachedRoot = false; + + if (xmlData[0] === '\ufeff') { + // check for byte order mark (BOM) + xmlData = xmlData.substr(1); + } + + for (let i = 0; i < xmlData.length; i++) { + + if (xmlData[i] === '<' && xmlData[i+1] === '?') { + i+=2; + i = readPI(xmlData,i); + if (i.err) return i; + }else if (xmlData[i] === '<') { + //starting of tag + //read until you reach to '>' avoiding any '>' in attribute value + let tagStartPos = i; + i++; + + if (xmlData[i] === '!') { + i = readCommentAndCDATA(xmlData, i); + continue; + } else { + let closingTag = false; + if (xmlData[i] === '/') { + //closing tag + closingTag = true; + i++; + } + //read tagname + let tagName = ''; + for (; i < xmlData.length && + xmlData[i] !== '>' && + xmlData[i] !== ' ' && + xmlData[i] !== '\t' && + xmlData[i] !== '\n' && + xmlData[i] !== '\r'; i++ + ) { + tagName += xmlData[i]; + } + tagName = tagName.trim(); + //console.log(tagName); + + if (tagName[tagName.length - 1] === '/') { + //self closing tag without attributes + tagName = tagName.substring(0, tagName.length - 1); + //continue; + i--; + } + if (!validateTagName(tagName)) { + let msg; + if (tagName.trim().length === 0) { + msg = "Invalid space after '<'."; + } else { + msg = "Tag '"+tagName+"' is an invalid name."; + } + return getErrorObject('InvalidTag', msg, getLineNumberForPosition(xmlData, i)); + } + + const result = readAttributeStr(xmlData, i); + if (result === false) { + return getErrorObject('InvalidAttr', "Attributes for '"+tagName+"' have open quote.", getLineNumberForPosition(xmlData, i)); + } + let attrStr = result.value; + i = result.index; + + if (attrStr[attrStr.length - 1] === '/') { + //self closing tag + const attrStrStart = i - attrStr.length; + attrStr = attrStr.substring(0, attrStr.length - 1); + const isValid = validateAttributeString(attrStr, options); + if (isValid === true) { + tagFound = true; + //continue; //text may presents after self closing tag + } else { + //the result from the nested function returns the position of the error within the attribute + //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute + //this gives us the absolute index in the entire xml, which we can use to find the line at last + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); + } + } else if (closingTag) { + if (!result.tagClosed) { + return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); + } else if (attrStr.trim().length > 0) { + return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); + } else { + const otg = tags.pop(); + if (tagName !== otg.tagName) { + let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); + return getErrorObject('InvalidTag', + "Expected closing tag '"+otg.tagName+"' (opened in line "+openPos.line+", col "+openPos.col+") instead of closing tag '"+tagName+"'.", + getLineNumberForPosition(xmlData, tagStartPos)); + } + + //when there are no more tags, we reached the root level. + if (tags.length == 0) { + reachedRoot = true; + } + } + } else { + const isValid = validateAttributeString(attrStr, options); + if (isValid !== true) { + //the result from the nested function returns the position of the error within the attribute + //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute + //this gives us the absolute index in the entire xml, which we can use to find the line at last + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); + } + + //if the root level has been reached before ... + if (reachedRoot === true) { + return getErrorObject('InvalidXml', 'Multiple possible root nodes found.', getLineNumberForPosition(xmlData, i)); + } else if(options.unpairedTags.indexOf(tagName) !== -1){ + //don't push into stack + } else { + tags.push({tagName, tagStartPos}); + } + tagFound = true; + } + + //skip tag text value + //It may include comments and CDATA value + for (i++; i < xmlData.length; i++) { + if (xmlData[i] === '<') { + if (xmlData[i + 1] === '!') { + //comment or CADATA + i++; + i = readCommentAndCDATA(xmlData, i); + continue; + } else if (xmlData[i+1] === '?') { + i = readPI(xmlData, ++i); + if (i.err) return i; + } else{ + break; + } + } else if (xmlData[i] === '&') { + const afterAmp = validateAmpersand(xmlData, i); + if (afterAmp == -1) + return getErrorObject('InvalidChar', "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); + i = afterAmp; + }else{ + if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { + return getErrorObject('InvalidXml', "Extra text at the end", getLineNumberForPosition(xmlData, i)); + } + } + } //end of reading tag text value + if (xmlData[i] === '<') { + i--; + } + } + } else { + if ( isWhiteSpace(xmlData[i])) { + continue; + } + return getErrorObject('InvalidChar', "char '"+xmlData[i]+"' is not expected.", getLineNumberForPosition(xmlData, i)); + } + } + + if (!tagFound) { + return getErrorObject('InvalidXml', 'Start tag expected.', 1); + }else if (tags.length == 1) { + return getErrorObject('InvalidTag', "Unclosed tag '"+tags[0].tagName+"'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); + }else if (tags.length > 0) { + return getErrorObject('InvalidXml', "Invalid '"+ + JSON.stringify(tags.map(t => t.tagName), null, 4).replace(/\r?\n/g, '')+ + "' found.", {line: 1, col: 1}); + } + + return true; +}; + +function isWhiteSpace(char){ + return char === ' ' || char === '\t' || char === '\n' || char === '\r'; +} +/** + * Read Processing insstructions and skip + * @param {*} xmlData + * @param {*} i + */ +function readPI(xmlData, i) { + const start = i; + for (; i < xmlData.length; i++) { + if (xmlData[i] == '?' || xmlData[i] == ' ') { + //tagname + const tagname = xmlData.substr(start, i - start); + if (i > 5 && tagname === 'xml') { + return getErrorObject('InvalidXml', 'XML declaration allowed only at the start of the document.', getLineNumberForPosition(xmlData, i)); + } else if (xmlData[i] == '?' && xmlData[i + 1] == '>') { + //check if valid attribut string + i++; + break; + } else { + continue; + } + } + } + return i; +} + +function readCommentAndCDATA(xmlData, i) { + if (xmlData.length > i + 5 && xmlData[i + 1] === '-' && xmlData[i + 2] === '-') { + //comment + for (i += 3; i < xmlData.length; i++) { + if (xmlData[i] === '-' && xmlData[i + 1] === '-' && xmlData[i + 2] === '>') { + i += 2; + break; + } + } + } else if ( + xmlData.length > i + 8 && + xmlData[i + 1] === 'D' && + xmlData[i + 2] === 'O' && + xmlData[i + 3] === 'C' && + xmlData[i + 4] === 'T' && + xmlData[i + 5] === 'Y' && + xmlData[i + 6] === 'P' && + xmlData[i + 7] === 'E' + ) { + let angleBracketsCount = 1; + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === '<') { + angleBracketsCount++; + } else if (xmlData[i] === '>') { + angleBracketsCount--; + if (angleBracketsCount === 0) { + break; + } + } + } + } else if ( + xmlData.length > i + 9 && + xmlData[i + 1] === '[' && + xmlData[i + 2] === 'C' && + xmlData[i + 3] === 'D' && + xmlData[i + 4] === 'A' && + xmlData[i + 5] === 'T' && + xmlData[i + 6] === 'A' && + xmlData[i + 7] === '[' + ) { + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === ']' && xmlData[i + 1] === ']' && xmlData[i + 2] === '>') { + i += 2; + break; + } + } + } + + return i; +} + +const doubleQuote = '"'; +const singleQuote = "'"; + +/** + * Keep reading xmlData until '<' is found outside the attribute value. + * @param {string} xmlData + * @param {number} i + */ +function readAttributeStr(xmlData, i) { + let attrStr = ''; + let startChar = ''; + let tagClosed = false; + for (; i < xmlData.length; i++) { + if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { + if (startChar === '') { + startChar = xmlData[i]; + } else if (startChar !== xmlData[i]) { + //if vaue is enclosed with double quote then single quotes are allowed inside the value and vice versa + } else { + startChar = ''; + } + } else if (xmlData[i] === '>') { + if (startChar === '') { + tagClosed = true; + break; + } + } + attrStr += xmlData[i]; + } + if (startChar !== '') { + return false; + } + + return { + value: attrStr, + index: i, + tagClosed: tagClosed + }; +} + +/** + * Select all the attributes whether valid or invalid. + */ +const validAttrStrRegxp = new RegExp('(\\s*)([^\\s=]+)(\\s*=)?(\\s*([\'"])(([\\s\\S])*?)\\5)?', 'g'); + +//attr, ="sd", a="amit's", a="sd"b="saf", ab cd="" + +function validateAttributeString(attrStr, options) { + //console.log("start:"+attrStr+":end"); + + //if(attrStr.trim().length === 0) return true; //empty string + + const matches = util.getAllMatches(attrStr, validAttrStrRegxp); + const attrNames = {}; + + for (let i = 0; i < matches.length; i++) { + if (matches[i][1].length === 0) { + //nospace before attribute name: a="sd"b="saf" + return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' has no space in starting.", getPositionFromMatch(matches[i])) + } else if (matches[i][3] !== undefined && matches[i][4] === undefined) { + return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' is without value.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] === undefined && !options.allowBooleanAttributes) { + //independent attribute: ab + return getErrorObject('InvalidAttr', "boolean attribute '"+matches[i][2]+"' is not allowed.", getPositionFromMatch(matches[i])); + } + /* else if(matches[i][6] === undefined){//attribute without value: ab= + return { err: { code:"InvalidAttr",msg:"attribute " + matches[i][2] + " has no value assigned."}}; + } */ + const attrName = matches[i][2]; + if (!validateAttrName(attrName)) { + return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is an invalid name.", getPositionFromMatch(matches[i])); + } + if (!attrNames.hasOwnProperty(attrName)) { + //check for duplicate attribute. + attrNames[attrName] = 1; + } else { + return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is repeated.", getPositionFromMatch(matches[i])); + } + } + + return true; +} + +function validateNumberAmpersand(xmlData, i) { + let re = /\d/; + if (xmlData[i] === 'x') { + i++; + re = /[\da-fA-F]/; + } + for (; i < xmlData.length; i++) { + if (xmlData[i] === ';') + return i; + if (!xmlData[i].match(re)) + break; + } + return -1; +} + +function validateAmpersand(xmlData, i) { + // https://www.w3.org/TR/xml/#dt-charref + i++; + if (xmlData[i] === ';') + return -1; + if (xmlData[i] === '#') { + i++; + return validateNumberAmpersand(xmlData, i); + } + let count = 0; + for (; i < xmlData.length; i++, count++) { + if (xmlData[i].match(/\w/) && count < 20) + continue; + if (xmlData[i] === ';') + break; + return -1; + } + return i; +} + +function getErrorObject(code, message, lineNumber) { + return { + err: { + code: code, + msg: message, + line: lineNumber.line || lineNumber, + col: lineNumber.col, + }, + }; +} + +function validateAttrName(attrName) { + return util.isName(attrName); +} + +// const startsWithXML = /^xml/i; + +function validateTagName(tagname) { + return util.isName(tagname) /* && !tagname.match(startsWithXML) */; +} + +//this function returns the line number for the character at the given index +function getLineNumberForPosition(xmlData, index) { + const lines = xmlData.substring(0, index).split(/\r?\n/); + return { + line: lines.length, + + // column number is last line's length + 1, because column numbering starts at 1: + col: lines[lines.length - 1].length + 1 + }; +} + +//this function returns the position of the first character of match within attrStr +function getPositionFromMatch(match) { + return match.startIndex + match[1].length; +} + + +/***/ }), + +/***/ 660: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +//parse Empty Node as self closing node +const buildFromOrderedJs = __nccwpck_require__(2462); + +const defaultOptions = { + attributeNamePrefix: '@_', + attributesGroupName: false, + textNodeName: '#text', + ignoreAttributes: true, + cdataPropName: false, + format: false, + indentBy: ' ', + suppressEmptyNode: false, + suppressUnpairedNode: true, + suppressBooleanAttributes: true, + tagValueProcessor: function(key, a) { + return a; + }, + attributeValueProcessor: function(attrName, a) { + return a; + }, + preserveOrder: false, + commentPropName: false, + unpairedTags: [], + entities: [ + { regex: new RegExp("&", "g"), val: "&" },//it must be on top + { regex: new RegExp(">", "g"), val: ">" }, + { regex: new RegExp("<", "g"), val: "<" }, + { regex: new RegExp("\'", "g"), val: "'" }, + { regex: new RegExp("\"", "g"), val: """ } + ], + processEntities: true, + stopNodes: [], + transformTagName: false, +}; + +function Builder(options) { + this.options = Object.assign({}, defaultOptions, options); + if (this.options.ignoreAttributes || this.options.attributesGroupName) { + this.isAttribute = function(/*a*/) { + return false; + }; + } else { + this.attrPrefixLen = this.options.attributeNamePrefix.length; + this.isAttribute = isAttribute; + } + + this.processTextOrObjNode = processTextOrObjNode + + if (this.options.format) { + this.indentate = indentate; + this.tagEndChar = '>\n'; + this.newLine = '\n'; + } else { + this.indentate = function() { + return ''; + }; + this.tagEndChar = '>'; + this.newLine = ''; + } + + if (this.options.suppressEmptyNode) { + this.buildTextNode = buildEmptyTextNode; + this.buildObjNode = buildEmptyObjNode; + } else { + this.buildTextNode = buildTextValNode; + this.buildObjNode = buildObjectNode; + } + + this.buildTextValNode = buildTextValNode; + this.buildObjectNode = buildObjectNode; + + this.replaceEntitiesValue = replaceEntitiesValue; + this.buildAttrPairStr = buildAttrPairStr; +} + +Builder.prototype.build = function(jObj) { + if(this.options.preserveOrder){ + return buildFromOrderedJs(jObj, this.options); + }else { + if(Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1){ + jObj = { + [this.options.arrayNodeName] : jObj + } + } + return this.j2x(jObj, 0).val; + } +}; + +Builder.prototype.j2x = function(jObj, level) { + let attrStr = ''; + let val = ''; + for (let key in jObj) { + if (typeof jObj[key] === 'undefined') { + // supress undefined node + } else if (jObj[key] === null) { + if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; + else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + } else if (jObj[key] instanceof Date) { + val += this.buildTextNode(jObj[key], key, '', level); + } else if (typeof jObj[key] !== 'object') { + //premitive type + const attr = this.isAttribute(key); + if (attr) { + attrStr += this.buildAttrPairStr(attr, '' + jObj[key]); + }else { + //tag value + if (key === this.options.textNodeName) { + let newval = this.options.tagValueProcessor(key, '' + jObj[key]); + val += this.replaceEntitiesValue(newval); + } else { + val += this.buildTextNode(jObj[key], key, '', level); + } + } + } else if (Array.isArray(jObj[key])) { + //repeated nodes + const arrLen = jObj[key].length; + for (let j = 0; j < arrLen; j++) { + const item = jObj[key][j]; + if (typeof item === 'undefined') { + // supress undefined node + } else if (item === null) { + if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; + else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + } else if (typeof item === 'object') { + val += this.processTextOrObjNode(item, key, level) + } else { + val += this.buildTextNode(item, key, '', level); + } + } + } else { + //nested node + if (this.options.attributesGroupName && key === this.options.attributesGroupName) { + const Ks = Object.keys(jObj[key]); + const L = Ks.length; + for (let j = 0; j < L; j++) { + attrStr += this.buildAttrPairStr(Ks[j], '' + jObj[key][Ks[j]]); + } + } else { + val += this.processTextOrObjNode(jObj[key], key, level) + } + } + } + return {attrStr: attrStr, val: val}; +}; + +function buildAttrPairStr(attrName, val){ + val = this.options.attributeValueProcessor(attrName, '' + val); + val = this.replaceEntitiesValue(val); + if (this.options.suppressBooleanAttributes && val === "true") { + return ' ' + attrName; + } else return ' ' + attrName + '="' + val + '"'; +} + +function processTextOrObjNode (object, key, level) { + const result = this.j2x(object, level + 1); + if (object[this.options.textNodeName] !== undefined && Object.keys(object).length === 1) { + return this.buildTextNode(object[this.options.textNodeName], key, result.attrStr, level); + } else { + return this.buildObjNode(result.val, key, result.attrStr, level); + } +} + +function buildObjectNode(val, key, attrStr, level) { + let tagEndExp = '' + val + tagEndExp ); + } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { + return this.indentate(level) + `` + this.newLine; + }else { + return ( + this.indentate(level) + '<' + key + attrStr + piClosingChar + this.tagEndChar + + val + + this.indentate(level) + tagEndExp ); + } +} + +function buildEmptyObjNode(val, key, attrStr, level) { + if (val !== '') { + return this.buildObjectNode(val, key, attrStr, level); + } else { + if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; + else return this.indentate(level) + '<' + key + attrStr + '/' + this.tagEndChar; + } +} + +function buildTextValNode(val, key, attrStr, level) { + if (this.options.cdataPropName !== false && key === this.options.cdataPropName) { + return this.indentate(level) + `` + this.newLine; + }else if (this.options.commentPropName !== false && key === this.options.commentPropName) { + return this.indentate(level) + `` + this.newLine; + }else{ + let textValue = this.options.tagValueProcessor(key, val); + textValue = this.replaceEntitiesValue(textValue); + + if( textValue === '' && this.options.unpairedTags.indexOf(key) !== -1){ //unpaired + if(this.options.suppressUnpairedNode){ + return this.indentate(level) + '<' + key + this.tagEndChar; + }else{ + return this.indentate(level) + '<' + key + "/" + this.tagEndChar; + } + } else{ + return ( + this.indentate(level) + '<' + key + attrStr + '>' + + textValue + + ' 0 && this.options.processEntities){ + for (let i=0; i { + +const EOL = "\n"; + +/** + * + * @param {array} jArray + * @param {any} options + * @returns + */ +function toXml(jArray, options){ + return arrToStr( jArray, options, "", 0); +} + +function arrToStr(arr, options, jPath, level){ + let xmlStr = ""; + + let indentation = ""; + if(options.format && options.indentBy.length > 0){//TODO: this logic can be avoided for each call + indentation = EOL + "" + options.indentBy.repeat(level); + } + + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const tagName = propName(tagObj); + let newJPath = ""; + if(jPath.length === 0) newJPath = tagName + else newJPath = `${jPath}.${tagName}`; + + if(tagName === options.textNodeName){ + let tagText = tagObj[tagName]; + if(!isStopNode(newJPath, options)){ + tagText = options.tagValueProcessor( tagName, tagText); + tagText = replaceEntitiesValue(tagText, options); + } + xmlStr += indentation + tagText; + continue; + }else if( tagName === options.cdataPropName){ + xmlStr += indentation + ``; + continue; + }else if( tagName === options.commentPropName){ + xmlStr += indentation + ``; + continue; + }else if( tagName[0] === "?"){ + const attStr = attr_to_str(tagObj[":@"], options); + const tempInd = tagName === "?xml" ? "" : indentation; + let piTextNodeName = tagObj[tagName][0][options.textNodeName]; + piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; //remove extra spacing + xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr}?>`; + continue; + } + const attStr = attr_to_str(tagObj[":@"], options); + let tagStart = indentation + `<${tagName}${attStr}`; + let tagValue = arrToStr(tagObj[tagName], options, newJPath, level + 1); + if(options.unpairedTags.indexOf(tagName) !== -1){ + if(options.suppressUnpairedNode) xmlStr += tagStart + ">"; + else xmlStr += tagStart + "/>"; + }else if( (!tagValue || tagValue.length === 0) && options.suppressEmptyNode){ + xmlStr += tagStart + "/>"; + }else{ + //TODO: node with only text value should not parse the text value in next line + xmlStr += tagStart + `>${tagValue}${indentation}` ; + } + } + + return xmlStr; +} + +function propName(obj){ + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if(key !== ":@") return key; + } + } + +function attr_to_str(attrMap, options){ + let attrStr = ""; + if(attrMap && !options.ignoreAttributes){ + for (let attr in attrMap){ + let attrVal = options.attributeValueProcessor(attr, attrMap[attr]); + attrVal = replaceEntitiesValue(attrVal, options); + if(attrVal === true && options.suppressBooleanAttributes){ + attrStr+= ` ${attr.substr(options.attributeNamePrefix.length)}`; + }else{ + attrStr+= ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`; + } + } + } + return attrStr; +} + +function isStopNode(jPath, options){ + jPath = jPath.substr(0,jPath.length - options.textNodeName.length - 1); + let tagName = jPath.substr(jPath.lastIndexOf(".") + 1); + for(let index in options.stopNodes){ + if(options.stopNodes[index] === jPath || options.stopNodes[index] === "*."+tagName) return true; + } + return false; +} + +function replaceEntitiesValue(textValue, options){ + if(textValue && textValue.length > 0 && options.processEntities){ + for (let i=0; i< options.entities.length; i++) { + const entity = options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); + } + } + return textValue; + } +module.exports = toXml; + +/***/ }), + +/***/ 6072: +/***/ ((module) => { + +//TODO: handle comments +function readDocType(xmlData, i){ + + const entities = {}; + if( xmlData[i + 3] === 'O' && + xmlData[i + 4] === 'C' && + xmlData[i + 5] === 'T' && + xmlData[i + 6] === 'Y' && + xmlData[i + 7] === 'P' && + xmlData[i + 8] === 'E') + { + i = i+9; + let angleBracketsCount = 1; + let hasBody = false, entity = false, comment = false; + let exp = ""; + for(;i') { + if(comment){ + if( xmlData[i - 1] === "-" && xmlData[i - 2] === "-"){ + comment = false; + }else{ + throw new Error(`Invalid XML comment in DOCTYPE`); + } + }else if(entity){ + parseEntityExp(exp, entities); + entity = false; + } + angleBracketsCount--; + if (angleBracketsCount === 0) { + break; + } + }else if( xmlData[i] === '['){ + hasBody = true; + }else{ + exp += xmlData[i]; + } + } + if(angleBracketsCount !== 0){ + throw new Error(`Unclosed DOCTYPE`); + } + }else{ + throw new Error(`Invalid Tag instead of DOCTYPE`); + } + return {entities, i}; +} + +const entityRegex = RegExp("^\\s([a-zA-z0-0]+)[ \t](['\"])([^&]+)\\2"); +function parseEntityExp(exp, entities){ + const match = entityRegex.exec(exp); + if(match){ + entities[ match[1] ] = { + regx : RegExp( `&${match[1]};`,"g"), + val: match[3] + }; + } +} +module.exports = readDocType; + +/***/ }), + +/***/ 6993: +/***/ ((__unused_webpack_module, exports) => { + + +const defaultOptions = { + preserveOrder: false, + attributeNamePrefix: '@_', + attributesGroupName: false, + textNodeName: '#text', + ignoreAttributes: true, + removeNSPrefix: false, // remove NS from tag name or attribute name if true + allowBooleanAttributes: false, //a tag can have attributes without any value + //ignoreRootElement : false, + parseTagValue: true, + parseAttributeValue: false, + trimValues: true, //Trim string values of tag and attributes + cdataPropName: false, + numberParseOptions: { + hex: true, + leadingZeros: true + }, + tagValueProcessor: function(tagName, val) { + return val; + }, + attributeValueProcessor: function(attrName, val) { + return val; + }, + stopNodes: [], //nested tags will not be parsed even for errors + alwaysCreateTextNode: false, + isArray: () => false, + commentPropName: false, + unpairedTags: [], + processEntities: true, + htmlEntities: false, + ignoreDeclaration: false, + ignorePiTags: false, + transformTagName: false, +}; + +const buildOptions = function(options) { + return Object.assign({}, defaultOptions, options); +}; + +exports.buildOptions = buildOptions; +exports.defaultOptions = defaultOptions; + +/***/ }), + +/***/ 5832: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +///@ts-check + +const util = __nccwpck_require__(8280); +const xmlNode = __nccwpck_require__(7462); +const readDocType = __nccwpck_require__(6072); +const toNumber = __nccwpck_require__(4526); + +const regx = + '<((!\\[CDATA\\[([\\s\\S]*?)(]]>))|((NAME:)?(NAME))([^>]*)>|((\\/)(NAME)\\s*>))([^<]*)' + .replace(/NAME/g, util.nameRegexp); + +//const tagsRegx = new RegExp("<(\\/?[\\w:\\-\._]+)([^>]*)>(\\s*"+cdataRegx+")*([^<]+)?","g"); +//const tagsRegx = new RegExp("<(\\/?)((\\w*:)?([\\w:\\-\._]+))([^>]*)>([^<]*)("+cdataRegx+"([^<]*))*([^<]+)?","g"); + +class OrderedObjParser{ + constructor(options){ + this.options = options; + this.currentNode = null; + this.tagsNodeStack = []; + this.docTypeEntities = {}; + this.lastEntities = { + "apos" : { regex: /&(apos|#39|#x27);/g, val : "'"}, + "gt" : { regex: /&(gt|#62|#x3E);/g, val : ">"}, + "lt" : { regex: /&(lt|#60|#x3C);/g, val : "<"}, + "quot" : { regex: /&(quot|#34|#x22);/g, val : "\""}, + }; + this.ampEntity = { regex: /&(amp|#38|#x26);/g, val : "&"}; + this.htmlEntities = { + "space": { regex: /&(nbsp|#160);/g, val: " " }, + // "lt" : { regex: /&(lt|#60);/g, val: "<" }, + // "gt" : { regex: /&(gt|#62);/g, val: ">" }, + // "amp" : { regex: /&(amp|#38);/g, val: "&" }, + // "quot" : { regex: /&(quot|#34);/g, val: "\"" }, + // "apos" : { regex: /&(apos|#39);/g, val: "'" }, + "cent" : { regex: /&(cent|#162);/g, val: "¢" }, + "pound" : { regex: /&(pound|#163);/g, val: "£" }, + "yen" : { regex: /&(yen|#165);/g, val: "¥" }, + "euro" : { regex: /&(euro|#8364);/g, val: "€" }, + "copyright" : { regex: /&(copy|#169);/g, val: "©" }, + "reg" : { regex: /&(reg|#174);/g, val: "®" }, + "inr" : { regex: /&(inr|#8377);/g, val: "₹" }, + }; + this.addExternalEntities = addExternalEntities; + this.parseXml = parseXml; + this.parseTextData = parseTextData; + this.resolveNameSpace = resolveNameSpace; + this.buildAttributesMap = buildAttributesMap; + this.isItStopNode = isItStopNode; + this.replaceEntitiesValue = replaceEntitiesValue; + this.readStopNodeData = readStopNodeData; + this.saveTextToParentTag = saveTextToParentTag; + } + +} + +function addExternalEntities(externalEntities){ + const entKeys = Object.keys(externalEntities); + for (let i = 0; i < entKeys.length; i++) { + const ent = entKeys[i]; + this.lastEntities[ent] = { + regex: new RegExp("&"+ent+";","g"), + val : externalEntities[ent] + } + } +} + +/** + * @param {string} val + * @param {string} tagName + * @param {string} jPath + * @param {boolean} dontTrim + * @param {boolean} hasAttributes + * @param {boolean} isLeafNode + * @param {boolean} escapeEntities + */ +function parseTextData(val, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) { + if (val !== undefined) { + if (this.options.trimValues && !dontTrim) { + val = val.trim(); + } + if(val.length > 0){ + if(!escapeEntities) val = this.replaceEntitiesValue(val); + + const newval = this.options.tagValueProcessor(tagName, val, jPath, hasAttributes, isLeafNode); + if(newval === null || newval === undefined){ + //don't parse + return val; + }else if(typeof newval !== typeof val || newval !== val){ + //overwrite + return newval; + }else if(this.options.trimValues){ + return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions); + }else{ + const trimmedVal = val.trim(); + if(trimmedVal === val){ + return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions); + }else{ + return val; + } + } + } + } +} + +function resolveNameSpace(tagname) { + if (this.options.removeNSPrefix) { + const tags = tagname.split(':'); + const prefix = tagname.charAt(0) === '/' ? '/' : ''; + if (tags[0] === 'xmlns') { + return ''; + } + if (tags.length === 2) { + tagname = prefix + tags[1]; + } + } + return tagname; +} + +//TODO: change regex to capture NS +//const attrsRegx = new RegExp("([\\w\\-\\.\\:]+)\\s*=\\s*(['\"])((.|\n)*?)\\2","gm"); +const attrsRegx = new RegExp('([^\\s=]+)\\s*(=\\s*([\'"])([\\s\\S]*?)\\3)?', 'gm'); + +function buildAttributesMap(attrStr, jPath) { + if (!this.options.ignoreAttributes && typeof attrStr === 'string') { + // attrStr = attrStr.replace(/\r?\n/g, ' '); + //attrStr = attrStr || attrStr.trim(); + + const matches = util.getAllMatches(attrStr, attrsRegx); + const len = matches.length; //don't make it inline + const attrs = {}; + for (let i = 0; i < len; i++) { + const attrName = this.resolveNameSpace(matches[i][1]); + let oldVal = matches[i][4]; + const aName = this.options.attributeNamePrefix + attrName; + if (attrName.length) { + if (oldVal !== undefined) { + if (this.options.trimValues) { + oldVal = oldVal.trim(); + } + oldVal = this.replaceEntitiesValue(oldVal); + const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath); + if(newVal === null || newVal === undefined){ + //don't parse + attrs[aName] = oldVal; + }else if(typeof newVal !== typeof oldVal || newVal !== oldVal){ + //overwrite + attrs[aName] = newVal; + }else{ + //parse + attrs[aName] = parseValue( + oldVal, + this.options.parseAttributeValue, + this.options.numberParseOptions + ); + } + } else if (this.options.allowBooleanAttributes) { + attrs[aName] = true; + } + } + } + if (!Object.keys(attrs).length) { + return; + } + if (this.options.attributesGroupName) { + const attrCollection = {}; + attrCollection[this.options.attributesGroupName] = attrs; + return attrCollection; + } + return attrs; + } +} + +const parseXml = function(xmlData) { + xmlData = xmlData.replace(/\r\n?/g, "\n"); //TODO: remove this line + const xmlObj = new xmlNode('!xml'); + let currentNode = xmlObj; + let textData = ""; + let jPath = ""; + for(let i=0; i< xmlData.length; i++){//for each char in XML data + const ch = xmlData[i]; + if(ch === '<'){ + // const nextIndex = i+1; + // const _2ndChar = xmlData[nextIndex]; + if( xmlData[i+1] === '/') {//Closing Tag + const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed.") + let tagName = xmlData.substring(i+2,closeIndex).trim(); + + if(this.options.removeNSPrefix){ + const colonIndex = tagName.indexOf(":"); + if(colonIndex !== -1){ + tagName = tagName.substr(colonIndex+1); + } + } + + if(this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + + if(currentNode){ + textData = this.saveTextToParentTag(textData, currentNode, jPath); + } + + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + + currentNode = this.tagsNodeStack.pop();//avoid recurssion, set the parent tag scope + textData = ""; + i = closeIndex; + } else if( xmlData[i+1] === '?') { + + let tagData = readTagExp(xmlData,i, false, "?>"); + if(!tagData) throw new Error("Pi Tag is not closed."); + + textData = this.saveTextToParentTag(textData, currentNode, jPath); + if( (this.options.ignoreDeclaration && tagData.tagName === "?xml") || this.options.ignorePiTags){ + + }else{ + + const childNode = new xmlNode(tagData.tagName); + childNode.add(this.options.textNodeName, ""); + + if(tagData.tagName !== tagData.tagExp && tagData.attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath); + } + currentNode.addChild(childNode); + + } + + + i = tagData.closeIndex + 1; + } else if(xmlData.substr(i + 1, 3) === '!--') { + const endIndex = findClosingIndex(xmlData, "-->", i+4, "Comment is not closed.") + if(this.options.commentPropName){ + const comment = xmlData.substring(i + 4, endIndex - 2); + + textData = this.saveTextToParentTag(textData, currentNode, jPath); + + currentNode.add(this.options.commentPropName, [ { [this.options.textNodeName] : comment } ]); + } + i = endIndex; + } else if( xmlData.substr(i + 1, 2) === '!D') { + const result = readDocType(xmlData, i); + this.docTypeEntities = result.entities; + i = result.i; + }else if(xmlData.substr(i + 1, 2) === '![') { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2; + const tagExp = xmlData.substring(i + 9,closeIndex); + + textData = this.saveTextToParentTag(textData, currentNode, jPath); + + //cdata should be set even if it is 0 length string + if(this.options.cdataPropName){ + // let val = this.parseTextData(tagExp, this.options.cdataPropName, jPath + "." + this.options.cdataPropName, true, false, true); + // if(!val) val = ""; + currentNode.add(this.options.cdataPropName, [ { [this.options.textNodeName] : tagExp } ]); + }else{ + let val = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true); + if(val == undefined) val = ""; + currentNode.add(this.options.textNodeName, val); + } + + i = closeIndex + 2; + }else {//Opening tag + let result = readTagExp(xmlData,i, this. options.removeNSPrefix); + let tagName= result.tagName; + let tagExp = result.tagExp; + let attrExpPresent = result.attrExpPresent; + let closeIndex = result.closeIndex; + + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + + //save text as child node + if (currentNode && textData) { + if(currentNode.tagname !== '!xml'){ + //when nested tag is found + textData = this.saveTextToParentTag(textData, currentNode, jPath, false); + } + } + + if(tagName !== xmlObj.tagname){ + jPath += jPath ? "." + tagName : tagName; + } + + //check if last tag was unpaired tag + const lastTag = currentNode; + if(lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1 ){ + currentNode = this.tagsNodeStack.pop(); + } + + if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { //TODO: namespace + let tagContent = ""; + //self-closing tag + if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){ + i = result.closeIndex; + } + //boolean tag + else if(this.options.unpairedTags.indexOf(tagName) !== -1){ + i = result.closeIndex; + } + //normal tag + else{ + //read until closing tag is found + const result = this.readStopNodeData(xmlData, tagName, closeIndex + 1); + if(!result) throw new Error(`Unexpected end of ${tagName}`); + i = result.i; + tagContent = result.tagContent; + } + + const childNode = new xmlNode(tagName); + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath); + } + if(tagContent) { + tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true); + } + + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + childNode.add(this.options.textNodeName, tagContent); + + currentNode.addChild(childNode); + }else{ + //selfClosing tag + if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){ + if(tagName[tagName.length - 1] === "/"){ //remove trailing '/' + tagName = tagName.substr(0, tagName.length - 1); + tagExp = tagName; + }else{ + tagExp = tagExp.substr(0, tagExp.length - 1); + } + + if(this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + + const childNode = new xmlNode(tagName); + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath); + } + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + currentNode.addChild(childNode); + } + //opening tag + else{ + const childNode = new xmlNode( tagName); + this.tagsNodeStack.push(currentNode); + + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath); + } + currentNode.addChild(childNode); + currentNode = childNode; + } + textData = ""; + i = closeIndex; + } + } + }else{ + textData += xmlData[i]; + } + } + return xmlObj.child; +} + +const replaceEntitiesValue = function(val){ + + if(this.options.processEntities){ + for(let entityName in this.docTypeEntities){ + const entity = this.docTypeEntities[entityName]; + val = val.replace( entity.regx, entity.val); + } + for(let entityName in this.lastEntities){ + const entity = this.lastEntities[entityName]; + val = val.replace( entity.regex, entity.val); + } + if(this.options.htmlEntities){ + for(let entityName in this.htmlEntities){ + const entity = this.htmlEntities[entityName]; + val = val.replace( entity.regex, entity.val); + } + } + val = val.replace( this.ampEntity.regex, this.ampEntity.val); + } + return val; +} +function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) { + if (textData) { //store previously collected data as textNode + if(isLeafNode === undefined) isLeafNode = Object.keys(currentNode.child).length === 0 + + textData = this.parseTextData(textData, + currentNode.tagname, + jPath, + false, + currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false, + isLeafNode); + + if (textData !== undefined && textData !== "") + currentNode.add(this.options.textNodeName, textData); + textData = ""; + } + return textData; +} + +//TODO: use jPath to simplify the logic +/** + * + * @param {string[]} stopNodes + * @param {string} jPath + * @param {string} currentTagName + */ +function isItStopNode(stopNodes, jPath, currentTagName){ + const allNodesExp = "*." + currentTagName; + for (const stopNodePath in stopNodes) { + const stopNodeExp = stopNodes[stopNodePath]; + if( allNodesExp === stopNodeExp || jPath === stopNodeExp ) return true; + } + return false; +} + +/** + * Returns the tag Expression and where it is ending handling single-dobule quotes situation + * @param {string} xmlData + * @param {number} i starting index + * @returns + */ +function tagExpWithClosingIndex(xmlData, i, closingChar = ">"){ + let attrBoundary; + let tagExp = ""; + for (let index = i; index < xmlData.length; index++) { + let ch = xmlData[index]; + if (attrBoundary) { + if (ch === attrBoundary) attrBoundary = "";//reset + } else if (ch === '"' || ch === "'") { + attrBoundary = ch; + } else if (ch === closingChar[0]) { + if(closingChar[1]){ + if(xmlData[index + 1] === closingChar[1]){ + return { + data: tagExp, + index: index + } + } + }else{ + return { + data: tagExp, + index: index + } + } + } else if (ch === '\t') { + ch = " " + } + tagExp += ch; + } +} + +function findClosingIndex(xmlData, str, i, errMsg){ + const closingIndex = xmlData.indexOf(str, i); + if(closingIndex === -1){ + throw new Error(errMsg) + }else{ + return closingIndex + str.length - 1; + } +} + +function readTagExp(xmlData,i, removeNSPrefix, closingChar = ">"){ + const result = tagExpWithClosingIndex(xmlData, i+1, closingChar); + if(!result) return; + let tagExp = result.data; + const closeIndex = result.index; + const separatorIndex = tagExp.search(/\s/); + let tagName = tagExp; + let attrExpPresent = true; + if(separatorIndex !== -1){//separate tag name and attributes expression + tagName = tagExp.substr(0, separatorIndex).replace(/\s\s*$/, ''); + tagExp = tagExp.substr(separatorIndex + 1); + } + + if(removeNSPrefix){ + const colonIndex = tagName.indexOf(":"); + if(colonIndex !== -1){ + tagName = tagName.substr(colonIndex+1); + attrExpPresent = tagName !== result.data.substr(colonIndex + 1); + } + } + + return { + tagName: tagName, + tagExp: tagExp, + closeIndex: closeIndex, + attrExpPresent: attrExpPresent, + } +} +/** + * find paired tag for a stop node + * @param {string} xmlData + * @param {string} tagName + * @param {number} i + */ +function readStopNodeData(xmlData, tagName, i){ + const startIndex = i; + // Starting at 1 since we already have an open tag + let openTagCount = 1; + + for (; i < xmlData.length; i++) { + if( xmlData[i] === "<"){ + if (xmlData[i+1] === "/") {//close tag + const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`); + let closeTagName = xmlData.substring(i+2,closeIndex).trim(); + if(closeTagName === tagName){ + openTagCount--; + if (openTagCount === 0) { + return { + tagContent: xmlData.substring(startIndex, i), + i : closeIndex + } + } + } + i=closeIndex; + } else if(xmlData[i+1] === '?') { + const closeIndex = findClosingIndex(xmlData, "?>", i+1, "StopNode is not closed.") + i=closeIndex; + } else if(xmlData.substr(i + 1, 3) === '!--') { + const closeIndex = findClosingIndex(xmlData, "-->", i+3, "StopNode is not closed.") + i=closeIndex; + } else if(xmlData.substr(i + 1, 2) === '![') { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2; + i=closeIndex; + } else { + const tagData = readTagExp(xmlData, i, '>') + + if (tagData) { + const openTagName = tagData && tagData.tagName; + if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length-1] !== "/") { + openTagCount++; + } + i=tagData.closeIndex; + } + } + } + }//end for loop +} + +function parseValue(val, shouldParse, options) { + if (shouldParse && typeof val === 'string') { + //console.log(options) + const newval = val.trim(); + if(newval === 'true' ) return true; + else if(newval === 'false' ) return false; + else return toNumber(val, options); + } else { + if (util.isExist(val)) { + return val; + } else { + return ''; + } + } +} + + +module.exports = OrderedObjParser; + + +/***/ }), + +/***/ 2380: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +const { buildOptions} = __nccwpck_require__(6993); +const OrderedObjParser = __nccwpck_require__(5832); +const { prettify} = __nccwpck_require__(2882); +const validator = __nccwpck_require__(1739); + +class XMLParser{ + + constructor(options){ + this.externalEntities = {}; + this.options = buildOptions(options); + + } + /** + * Parse XML dats to JS object + * @param {string|Buffer} xmlData + * @param {boolean|Object} validationOption + */ + parse(xmlData,validationOption){ + if(typeof xmlData === "string"){ + }else if( xmlData.toString){ + xmlData = xmlData.toString(); + }else{ + throw new Error("XML data is accepted in String or Bytes[] form.") + } + if( validationOption){ + if(validationOption === true) validationOption = {}; //validate with default options + + const result = validator.validate(xmlData, validationOption); + if (result !== true) { + throw Error( `${result.err.msg}:${result.err.line}:${result.err.col}` ) + } + } + const orderedObjParser = new OrderedObjParser(this.options); + orderedObjParser.addExternalEntities(this.externalEntities); + const orderedResult = orderedObjParser.parseXml(xmlData); + if(this.options.preserveOrder || orderedResult === undefined) return orderedResult; + else return prettify(orderedResult, this.options); + } + + /** + * Add Entity which is not by default supported by this library + * @param {string} key + * @param {string} value + */ + addEntity(key, value){ + if(value.indexOf("&") !== -1){ + throw new Error("Entity value can't have '&'") + }else if(key.indexOf("&") !== -1 || key.indexOf(";") !== -1){ + throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for ' '") + }else if(value === "&"){ + throw new Error("An entity with value '&' is not permitted"); + }else{ + this.externalEntities[key] = value; + } + } +} + +module.exports = XMLParser; + +/***/ }), + +/***/ 2882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +/** + * + * @param {array} node + * @param {any} options + * @returns + */ +function prettify(node, options){ + return compress( node, options); +} + +/** + * + * @param {array} arr + * @param {object} options + * @param {string} jPath + * @returns object + */ +function compress(arr, options, jPath){ + let text; + const compressedObj = {}; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const property = propName(tagObj); + let newJpath = ""; + if(jPath === undefined) newJpath = property; + else newJpath = jPath + "." + property; + + if(property === options.textNodeName){ + if(text === undefined) text = tagObj[property]; + else text += "" + tagObj[property]; + }else if(property === undefined){ + continue; + }else if(tagObj[property]){ + + let val = compress(tagObj[property], options, newJpath); + const isLeaf = isLeafTag(val, options); + + if(tagObj[":@"]){ + assignAttributes( val, tagObj[":@"], newJpath, options); + }else if(Object.keys(val).length === 1 && val[options.textNodeName] !== undefined && !options.alwaysCreateTextNode){ + val = val[options.textNodeName]; + }else if(Object.keys(val).length === 0){ + if(options.alwaysCreateTextNode) val[options.textNodeName] = ""; + else val = ""; + } + + if(compressedObj[property] !== undefined && compressedObj.hasOwnProperty(property)) { + if(!Array.isArray(compressedObj[property])) { + compressedObj[property] = [ compressedObj[property] ]; + } + compressedObj[property].push(val); + }else{ + //TODO: if a node is not an array, then check if it should be an array + //also determine if it is a leaf node + if (options.isArray(property, newJpath, isLeaf )) { + compressedObj[property] = [val]; + }else{ + compressedObj[property] = val; + } + } + } + + } + // if(text && text.length > 0) compressedObj[options.textNodeName] = text; + if(typeof text === "string"){ + if(text.length > 0) compressedObj[options.textNodeName] = text; + }else if(text !== undefined) compressedObj[options.textNodeName] = text; + return compressedObj; +} + +function propName(obj){ + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if(key !== ":@") return key; + } +} + +function assignAttributes(obj, attrMap, jpath, options){ + if (attrMap) { + const keys = Object.keys(attrMap); + const len = keys.length; //don't make it inline + for (let i = 0; i < len; i++) { + const atrrName = keys[i]; + if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) { + obj[atrrName] = [ attrMap[atrrName] ]; + } else { + obj[atrrName] = attrMap[atrrName]; + } + } + } +} + +function isLeafTag(obj, options){ + const propCount = Object.keys(obj).length; + if( propCount === 0 || (propCount === 1 && obj[options.textNodeName]) ) return true; + return false; +} +exports.prettify = prettify; + + +/***/ }), + +/***/ 7462: +/***/ ((module) => { + +"use strict"; + + +class XmlNode{ + constructor(tagname) { + this.tagname = tagname; + this.child = []; //nested tags, text, cdata, comments in order + this[":@"] = {}; //attributes map + } + add(key,val){ + // this.child.push( {name : key, val: val, isCdata: isCdata }); + this.child.push( {[key]: val }); + } + addChild(node) { + if(node[":@"] && Object.keys(node[":@"]).length > 0){ + this.child.push( { [node.tagname]: node.child, [":@"]: node[":@"] }); + }else{ + this.child.push( { [node.tagname]: node.child }); + } + }; +}; + + +module.exports = XmlNode; + +/***/ }), + +/***/ 4526: +/***/ ((module) => { + +const hexRegex = /^[-+]?0x[a-fA-F0-9]+$/; +const numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/; +// const octRegex = /0x[a-z0-9]+/; +// const binRegex = /0x[a-z0-9]+/; + + +//polyfill +if (!Number.parseInt && window.parseInt) { + Number.parseInt = window.parseInt; +} +if (!Number.parseFloat && window.parseFloat) { + Number.parseFloat = window.parseFloat; +} + + +const consider = { + hex : true, + leadingZeros: true, + decimalPoint: "\.", + eNotation: true + //skipLike: /regex/ +}; + +function toNumber(str, options = {}){ + // const options = Object.assign({}, consider); + // if(opt.leadingZeros === false){ + // options.leadingZeros = false; + // }else if(opt.hex === false){ + // options.hex = false; + // } + + options = Object.assign({}, consider, options ); + if(!str || typeof str !== "string" ) return str; + + let trimmedStr = str.trim(); + // if(trimmedStr === "0.0") return 0; + // else if(trimmedStr === "+0.0") return 0; + // else if(trimmedStr === "-0.0") return -0; + + if(options.skipLike !== undefined && options.skipLike.test(trimmedStr)) return str; + else if (options.hex && hexRegex.test(trimmedStr)) { + return Number.parseInt(trimmedStr, 16); + // } else if (options.parseOct && octRegex.test(str)) { + // return Number.parseInt(val, 8); + // }else if (options.parseBin && binRegex.test(str)) { + // return Number.parseInt(val, 2); + }else{ + //separate negative sign, leading zeros, and rest number + const match = numRegex.exec(trimmedStr); + if(match){ + const sign = match[1]; + const leadingZeros = match[2]; + let numTrimmedByZeros = trimZeros(match[3]); //complete num without leading zeros + //trim ending zeros for floating number + + const eNotation = match[4] || match[6]; + if(!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; //-0123 + else if(!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; //0123 + else{//no leading zeros or leading zeros are allowed + const num = Number(trimmedStr); + const numStr = "" + num; + if(numStr.search(/[eE]/) !== -1){ //given number is long and parsed to eNotation + if(options.eNotation) return num; + else return str; + }else if(eNotation){ //given number has enotation + if(options.eNotation) return num; + else return str; + }else if(trimmedStr.indexOf(".") !== -1){ //floating number + // const decimalPart = match[5].substr(1); + // const intPart = trimmedStr.substr(0,trimmedStr.indexOf(".")); + + + // const p = numStr.indexOf("."); + // const givenIntPart = numStr.substr(0,p); + // const givenDecPart = numStr.substr(p+1); + if(numStr === "0" && (numTrimmedByZeros === "") ) return num; //0.0 + else if(numStr === numTrimmedByZeros) return num; //0.456. 0.79000 + else if( sign && numStr === "-"+numTrimmedByZeros) return num; + else return str; + } + + if(leadingZeros){ + // if(numTrimmedByZeros === numStr){ + // if(options.leadingZeros) return num; + // else return str; + // }else return str; + if(numTrimmedByZeros === numStr) return num; + else if(sign+numTrimmedByZeros === numStr) return num; + else return str; + } + + if(trimmedStr === numStr) return num; + else if(trimmedStr === sign+numStr) return num; + // else{ + // //number with +/- sign + // trimmedStr.test(/[-+][0-9]); + + // } + return str; + } + // else if(!eNotation && trimmedStr && trimmedStr !== Number(trimmedStr) ) return str; + + }else{ //non-numeric string + return str; + } + } +} + +/** + * + * @param {string} numStr without leading zeros + * @returns + */ +function trimZeros(numStr){ + if(numStr && numStr.indexOf(".") !== -1){//float + numStr = numStr.replace(/0+$/, ""); //remove ending zeros + if(numStr === ".") numStr = "0"; + else if(numStr[0] === ".") numStr = "0"+numStr; + else if(numStr[numStr.length-1] === ".") numStr = numStr.substr(0,numStr.length-1); + return numStr; + } + return numStr; +} +module.exports = toNumber + + +/***/ }), + +/***/ 4351: +/***/ ((module) => { + +/****************************************************************************** +Copyright (c) Microsoft Corporation. + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. +***************************************************************************** */ +/* global global, define, System, Reflect, Promise */ +var __extends; +var __assign; +var __rest; +var __decorate; +var __param; +var __metadata; +var __awaiter; +var __generator; +var __exportStar; +var __values; +var __read; +var __spread; +var __spreadArrays; +var __spreadArray; +var __await; +var __asyncGenerator; +var __asyncDelegator; +var __asyncValues; +var __makeTemplateObject; +var __importStar; +var __importDefault; +var __classPrivateFieldGet; +var __classPrivateFieldSet; +var __classPrivateFieldIn; +var __createBinding; +(function (factory) { + var root = typeof global === "object" ? global : typeof self === "object" ? self : typeof this === "object" ? this : {}; + if (typeof define === "function" && define.amd) { + define("tslib", ["exports"], function (exports) { factory(createExporter(root, createExporter(exports))); }); + } + else if ( true && typeof module.exports === "object") { + factory(createExporter(root, createExporter(module.exports))); + } + else { + factory(createExporter(root)); + } + function createExporter(exports, previous) { + if (exports !== root) { + if (typeof Object.create === "function") { + Object.defineProperty(exports, "__esModule", { value: true }); + } + else { + exports.__esModule = true; + } + } + return function (id, v) { return exports[id] = previous ? previous(id, v) : v; }; + } +}) +(function (exporter) { + var extendStatics = Object.setPrototypeOf || + ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || + function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; }; + + __extends = function (d, b) { + if (typeof b !== "function" && b !== null) + throw new TypeError("Class extends value " + String(b) + " is not a constructor or null"); + extendStatics(d, b); + function __() { this.constructor = d; } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); + }; + + __assign = Object.assign || function (t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + } + return t; + }; + + __rest = function (s, e) { + var t = {}; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === "function") + for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) { + if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) + t[p[i]] = s[p[i]]; + } + return t; + }; + + __decorate = function (decorators, target, key, desc) { + var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); + else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; + return c > 3 && r && Object.defineProperty(target, key, r), r; + }; + + __param = function (paramIndex, decorator) { + return function (target, key) { decorator(target, key, paramIndex); } + }; + + __metadata = function (metadataKey, metadataValue) { + if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); + }; + + __awaiter = function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); + }; + + __generator = function (thisArg, body) { + var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; + return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; + function verb(n) { return function (v) { return step([n, v]); }; } + function step(op) { + if (f) throw new TypeError("Generator is already executing."); + while (_) try { + if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; + if (y = 0, t) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: case 1: t = op; break; + case 4: _.label++; return { value: op[1], done: false }; + case 5: _.label++; y = op[1]; op = [0]; continue; + case 7: op = _.ops.pop(); _.trys.pop(); continue; + default: + if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } + if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } + if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } + if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } + if (t[2]) _.ops.pop(); + _.trys.pop(); continue; + } + op = body.call(thisArg, _); + } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } + if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; + } + }; + + __exportStar = function(m, o) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p); + }; + + __createBinding = Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); + }) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; + }); + + __values = function (o) { + var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0; + if (m) return m.call(o); + if (o && typeof o.length === "number") return { + next: function () { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; + } + }; + throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined."); + }; + + __read = function (o, n) { + var m = typeof Symbol === "function" && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), r, ar = [], e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); + } + catch (error) { e = { error: error }; } + finally { + try { + if (r && !r.done && (m = i["return"])) m.call(i); + } + finally { if (e) throw e.error; } + } + return ar; + }; + + /** @deprecated */ + __spread = function () { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; + }; + + /** @deprecated */ + __spreadArrays = function () { + for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length; + for (var r = Array(s), k = 0, i = 0; i < il; i++) + for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++) + r[k] = a[j]; + return r; + }; + + __spreadArray = function (to, from, pack) { + if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) { + if (ar || !(i in from)) { + if (!ar) ar = Array.prototype.slice.call(from, 0, i); + ar[i] = from[i]; + } + } + return to.concat(ar || Array.prototype.slice.call(from)); + }; + + __await = function (v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); + }; + + __asyncGenerator = function (thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), i, q = []; + return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i; + function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; } + function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } } + function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); } + function fulfill(value) { resume("next", value); } + function reject(value) { resume("throw", value); } + function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); } + }; + + __asyncDelegator = function (o) { + var i, p; + return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i; + function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; } + }; + + __asyncValues = function (o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i); + function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; } + function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); } + }; + + __makeTemplateObject = function (cooked, raw) { + if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; } + return cooked; + }; + + var __setModuleDefault = Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); + }) : function(o, v) { + o["default"] = v; + }; + + __importStar = function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; + }; + + __importDefault = function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; + }; + + __classPrivateFieldGet = function (receiver, state, kind, f) { + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it"); + return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver); + }; + + __classPrivateFieldSet = function (receiver, state, value, kind, f) { + if (kind === "m") throw new TypeError("Private method is not writable"); + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it"); + return (kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value; + }; + + __classPrivateFieldIn = function (state, receiver) { + if (receiver === null || (typeof receiver !== "object" && typeof receiver !== "function")) throw new TypeError("Cannot use 'in' operator on non-object"); + return typeof state === "function" ? receiver === state : state.has(receiver); + }; + + exporter("__extends", __extends); + exporter("__assign", __assign); + exporter("__rest", __rest); + exporter("__decorate", __decorate); + exporter("__param", __param); + exporter("__metadata", __metadata); + exporter("__awaiter", __awaiter); + exporter("__generator", __generator); + exporter("__exportStar", __exportStar); + exporter("__createBinding", __createBinding); + exporter("__values", __values); + exporter("__read", __read); + exporter("__spread", __spread); + exporter("__spreadArrays", __spreadArrays); + exporter("__spreadArray", __spreadArray); + exporter("__await", __await); + exporter("__asyncGenerator", __asyncGenerator); + exporter("__asyncDelegator", __asyncDelegator); + exporter("__asyncValues", __asyncValues); + exporter("__makeTemplateObject", __makeTemplateObject); + exporter("__importStar", __importStar); + exporter("__importDefault", __importDefault); + exporter("__classPrivateFieldGet", __classPrivateFieldGet); + exporter("__classPrivateFieldSet", __classPrivateFieldSet); + exporter("__classPrivateFieldIn", __classPrivateFieldIn); +}); + + +/***/ }), + +/***/ 4294: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +module.exports = __nccwpck_require__(4219); + + +/***/ }), + +/***/ 4219: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +var net = __nccwpck_require__(1808); +var tls = __nccwpck_require__(4404); +var http = __nccwpck_require__(3685); +var https = __nccwpck_require__(5687); +var events = __nccwpck_require__(2361); +var assert = __nccwpck_require__(9491); +var util = __nccwpck_require__(3837); + + +exports.httpOverHttp = httpOverHttp; +exports.httpsOverHttp = httpsOverHttp; +exports.httpOverHttps = httpOverHttps; +exports.httpsOverHttps = httpsOverHttps; + + +function httpOverHttp(options) { + var agent = new TunnelingAgent(options); + agent.request = http.request; + return agent; +} + +function httpsOverHttp(options) { + var agent = new TunnelingAgent(options); + agent.request = http.request; + agent.createSocket = createSecureSocket; + agent.defaultPort = 443; + return agent; +} + +function httpOverHttps(options) { + var agent = new TunnelingAgent(options); + agent.request = https.request; + return agent; +} + +function httpsOverHttps(options) { + var agent = new TunnelingAgent(options); + agent.request = https.request; + agent.createSocket = createSecureSocket; + agent.defaultPort = 443; + return agent; +} + + +function TunnelingAgent(options) { + var self = this; + self.options = options || {}; + self.proxyOptions = self.options.proxy || {}; + self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets; + self.requests = []; + self.sockets = []; + + self.on('free', function onFree(socket, host, port, localAddress) { + var options = toOptions(host, port, localAddress); + for (var i = 0, len = self.requests.length; i < len; ++i) { + var pending = self.requests[i]; + if (pending.host === options.host && pending.port === options.port) { + // Detect the request to connect same origin server, + // reuse the connection. + self.requests.splice(i, 1); + pending.request.onSocket(socket); + return; + } + } + socket.destroy(); + self.removeSocket(socket); + }); +} +util.inherits(TunnelingAgent, events.EventEmitter); + +TunnelingAgent.prototype.addRequest = function addRequest(req, host, port, localAddress) { + var self = this; + var options = mergeOptions({request: req}, self.options, toOptions(host, port, localAddress)); + + if (self.sockets.length >= this.maxSockets) { + // We are over limit so we'll add it to the queue. + self.requests.push(options); + return; + } + + // If we are under maxSockets create a new one. + self.createSocket(options, function(socket) { + socket.on('free', onFree); + socket.on('close', onCloseOrRemove); + socket.on('agentRemove', onCloseOrRemove); + req.onSocket(socket); + + function onFree() { + self.emit('free', socket, options); + } + + function onCloseOrRemove(err) { + self.removeSocket(socket); + socket.removeListener('free', onFree); + socket.removeListener('close', onCloseOrRemove); + socket.removeListener('agentRemove', onCloseOrRemove); + } + }); +}; + +TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { + var self = this; + var placeholder = {}; + self.sockets.push(placeholder); + + var connectOptions = mergeOptions({}, self.proxyOptions, { + method: 'CONNECT', + path: options.host + ':' + options.port, + agent: false, + headers: { + host: options.host + ':' + options.port + } + }); + if (options.localAddress) { + connectOptions.localAddress = options.localAddress; + } + if (connectOptions.proxyAuth) { + connectOptions.headers = connectOptions.headers || {}; + connectOptions.headers['Proxy-Authorization'] = 'Basic ' + + new Buffer(connectOptions.proxyAuth).toString('base64'); + } + + debug('making CONNECT request'); + var connectReq = self.request(connectOptions); + connectReq.useChunkedEncodingByDefault = false; // for v0.6 + connectReq.once('response', onResponse); // for v0.6 + connectReq.once('upgrade', onUpgrade); // for v0.6 + connectReq.once('connect', onConnect); // for v0.7 or later + connectReq.once('error', onError); + connectReq.end(); + + function onResponse(res) { + // Very hacky. This is necessary to avoid http-parser leaks. + res.upgrade = true; + } + + function onUpgrade(res, socket, head) { + // Hacky. + process.nextTick(function() { + onConnect(res, socket, head); + }); + } + + function onConnect(res, socket, head) { + connectReq.removeAllListeners(); + socket.removeAllListeners(); + + if (res.statusCode !== 200) { + debug('tunneling socket could not be established, statusCode=%d', + res.statusCode); + socket.destroy(); + var error = new Error('tunneling socket could not be established, ' + + 'statusCode=' + res.statusCode); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + return; + } + if (head.length > 0) { + debug('got illegal response body from proxy'); + socket.destroy(); + var error = new Error('got illegal response body from proxy'); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + return; + } + debug('tunneling connection has established'); + self.sockets[self.sockets.indexOf(placeholder)] = socket; + return cb(socket); + } + + function onError(cause) { + connectReq.removeAllListeners(); + + debug('tunneling socket could not be established, cause=%s\n', + cause.message, cause.stack); + var error = new Error('tunneling socket could not be established, ' + + 'cause=' + cause.message); + error.code = 'ECONNRESET'; + options.request.emit('error', error); + self.removeSocket(placeholder); + } +}; + +TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { + var pos = this.sockets.indexOf(socket) + if (pos === -1) { + return; + } + this.sockets.splice(pos, 1); + + var pending = this.requests.shift(); + if (pending) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createSocket(pending, function(socket) { + pending.request.onSocket(socket); + }); + } +}; + +function createSecureSocket(options, cb) { + var self = this; + TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { + var hostHeader = options.request.getHeader('host'); + var tlsOptions = mergeOptions({}, self.options, { + socket: socket, + servername: hostHeader ? hostHeader.replace(/:.*$/, '') : options.host + }); + + // 0 is dummy port for v0.6 + var secureSocket = tls.connect(0, tlsOptions); + self.sockets[self.sockets.indexOf(socket)] = secureSocket; + cb(secureSocket); + }); +} + + +function toOptions(host, port, localAddress) { + if (typeof host === 'string') { // since v0.10 + return { + host: host, + port: port, + localAddress: localAddress + }; + } + return host; // for v0.11 or later +} + +function mergeOptions(target) { + for (var i = 1, len = arguments.length; i < len; ++i) { + var overrides = arguments[i]; + if (typeof overrides === 'object') { + var keys = Object.keys(overrides); + for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { + var k = keys[j]; + if (overrides[k] !== undefined) { + target[k] = overrides[k]; + } + } + } + } + return target; +} + + +var debug; +if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { + debug = function() { + var args = Array.prototype.slice.call(arguments); + if (typeof args[0] === 'string') { + args[0] = 'TUNNEL: ' + args[0]; + } else { + args.unshift('TUNNEL:'); + } + console.error.apply(console, args); + } +} else { + debug = function() {}; +} +exports.debug = debug; // for test + + +/***/ }), + +/***/ 5840: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "v1", ({ + enumerable: true, + get: function () { + return _v.default; + } +})); +Object.defineProperty(exports, "v3", ({ + enumerable: true, + get: function () { + return _v2.default; + } +})); +Object.defineProperty(exports, "v4", ({ + enumerable: true, + get: function () { + return _v3.default; + } +})); +Object.defineProperty(exports, "v5", ({ + enumerable: true, + get: function () { + return _v4.default; + } +})); +Object.defineProperty(exports, "NIL", ({ + enumerable: true, + get: function () { + return _nil.default; + } +})); +Object.defineProperty(exports, "version", ({ + enumerable: true, + get: function () { + return _version.default; + } +})); +Object.defineProperty(exports, "validate", ({ + enumerable: true, + get: function () { + return _validate.default; + } +})); +Object.defineProperty(exports, "stringify", ({ + enumerable: true, + get: function () { + return _stringify.default; + } +})); +Object.defineProperty(exports, "parse", ({ + enumerable: true, + get: function () { + return _parse.default; + } +})); + +var _v = _interopRequireDefault(__nccwpck_require__(8628)); + +var _v2 = _interopRequireDefault(__nccwpck_require__(6409)); + +var _v3 = _interopRequireDefault(__nccwpck_require__(5122)); + +var _v4 = _interopRequireDefault(__nccwpck_require__(9120)); + +var _nil = _interopRequireDefault(__nccwpck_require__(5332)); + +var _version = _interopRequireDefault(__nccwpck_require__(1595)); + +var _validate = _interopRequireDefault(__nccwpck_require__(6900)); + +var _stringify = _interopRequireDefault(__nccwpck_require__(8950)); + +var _parse = _interopRequireDefault(__nccwpck_require__(2746)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/***/ }), + +/***/ 4569: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function md5(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('md5').update(bytes).digest(); +} + +var _default = md5; +exports["default"] = _default; + +/***/ }), + +/***/ 5332: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = '00000000-0000-0000-0000-000000000000'; +exports["default"] = _default; + +/***/ }), + +/***/ 2746: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(6900)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function parse(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + let v; + const arr = new Uint8Array(16); // Parse ########-....-....-....-............ + + arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; + arr[1] = v >>> 16 & 0xff; + arr[2] = v >>> 8 & 0xff; + arr[3] = v & 0xff; // Parse ........-####-....-....-............ + + arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; + arr[5] = v & 0xff; // Parse ........-....-####-....-............ + + arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; + arr[7] = v & 0xff; // Parse ........-....-....-####-............ + + arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; + arr[9] = v & 0xff; // Parse ........-....-....-....-############ + // (Use "/" to avoid 32-bit truncation when bit-shifting high-order bytes) + + arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 0x10000000000 & 0xff; + arr[11] = v / 0x100000000 & 0xff; + arr[12] = v >>> 24 & 0xff; + arr[13] = v >>> 16 & 0xff; + arr[14] = v >>> 8 & 0xff; + arr[15] = v & 0xff; + return arr; +} + +var _default = parse; +exports["default"] = _default; + +/***/ }), + +/***/ 814: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; +exports["default"] = _default; + +/***/ }), + +/***/ 807: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = rng; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const rnds8Pool = new Uint8Array(256); // # of random values to pre-allocate + +let poolPtr = rnds8Pool.length; + +function rng() { + if (poolPtr > rnds8Pool.length - 16) { + _crypto.default.randomFillSync(rnds8Pool); + + poolPtr = 0; + } + + return rnds8Pool.slice(poolPtr, poolPtr += 16); +} + +/***/ }), + +/***/ 5274: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function sha1(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('sha1').update(bytes).digest(); +} + +var _default = sha1; +exports["default"] = _default; + +/***/ }), + +/***/ 8950: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(6900)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +const byteToHex = []; + +for (let i = 0; i < 256; ++i) { + byteToHex.push((i + 0x100).toString(16).substr(1)); +} + +function stringify(arr, offset = 0) { + // Note: Be careful editing this code! It's been tuned for performance + // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434 + const uuid = (byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]).toLowerCase(); // Consistency check for valid UUID. If this throws, it's likely due to one + // of the following: + // - One or more input array values don't map to a hex octet (leading to + // "undefined" in the uuid) + // - Invalid input values for the RFC `version` or `variant` fields + + if (!(0, _validate.default)(uuid)) { + throw TypeError('Stringified UUID is invalid'); + } + + return uuid; +} + +var _default = stringify; +exports["default"] = _default; + +/***/ }), + +/***/ 8628: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _rng = _interopRequireDefault(__nccwpck_require__(807)); + +var _stringify = _interopRequireDefault(__nccwpck_require__(8950)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +// **`v1()` - Generate time-based UUID** +// +// Inspired by https://github.com/LiosK/UUID.js +// and http://docs.python.org/library/uuid.html +let _nodeId; + +let _clockseq; // Previous uuid creation time + + +let _lastMSecs = 0; +let _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details + +function v1(options, buf, offset) { + let i = buf && offset || 0; + const b = buf || new Array(16); + options = options || {}; + let node = options.node || _nodeId; + let clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not + // specified. We do this lazily to minimize issues related to insufficient + // system entropy. See #189 + + if (node == null || clockseq == null) { + const seedBytes = options.random || (options.rng || _rng.default)(); + + if (node == null) { + // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) + node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; + } + + if (clockseq == null) { + // Per 4.2.2, randomize (14 bit) clockseq + clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; + } + } // UUID timestamps are 100 nano-second units since the Gregorian epoch, + // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so + // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' + // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. + + + let msecs = options.msecs !== undefined ? options.msecs : Date.now(); // Per 4.2.1.2, use count of uuid's generated during the current clock + // cycle to simulate higher resolution clock + + let nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) + + const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression + + if (dt < 0 && options.clockseq === undefined) { + clockseq = clockseq + 1 & 0x3fff; + } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new + // time interval + + + if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { + nsecs = 0; + } // Per 4.2.1.2 Throw error if too many uuids are requested + + + if (nsecs >= 10000) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } + + _lastMSecs = msecs; + _lastNSecs = nsecs; + _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch + + msecs += 12219292800000; // `time_low` + + const tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; + b[i++] = tl >>> 24 & 0xff; + b[i++] = tl >>> 16 & 0xff; + b[i++] = tl >>> 8 & 0xff; + b[i++] = tl & 0xff; // `time_mid` + + const tmh = msecs / 0x100000000 * 10000 & 0xfffffff; + b[i++] = tmh >>> 8 & 0xff; + b[i++] = tmh & 0xff; // `time_high_and_version` + + b[i++] = tmh >>> 24 & 0xf | 0x10; // include version + + b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) + + b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` + + b[i++] = clockseq & 0xff; // `node` + + for (let n = 0; n < 6; ++n) { + b[i + n] = node[n]; + } + + return buf || (0, _stringify.default)(b); +} + +var _default = v1; +exports["default"] = _default; + +/***/ }), + +/***/ 6409: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(5998)); + +var _md = _interopRequireDefault(__nccwpck_require__(4569)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v3 = (0, _v.default)('v3', 0x30, _md.default); +var _default = v3; +exports["default"] = _default; + +/***/ }), + +/***/ 5998: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = _default; +exports.URL = exports.DNS = void 0; + +var _stringify = _interopRequireDefault(__nccwpck_require__(8950)); + +var _parse = _interopRequireDefault(__nccwpck_require__(2746)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function stringToBytes(str) { + str = unescape(encodeURIComponent(str)); // UTF8 escape + + const bytes = []; + + for (let i = 0; i < str.length; ++i) { + bytes.push(str.charCodeAt(i)); + } + + return bytes; +} + +const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; +exports.DNS = DNS; +const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; +exports.URL = URL; + +function _default(name, version, hashfunc) { + function generateUUID(value, namespace, buf, offset) { + if (typeof value === 'string') { + value = stringToBytes(value); + } + + if (typeof namespace === 'string') { + namespace = (0, _parse.default)(namespace); + } + + if (namespace.length !== 16) { + throw TypeError('Namespace must be array-like (16 iterable integer values, 0-255)'); + } // Compute hash of namespace and value, Per 4.3 + // Future: Use spread syntax when supported on all platforms, e.g. `bytes = + // hashfunc([...namespace, ... value])` + + + let bytes = new Uint8Array(16 + value.length); + bytes.set(namespace); + bytes.set(value, namespace.length); + bytes = hashfunc(bytes); + bytes[6] = bytes[6] & 0x0f | version; + bytes[8] = bytes[8] & 0x3f | 0x80; + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = bytes[i]; + } + + return buf; + } + + return (0, _stringify.default)(bytes); + } // Function#name is not settable on some platforms (#270) + + + try { + generateUUID.name = name; // eslint-disable-next-line no-empty + } catch (err) {} // For CommonJS default export support + + + generateUUID.DNS = DNS; + generateUUID.URL = URL; + return generateUUID; +} + +/***/ }), + +/***/ 5122: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _rng = _interopRequireDefault(__nccwpck_require__(807)); + +var _stringify = _interopRequireDefault(__nccwpck_require__(8950)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function v4(options, buf, offset) { + options = options || {}; + + const rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` + + + rnds[6] = rnds[6] & 0x0f | 0x40; + rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = rnds[i]; + } + + return buf; + } + + return (0, _stringify.default)(rnds); +} + +var _default = v4; +exports["default"] = _default; + +/***/ }), + +/***/ 9120: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(5998)); + +var _sha = _interopRequireDefault(__nccwpck_require__(5274)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v5 = (0, _v.default)('v5', 0x50, _sha.default); +var _default = v5; +exports["default"] = _default; + +/***/ }), + +/***/ 6900: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _regex = _interopRequireDefault(__nccwpck_require__(814)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function validate(uuid) { + return typeof uuid === 'string' && _regex.default.test(uuid); +} + +var _default = validate; +exports["default"] = _default; + +/***/ }), + +/***/ 1595: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(6900)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function version(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + return parseInt(uuid.substr(14, 1), 16); +} + +var _default = version; +exports["default"] = _default; + +/***/ }), + +/***/ 7424: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.cleanup = void 0; +const core = __importStar(__nccwpck_require__(2186)); +const helpers_1 = __nccwpck_require__(3015); +/** + * When the GitHub Actions job is done, clean up any environment variables that + * may have been set by the configure-aws-credentials steps in the job. + * + * Environment variables are not intended to be shared across different jobs in + * the same GitHub Actions workflow: GitHub Actions documentation states that + * each job runs in a fresh instance. However, doing our own cleanup will + * give us additional assurance that these environment variables are not shared + * with any other jobs. + */ +function cleanup() { + try { + // The GitHub Actions toolkit does not have an option to completely unset + // environment variables, so we overwrite the current value with an empty + // string. The AWS CLI and AWS SDKs will behave correctly: they treat an + // empty string value as if the environment variable does not exist. + core.exportVariable('AWS_ACCESS_KEY_ID', ''); + core.exportVariable('AWS_SECRET_ACCESS_KEY', ''); + core.exportVariable('AWS_SESSION_TOKEN', ''); + core.exportVariable('AWS_DEFAULT_REGION', ''); + core.exportVariable('AWS_REGION', ''); + } + catch (error) { + core.setFailed((0, helpers_1.errorMessage)(error)); + } +} +exports.cleanup = cleanup; +/* c8 ignore start */ +if (require.main === require.cache[eval('__filename')]) { + try { + cleanup(); + } + catch (error) { + core.setFailed((0, helpers_1.errorMessage)(error)); + } +} + + +/***/ }), + +/***/ 3015: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isDefined = exports.errorMessage = exports.retryAndBackoff = exports.reset = exports.withsleep = exports.defaultSleep = exports.sanitizeGitHubVariables = exports.exportAccountId = exports.exportRegion = exports.exportCredentials = void 0; +const core = __importStar(__nccwpck_require__(2186)); +const client_sts_1 = __nccwpck_require__(2209); +const MAX_TAG_VALUE_LENGTH = 256; +const SANITIZATION_CHARACTER = '_'; +// Configure the AWS CLI and AWS SDKs using environment variables and set them as secrets. +// Setting the credentials as secrets masks them in Github Actions logs +function exportCredentials(creds) { + if (creds?.AccessKeyId) { + core.setSecret(creds.AccessKeyId); + core.exportVariable('AWS_ACCESS_KEY_ID', creds.AccessKeyId); + } + if (creds?.SecretAccessKey) { + core.setSecret(creds.SecretAccessKey); + core.exportVariable('AWS_SECRET_ACCESS_KEY', creds.SecretAccessKey); + } + if (creds?.SessionToken) { + core.setSecret(creds.SessionToken); + core.exportVariable('AWS_SESSION_TOKEN', creds.SessionToken); + } + else if (process.env['AWS_SESSION_TOKEN']) { + // clear session token from previous credentials action + core.exportVariable('AWS_SESSION_TOKEN', ''); + } +} +exports.exportCredentials = exportCredentials; +function exportRegion(region) { + core.exportVariable('AWS_DEFAULT_REGION', region); + core.exportVariable('AWS_REGION', region); +} +exports.exportRegion = exportRegion; +// Obtains account ID from STS Client and sets it as output +async function exportAccountId(credentialsClient, maskAccountId) { + const client = credentialsClient.getStsClient(); + const identity = await client.send(new client_sts_1.GetCallerIdentityCommand({})); + const accountId = identity.Account; + if (!accountId) { + throw new Error('Could not get Account ID from STS. Did you set credentials?'); + } + if (maskAccountId) { + core.setSecret(accountId); + } + core.setOutput('aws-account-id', accountId); + return accountId; +} +exports.exportAccountId = exportAccountId; +// Tags have a more restrictive set of acceptable characters than GitHub environment variables can. +// This replaces anything not conforming to the tag restrictions by inverting the regular expression. +// See the AWS documentation for constraint specifics https://docs.aws.amazon.com/STS/latest/APIReference/API_Tag.html. +function sanitizeGitHubVariables(name) { + const nameWithoutSpecialCharacters = name.replace(/[^\p{L}\p{Z}\p{N}_.:/=+\-@]/gu, SANITIZATION_CHARACTER); + const nameTruncated = nameWithoutSpecialCharacters.slice(0, MAX_TAG_VALUE_LENGTH); + return nameTruncated; +} +exports.sanitizeGitHubVariables = sanitizeGitHubVariables; +async function defaultSleep(ms) { + return new Promise((resolve) => setTimeout(resolve, ms)); +} +exports.defaultSleep = defaultSleep; +let sleep = defaultSleep; +function withsleep(s) { + sleep = s; +} +exports.withsleep = withsleep; +function reset() { + sleep = defaultSleep; +} +exports.reset = reset; +// Retries the promise with exponential backoff if the error isRetryable up to maxRetries time. +async function retryAndBackoff(fn, isRetryable, retries = 0, maxRetries = 12, base = 50) { + try { + return await fn(); + } + catch (err) { + if (!isRetryable) { + throw err; + } + // It's retryable, so sleep and retry. + await sleep(Math.random() * (Math.pow(2, retries) * base)); + retries += 1; + if (retries === maxRetries) { + throw err; + } + return await retryAndBackoff(fn, isRetryable, retries, maxRetries, base); + } +} +exports.retryAndBackoff = retryAndBackoff; +/* c8 ignore start */ +function errorMessage(error) { + return error instanceof Error ? error.message : String(error); +} +exports.errorMessage = errorMessage; +function isDefined(i) { + return i !== undefined && i !== null; +} +exports.isDefined = isDefined; +/* c8 ignore stop */ + + +/***/ }), + +/***/ 7578: +/***/ ((module) => { + +module.exports = eval("require")("aws-crt"); + + +/***/ }), + +/***/ 9491: +/***/ ((module) => { + +"use strict"; +module.exports = require("assert"); + +/***/ }), + +/***/ 4300: +/***/ ((module) => { + +"use strict"; +module.exports = require("buffer"); + +/***/ }), + +/***/ 2081: +/***/ ((module) => { + +"use strict"; +module.exports = require("child_process"); + +/***/ }), + +/***/ 6113: +/***/ ((module) => { + +"use strict"; +module.exports = require("crypto"); + +/***/ }), + +/***/ 2361: +/***/ ((module) => { + +"use strict"; +module.exports = require("events"); + +/***/ }), + +/***/ 7147: +/***/ ((module) => { + +"use strict"; +module.exports = require("fs"); + +/***/ }), + +/***/ 3685: +/***/ ((module) => { + +"use strict"; +module.exports = require("http"); + +/***/ }), + +/***/ 5158: +/***/ ((module) => { + +"use strict"; +module.exports = require("http2"); + +/***/ }), + +/***/ 5687: +/***/ ((module) => { + +"use strict"; +module.exports = require("https"); + +/***/ }), + +/***/ 1808: +/***/ ((module) => { + +"use strict"; +module.exports = require("net"); + +/***/ }), + +/***/ 2037: +/***/ ((module) => { + +"use strict"; +module.exports = require("os"); + +/***/ }), + +/***/ 1017: +/***/ ((module) => { + +"use strict"; +module.exports = require("path"); + +/***/ }), + +/***/ 7282: +/***/ ((module) => { + +"use strict"; +module.exports = require("process"); + +/***/ }), + +/***/ 2781: +/***/ ((module) => { + +"use strict"; +module.exports = require("stream"); + +/***/ }), + +/***/ 4404: +/***/ ((module) => { + +"use strict"; +module.exports = require("tls"); + +/***/ }), + +/***/ 7310: +/***/ ((module) => { + +"use strict"; +module.exports = require("url"); + +/***/ }), + +/***/ 3837: +/***/ ((module) => { + +"use strict"; +module.exports = require("util"); + +/***/ }), + +/***/ 1092: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.198.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"2.0.0","@aws-crypto/sha256-js":"2.0.0","@aws-sdk/config-resolver":"3.198.0","@aws-sdk/fetch-http-handler":"3.198.0","@aws-sdk/hash-node":"3.198.0","@aws-sdk/invalid-dependency":"3.198.0","@aws-sdk/middleware-content-length":"3.198.0","@aws-sdk/middleware-endpoint":"3.198.0","@aws-sdk/middleware-host-header":"3.198.0","@aws-sdk/middleware-logger":"3.198.0","@aws-sdk/middleware-recursion-detection":"3.198.0","@aws-sdk/middleware-retry":"3.198.0","@aws-sdk/middleware-serde":"3.198.0","@aws-sdk/middleware-stack":"3.198.0","@aws-sdk/middleware-user-agent":"3.198.0","@aws-sdk/node-config-provider":"3.198.0","@aws-sdk/node-http-handler":"3.198.0","@aws-sdk/protocol-http":"3.198.0","@aws-sdk/smithy-client":"3.198.0","@aws-sdk/types":"3.198.0","@aws-sdk/url-parser":"3.198.0","@aws-sdk/util-base64-browser":"3.188.0","@aws-sdk/util-base64-node":"3.188.0","@aws-sdk/util-body-length-browser":"3.188.0","@aws-sdk/util-body-length-node":"3.188.0","@aws-sdk/util-defaults-mode-browser":"3.198.0","@aws-sdk/util-defaults-mode-node":"3.198.0","@aws-sdk/util-endpoints":"3.198.0","@aws-sdk/util-user-agent-browser":"3.198.0","@aws-sdk/util-user-agent-node":"3.198.0","@aws-sdk/util-utf8-browser":"3.188.0","@aws-sdk/util-utf8-node":"3.188.0","tslib":"^2.3.1"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.188.0","@tsconfig/recommended":"1.0.1","@types/node":"^12.7.5","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.19.2","typescript":"~4.6.2"},"overrides":{"typedoc":{"typescript":"~4.6.2"}},"engines":{"node":">=12.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); + +/***/ }), + +/***/ 7947: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native","version":"3.198.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"tsc -p tsconfig.cjs.json","build:docs":"typedoc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","test":"yarn test:unit","test:unit":"jest"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"2.0.0","@aws-crypto/sha256-js":"2.0.0","@aws-sdk/config-resolver":"3.198.0","@aws-sdk/credential-provider-node":"3.198.0","@aws-sdk/fetch-http-handler":"3.198.0","@aws-sdk/hash-node":"3.198.0","@aws-sdk/invalid-dependency":"3.198.0","@aws-sdk/middleware-content-length":"3.198.0","@aws-sdk/middleware-endpoint":"3.198.0","@aws-sdk/middleware-host-header":"3.198.0","@aws-sdk/middleware-logger":"3.198.0","@aws-sdk/middleware-recursion-detection":"3.198.0","@aws-sdk/middleware-retry":"3.198.0","@aws-sdk/middleware-sdk-sts":"3.198.0","@aws-sdk/middleware-serde":"3.198.0","@aws-sdk/middleware-signing":"3.198.0","@aws-sdk/middleware-stack":"3.198.0","@aws-sdk/middleware-user-agent":"3.198.0","@aws-sdk/node-config-provider":"3.198.0","@aws-sdk/node-http-handler":"3.198.0","@aws-sdk/protocol-http":"3.198.0","@aws-sdk/smithy-client":"3.198.0","@aws-sdk/types":"3.198.0","@aws-sdk/url-parser":"3.198.0","@aws-sdk/util-base64-browser":"3.188.0","@aws-sdk/util-base64-node":"3.188.0","@aws-sdk/util-body-length-browser":"3.188.0","@aws-sdk/util-body-length-node":"3.188.0","@aws-sdk/util-defaults-mode-browser":"3.198.0","@aws-sdk/util-defaults-mode-node":"3.198.0","@aws-sdk/util-endpoints":"3.198.0","@aws-sdk/util-user-agent-browser":"3.198.0","@aws-sdk/util-user-agent-node":"3.198.0","@aws-sdk/util-utf8-browser":"3.188.0","@aws-sdk/util-utf8-node":"3.188.0","fast-xml-parser":"4.0.11","tslib":"^2.3.1"},"devDependencies":{"@aws-sdk/service-client-documentation-generator":"3.188.0","@tsconfig/recommended":"1.0.1","@types/node":"^12.7.5","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typedoc":"0.19.2","typescript":"~4.6.2"},"overrides":{"typedoc":{"typescript":"~4.6.2"}},"engines":{"node":">=12.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sts"}}'); + +/***/ }), + +/***/ 5367: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"version":"1.1","partitions":[{"id":"aws","regionRegex":"^(us|eu|ap|sa|ca|me|af)-\\\\w+-\\\\d+$","regions":{"af-south-1":{},"af-east-1":{},"ap-northeast-1":{},"ap-northeast-2":{},"ap-northeast-3":{},"ap-south-1":{},"ap-southeast-1":{},"ap-southeast-2":{},"ap-southeast-3":{},"ca-central-1":{},"eu-central-1":{},"eu-north-1":{},"eu-south-1":{},"eu-west-1":{},"eu-west-2":{},"eu-west-3":{},"me-south-1":{},"sa-east-1":{},"us-east-1":{},"us-east-2":{},"us-west-1":{},"us-west-2":{},"aws-global":{}},"outputs":{"name":"aws","dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","supportsFIPS":true,"supportsDualStack":true}},{"id":"aws-us-gov","regionRegex":"^us\\\\-gov\\\\-\\\\w+\\\\-\\\\d+$","regions":{"us-gov-west-1":{},"us-gov-east-1":{},"aws-us-gov-global":{}},"outputs":{"name":"aws-us-gov","dnsSuffix":"amazonaws.com","dualStackDnsSuffix":"api.aws","supportsFIPS":true,"supportsDualStack":true}},{"id":"aws-cn","regionRegex":"^cn\\\\-\\\\w+\\\\-\\\\d+$","regions":{"cn-north-1":{},"cn-northwest-1":{},"aws-cn-global":{}},"outputs":{"name":"aws-cn","dnsSuffix":"amazonaws.com.cn","dualStackDnsSuffix":"api.amazonwebservices.com.cn","supportsFIPS":true,"supportsDualStack":true}},{"id":"aws-iso","regionRegex":"^us\\\\-iso\\\\-\\\\w+\\\\-\\\\d+$","outputs":{"name":"aws-iso","dnsSuffix":"c2s.ic.gov","supportsFIPS":true,"supportsDualStack":false,"dualStackDnsSuffix":"c2s.ic.gov"},"regions":{"aws-iso-global":{}}},{"id":"aws-iso-b","regionRegex":"^us\\\\-isob\\\\-\\\\w+\\\\-\\\\d+$","outputs":{"name":"aws-iso-b","dnsSuffix":"sc2s.sgov.gov","supportsFIPS":true,"supportsDualStack":false,"dualStackDnsSuffix":"sc2s.sgov.gov"},"regions":{"aws-iso-b-global":{}}}]}'); + +/***/ }) + +/******/ }); +/************************************************************************/ +/******/ // The module cache +/******/ var __webpack_module_cache__ = {}; +/******/ +/******/ // The require function +/******/ function __nccwpck_require__(moduleId) { +/******/ // Check if module is in cache +/******/ var cachedModule = __webpack_module_cache__[moduleId]; +/******/ if (cachedModule !== undefined) { +/******/ return cachedModule.exports; +/******/ } +/******/ // Create a new module (and put it into the cache) +/******/ var module = __webpack_module_cache__[moduleId] = { +/******/ // no module.id needed +/******/ // no module.loaded needed +/******/ exports: {} +/******/ }; +/******/ +/******/ // Execute the module function +/******/ var threw = true; +/******/ try { +/******/ __webpack_modules__[moduleId].call(module.exports, module, module.exports, __nccwpck_require__); +/******/ threw = false; +/******/ } finally { +/******/ if(threw) delete __webpack_module_cache__[moduleId]; +/******/ } +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/************************************************************************/ +/******/ /* webpack/runtime/compat */ +/******/ +/******/ if (typeof __nccwpck_require__ !== 'undefined') __nccwpck_require__.ab = __dirname + "/"; +/******/ +/************************************************************************/ +/******/ +/******/ // startup +/******/ // Load entry module and return exports +/******/ // This entry module is referenced by other modules so it can't be inlined +/******/ var __webpack_exports__ = __nccwpck_require__(7424); +/******/ module.exports = __webpack_exports__; +/******/ +/******/ })() +; \ No newline at end of file diff --git a/dist/cleanup/src/CredentialsClient.d.ts b/dist/cleanup/src/CredentialsClient.d.ts new file mode 100644 index 0000000..4fbcf1b --- /dev/null +++ b/dist/cleanup/src/CredentialsClient.d.ts @@ -0,0 +1,14 @@ +import { STSClient } from '@aws-sdk/client-sts'; +export interface CredentialsClientProps { + region?: string; + proxyServer?: string; +} +export declare class CredentialsClient { + region?: string; + private stsClient?; + private readonly requestHandler?; + constructor(props: CredentialsClientProps); + getStsClient(): STSClient; + validateCredentials(expectedAccessKeyId?: string): Promise; + private loadCredentials; +} diff --git a/dist/cleanup/src/assumeRole.d.ts b/dist/cleanup/src/assumeRole.d.ts new file mode 100644 index 0000000..4676ecd --- /dev/null +++ b/dist/cleanup/src/assumeRole.d.ts @@ -0,0 +1,13 @@ +import type { CredentialsClient } from './CredentialsClient'; +export interface assumeRoleParams { + credentialsClient: CredentialsClient; + roleToAssume: string; + roleDuration: number; + roleSessionName: string; + roleSkipSessionTagging?: boolean; + sourceAccountId?: string; + roleExternalId?: string; + webIdentityTokenFile?: string; + webIdentityToken?: string; +} +export declare function assumeRole(params: assumeRoleParams): Promise; diff --git a/dist/cleanup/src/cleanup/index.d.ts b/dist/cleanup/src/cleanup/index.d.ts new file mode 100644 index 0000000..e2bed30 --- /dev/null +++ b/dist/cleanup/src/cleanup/index.d.ts @@ -0,0 +1,11 @@ +/** + * When the GitHub Actions job is done, clean up any environment variables that + * may have been set by the configure-aws-credentials steps in the job. + * + * Environment variables are not intended to be shared across different jobs in + * the same GitHub Actions workflow: GitHub Actions documentation states that + * each job runs in a fresh instance. However, doing our own cleanup will + * give us additional assurance that these environment variables are not shared + * with any other jobs. + */ +export declare function cleanup(): void; diff --git a/dist/cleanup/src/helpers.d.ts b/dist/cleanup/src/helpers.d.ts new file mode 100644 index 0000000..9c81dc9 --- /dev/null +++ b/dist/cleanup/src/helpers.d.ts @@ -0,0 +1,14 @@ +import type { Credentials } from '@aws-sdk/client-sts'; +import type { CredentialsClient } from './CredentialsClient'; +export declare function exportCredentials(creds?: Partial): void; +export declare function exportRegion(region: string): void; +export declare function exportAccountId(credentialsClient: CredentialsClient, maskAccountId?: string): Promise; +export declare function sanitizeGitHubVariables(name: string): string; +export declare function defaultSleep(ms: number): Promise; +declare let sleep: typeof defaultSleep; +export declare function withsleep(s: typeof sleep): void; +export declare function reset(): void; +export declare function retryAndBackoff(fn: () => Promise, isRetryable: boolean, retries?: number, maxRetries?: number, base?: number): Promise; +export declare function errorMessage(error: unknown): string; +export declare function isDefined(i: T | undefined | null): i is T; +export {}; diff --git a/dist/cleanup/src/index.d.ts b/dist/cleanup/src/index.d.ts new file mode 100644 index 0000000..1aeec71 --- /dev/null +++ b/dist/cleanup/src/index.d.ts @@ -0,0 +1 @@ +export declare function run(): Promise; diff --git a/dist/cleanup/test/cleanup.test.d.ts b/dist/cleanup/test/cleanup.test.d.ts new file mode 100644 index 0000000..cb0ff5c --- /dev/null +++ b/dist/cleanup/test/cleanup.test.d.ts @@ -0,0 +1 @@ +export {}; diff --git a/dist/cleanup/test/helpers.test.d.ts b/dist/cleanup/test/helpers.test.d.ts new file mode 100644 index 0000000..cb0ff5c --- /dev/null +++ b/dist/cleanup/test/helpers.test.d.ts @@ -0,0 +1 @@ +export {}; diff --git a/dist/cleanup/test/index.test.d.ts b/dist/cleanup/test/index.test.d.ts new file mode 100644 index 0000000..cb0ff5c --- /dev/null +++ b/dist/cleanup/test/index.test.d.ts @@ -0,0 +1 @@ +export {}; diff --git a/package.json b/package.json index 5107cc4..49b843f 100644 --- a/package.json +++ b/package.json @@ -4,7 +4,7 @@ "scripts": { "build": "tsc --project tsconfig.build.json", "lint": "eslint .", - "package": "npm run build && ncc build --license THIRD-PARTY -o dist && tsc src/cleanup/index.ts --skipLibCheck --outdir dist/cleanup && copyup -E dist/THIRD-PARTY . && del-cli dist/THIRD-PARTY", + "package": "npm run build && ncc build --license THIRD-PARTY -o dist && ncc build src/cleanup/index.ts -o dist/cleanup && copyup -E dist/THIRD-PARTY . && del-cli dist/THIRD-PARTY", "test": "npm run lint && jest --verbose" }, "author": {